CA1162698A - Thermoplastic copolyester elastomer - Google Patents
Thermoplastic copolyester elastomerInfo
- Publication number
- CA1162698A CA1162698A CA000382215A CA382215A CA1162698A CA 1162698 A CA1162698 A CA 1162698A CA 000382215 A CA000382215 A CA 000382215A CA 382215 A CA382215 A CA 382215A CA 1162698 A CA1162698 A CA 1162698A
- Authority
- CA
- Canada
- Prior art keywords
- removal
- groups
- hydroxyl groups
- elastomer according
- remaining
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920001971 elastomer Polymers 0.000 title claims abstract description 37
- 239000000806 elastomer Substances 0.000 title claims abstract description 37
- 229920006344 thermoplastic copolyester Polymers 0.000 title claims abstract description 8
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 claims abstract description 13
- 239000000203 mixture Substances 0.000 claims abstract description 12
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 38
- -1 hydrocarbon radical Chemical group 0.000 claims description 26
- 150000002148 esters Chemical group 0.000 claims description 24
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 22
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 19
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 19
- 150000003254 radicals Chemical class 0.000 claims description 17
- 229920001634 Copolyester Polymers 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 9
- OZCRKDNRAAKDAN-UHFFFAOYSA-N but-1-ene-1,4-diol Chemical compound O[CH][CH]CCO OZCRKDNRAAKDAN-UHFFFAOYSA-N 0.000 claims description 9
- 239000004215 Carbon black (E152) Substances 0.000 claims description 6
- 229930195733 hydrocarbon Natural products 0.000 claims description 6
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 5
- 229920000570 polyether Polymers 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- HAYIPGIFANTODX-UHFFFAOYSA-N 4,6-dimethylbenzene-1,3-dicarboxylic acid Chemical compound CC1=CC(C)=C(C(O)=O)C=C1C(O)=O HAYIPGIFANTODX-UHFFFAOYSA-N 0.000 claims 2
- MQRCHVBRBGNZGJ-UHFFFAOYSA-N 2-[3,5-bis[2-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoyloxy]ethyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(CCC(=O)OCCN2C(N(CCOC(=O)CCC=3C=C(C(O)=C(C=3)C(C)(C)C)C(C)(C)C)C(=O)N(CCOC(=O)CCC=3C=C(C(O)=C(C=3)C(C)(C)C)C(C)(C)C)C2=O)=O)=C1 MQRCHVBRBGNZGJ-UHFFFAOYSA-N 0.000 claims 1
- 229920002725 thermoplastic elastomer Polymers 0.000 claims 1
- 150000002334 glycols Chemical class 0.000 abstract description 6
- 125000004185 ester group Chemical group 0.000 abstract 2
- 150000003022 phthalic acids Chemical class 0.000 abstract 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 20
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 12
- 238000000034 method Methods 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- CDQSJQSWAWPGKG-UHFFFAOYSA-N butane-1,1-diol Chemical compound CCCC(O)O CDQSJQSWAWPGKG-UHFFFAOYSA-N 0.000 description 9
- 150000002009 diols Chemical class 0.000 description 8
- 238000006116 polymerization reaction Methods 0.000 description 8
- 239000000047 product Substances 0.000 description 7
- ORTVZLZNOYNASJ-UPHRSURJSA-N (z)-but-2-ene-1,4-diol Chemical compound OC\C=C/CO ORTVZLZNOYNASJ-UPHRSURJSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 230000006872 improvement Effects 0.000 description 4
- 229920000728 polyester Polymers 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- VNGOYPQMJFJDLV-UHFFFAOYSA-N dimethyl benzene-1,3-dicarboxylate Chemical compound COC(=O)C1=CC=CC(C(=O)OC)=C1 VNGOYPQMJFJDLV-UHFFFAOYSA-N 0.000 description 3
- 230000032050 esterification Effects 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 238000006068 polycondensation reaction Methods 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- VOYADQIFGGIKAT-UHFFFAOYSA-N 1,3-dibutyl-4-hydroxy-2,6-dioxopyrimidine-5-carboximidamide Chemical compound CCCCn1c(O)c(C(N)=N)c(=O)n(CCCC)c1=O VOYADQIFGGIKAT-UHFFFAOYSA-N 0.000 description 2
- CTMHWPIWNRWQEG-UHFFFAOYSA-N 1-methylcyclohexene Chemical compound CC1=CCCCC1 CTMHWPIWNRWQEG-UHFFFAOYSA-N 0.000 description 2
- 239000007983 Tris buffer Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- 235000011092 calcium acetate Nutrition 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- 229940035437 1,3-propanediol Drugs 0.000 description 1
- AWFYPPSBLUWMFQ-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)NN=C2 AWFYPPSBLUWMFQ-UHFFFAOYSA-N 0.000 description 1
- PFANXOISJYKQRP-UHFFFAOYSA-N 2-tert-butyl-4-[1-(5-tert-butyl-4-hydroxy-2-methylphenyl)butyl]-5-methylphenol Chemical compound C=1C(C(C)(C)C)=C(O)C=C(C)C=1C(CCC)C1=CC(C(C)(C)C)=C(O)C=C1C PFANXOISJYKQRP-UHFFFAOYSA-N 0.000 description 1
- ODJQKYXPKWQWNK-UHFFFAOYSA-N 3,3'-Thiobispropanoic acid Chemical compound OC(=O)CCSCCC(O)=O ODJQKYXPKWQWNK-UHFFFAOYSA-N 0.000 description 1
- 125000003143 4-hydroxybenzyl group Chemical group [H]C([*])([H])C1=C([H])C([H])=C(O[H])C([H])=C1[H] 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 238000012695 Interfacial polymerization Methods 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229920001730 Moisture cure polyurethane Polymers 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000003490 Thiodipropionic acid Substances 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- 150000001565 benzotriazoles Chemical class 0.000 description 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 1
- 238000000071 blow moulding Methods 0.000 description 1
- VSGNNIFQASZAOI-UHFFFAOYSA-L calcium acetate Chemical compound [Ca+2].CC([O-])=O.CC([O-])=O VSGNNIFQASZAOI-UHFFFAOYSA-L 0.000 description 1
- 239000001639 calcium acetate Substances 0.000 description 1
- 229960005147 calcium acetate Drugs 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- OVHKECRARPYFQS-UHFFFAOYSA-N cyclohex-2-ene-1,1-dicarboxylic acid Chemical compound OC(=O)C1(C(O)=O)CCCC=C1 OVHKECRARPYFQS-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011152 fibreglass Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000011256 inorganic filler Substances 0.000 description 1
- 229910003475 inorganic filler Inorganic materials 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- 150000002531 isophthalic acids Chemical class 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 235000011285 magnesium acetate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- AHHWIHXENZJRFG-UHFFFAOYSA-N oxetane Chemical compound C1COC1 AHHWIHXENZJRFG-UHFFFAOYSA-N 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 150000008301 phosphite esters Chemical class 0.000 description 1
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 1
- 229920001707 polybutylene terephthalate Polymers 0.000 description 1
- 238000012643 polycondensation polymerization Methods 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 150000003504 terephthalic acids Chemical class 0.000 description 1
- VXUYXOFXAQZZMF-UHFFFAOYSA-N tetraisopropyl titanate Substances CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 235000019303 thiodipropionic acid Nutrition 0.000 description 1
- 150000005691 triesters Chemical class 0.000 description 1
- BOXSVZNGTQTENJ-UHFFFAOYSA-L zinc dibutyldithiocarbamate Chemical compound [Zn+2].CCCCN(C([S-])=S)CCCC.CCCCN(C([S-])=S)CCCC BOXSVZNGTQTENJ-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/66—Polyesters containing oxygen in the form of ether groups
- C08G63/668—Polyesters containing oxygen in the form of ether groups derived from polycarboxylic acids and polyhydroxy compounds
- C08G63/672—Dicarboxylic acids and dihydroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US196,958 | 1980-10-14 | ||
| US06/196,958 US4355155A (en) | 1980-10-14 | 1980-10-14 | Thermoplastic copolyester elastomer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1162698A true CA1162698A (en) | 1984-02-21 |
Family
ID=22727459
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000382215A Expired CA1162698A (en) | 1980-10-14 | 1981-07-22 | Thermoplastic copolyester elastomer |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4355155A (index.php) |
| EP (1) | EP0049823B1 (index.php) |
| JP (1) | JPS5780425A (index.php) |
| AT (1) | ATE16606T1 (index.php) |
| BR (1) | BR8106559A (index.php) |
| CA (1) | CA1162698A (index.php) |
| DE (1) | DE3173013D1 (index.php) |
| IL (1) | IL63761A0 (index.php) |
| ZA (1) | ZA816684B (index.php) |
Families Citing this family (56)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3244011A1 (de) * | 1982-11-27 | 1984-05-30 | Cassella Ag, 6000 Frankfurt | In wasser dispergierbarer polyester, seine herstellung und verwendung als hydrophobierungsmittel |
| US4469851A (en) * | 1983-06-06 | 1984-09-04 | Gaf Corporation | Molding composition |
| US4520150A (en) * | 1983-12-01 | 1985-05-28 | Gaf Corporation | Stabilized elastomer compositions |
| US4778839A (en) * | 1983-12-01 | 1988-10-18 | Hoechst Celanese Corporation | Stabilized thermoplastic elastomer compositions |
| US4797437A (en) * | 1983-12-01 | 1989-01-10 | Hoechst Celanese Corporation | Thermoplastic elastomer |
| US4520149A (en) * | 1983-12-01 | 1985-05-28 | Gaf Corporation | Elastomer compositions |
| US4520148A (en) * | 1983-12-01 | 1985-05-28 | Gaf Corporation | Thermoplastic elastomer compositions |
| US4766164A (en) * | 1983-12-01 | 1988-08-23 | Golder Michael D | Stabilized thermoplastic elastomer |
| US4824723A (en) * | 1986-06-02 | 1989-04-25 | General Electric Company | Flame resistant electrical insulating material |
| EP0357194A1 (en) * | 1988-08-30 | 1990-03-07 | Hoechst Celanese Corporation | Blends of copolyester elastomers and carbodiimides |
| US5032631A (en) * | 1988-11-10 | 1991-07-16 | Hoechst Celanese Corporation | UV-light stabilized polyester molding compositions |
| JPH0294375U (index.php) * | 1989-01-11 | 1990-07-26 | ||
| US5039744A (en) * | 1989-05-11 | 1991-08-13 | Hoechst Celanese Corporation | Elastomer compositions made from blends of copolyester elastomers and copolymers of ethylene and ethyl acrylate |
| US5179163A (en) * | 1989-05-11 | 1993-01-12 | Hoechst Celanese Corporation | Elastomer compositions made from blends of copolyester elastomers and copolymers of ethylene and ethyl acrylate |
| US5214088A (en) * | 1989-10-20 | 1993-05-25 | General Electric Company | Highly dense thermoplastic molding compositions |
| US5399608A (en) * | 1989-10-20 | 1995-03-21 | General Electric Company | Highly dense thermoplastic molding compositions |
| US5258445A (en) * | 1990-03-08 | 1993-11-02 | The B. F. Goodrich Company | Fiber-reinforced thermoplastic molding compositions using a copolyester |
| US5300563A (en) * | 1990-07-30 | 1994-04-05 | Quantum Chemical Corporation | Polyester-based adhesives and composite structures |
| US5110668A (en) * | 1990-12-21 | 1992-05-05 | General Electric Company | Flexible laminate having copolyetherester adhesive |
| US5202069A (en) * | 1991-04-23 | 1993-04-13 | Astro-Valcour, Inc. | Method for producing foamed, molded thermoplastic articles |
| US5246976A (en) * | 1991-04-23 | 1993-09-21 | Astro-Valcour, Inc. | Apparatus for producing foamed, molded thermoplastic articles and articles produced thereby |
| US5128185A (en) * | 1991-08-29 | 1992-07-07 | E. I. Du Pont De Nemours And Company | Copolyetherester elastomer with poly(1,3-propylenebibenzoate) hard segment |
| US5334647A (en) * | 1991-09-16 | 1994-08-02 | The B. F. Goodrich Company | Fiber-reinforced thermoplastic molding compositions |
| US5519094A (en) * | 1992-03-06 | 1996-05-21 | B. F. Goodrich Company | Fiber-reinforced thermoplastic molding compositions using a modified thermoplastic polyurethane |
| CA2103420A1 (en) * | 1992-12-22 | 1994-06-23 | Eileen B. Walsh | Stabilization of low molecular weight polybutylene terephthalate/polyester blends with phosphorus compounds |
| US5346767A (en) * | 1992-12-22 | 1994-09-13 | General Electric Company | Abrasion resistant highly filled polyester compositions |
| US5441997A (en) * | 1992-12-22 | 1995-08-15 | General Electric Company | High density polyester-polycarbonate molding composition |
| US5624737A (en) * | 1993-02-18 | 1997-04-29 | General Electric Company | Method for adhering materials having differing expansion properties and articles produced therefrom |
| US5384387A (en) * | 1993-05-04 | 1995-01-24 | General Electric Company | Amine-functionalized polyester |
| DE4330062A1 (de) * | 1993-09-06 | 1995-03-09 | Huels Chemische Werke Ag | Verfahren zur Herstellung hochmolekularer Polyester |
| US5674931A (en) * | 1995-04-07 | 1997-10-07 | General Electric Company | Flame retardant heavily filled thermoplastic composition |
| US5965261A (en) * | 1998-11-16 | 1999-10-12 | Clariant Finance (Bvi) Limited | Polyester |
| US6423789B1 (en) | 2001-08-10 | 2002-07-23 | E. I. Dupont De Nemours & Company | Process to produce poly(alkylene ether)glycol-containing polyesters |
| US6610795B2 (en) | 2001-08-10 | 2003-08-26 | E. I. Du Pont De Nemours And Company | Process to produce poly(alkylene ether) glycol-containing polyesters |
| US6399737B1 (en) | 2001-09-21 | 2002-06-04 | General Electric Company | EMI-shielding thermoplastic composition, method for the preparation thereof, and pellets and articles derived therefrom |
| EP1321270A1 (en) * | 2001-12-18 | 2003-06-25 | Dsm N.V. | Process for making a slush-moulded article |
| US7625994B2 (en) | 2002-07-30 | 2009-12-01 | E.I. Du Pont De Nemours And Company | Sulfonated aliphatic-aromatic copolyetheresters |
| US7223456B2 (en) * | 2004-03-18 | 2007-05-29 | Noveon, Inc. | Flexible laminated plastic pipe having a chlorinated poly(vinyl chloride) hollow core |
| ES2363786T3 (es) * | 2005-04-19 | 2011-08-16 | Unilever N.V. | Procedimiento para la producción de productos de confitería aireados congelados. |
| DE602007004072D1 (de) * | 2006-01-27 | 2010-02-11 | Gen Electric | Artikel aus zusammensetzungen mit modifizierten polybutylen-terephthalat-statistik-copolymeren aus polyethylen-terephthalat |
| US7902264B2 (en) * | 2006-01-27 | 2011-03-08 | Sabic Innovative Plastics Ip B.V. | Polytrimethylene terephthalate (PTT) derived from polyethylene terephthalate (PET) and containing PET residues |
| WO2007089653A2 (en) * | 2006-01-27 | 2007-08-09 | General Electric Company | Molding compositions containing polyalkylene terephthalates and modified polybutylene terephthalate (pbt) random copolymers derived from pet |
| US7923506B2 (en) * | 2006-01-27 | 2011-04-12 | Sabic Innovative Plastics Ip B.V. | Molding compositions containing modified polybutylene terephthalate (PBT) random copolymers derived from polyethylene terephthalate (PET) |
| US7795320B2 (en) * | 2006-01-27 | 2010-09-14 | Sabic Innovative Plastics Ip B.V. | Copolyetheresters derived from polyethylene terephthalate |
| US7902263B2 (en) * | 2006-01-27 | 2011-03-08 | Sabic Innovative Plastics Ip B.V. | Process for making polybutylene terephthalate (PBT) from polyethylene terephthalate (PET) |
| US8680167B2 (en) * | 2006-01-27 | 2014-03-25 | Sabic Innovative Plastics Ip B.V. | Molding compositions containing fillers and modified polybutylene terephthalate (PBT) random copolymers derived from polyethylene terephthalate (PET) |
| US7799836B2 (en) * | 2006-03-01 | 2010-09-21 | Sabic Innovative Plastics Ip B.V. | Process for making polybutylene terephthalate (PBT) from polyethylene terephthalate (PET) |
| US7799838B2 (en) * | 2006-07-26 | 2010-09-21 | Sabic Innovative Plastics Ip B.V. | Elastomer blends of polyesters and copolyetheresters derived from polyethylene terephthalate, method of manufacture, and articles therefrom |
| US8309656B2 (en) | 2006-07-26 | 2012-11-13 | Sabic Innovative Plastics Ip B.V. | Elastomer blends containing polycarbonates and copolyetheresters derived from polyethylene terephthalate, method of manufacture, and articles therefrom |
| US8158710B2 (en) * | 2006-11-27 | 2012-04-17 | Sabic Innovative Plastics Ip B.V. | Polyester blends, methods of making, and articles formed therefrom |
| CN101611094B (zh) * | 2007-02-12 | 2012-03-21 | 帝斯曼知识产权资产管理有限公司 | 聚合物组合物及由其制成的塑料管 |
| US7799892B2 (en) * | 2008-05-02 | 2010-09-21 | Sabic Innovative Plastics Ip B.V. | Method of making polybutylene terephthalate and compositions and articles comprising the same |
| PT2467420E (pt) * | 2009-08-17 | 2013-10-31 | Basf Se | Utilização de elastómero termoplástico de copoliéster ou copoliamida para aumentar a atividade eliminadora de oxigénio de películas de poliolefinas funcionalizadas |
| US8129471B2 (en) * | 2009-12-30 | 2012-03-06 | Sabic Innovative Plastics Ip B.V. | Polycarbonate-poly(ether-ester) copolymer composition, method of manufacture, and articles therefrom |
| WO2021019076A1 (de) | 2019-07-31 | 2021-02-04 | Basf Se | Neue blockcopolymere |
| EP4291607B1 (en) | 2021-02-10 | 2025-01-01 | Cabot Corporation | Method of producing thermoplastic elastomers and polymer composite obtained thereby |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3023192A (en) * | 1958-05-29 | 1962-02-27 | Du Pont | Segmented copolyetherester elastomers |
| US3651014A (en) * | 1969-07-18 | 1972-03-21 | Du Pont | Segmented thermoplastic copolyester elastomers |
| US3766146A (en) * | 1971-03-18 | 1973-10-16 | Du Pont | Segmented thermoplastic copolyester elastomers |
| US3763109A (en) * | 1971-08-19 | 1973-10-02 | Du Pont | Segmented thermoplastic copolyesters |
| BE793332A (fr) * | 1972-01-26 | 1973-04-16 | Du Pont | Copolyesters thermoplastiques a segments |
| US4013624A (en) * | 1972-03-20 | 1977-03-22 | E. I. Du Pont De Nemours And Company | Branched thermoplastic copolyesters |
| CA1035092A (en) * | 1973-02-20 | 1978-07-18 | E.I. Du Pont De Nemours And Company | Soft thermoplastic segmented copolyesters as pressure sensitive adhesives |
| US4156774A (en) * | 1977-07-07 | 1979-05-29 | Ciba-Geigy Corporation | Thermoplastic copolyesters, processes for their preparation and their use |
| US4205158A (en) * | 1979-03-28 | 1980-05-27 | E. I. Du Pont De Nemours And Company | Copolyetherester based on ethylene oxide-capped poly(propylene oxide) glycol and branching agent |
| US4264761A (en) * | 1980-03-07 | 1981-04-28 | E. I. Du Pont De Nemours And Company | Copolyester barrier coat |
-
1980
- 1980-10-14 US US06/196,958 patent/US4355155A/en not_active Expired - Lifetime
-
1981
- 1981-07-22 CA CA000382215A patent/CA1162698A/en not_active Expired
- 1981-09-07 IL IL63761A patent/IL63761A0/xx not_active IP Right Cessation
- 1981-09-07 JP JP56139862A patent/JPS5780425A/ja active Granted
- 1981-09-25 ZA ZA816684A patent/ZA816684B/xx unknown
- 1981-09-30 EP EP81107784A patent/EP0049823B1/en not_active Expired
- 1981-09-30 AT AT81107784T patent/ATE16606T1/de not_active IP Right Cessation
- 1981-09-30 DE DE8181107784T patent/DE3173013D1/de not_active Expired
- 1981-10-09 BR BR8106559A patent/BR8106559A/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6259737B2 (index.php) | 1987-12-12 |
| BR8106559A (pt) | 1982-06-29 |
| US4355155A (en) | 1982-10-19 |
| JPS5780425A (en) | 1982-05-20 |
| ZA816684B (en) | 1983-04-27 |
| ATE16606T1 (de) | 1985-12-15 |
| DE3173013D1 (en) | 1986-01-02 |
| EP0049823A1 (en) | 1982-04-21 |
| IL63761A0 (en) | 1981-12-31 |
| EP0049823B1 (en) | 1985-11-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1162698A (en) | Thermoplastic copolyester elastomer | |
| US4469851A (en) | Molding composition | |
| US4405749A (en) | Thermoplastic elastomer compositions | |
| BE1010792A3 (nl) | Copolyester elastomeer. | |
| EP0180148B1 (en) | Modified thermoplastic copolyetherimide ester elastomers | |
| JPS5840977B2 (ja) | 熱可塑性ポリエステル共重合体エラストマ−の製造法 | |
| US4562232A (en) | Copolyetherester-dimer ester-block copolymers | |
| JPH08511578A (ja) | ポリエーテルエステルブロック共重合体エラストマー | |
| US4520149A (en) | Elastomer compositions | |
| US3891604A (en) | Segmented thermoplastic copolyester elastomer | |
| US4520148A (en) | Thermoplastic elastomer compositions | |
| US4520150A (en) | Stabilized elastomer compositions | |
| EP0058503B1 (en) | Polyester-polyether copolymer composition | |
| EP0608976B1 (en) | Esteramide copolymers and production thereof | |
| US5298544A (en) | Non-halogen flame retardant thermoplastic composition | |
| US3477989A (en) | Copolyesters of 2,5-dihydroxyterephthalic acid | |
| US4797437A (en) | Thermoplastic elastomer | |
| EP0357194A1 (en) | Blends of copolyester elastomers and carbodiimides | |
| US4778839A (en) | Stabilized thermoplastic elastomer compositions | |
| US4766164A (en) | Stabilized thermoplastic elastomer | |
| CA1222342A (en) | Random elastomeric copolyesters | |
| US4581420A (en) | Copolyetherester-hexahydrophthalate ester-block copolymers | |
| EP0144174B1 (en) | Thermoplastic elastomer compositions | |
| JPH06306262A (ja) | ポリエステルエラストマー組成物 | |
| US4711947A (en) | Translucent polyetherimide ester compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |