CA1163268A - Dihydropyridazinones, their preparation and therapeutic agents containing these compounds - Google Patents
Dihydropyridazinones, their preparation and therapeutic agents containing these compoundsInfo
- Publication number
- CA1163268A CA1163268A CA000379001A CA379001A CA1163268A CA 1163268 A CA1163268 A CA 1163268A CA 000379001 A CA000379001 A CA 000379001A CA 379001 A CA379001 A CA 379001A CA 1163268 A CA1163268 A CA 1163268A
- Authority
- CA
- Canada
- Prior art keywords
- carbon atoms
- methyl
- dihydro
- pyridazinone
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 72
- 238000002360 preparation method Methods 0.000 title claims abstract description 22
- 239000003814 drug Substances 0.000 title abstract description 8
- 229940124597 therapeutic agent Drugs 0.000 title description 4
- 238000000034 method Methods 0.000 claims abstract description 46
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 29
- 125000004432 carbon atom Chemical group C* 0.000 claims description 157
- -1 4,5-dihydro-5-methyl-6-(p-propoxycarbonyl-aminophenyl)-3(2H)-pyridazinone Chemical compound 0.000 claims description 115
- 125000000217 alkyl group Chemical group 0.000 claims description 66
- 125000003545 alkoxy group Chemical group 0.000 claims description 24
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 23
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 claims description 22
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 20
- 239000000460 chlorine Substances 0.000 claims description 20
- GDMRFHZLKNYRRO-UHFFFAOYSA-N 3-(4-aminophenyl)-4-methyl-4,5-dihydro-1h-pyridazin-6-one Chemical compound CC1CC(=O)NN=C1C1=CC=C(N)C=C1 GDMRFHZLKNYRRO-UHFFFAOYSA-N 0.000 claims description 19
- 239000001257 hydrogen Substances 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 17
- 239000000126 substance Substances 0.000 claims description 17
- 125000001424 substituent group Chemical group 0.000 claims description 16
- 229910052736 halogen Inorganic materials 0.000 claims description 15
- 150000002367 halogens Chemical class 0.000 claims description 15
- 125000000304 alkynyl group Chemical group 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 13
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 13
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 12
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 12
- 229910052794 bromium Inorganic materials 0.000 claims description 12
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 11
- 229910052801 chlorine Inorganic materials 0.000 claims description 11
- 125000003342 alkenyl group Chemical group 0.000 claims description 9
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 239000012948 isocyanate Substances 0.000 claims description 7
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 6
- 239000011737 fluorine Substances 0.000 claims description 6
- 150000002513 isocyanates Chemical class 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052717 sulfur Chemical group 0.000 claims description 5
- 239000011593 sulfur Chemical group 0.000 claims description 5
- PYBZUWHTGDCWSL-UHFFFAOYSA-N 2-amino-1-phenyl-4h-pyridazin-3-one Chemical compound C1=CCC(=O)N(N)N1C1=CC=CC=C1 PYBZUWHTGDCWSL-UHFFFAOYSA-N 0.000 claims description 4
- DCFPQKOQJMEVQR-UHFFFAOYSA-N 2-methoxypropyl carbonochloridate Chemical compound COC(C)COC(Cl)=O DCFPQKOQJMEVQR-UHFFFAOYSA-N 0.000 claims description 4
- 235000001014 amino acid Nutrition 0.000 claims description 4
- 150000001413 amino acids Chemical class 0.000 claims description 4
- LLOHDKPSKQNASI-UHFFFAOYSA-N ethyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OCC)=CC=C1C1=NNC(=O)CC1C LLOHDKPSKQNASI-UHFFFAOYSA-N 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- KECIMMXQVHNUSK-UHFFFAOYSA-N methyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OC)=CC=C1C1=NNC(=O)CC1C KECIMMXQVHNUSK-UHFFFAOYSA-N 0.000 claims description 4
- SVDDJQGVOFZBNX-UHFFFAOYSA-N 2-chloroethyl carbonochloridate Chemical compound ClCCOC(Cl)=O SVDDJQGVOFZBNX-UHFFFAOYSA-N 0.000 claims description 3
- KIUCRCQHKXWVOW-UHFFFAOYSA-N 2-chloroethyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C1=CC=C(NC(=O)OCCCl)C=C1 KIUCRCQHKXWVOW-UHFFFAOYSA-N 0.000 claims description 3
- UEQZSMIPKHKBIN-UHFFFAOYSA-N 2-methoxypropyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OCC(C)OC)=CC=C1C1=NNC(=O)CC1C UEQZSMIPKHKBIN-UHFFFAOYSA-N 0.000 claims description 3
- GCPPRMVTVCVAHY-UHFFFAOYSA-N 3-ethoxypropyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OCCCOCC)=CC=C1C1=NNC(=O)CC1C GCPPRMVTVCVAHY-UHFFFAOYSA-N 0.000 claims description 3
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 claims description 2
- QQKDTTWZXHEGAQ-UHFFFAOYSA-N propyl carbonochloridate Chemical compound CCCOC(Cl)=O QQKDTTWZXHEGAQ-UHFFFAOYSA-N 0.000 claims description 2
- LEEQDBNTHRUXCJ-UHFFFAOYSA-N propyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OCCC)=CC=C1C1=NNC(=O)CC1C LEEQDBNTHRUXCJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims 4
- OYFKPUPGRGTQPT-UHFFFAOYSA-N benzyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)OCC1=CC=CC=C1 OYFKPUPGRGTQPT-UHFFFAOYSA-N 0.000 claims 3
- YWOHFNQZUJEMGK-UHFFFAOYSA-N prop-2-ynyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C1=CC=C(NC(=O)OCC#C)C=C1 YWOHFNQZUJEMGK-UHFFFAOYSA-N 0.000 claims 2
- URZYMTPCCZLJRG-UHFFFAOYSA-N 3-ethoxypropyl carbonochloridate Chemical compound CCOCCCOC(Cl)=O URZYMTPCCZLJRG-UHFFFAOYSA-N 0.000 claims 1
- RAMTXCRMKBFPRG-UHFFFAOYSA-N prop-2-ynyl carbonochloridate Chemical compound ClC(=O)OCC#C RAMTXCRMKBFPRG-UHFFFAOYSA-N 0.000 claims 1
- 230000003276 anti-hypertensive effect Effects 0.000 abstract description 4
- KSGYMLDMYPAMFV-UHFFFAOYSA-N 3-phenyl-4,5-dihydro-1h-pyridazin-6-one Chemical class N1C(=O)CCC(C=2C=CC=CC=2)=N1 KSGYMLDMYPAMFV-UHFFFAOYSA-N 0.000 abstract description 3
- 239000002220 antihypertensive agent Substances 0.000 abstract description 3
- 229940030600 antihypertensive agent Drugs 0.000 abstract description 3
- 229940079593 drug Drugs 0.000 abstract description 3
- 230000009424 thromboembolic effect Effects 0.000 abstract description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 abstract description 2
- 239000008194 pharmaceutical composition Substances 0.000 abstract description 2
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical group NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 abstract 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 66
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 56
- 235000013350 formula milk Nutrition 0.000 description 50
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 46
- 239000013078 crystal Substances 0.000 description 43
- 239000000047 product Substances 0.000 description 42
- 238000002844 melting Methods 0.000 description 39
- 230000008018 melting Effects 0.000 description 39
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 36
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 31
- 239000000243 solution Substances 0.000 description 27
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 21
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical compound OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 description 20
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 18
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 16
- 229960004756 ethanol Drugs 0.000 description 16
- 235000019441 ethanol Nutrition 0.000 description 16
- 239000000203 mixture Substances 0.000 description 13
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 11
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 230000002776 aggregation Effects 0.000 description 8
- 238000004220 aggregation Methods 0.000 description 8
- 210000001772 blood platelet Anatomy 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 7
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 125000002947 alkylene group Chemical group 0.000 description 6
- 210000004369 blood Anatomy 0.000 description 6
- 239000008280 blood Substances 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- 241000700159 Rattus Species 0.000 description 5
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 5
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 5
- 239000000454 talc Substances 0.000 description 5
- 229910052623 talc Inorganic materials 0.000 description 5
- 235000012222 talc Nutrition 0.000 description 5
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 239000008298 dragée Substances 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 102000008186 Collagen Human genes 0.000 description 3
- 108010035532 Collagen Proteins 0.000 description 3
- 229920002261 Corn starch Polymers 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 230000003110 anti-inflammatory effect Effects 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 229920001436 collagen Polymers 0.000 description 3
- 239000008120 corn starch Substances 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 208000035475 disorder Diseases 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- 235000000346 sugar Nutrition 0.000 description 3
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- NDYYWMXJZWHRLZ-UHFFFAOYSA-N 2-methoxyethyl carbonochloridate Chemical compound COCCOC(Cl)=O NDYYWMXJZWHRLZ-UHFFFAOYSA-N 0.000 description 2
- WRMNZCZEMHIOCP-UHFFFAOYSA-N 2-phenylethanol Chemical compound OCCC1=CC=CC=C1 WRMNZCZEMHIOCP-UHFFFAOYSA-N 0.000 description 2
- ORSUMIZRRGPJBR-UHFFFAOYSA-N 4,5-dihydro-1h-pyridazin-6-one Chemical class O=C1CCC=NN1 ORSUMIZRRGPJBR-UHFFFAOYSA-N 0.000 description 2
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 208000010513 Stupor Diseases 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000000370 acceptor Substances 0.000 description 2
- 229960001138 acetylsalicylic acid Drugs 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 229940125773 compound 10 Drugs 0.000 description 2
- GXBSYUMCIFBIPI-UHFFFAOYSA-N cyclobutyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)OC1CCC1 GXBSYUMCIFBIPI-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000002526 effect on cardiovascular system Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- OKJFKCCCFFXCIN-UHFFFAOYSA-N ethyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OCC)=CC=C1C1=NNC(=O)CC1 OKJFKCCCFFXCIN-UHFFFAOYSA-N 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- VIKNJXKGJWUCNN-XGXHKTLJSA-N norethisterone Chemical compound O=C1CC[C@@H]2[C@H]3CC[C@](C)([C@](CC4)(O)C#C)[C@@H]4[C@@H]3CCC2=C1 VIKNJXKGJWUCNN-XGXHKTLJSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 2
- UKTLHCCSVQRQHK-UHFFFAOYSA-N phenyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C=1C=CC=CC=1OC(=O)NC(C=C1)=CC=C1C1=NNC(=O)CC1 UKTLHCCSVQRQHK-UHFFFAOYSA-N 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 239000011736 potassium bicarbonate Substances 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 description 2
- 229940094025 potassium bicarbonate Drugs 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 230000036647 reaction Effects 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- LLMGBBSLOCLKJZ-UHFFFAOYSA-N s-propyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamothioate Chemical compound C1=CC(NC(=O)SCCC)=CC=C1C1=NNC(=O)CC1C LLMGBBSLOCLKJZ-UHFFFAOYSA-N 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000017550 sodium carbonate Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 230000035488 systolic blood pressure Effects 0.000 description 2
- SYRHIZPPCHMRIT-UHFFFAOYSA-N tin(4+) Chemical compound [Sn+4] SYRHIZPPCHMRIT-UHFFFAOYSA-N 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- NOVIFGSGDWYJEL-UHFFFAOYSA-N (2,2-dimethylcyclobutyl) n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)OC1C(C)(C)CC1 NOVIFGSGDWYJEL-UHFFFAOYSA-N 0.000 description 1
- OLWUXFRASLBAMH-UHFFFAOYSA-N (2-chloro-2-methylpropyl) n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C1=CC=C(NC(=O)OCC(C)(C)Cl)C=C1 OLWUXFRASLBAMH-UHFFFAOYSA-N 0.000 description 1
- VDLQSPNQAVRJND-UHFFFAOYSA-N (2-methoxyphenyl) carbonochloridate Chemical compound COC1=CC=CC=C1OC(Cl)=O VDLQSPNQAVRJND-UHFFFAOYSA-N 0.000 description 1
- VODNTMFUEONMHI-UHFFFAOYSA-N (2-methoxyphenyl) n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound COC1=CC=CC=C1OC(=O)NC1=CC=C(C=2C(CC(=O)NN=2)C)C=C1 VODNTMFUEONMHI-UHFFFAOYSA-N 0.000 description 1
- HXUKLMHFUJJFDX-UHFFFAOYSA-N (2-methylcyclopropyl) n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC1OC(=O)NC1=CC=C(C=2C(CC(=O)NN=2)C)C=C1 HXUKLMHFUJJFDX-UHFFFAOYSA-N 0.000 description 1
- WSZYFYCNIUVTLZ-UHFFFAOYSA-N (2-methylcyclopropyl)methyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC1COC(=O)NC1=CC=C(C=2C(CC(=O)NN=2)C)C=C1 WSZYFYCNIUVTLZ-UHFFFAOYSA-N 0.000 description 1
- RJSSIOLKUDFMBI-UHFFFAOYSA-N (2-nitrophenyl) n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)OC1=CC=CC=C1[N+]([O-])=O RJSSIOLKUDFMBI-UHFFFAOYSA-N 0.000 description 1
- ZSRDNPVYGSFUMD-UHFFFAOYSA-N (3-chlorophenyl)methanol Chemical compound OCC1=CC=CC(Cl)=C1 ZSRDNPVYGSFUMD-UHFFFAOYSA-N 0.000 description 1
- FIZOWHDKVMLCLK-UHFFFAOYSA-N (3-methoxyphenyl) n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound COC1=CC=CC(OC(=O)NC=2C=CC(=CC=2)C=2C(CC(=O)NN=2)C)=C1 FIZOWHDKVMLCLK-UHFFFAOYSA-N 0.000 description 1
- SFVXVBHFNYYDDZ-UHFFFAOYSA-N (3-methoxyphenyl)methyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound COC1=CC=CC(COC(=O)NC=2C=CC(=CC=2)C=2C(CC(=O)NN=2)C)=C1 SFVXVBHFNYYDDZ-UHFFFAOYSA-N 0.000 description 1
- JXYLZACPFSDBPR-UHFFFAOYSA-N (3-methylphenyl) carbonochloridate Chemical compound CC1=CC=CC(OC(Cl)=O)=C1 JXYLZACPFSDBPR-UHFFFAOYSA-N 0.000 description 1
- SVBSLUHZCAFTPZ-UHFFFAOYSA-N (4-cyanophenyl) n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)OC1=CC=C(C#N)C=C1 SVBSLUHZCAFTPZ-UHFFFAOYSA-N 0.000 description 1
- HLTLEVCSMVMUJK-UHFFFAOYSA-N (4-fluorophenyl)methyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)OCC1=CC=C(F)C=C1 HLTLEVCSMVMUJK-UHFFFAOYSA-N 0.000 description 1
- XOFZPIYYMJUNRG-UHFFFAOYSA-N (4-methylphenyl) carbonochloridate Chemical compound CC1=CC=C(OC(Cl)=O)C=C1 XOFZPIYYMJUNRG-UHFFFAOYSA-N 0.000 description 1
- NXLNNXIXOYSCMB-UHFFFAOYSA-N (4-nitrophenyl) carbonochloridate Chemical compound [O-][N+](=O)C1=CC=C(OC(Cl)=O)C=C1 NXLNNXIXOYSCMB-UHFFFAOYSA-N 0.000 description 1
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 1
- AZIPXGPZXZUMIE-UHFFFAOYSA-N 1-chlorobutan-2-yl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OC(CCl)CC)=CC=C1C1=NNC(=O)CC1C AZIPXGPZXZUMIE-UHFFFAOYSA-N 0.000 description 1
- GQTXRJSALOLLLC-UHFFFAOYSA-N 1-chloroethyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OC(Cl)C)=CC=C1C1=NNC(=O)CC1C GQTXRJSALOLLLC-UHFFFAOYSA-N 0.000 description 1
- ORHFZFAIULPFEA-UHFFFAOYSA-N 1-chloroethyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OC(Cl)C)=CC=C1C1=NNC(=O)CC1 ORHFZFAIULPFEA-UHFFFAOYSA-N 0.000 description 1
- MOMPCGIMVKVCOJ-UHFFFAOYSA-N 1-cyclopropylethyl carbonochloridate Chemical compound ClC(=O)OC(C)C1CC1 MOMPCGIMVKVCOJ-UHFFFAOYSA-N 0.000 description 1
- VYBJDIRPPRBYDF-UHFFFAOYSA-N 1-phenylethyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C=1C=CC=CC=1C(C)OC(=O)NC(C=C1)=CC=C1C1=NNC(=O)CC1 VYBJDIRPPRBYDF-UHFFFAOYSA-N 0.000 description 1
- LJCZNYWLQZZIOS-UHFFFAOYSA-N 2,2,2-trichlorethoxycarbonyl chloride Chemical compound ClC(=O)OCC(Cl)(Cl)Cl LJCZNYWLQZZIOS-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- OGYSNZBRBGCETM-UHFFFAOYSA-N 2,2,2-trichloroethyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C1=CC=C(NC(=O)OCC(Cl)(Cl)Cl)C=C1 OGYSNZBRBGCETM-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- GTJRHBUODOYPHR-UHFFFAOYSA-N 2,3-dichloropropyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C1=CC=C(NC(=O)OCC(Cl)CCl)C=C1 GTJRHBUODOYPHR-UHFFFAOYSA-N 0.000 description 1
- KMGUEILFFWDGFV-UHFFFAOYSA-N 2-benzoyl-2-benzoyloxy-3-hydroxybutanedioic acid Chemical compound C=1C=CC=CC=1C(=O)C(C(C(O)=O)O)(C(O)=O)OC(=O)C1=CC=CC=C1 KMGUEILFFWDGFV-UHFFFAOYSA-N 0.000 description 1
- ZLCKDYMZBZNBMJ-UHFFFAOYSA-N 2-bromoethyl carbonochloridate Chemical compound ClC(=O)OCCBr ZLCKDYMZBZNBMJ-UHFFFAOYSA-N 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- VQNSOGXIVGBAAL-UHFFFAOYSA-N 2-bromoethyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OCCBr)=CC=C1C1=NNC(=O)CC1 VQNSOGXIVGBAAL-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- RRFJOCZJMNCVBW-UHFFFAOYSA-N 2-chloroethyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OCCCl)=CC=C1C1=NNC(=O)CC1 RRFJOCZJMNCVBW-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- NHXIIFNGTPVIML-UHFFFAOYSA-N 2-cyclopropylethyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1CC1CCOC(=O)NC(C=C1)=CC=C1C1=NNC(=O)CC1 NHXIIFNGTPVIML-UHFFFAOYSA-N 0.000 description 1
- YGODGSOIDVDNEO-UHFFFAOYSA-N 2-ethoxyethyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OCCOCC)=CC=C1C1=NNC(=O)CC1C YGODGSOIDVDNEO-UHFFFAOYSA-N 0.000 description 1
- 125000004847 2-fluorobenzyl group Chemical group [H]C1=C([H])C(F)=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- RISGZMKJLKIZRE-UHFFFAOYSA-N 2-fluoroethyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C1=CC=C(NC(=O)OCCF)C=C1 RISGZMKJLKIZRE-UHFFFAOYSA-N 0.000 description 1
- QBRWXHIJGLEFOY-UHFFFAOYSA-N 2-fluoroethyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OCCF)=CC=C1C1=NNC(=O)CC1 QBRWXHIJGLEFOY-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- NGBKMIYVLRKUKB-UHFFFAOYSA-N 2-methoxyethyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OCCOC)=CC=C1C1=NNC(=O)CC1 NGBKMIYVLRKUKB-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- PZXANLQSQMFUAD-UHFFFAOYSA-N 2-methylpropyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OCC(C)C)=CC=C1C1=NNC(=O)CC1C PZXANLQSQMFUAD-UHFFFAOYSA-N 0.000 description 1
- UXNQKCOMUCSBSS-UHFFFAOYSA-N 2-phenyl-1,5-dihydropyridazin-6-one Chemical compound N1C(=O)CC=CN1C1=CC=CC=C1 UXNQKCOMUCSBSS-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- XMTUHSIIBGFSTQ-UHFFFAOYSA-N 3-(4-aminophenyl)-4,5-dihydro-1h-pyridazin-6-one Chemical compound C1=CC(N)=CC=C1C1=NNC(=O)CC1 XMTUHSIIBGFSTQ-UHFFFAOYSA-N 0.000 description 1
- IIGNZLVHOZEOPV-UHFFFAOYSA-N 3-Methoxybenzyl alcohol Chemical compound COC1=CC=CC(CO)=C1 IIGNZLVHOZEOPV-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000006284 3-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(F)=C1[H])C([H])([H])* 0.000 description 1
- WRBOAZUDXNNWNI-UHFFFAOYSA-N 4-(4-aminophenyl)-4-oxobutanoic acid Chemical compound NC1=CC=C(C(=O)CCC(O)=O)C=C1 WRBOAZUDXNNWNI-UHFFFAOYSA-N 0.000 description 1
- OGOAZOPKAUTBGH-UHFFFAOYSA-N 4-[4-(ethoxycarbonylamino)phenyl]-4-oxobutanoic acid Chemical compound CCOC(=O)NC1=CC=C(C(=O)CCC(O)=O)C=C1 OGOAZOPKAUTBGH-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- 125000004176 4-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1F)C([H])([H])* 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- MMDFKVYPOQFQHP-UHFFFAOYSA-N 4-methyl-1h-pyridazin-6-one Chemical compound CC=1C=NNC(=O)C=1 MMDFKVYPOQFQHP-UHFFFAOYSA-N 0.000 description 1
- RWNZIIWZNOPSDB-UHFFFAOYSA-N 4-methyl-4,5-dihydro-1h-pyridazin-6-one Chemical compound CC1CC(=O)NN=C1 RWNZIIWZNOPSDB-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-FOQJRBATSA-N 59096-14-9 Chemical compound CC(=O)OC1=CC=CC=C1[14C](O)=O BSYNRYMUTXBXSQ-FOQJRBATSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical group OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 101001053401 Arabidopsis thaliana Acid beta-fructofuranosidase 3, vacuolar Proteins 0.000 description 1
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 1
- 241000238366 Cephalopoda Species 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- ISKQADXMHQSTHK-UHFFFAOYSA-N [4-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=C(CN)C=C1 ISKQADXMHQSTHK-UHFFFAOYSA-N 0.000 description 1
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000003266 anti-allergic effect Effects 0.000 description 1
- 230000001741 anti-phlogistic effect Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- PFOTUKVHYMNWRC-UHFFFAOYSA-N but-2-ynyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OCC#CC)=CC=C1C1=NNC(=O)CC1 PFOTUKVHYMNWRC-UHFFFAOYSA-N 0.000 description 1
- HEQZWELSXHVLPD-UHFFFAOYSA-N but-3-enyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C1=CC=C(NC(=O)OCCC=C)C=C1 HEQZWELSXHVLPD-UHFFFAOYSA-N 0.000 description 1
- UVCVIHNQUONSMS-UHFFFAOYSA-N but-3-yn-2-yl carbonochloridate Chemical compound C#CC(C)OC(Cl)=O UVCVIHNQUONSMS-UHFFFAOYSA-N 0.000 description 1
- FLRXSNLOTAHCPB-UHFFFAOYSA-N but-3-ynyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C1=CC=C(NC(=O)OCCC#C)C=C1 FLRXSNLOTAHCPB-UHFFFAOYSA-N 0.000 description 1
- NRDQFWXVTPZZAZ-UHFFFAOYSA-N butyl carbonochloridate Chemical compound CCCCOC(Cl)=O NRDQFWXVTPZZAZ-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- CLXISZPZSUMHOL-UHFFFAOYSA-N butyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OCCCC)=CC=C1C1=NNC(=O)CC1C CLXISZPZSUMHOL-UHFFFAOYSA-N 0.000 description 1
- VURPOKFNXZEQOU-UHFFFAOYSA-N butyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OCCCC)=CC=C1C1=NNC(=O)CC1 VURPOKFNXZEQOU-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229960001714 calcium phosphate Drugs 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 229940096529 carboxypolymethylene Drugs 0.000 description 1
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- MRZYQMBJDKFLBH-UHFFFAOYSA-N chloromethyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C1=CC=C(NC(=O)OCCl)C=C1 MRZYQMBJDKFLBH-UHFFFAOYSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 239000012059 conventional drug carrier Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- KTHXBEHDVMTNOH-UHFFFAOYSA-N cyclobutanol Chemical compound OC1CCC1 KTHXBEHDVMTNOH-UHFFFAOYSA-N 0.000 description 1
- QPOSYIIMLMZMAZ-UHFFFAOYSA-N cyclobutyl carbonochloridate Chemical compound ClC(=O)OC1CCC1 QPOSYIIMLMZMAZ-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- DJXOFTSOGIOYFS-UHFFFAOYSA-N cyclobutyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1CCC1OC(=O)NC(C=C1)=CC=C1C1=NNC(=O)CC1 DJXOFTSOGIOYFS-UHFFFAOYSA-N 0.000 description 1
- WPOPOPFNZYPKAV-UHFFFAOYSA-N cyclobutylmethanol Chemical compound OCC1CCC1 WPOPOPFNZYPKAV-UHFFFAOYSA-N 0.000 description 1
- VYDCMCUZQPGSKZ-UHFFFAOYSA-N cyclobutylmethyl carbonochloridate Chemical compound ClC(=O)OCC1CCC1 VYDCMCUZQPGSKZ-UHFFFAOYSA-N 0.000 description 1
- 125000004850 cyclobutylmethyl group Chemical group C1(CCC1)C* 0.000 description 1
- ZBYYDJVKTMPODV-UHFFFAOYSA-N cyclobutylmethyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)OCC1CCC1 ZBYYDJVKTMPODV-UHFFFAOYSA-N 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- IWVJLGPDBXCTDA-UHFFFAOYSA-N cyclohexyl carbonochloridate Chemical compound ClC(=O)OC1CCCCC1 IWVJLGPDBXCTDA-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- AOQONNCNKUWWRI-UHFFFAOYSA-N cyclohexylmethyl carbonochloridate Chemical compound ClC(=O)OCC1CCCCC1 AOQONNCNKUWWRI-UHFFFAOYSA-N 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- RBNOANMZMPAQQP-UHFFFAOYSA-N cyclohexylmethyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)OCC1CCCCC1 RBNOANMZMPAQQP-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- GFXVONOMVJDTRA-UHFFFAOYSA-N cyclopentyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)OC1CCCC1 GFXVONOMVJDTRA-UHFFFAOYSA-N 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- UEAOORRUCKWUET-UHFFFAOYSA-N cyclopentylmethyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)OCC1CCCC1 UEAOORRUCKWUET-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- XFIHSGIVXCMZJR-UHFFFAOYSA-N cyclopropyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)OC1CC1 XFIHSGIVXCMZJR-UHFFFAOYSA-N 0.000 description 1
- GUDMZGLFZNLYEY-UHFFFAOYSA-N cyclopropylmethanol Chemical compound OCC1CC1 GUDMZGLFZNLYEY-UHFFFAOYSA-N 0.000 description 1
- CUTUSCCYCWQYPQ-UHFFFAOYSA-N cyclopropylmethyl carbonochloridate Chemical compound ClC(=O)OCC1CC1 CUTUSCCYCWQYPQ-UHFFFAOYSA-N 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- AOQRXVFAPUGHCP-UHFFFAOYSA-N cyclopropylmethyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)OCC1CC1 AOQRXVFAPUGHCP-UHFFFAOYSA-N 0.000 description 1
- QZFUYWLGPCNLDI-UHFFFAOYSA-N cyclopropylmethyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1CC1COC(=O)NC(C=C1)=CC=C1C1=NNC(=O)CC1 QZFUYWLGPCNLDI-UHFFFAOYSA-N 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 239000012975 dibutyltin dilaurate Substances 0.000 description 1
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 1
- OLDYINHHINNNFN-UHFFFAOYSA-N dichloromethyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OC(Cl)Cl)=CC=C1C1=NNC(=O)CC1 OLDYINHHINNNFN-UHFFFAOYSA-N 0.000 description 1
- 230000000916 dilatatory effect Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- ZRCGODVVIBADDE-UHFFFAOYSA-N ethyl 4-(4-isocyanatophenyl)-4-oxobutanoate Chemical compound CCOC(=O)CCC(=O)C1=CC=C(N=C=O)C=C1 ZRCGODVVIBADDE-UHFFFAOYSA-N 0.000 description 1
- UHMZHYUCMREDRI-UHFFFAOYSA-N ethyl thiohypochlorite Chemical group CCSCl UHMZHYUCMREDRI-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate Chemical compound [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000006629 isopropoxycarbonylamino group Chemical group 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 230000000936 membranestabilizing effect Effects 0.000 description 1
- BQPIGGFYSBELGY-UHFFFAOYSA-N mercury(2+) Chemical class [Hg+2] BQPIGGFYSBELGY-UHFFFAOYSA-N 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- WEIHQUBBDYYAEA-UHFFFAOYSA-N methyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OC)=CC=C1C1=NNC(=O)CC1 WEIHQUBBDYYAEA-UHFFFAOYSA-N 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 125000001209 o-nitrophenyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])[N+]([O-])=O 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- XZZXKVYTWCYOQX-UHFFFAOYSA-J octanoate;tin(4+) Chemical compound [Sn+4].CCCCCCCC([O-])=O.CCCCCCCC([O-])=O.CCCCCCCC([O-])=O.CCCCCCCC([O-])=O XZZXKVYTWCYOQX-UHFFFAOYSA-J 0.000 description 1
- 229940099990 ogen Drugs 0.000 description 1
- LMAZKPOSWVOFGY-FBAUPLQOSA-N orine Natural products CO[C@H]1C[C@H](O[C@H]2CC[C@]3(C)[C@H]4C[C@@H](OC(=O)C=Cc5ccccc5)[C@]6(C)[C@@](O)(CC[C@]6(O)[C@]4(O)CC=C3C2)[C@H](C)OC(=O)C=Cc7ccccc7)O[C@H](C)[C@H]1O LMAZKPOSWVOFGY-FBAUPLQOSA-N 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- DJRVOAAZTVVFOU-UHFFFAOYSA-N pent-2-ynyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OCC#CCC)=CC=C1C1=NNC(=O)CC1C DJRVOAAZTVVFOU-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- PFXNYQAPFBPOPI-UHFFFAOYSA-N phenyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)OC1=CC=CC=C1 PFXNYQAPFBPOPI-UHFFFAOYSA-N 0.000 description 1
- XEBWQGVWTUSTLN-UHFFFAOYSA-M phenylmercury acetate Chemical compound CC(=O)O[Hg]C1=CC=CC=C1 XEBWQGVWTUSTLN-UHFFFAOYSA-M 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- CAEWJEXPFKNBQL-UHFFFAOYSA-N prop-2-enyl carbonochloridate Chemical compound ClC(=O)OCC=C CAEWJEXPFKNBQL-UHFFFAOYSA-N 0.000 description 1
- UTMIFVCEGUEFBE-UHFFFAOYSA-N prop-2-ynyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OCC#C)=CC=C1C1=NNC(=O)CC1 UTMIFVCEGUEFBE-UHFFFAOYSA-N 0.000 description 1
- IVRIRQXJSNCSPQ-UHFFFAOYSA-N propan-2-yl carbonochloridate Chemical compound CC(C)OC(Cl)=O IVRIRQXJSNCSPQ-UHFFFAOYSA-N 0.000 description 1
- URZPBBFLZPHKFR-UHFFFAOYSA-N propan-2-yl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OC(C)C)=CC=C1C1=NNC(=O)CC1 URZPBBFLZPHKFR-UHFFFAOYSA-N 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000006628 propoxycarbonylamino group Chemical group 0.000 description 1
- VYQHKUGAFRORJD-UHFFFAOYSA-N propyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamate Chemical compound C1=CC(NC(=O)OCCC)=CC=C1C1=NNC(=O)CC1 VYQHKUGAFRORJD-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- MOSXQJAJZSJWPG-UHFFFAOYSA-N s-(3-chloropropyl) n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamothioate Chemical compound CC1CC(=O)NN=C1C1=CC=C(NC(=O)SCCCCl)C=C1 MOSXQJAJZSJWPG-UHFFFAOYSA-N 0.000 description 1
- SIUKGORQDHTYIW-UHFFFAOYSA-N s-(4-fluorophenyl) n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamothioate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)SC1=CC=C(F)C=C1 SIUKGORQDHTYIW-UHFFFAOYSA-N 0.000 description 1
- JKJGKNMSZMZPKX-UHFFFAOYSA-N s-(cyclobutylmethyl) n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamothioate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)SCC1CCC1 JKJGKNMSZMZPKX-UHFFFAOYSA-N 0.000 description 1
- MPDBOMFOUYTFOE-UHFFFAOYSA-N s-(cyclopentylmethyl) n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamothioate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)SCC1CCCC1 MPDBOMFOUYTFOE-UHFFFAOYSA-N 0.000 description 1
- GJIUWVWXHCYPLM-UHFFFAOYSA-N s-(cyclopropylmethyl) n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamothioate Chemical compound C1CC1CSC(=O)NC(C=C1)=CC=C1C1=NNC(=O)CC1 GJIUWVWXHCYPLM-UHFFFAOYSA-N 0.000 description 1
- CGYISZVHDKGKER-UHFFFAOYSA-N s-(trifluoromethyl) n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamothioate Chemical compound CC1CC(=O)NN=C1C1=CC=C(NC(=O)SC(F)(F)F)C=C1 CGYISZVHDKGKER-UHFFFAOYSA-N 0.000 description 1
- OZJJZBFWDVFPAK-UHFFFAOYSA-N s-[(4-fluorophenyl)methyl] n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamothioate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)SCC1=CC=C(F)C=C1 OZJJZBFWDVFPAK-UHFFFAOYSA-N 0.000 description 1
- YGKBSLYSDBTXLG-UHFFFAOYSA-N s-[3-(trifluoromethyl)phenyl] n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamothioate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)SC1=CC=CC(C(F)(F)F)=C1 YGKBSLYSDBTXLG-UHFFFAOYSA-N 0.000 description 1
- QHNPFBUESBRZQU-UHFFFAOYSA-N s-benzyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamothioate Chemical compound C=1C=CC=CC=1CSC(=O)NC(C=C1)=CC=C1C1=NNC(=O)CC1 QHNPFBUESBRZQU-UHFFFAOYSA-N 0.000 description 1
- IWVCEFMBUPCSKV-UHFFFAOYSA-N s-cyclobutyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamothioate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)SC1CCC1 IWVCEFMBUPCSKV-UHFFFAOYSA-N 0.000 description 1
- IHEAHQPFTOEHJA-UHFFFAOYSA-N s-cyclohexyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamothioate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)SC1CCCCC1 IHEAHQPFTOEHJA-UHFFFAOYSA-N 0.000 description 1
- YFEGNEHOUDGWAS-UHFFFAOYSA-N s-ethyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamothioate Chemical compound C1=CC(NC(=O)SCC)=CC=C1C1=NNC(=O)CC1C YFEGNEHOUDGWAS-UHFFFAOYSA-N 0.000 description 1
- TUFSZLFVAZLHMB-UHFFFAOYSA-N s-ethyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamothioate Chemical compound C1=CC(NC(=O)SCC)=CC=C1C1=NNC(=O)CC1 TUFSZLFVAZLHMB-UHFFFAOYSA-N 0.000 description 1
- YPSUCTSXOROPBS-UHFFFAOYSA-N s-methyl chloromethanethioate Chemical compound CSC(Cl)=O YPSUCTSXOROPBS-UHFFFAOYSA-N 0.000 description 1
- LQJJJJPCMLPIJH-UHFFFAOYSA-N s-phenyl n-[4-(4-methyl-6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamothioate Chemical compound CC1CC(=O)NN=C1C(C=C1)=CC=C1NC(=O)SC1=CC=CC=C1 LQJJJJPCMLPIJH-UHFFFAOYSA-N 0.000 description 1
- FYOPSYJKEHWOBR-UHFFFAOYSA-N s-propyl chloromethanethioate Chemical compound CCCSC(Cl)=O FYOPSYJKEHWOBR-UHFFFAOYSA-N 0.000 description 1
- YIJPGENQIZLOML-UHFFFAOYSA-N s-propyl n-[4-(6-oxo-4,5-dihydro-1h-pyridazin-3-yl)phenyl]carbamothioate Chemical compound C1=CC(NC(=O)SCCC)=CC=C1C1=NNC(=O)CC1 YIJPGENQIZLOML-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000010356 sorbitol Nutrition 0.000 description 1
- 238000013222 sprague-dawley male rat Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- IUTCEZPPWBHGIX-UHFFFAOYSA-N tin(2+) Chemical compound [Sn+2] IUTCEZPPWBHGIX-UHFFFAOYSA-N 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D237/00—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings
- C07D237/02—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings
- C07D237/04—Heterocyclic compounds containing 1,2-diazine or hydrogenated 1,2-diazine rings not condensed with other rings having less than three double bonds between ring members or between ring members and non-ring members
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803022177 DE3022177A1 (de) | 1980-06-13 | 1980-06-13 | Neue dihydropyridazinone, verfahren zu ihrer herstellung und diese verbindung enthaltende therapeutische mittel |
| DEP3022177.3 | 1980-06-13 | ||
| DE19803033702 DE3033702A1 (de) | 1980-09-08 | 1980-09-08 | Neue dihydropyridazinone, verfahren zu ihrer herstellung und diese verbindungen enthaltende therapeutische mittel |
| DEP3033702.1 | 1980-09-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1163268A true CA1163268A (en) | 1984-03-06 |
Family
ID=25785986
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000379001A Expired CA1163268A (en) | 1980-06-13 | 1981-06-04 | Dihydropyridazinones, their preparation and therapeutic agents containing these compounds |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4415571A (enExample) |
| EP (1) | EP0042513B1 (enExample) |
| CA (1) | CA1163268A (enExample) |
| DE (1) | DE3165383D1 (enExample) |
| DK (1) | DK148536C (enExample) |
| ES (1) | ES503007A0 (enExample) |
| GR (1) | GR81309B (enExample) |
| IE (1) | IE51271B1 (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3302021A1 (de) * | 1983-01-22 | 1984-07-26 | Basf Ag, 6700 Ludwigshafen | 6-aryl-4,5-dihydro-3(2h)-pyridazinone, ihre herstellung und verwendung |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1670158U (de) | 1953-11-05 | 1954-01-14 | Gustav Fey | Vorrichtung zur erfassung und verteilung von versand- und oder lagergut. |
| DE1670043C3 (de) * | 1966-01-07 | 1975-05-22 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von 3-(Aminophenyl)-pyridazon-(6)-derivaten |
| IL37788A0 (en) | 1970-10-09 | 1971-12-29 | American Cyanamid Co | New pyridazinone compounds,their preparation and pharmaceutical compositions containing them |
| US3689652A (en) * | 1970-10-09 | 1972-09-05 | William Vincent Curran | Method of lowering blood pressure in mammals |
| DE2123246C2 (de) * | 1971-05-11 | 1982-11-25 | Basf Ag, 6700 Ludwigshafen | 6-[p-(β-Phenyläthylaminoacetylamino)-phenyl]-4,5-dihydropyridazon-(3) |
| BE791539A (fr) | 1971-11-19 | 1973-05-17 | Basf Ag | Dihydropyridazones, leur preparation et leurs utilisations therapeutiques |
| US3888901A (en) * | 1972-07-20 | 1975-06-10 | American Cyanamid Co | Process of preparing 3-alkyl-3-(benzoyl)propionitriles |
| US3824271A (en) * | 1972-07-20 | 1974-07-16 | American Cyanamid Co | 3-alkyl-3-(benzoyl)propionitriles |
| DE2304977A1 (de) | 1973-02-01 | 1974-08-08 | Basf Ag | Neue dihydropyridazinone |
| US4011321A (en) * | 1973-12-19 | 1977-03-08 | Smith Kline & French Laboratories Limited | Pharmaceutical compositions and methods of inhibiting β-adrenergic receptors |
| DE2727481A1 (de) * | 1977-06-18 | 1979-01-11 | Basf Ag | Dihydropyridazone und dihydropyridazone enthaltende therapeutische mittel |
-
1981
- 1981-06-01 GR GR65114A patent/GR81309B/el unknown
- 1981-06-03 EP EP81104262A patent/EP0042513B1/de not_active Expired
- 1981-06-03 DE DE8181104262T patent/DE3165383D1/de not_active Expired
- 1981-06-04 CA CA000379001A patent/CA1163268A/en not_active Expired
- 1981-06-09 US US06/272,016 patent/US4415571A/en not_active Expired - Fee Related
- 1981-06-10 IE IE1284/81A patent/IE51271B1/en unknown
- 1981-06-12 ES ES503007A patent/ES503007A0/es active Granted
- 1981-06-12 DK DK257481A patent/DK148536C/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DK257481A (da) | 1981-12-14 |
| ES8203854A1 (es) | 1982-04-01 |
| IE811284L (en) | 1981-12-13 |
| DK148536B (da) | 1985-07-29 |
| DK148536C (da) | 1986-01-06 |
| ES503007A0 (es) | 1982-04-01 |
| EP0042513B1 (de) | 1984-08-08 |
| IE51271B1 (en) | 1986-11-26 |
| GR81309B (enExample) | 1984-12-11 |
| EP0042513A1 (de) | 1981-12-30 |
| US4415571A (en) | 1983-11-15 |
| DE3165383D1 (en) | 1984-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1317955C (en) | 3-¬4(1-substituted-4-piperazinyl)butyl|-4- thiazolidinones a process for their preparation and their use as medicaments | |
| CA1082105A (en) | Pyidozinone derivatives and their use as agricultural fungicides | |
| US3952001A (en) | 1-Carbamoyl-1,2,4-triazoles | |
| US4376771A (en) | 6-(p-Acylaminophenyl)-4,5-dihydropyridaz-3-ones and therapeutic agents containing said compounds | |
| EP0068310B1 (de) | Neue 2-Aryl-3,4-diaza-bicyclo(4.n.0)alken-(2)-one-(5), Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| EP0400519A1 (de) | 2-Hydroxy-n-propylamine, diese Verbindungen enthaltende Arzneimittel und Verfahren zu ihrer Herstellung | |
| EP0117403B1 (de) | 6-(Acylaminoaryl)-3(2H)-pyridazinonderivate, ihre Herstellung und Verwendung | |
| EP0090978B1 (de) | Imidazolylphenyl-tetrahydropyridazine, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate | |
| US3868458A (en) | Insecticidal compositions and methods of use for combating insects using substituted imidazoles | |
| EP0299493B1 (en) | N-[(2-Oxopyrrolidin-1-yl)-acetyl]piperazine derivatives and drug for senile dementia | |
| CA1163268A (en) | Dihydropyridazinones, their preparation and therapeutic agents containing these compounds | |
| US4450275A (en) | Cyclic iminocarboxylic acid derivatives | |
| IE42626B1 (en) | 6-aryl-2,3,6,7-tetrahydro-5h-pyrrolo (1,2- )-imidazole derivatives, processes for their manufacture and compositions containing them | |
| US3940484A (en) | Insecticidal compositions and methods of combatting insects using substituted imidazoles | |
| CA1194024A (en) | 6-aryl-4,5-dihydro-3(2h)-pyridazinones, their preparation and use | |
| CA1161437A (en) | Dihydropyridazinones, their preparation and therapeutic agents containing these compounds | |
| US4579860A (en) | Isoxazolinone derivatives, process for their preparation and insecticidal and acaricidal compositions containing them | |
| US4654338A (en) | 1,2,4-thiadiazines | |
| EP0089650B1 (en) | Process for producing antifungal pyridazinone derivatives and certain novel compounds produced by such a process | |
| CA1064490A (en) | Imidazole derivatives | |
| US4281125A (en) | Quinoline catalyzed synthesis of pyridazinone pharmaceutical intermediates | |
| CA1050982A (en) | 3,5-diphenyl-4-(1h)-pyridazinones (thiones) | |
| US4772598A (en) | 2-aryl-3,4-diazabicyclo(4.n.O)alk-2-en-5-ones for the preparation of an agent for treating cardiac insufficiency | |
| DE3022177A1 (de) | Neue dihydropyridazinone, verfahren zu ihrer herstellung und diese verbindung enthaltende therapeutische mittel | |
| JPS5910351B2 (ja) | 3−オキシ−1,2,4−トリアゾ−ル誘導体の製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |