CA1207311A - Polymerization catalyst - Google Patents
Polymerization catalystInfo
- Publication number
- CA1207311A CA1207311A CA000441397A CA441397A CA1207311A CA 1207311 A CA1207311 A CA 1207311A CA 000441397 A CA000441397 A CA 000441397A CA 441397 A CA441397 A CA 441397A CA 1207311 A CA1207311 A CA 1207311A
- Authority
- CA
- Canada
- Prior art keywords
- composition
- inorganic oxide
- value
- compound
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002685 polymerization catalyst Substances 0.000 title description 2
- 239000000203 mixture Substances 0.000 claims abstract description 95
- 239000003054 catalyst Substances 0.000 claims abstract description 84
- 229910052809 inorganic oxide Inorganic materials 0.000 claims abstract description 41
- 150000002902 organometallic compounds Chemical class 0.000 claims abstract description 31
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims abstract description 30
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 27
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 20
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 claims abstract description 18
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 16
- 238000001035 drying Methods 0.000 claims abstract description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 15
- 239000000377 silicon dioxide Substances 0.000 claims abstract description 14
- 239000001257 hydrogen Substances 0.000 claims abstract description 12
- 238000002360 preparation method Methods 0.000 claims abstract description 11
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 claims abstract description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 9
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims abstract description 8
- 125000001183 hydrocarbyl group Chemical group 0.000 claims abstract description 5
- 239000000395 magnesium oxide Substances 0.000 claims abstract description 5
- 229910052751 metal Inorganic materials 0.000 claims abstract description 4
- 239000002184 metal Substances 0.000 claims abstract description 4
- 238000000034 method Methods 0.000 claims description 57
- 150000003682 vanadium compounds Chemical class 0.000 claims description 26
- 238000006116 polymerization reaction Methods 0.000 claims description 25
- 150000001875 compounds Chemical class 0.000 claims description 23
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 17
- 239000005977 Ethylene Substances 0.000 claims description 17
- 239000000178 monomer Substances 0.000 claims description 16
- 238000012685 gas phase polymerization Methods 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 9
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical group CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 claims description 9
- 239000007788 liquid Substances 0.000 claims description 8
- 239000004215 Carbon black (E152) Substances 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 229930195733 hydrocarbon Natural products 0.000 claims description 7
- 230000000379 polymerizing effect Effects 0.000 claims description 6
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 claims description 5
- 150000002430 hydrocarbons Chemical class 0.000 claims description 5
- 239000004711 α-olefin Substances 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 230000000737 periodic effect Effects 0.000 claims description 3
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 3
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 3
- ORYGRKHDLWYTKX-UHFFFAOYSA-N trihexylalumane Chemical group CCCCCC[Al](CCCCCC)CCCCCC ORYGRKHDLWYTKX-UHFFFAOYSA-N 0.000 claims description 3
- 230000000875 corresponding effect Effects 0.000 claims 7
- 235000012245 magnesium oxide Nutrition 0.000 claims 2
- 239000011541 reaction mixture Substances 0.000 claims 2
- 125000001424 substituent group Chemical group 0.000 claims 2
- 239000007858 starting material Substances 0.000 claims 1
- 238000009826 distribution Methods 0.000 abstract description 24
- 229910052720 vanadium Inorganic materials 0.000 abstract description 13
- -1 vanadium halide Chemical class 0.000 abstract description 8
- 229920000573 polyethylene Polymers 0.000 abstract description 6
- 229910021552 Vanadium(IV) chloride Inorganic materials 0.000 abstract description 4
- JTJFQBNJBPPZRI-UHFFFAOYSA-J vanadium tetrachloride Chemical compound Cl[V](Cl)(Cl)Cl JTJFQBNJBPPZRI-UHFFFAOYSA-J 0.000 abstract description 4
- 239000007795 chemical reaction product Substances 0.000 abstract description 3
- 229920000642 polymer Polymers 0.000 description 42
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- 239000000306 component Substances 0.000 description 15
- 239000002245 particle Substances 0.000 description 13
- 239000002002 slurry Substances 0.000 description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 229910052681 coesite Inorganic materials 0.000 description 7
- 229910052906 cristobalite Inorganic materials 0.000 description 7
- 235000012239 silicon dioxide Nutrition 0.000 description 7
- 229910052682 stishovite Inorganic materials 0.000 description 7
- 229910052905 tridymite Inorganic materials 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 229920005989 resin Polymers 0.000 description 6
- 239000011347 resin Substances 0.000 description 6
- 150000001336 alkenes Chemical class 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 229920001577 copolymer Polymers 0.000 description 5
- 230000000704 physical effect Effects 0.000 description 5
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- 229960001701 chloroform Drugs 0.000 description 4
- 238000001746 injection moulding Methods 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 239000011148 porous material Substances 0.000 description 4
- 238000011160 research Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 3
- 239000002671 adjuvant Substances 0.000 description 3
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 238000000071 blow moulding Methods 0.000 description 3
- 238000006555 catalytic reaction Methods 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 2
- 125000005234 alkyl aluminium group Chemical group 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- NNPPMTNAJDCUHE-UHFFFAOYSA-N isobutane Chemical compound CC(C)C NNPPMTNAJDCUHE-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000010926 purge Methods 0.000 description 2
- 239000002516 radical scavenger Substances 0.000 description 2
- 230000036647 reaction Effects 0.000 description 2
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000000153 supplemental effect Effects 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 241000193803 Therea Species 0.000 description 1
- CYJVMBNEKOYAAI-UHFFFAOYSA-N [AlH2]C(C)=C Chemical compound [AlH2]C(C)=C CYJVMBNEKOYAAI-UHFFFAOYSA-N 0.000 description 1
- SZNWCVFYBNVQOI-UHFFFAOYSA-N [O-]CC.C(C)[Al+2].[O-]CC.[O-]CC.C(C)[Al+2] Chemical compound [O-]CC.C(C)[Al+2].[O-]CC.[O-]CC.C(C)[Al+2] SZNWCVFYBNVQOI-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- HQMRIBYCTLBDAK-UHFFFAOYSA-M bis(2-methylpropyl)alumanylium;chloride Chemical compound CC(C)C[Al](Cl)CC(C)C HQMRIBYCTLBDAK-UHFFFAOYSA-M 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- DLRHRQTUCJTIIV-UHFFFAOYSA-N diethoxy(ethyl)alumane Chemical compound CC[O-].CC[O-].CC[Al+2] DLRHRQTUCJTIIV-UHFFFAOYSA-N 0.000 description 1
- YNLAOSYQHBDIKW-UHFFFAOYSA-M diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 description 1
- AFABGHUZZDYHJO-UHFFFAOYSA-N dimethyl butane Natural products CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 1
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 1
- JGHYBJVUQGTEEB-UHFFFAOYSA-M dimethylalumanylium;chloride Chemical compound C[Al](C)Cl JGHYBJVUQGTEEB-UHFFFAOYSA-M 0.000 description 1
- XOCWTYIVWYOSGQ-UHFFFAOYSA-N dipropylalumane Chemical compound C(CC)[AlH]CCC XOCWTYIVWYOSGQ-UHFFFAOYSA-N 0.000 description 1
- ZMXPNWBFRPIZFV-UHFFFAOYSA-M dipropylalumanylium;chloride Chemical compound [Cl-].CCC[Al+]CCC ZMXPNWBFRPIZFV-UHFFFAOYSA-M 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- GCPCLEKQVMKXJM-UHFFFAOYSA-N ethoxy(diethyl)alumane Chemical compound CCO[Al](CC)CC GCPCLEKQVMKXJM-UHFFFAOYSA-N 0.000 description 1
- XPURMEXEEOGCNE-UHFFFAOYSA-N ethyl-di(propan-2-yloxy)alumane Chemical compound CC[Al+2].CC(C)[O-].CC(C)[O-] XPURMEXEEOGCNE-UHFFFAOYSA-N 0.000 description 1
- 229920001038 ethylene copolymer Polymers 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000001145 hydrido group Chemical group *[H] 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000001282 iso-butane Substances 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 238000010606 normalization Methods 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000006069 physical mixture Substances 0.000 description 1
- 231100000572 poisoning Toxicity 0.000 description 1
- 230000000607 poisoning effect Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- SQBBHCOIQXKPHL-UHFFFAOYSA-N tributylalumane Chemical compound CCCC[Al](CCCC)CCCC SQBBHCOIQXKPHL-UHFFFAOYSA-N 0.000 description 1
- YGRHYJIWZFEDBT-UHFFFAOYSA-N tridecylaluminum Chemical compound CCCCCCCCCCCCC[Al] YGRHYJIWZFEDBT-UHFFFAOYSA-N 0.000 description 1
- XBEXIHMRFRFRAM-UHFFFAOYSA-N tridodecylalumane Chemical compound CCCCCCCCCCCC[Al](CCCCCCCCCCCC)CCCCCCCCCCCC XBEXIHMRFRFRAM-UHFFFAOYSA-N 0.000 description 1
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical compound CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 1
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 1
- LFXVBWRMVZPLFK-UHFFFAOYSA-N trioctylalumane Chemical compound CCCCCCCC[Al](CCCCCCCC)CCCCCCCC LFXVBWRMVZPLFK-UHFFFAOYSA-N 0.000 description 1
- PHYFQTYBJUILEZ-IUPFWZBJSA-N triolein Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC(OC(=O)CCCCCCC\C=C/CCCCCCCC)COC(=O)CCCCCCC\C=C/CCCCCCCC PHYFQTYBJUILEZ-IUPFWZBJSA-N 0.000 description 1
- 238000013022 venting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Catalysts (AREA)
- Polyethers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/444,288 US4434242A (en) | 1982-11-24 | 1982-11-24 | Polymerization catalyst |
| US444,288 | 1989-12-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1207311A true CA1207311A (en) | 1986-07-08 |
Family
ID=23764281
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000441397A Expired CA1207311A (en) | 1982-11-24 | 1983-11-17 | Polymerization catalyst |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4434242A (enrdf_load_stackoverflow) |
| EP (1) | EP0112042B1 (enrdf_load_stackoverflow) |
| JP (1) | JPS59100112A (enrdf_load_stackoverflow) |
| AT (1) | ATE21400T1 (enrdf_load_stackoverflow) |
| AU (1) | AU564911B2 (enrdf_load_stackoverflow) |
| CA (1) | CA1207311A (enrdf_load_stackoverflow) |
| DE (1) | DE3365341D1 (enrdf_load_stackoverflow) |
| MX (1) | MX165915B (enrdf_load_stackoverflow) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4665138A (en) * | 1982-11-24 | 1987-05-12 | Cities Service Oil & Gas Corp | Process for polymerizing a monomer charge |
| US4579835A (en) * | 1984-12-12 | 1986-04-01 | Exxon Research & Engineering Co. | Polymerization catalyst, production and use |
| US4634751A (en) * | 1984-12-12 | 1987-01-06 | Exxon Research & Engineering Co. | Polymerization catalyst, production and use |
| US4579834A (en) * | 1984-12-12 | 1986-04-01 | Exxon Research & Engineering Co. | Polymerization catalyst, production and use |
| US4634750A (en) * | 1984-12-12 | 1987-01-06 | Exxon Research & Engineering Co. | Polymerization catalyst, production and use |
| US4657997A (en) * | 1984-12-12 | 1987-04-14 | Exxon Research & Engineering Co. | Polymerization catalyst, production and use |
| US4578374A (en) * | 1984-12-12 | 1986-03-25 | Exxon Research & Engineering Co. | Polymerization catalyst, production and use |
| FR2597486B1 (fr) * | 1986-04-18 | 1992-09-11 | Chemopetrol Koncernova Ucelova | Catalyseur et procede pour la production de polymeres et de copolymeres de 1-alcenes. |
| US5006618A (en) * | 1988-01-15 | 1991-04-09 | Mobil Oil Corporation | Process for preparing high density or medium density polymers |
| US4912074A (en) * | 1988-01-15 | 1990-03-27 | Mobil Oil Corporation | Catalyst composition for preparing high density or medium density olefin polymers |
| US4972033A (en) * | 1988-01-15 | 1990-11-20 | Mobil Oil Corporation | Olefin polymerization process for preparing high density or linear low density polymers of controlled molecular weight distribution |
| US5075271A (en) * | 1988-01-15 | 1991-12-24 | Mobil Oil Corporation | Olefin polymerization process for preparing high density or linear low density polymers of controlled molecular weight distribution |
| US4923938A (en) * | 1988-07-01 | 1990-05-08 | Union Carbide Chemicals And Plastics Company Inc. | Catalyst for regulating the molecular weight distribution of ethylene polymers |
| US4845067A (en) * | 1988-07-01 | 1989-07-04 | Union Carbide Corporation | Catalyst for regulating the molecular weight distribution of ethylene polymers |
| US5187246A (en) * | 1990-06-26 | 1993-02-16 | Union Carbide Chemicals & Plastics Technology Corporation | Process for making epr resins |
| US5204304A (en) * | 1991-06-04 | 1993-04-20 | Quantum Chemical Corporation | Vanadium-containing polymerization catalyst |
| US5399540A (en) * | 1993-02-12 | 1995-03-21 | Quantum Chemical Corporation | ZR/V multi-site olefin polymerization catalyst |
| US5405817A (en) * | 1993-02-12 | 1995-04-11 | Quantum Chemical Corporation | V/TI multi-site olefin polymerization catalyst |
| US5374597A (en) * | 1993-02-12 | 1994-12-20 | Quantum Chemical Corporation | Vanadium based olefin polymerization catalyst |
| US5534472A (en) * | 1995-03-29 | 1996-07-09 | Quantum Chemical Corporation | Vanadium-containing catalyst system |
| US5670439A (en) * | 1995-03-29 | 1997-09-23 | Quantum Chemical Corporation | Vanadium-containing catalyst system |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3457244A (en) | 1964-04-28 | 1969-07-22 | Mitsubishi Petrochemical Co | Process for preparing a polymer |
| NL6601610A (enrdf_load_stackoverflow) | 1966-02-09 | 1967-08-10 | ||
| US3535269A (en) | 1966-04-09 | 1970-10-20 | Mitsubishi Petrochemical Co | Catalyst compositions for polymerizing ethylene |
| US3591656A (en) | 1969-01-24 | 1971-07-06 | Exxon Research Engineering Co | Heterogeneous catalyst process |
| FR2082153A5 (fr) * | 1970-03-05 | 1971-12-10 | Solvay | Catalyseurs et procede perfectionnes pour la polymerisation et la copolymerisation des olefines |
| BE786203A (fr) * | 1971-07-12 | 1973-01-12 | Ici Ltd | Catalyseur de polymerisation des olefines comprenant un metal de transition |
| JPS5810403B2 (ja) | 1974-01-02 | 1983-02-25 | シティ−ズ・サ−ヴイス・カンパニ− | シヨクバイソセイブツ |
| GB1553673A (en) * | 1975-07-30 | 1979-09-26 | Bp Chem Int Ltd | Polymerisation catalyst |
| DE2553179A1 (de) | 1975-11-27 | 1977-06-08 | Hoechst Ag | Verfahren zur herstellung eines katalysators |
| DE2603919C2 (de) | 1976-02-03 | 1984-08-09 | Basf Ag, 6700 Ludwigshafen | Verfahren zum Herstellen von Homo- und Copolymerisaten von C↓2↓-bisC↓6↓-α-Monoolefinen |
| US4330648A (en) | 1977-12-13 | 1982-05-18 | Phillips Petroleum Company | Catalyst and process of polymerization of alpha-monoolefins |
| CA1145318A (en) | 1979-07-17 | 1983-04-26 | John G. Speakman | Olefin polymerisation catalyst, process and polyolefin product |
| GB2053939A (en) * | 1979-07-17 | 1981-02-11 | British Petroleum Co | Oxide supported vanadium halide catalyst components |
| US4263171A (en) | 1979-08-01 | 1981-04-21 | Chemplex Company | Polymerization catalyst |
-
1982
- 1982-11-24 US US06/444,288 patent/US4434242A/en not_active Expired - Fee Related
-
1983
- 1983-10-12 AU AU20098/83A patent/AU564911B2/en not_active Ceased
- 1983-11-10 JP JP58210046A patent/JPS59100112A/ja active Granted
- 1983-11-11 EP EP83306901A patent/EP0112042B1/en not_active Expired
- 1983-11-11 AT AT83306901T patent/ATE21400T1/de not_active IP Right Cessation
- 1983-11-11 DE DE8383306901T patent/DE3365341D1/de not_active Expired
- 1983-11-17 CA CA000441397A patent/CA1207311A/en not_active Expired
- 1983-11-21 MX MX199486A patent/MX165915B/es unknown
Also Published As
| Publication number | Publication date |
|---|---|
| EP0112042B1 (en) | 1986-08-13 |
| MX165915B (es) | 1992-12-09 |
| US4434242A (en) | 1984-02-28 |
| AU564911B2 (en) | 1987-09-03 |
| JPS59100112A (ja) | 1984-06-09 |
| AU2009883A (en) | 1984-05-31 |
| DE3365341D1 (en) | 1986-09-18 |
| JPH0516444B2 (enrdf_load_stackoverflow) | 1993-03-04 |
| ATE21400T1 (de) | 1986-08-15 |
| EP0112042A1 (en) | 1984-06-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1207311A (en) | Polymerization catalyst | |
| US4435518A (en) | Polymerization catalyst | |
| CA1263368A (en) | Polymerization catalyst, production and use | |
| CA1207741A (en) | Catalyst composition | |
| US4435520A (en) | Catalyst composition | |
| US4426317A (en) | Process for making olefin polymerization catalyst | |
| FR2503715A1 (fr) | Catalyseur de polymerisation d'olefines, son procede de production et son utilisation | |
| US4544646A (en) | Olefin polymerization catalyst and method | |
| US4276191A (en) | Catalyst and process for polymerization of alpha-olefins | |
| EP0173489A1 (en) | Polymerization catalyst, production and use | |
| US4665138A (en) | Process for polymerizing a monomer charge | |
| AU610052B2 (en) | Polymerization catalyst, production and use | |
| CA1264400A (en) | Process for polymerizing a monomer charge | |
| US4665139A (en) | Process for polymerizing a monomer charge | |
| US4618596A (en) | Polymerization catalyst, production and use | |
| CA1263996A (en) | Process for polymerizing a monomer charge | |
| EP0197689A1 (en) | A process for polymerizing a monomer charge | |
| EP0498230A2 (en) | Polymers of 3-ethyl-1-hexene |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |