CA1151694A - Gliding ring - Google Patents
Gliding ringInfo
- Publication number
- CA1151694A CA1151694A CA000343215A CA343215A CA1151694A CA 1151694 A CA1151694 A CA 1151694A CA 000343215 A CA000343215 A CA 000343215A CA 343215 A CA343215 A CA 343215A CA 1151694 A CA1151694 A CA 1151694A
- Authority
- CA
- Canada
- Prior art keywords
- airfoil
- recited
- angle
- gliding body
- annular
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000000694 effects Effects 0.000 claims abstract description 8
- 239000000463 material Substances 0.000 claims description 7
- 229920002725 thermoplastic elastomer Polymers 0.000 claims description 4
- 239000012858 resilient material Substances 0.000 claims 6
- 229920001169 thermoplastic Polymers 0.000 claims 2
- 239000012815 thermoplastic material Substances 0.000 claims 2
- 239000004416 thermosoftening plastic Substances 0.000 claims 2
- 239000002131 composite material Substances 0.000 claims 1
- 229920001971 elastomer Polymers 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 239000000806 elastomer Substances 0.000 description 4
- 230000010006 flight Effects 0.000 description 4
- 230000005484 gravity Effects 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 101000648554 Mus musculus Sushi domain-containing protein 6 Proteins 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- 238000005452 bending Methods 0.000 description 2
- KAATUXNTWXVJKI-UHFFFAOYSA-N cypermethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 KAATUXNTWXVJKI-UHFFFAOYSA-N 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 238000009987 spinning Methods 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 235000003625 Acrocomia mexicana Nutrition 0.000 description 1
- 244000202285 Acrocomia mexicana Species 0.000 description 1
- 238000012935 Averaging Methods 0.000 description 1
- 241000906091 Lethrinus miniatus Species 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 238000012443 analytical study Methods 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 239000007779 soft material Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B64—AIRCRAFT; AVIATION; COSMONAUTICS
- B64C—AEROPLANES; HELICOPTERS
- B64C39/00—Aircraft not otherwise provided for
- B64C39/06—Aircraft not otherwise provided for having disc- or ring-shaped wings
Landscapes
- Engineering & Computer Science (AREA)
- Aviation & Aerospace Engineering (AREA)
- Toys (AREA)
- Structures Of Non-Positive Displacement Pumps (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/003,992 US4456265A (en) | 1979-01-16 | 1979-01-16 | Gliding ring |
| US3,992 | 1979-01-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1151694A true CA1151694A (en) | 1983-08-09 |
Family
ID=21708584
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000343215A Expired CA1151694A (en) | 1979-01-16 | 1980-01-08 | Gliding ring |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4456265A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5599498A (cg-RX-API-DMAC7.html) |
| AU (1) | AU5451980A (cg-RX-API-DMAC7.html) |
| BE (1) | BE881184A (cg-RX-API-DMAC7.html) |
| BR (1) | BR8000246A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1151694A (cg-RX-API-DMAC7.html) |
| DE (1) | DE3000758A1 (cg-RX-API-DMAC7.html) |
| DK (1) | DK18080A (cg-RX-API-DMAC7.html) |
| ES (1) | ES255192Y (cg-RX-API-DMAC7.html) |
| FI (1) | FI800127A7 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2446661A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB2039760B (cg-RX-API-DMAC7.html) |
| IT (1) | IT8047595A0 (cg-RX-API-DMAC7.html) |
| LU (1) | LU82086A1 (cg-RX-API-DMAC7.html) |
| NL (1) | NL8000233A (cg-RX-API-DMAC7.html) |
| SE (1) | SE441895B (cg-RX-API-DMAC7.html) |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU2144083A (en) * | 1982-04-29 | 1984-05-24 | Marshall Rushton Blight | Boomerang |
| US4560358A (en) * | 1984-05-10 | 1985-12-24 | Adler Alan John | Gliding ring |
| JPS6239762U (cg-RX-API-DMAC7.html) * | 1985-08-28 | 1987-03-10 | ||
| US4669996A (en) * | 1985-10-07 | 1987-06-02 | Bershak William P | Recreational flying ring having primary and secondary airfoils |
| GB2193649A (en) * | 1986-08-09 | 1988-02-17 | Littler Gordon Brian Russell | Game apparatus |
| US4854907A (en) * | 1988-01-27 | 1989-08-08 | Holmes Stephen E | "ESU" flying ring |
| US4850923A (en) * | 1988-05-06 | 1989-07-25 | Etheridge Ronald D | Flying toy |
| USD314549S (en) | 1988-07-28 | 1991-02-12 | Myers David A | Aircraft wing |
| US5816880A (en) * | 1992-01-21 | 1998-10-06 | Forti; William M. | Gyroscopic flying device |
| DE4203286C2 (de) * | 1992-02-03 | 1993-10-21 | Hektor Steinhilber | Flugauto |
| US5358440A (en) * | 1994-01-06 | 1994-10-25 | Yu Zheng | Collapsible flying disc |
| US5531624A (en) * | 1994-02-14 | 1996-07-02 | Innova Champion Discs, Inc. | Flying disc |
| USD369191S (en) | 1994-02-16 | 1996-04-23 | Innova Champion Discs, Inc. | Flying disc |
| US5562512A (en) * | 1994-05-27 | 1996-10-08 | Samelian; John K. | Rescue device |
| US6179737B1 (en) * | 1995-01-09 | 2001-01-30 | Alan J. Adler | Flying disc |
| USD402318S (en) | 1996-02-28 | 1998-12-08 | Innova Champion Discs, Inc. | Flying disc |
| USD388134S (en) * | 1996-02-28 | 1997-12-23 | Innova Champion Discs, Inc. | Flying disc |
| USD386223S (en) * | 1996-07-23 | 1997-11-11 | Mattel, Inc. | High performance flying disc |
| USD401288S (en) | 1997-03-20 | 1998-11-17 | Champion Discs, Inc. | Flying disc |
| USD401289S (en) | 1997-03-20 | 1998-11-17 | Champion Discs, Inc. | Flying disc |
| US6247989B1 (en) | 1999-04-26 | 2001-06-19 | Richard D. Neff | Secondary lift flying ring |
| US6386997B1 (en) * | 2000-05-06 | 2002-05-14 | Kenneth M. Brown | Ultimate ring toss game |
| US7581500B2 (en) * | 2004-01-30 | 2009-09-01 | Flatau & Vanek, Llc | Payload delivering ring airfoil projectile |
| GB0402910D0 (en) * | 2004-02-11 | 2004-03-17 | Potts Jonathan | Flying disc |
| US20060163424A1 (en) * | 2004-09-16 | 2006-07-27 | Stumphauzer William C Ii | AeroStreamer Flight Kit |
| US20080026665A1 (en) * | 2006-06-01 | 2008-01-31 | William Mark Corporation | Free Flying Spinning Hoop Toy |
| US20100304635A1 (en) * | 2009-01-06 | 2010-12-02 | Bershak William P | Material improvements including the addition of a third airfoil to recreational flying ring having primary and secondary airfoils |
| USD640329S1 (en) | 2010-08-24 | 2011-06-21 | Canine Hardware Inc. | Flying disc |
| US8353792B2 (en) * | 2010-10-15 | 2013-01-15 | Joe Arroyo | Teardrop ring tossing game |
| US10486835B2 (en) * | 2013-03-12 | 2019-11-26 | William R. Crowe | Centrifugal force amplification method and system for generating vehicle lift |
| US9709069B2 (en) | 2013-10-22 | 2017-07-18 | Dayspring Church Of God Apostolic | Hybrid drive engine |
| US10118696B1 (en) | 2016-03-31 | 2018-11-06 | Steven M. Hoffberg | Steerable rotating projectile |
| US11712637B1 (en) | 2018-03-23 | 2023-08-01 | Steven M. Hoffberg | Steerable disk or ball |
| USD1006892S1 (en) * | 2023-06-20 | 2023-12-05 | David Laemle | Flying disc |
| US12311284B1 (en) * | 2024-05-08 | 2025-05-27 | Myron Bouchakian | Bi-elliptical flying toy with anhedral bent rings |
Family Cites Families (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US708519A (en) * | 1898-10-17 | 1902-09-09 | Charles T Bradshaw | Quoit. |
| US1508604A (en) * | 1917-12-04 | 1924-09-16 | Leathers Ward | Aeroplane |
| US1556560A (en) * | 1925-06-06 | 1925-10-06 | Thomas R Macmechen | Tandem multiplane |
| US1683643A (en) * | 1927-09-13 | 1928-09-11 | Harold S Wittmaak | Playing piece |
| US1991689A (en) * | 1932-06-22 | 1935-02-19 | Arley D Mcclintock | Method of making quoits |
| US1986937A (en) * | 1932-09-10 | 1935-01-08 | Bonney Forge And Tool Works | Quoit |
| US2126245A (en) * | 1937-07-29 | 1938-08-09 | Walter A Darby | Disk scaling game |
| US2324022A (en) * | 1940-10-09 | 1943-07-13 | Jr Robert H Prause | Aerial device |
| US2640699A (en) * | 1947-08-28 | 1953-06-02 | Paul W Garbo | Disklike plaything |
| US3029077A (en) * | 1961-05-25 | 1962-04-10 | Transogram Company Inc | Readily assemblable, multiple piece toy targets |
| US3082572A (en) * | 1961-10-05 | 1963-03-26 | Knox Instr Inc | Aerial toy |
| US3312472A (en) * | 1963-07-05 | 1967-04-04 | Robert A Kerr | Throwing disc employing raised aerodynamic sections |
| US3220142A (en) * | 1964-09-04 | 1965-11-30 | Butterfield Floyd | Aerial toy |
| US3565434A (en) * | 1965-10-18 | 1971-02-23 | James F Liston | Boomerang with adjustable-pitch blades |
| US3359678A (en) * | 1965-11-01 | 1967-12-26 | Wham O Mfg Company | Flying saucer |
| US3566532A (en) * | 1967-11-08 | 1971-03-02 | Wilson Henry A | Flying saucer type toy |
| US3545760A (en) * | 1968-01-30 | 1970-12-08 | Wilson Henry A | Combined cap and aerial projector |
| US3838835A (en) * | 1969-02-25 | 1974-10-01 | A Kling | Precessor flying craft |
| US3594945A (en) * | 1969-04-14 | 1971-07-27 | Howard R Turney | Flying toy |
| US3580580A (en) * | 1969-09-24 | 1971-05-25 | John D Wark | Aerial spinning disc |
| US3673732A (en) * | 1970-10-15 | 1972-07-04 | Liotta Alfonso L | Aerial toy |
| US3765122A (en) * | 1970-10-29 | 1973-10-16 | R English | Flying toy |
| US3724122A (en) * | 1971-03-16 | 1973-04-03 | Wham O Mfg Co | Flying saucer |
| US3673731A (en) * | 1971-06-21 | 1972-07-04 | Raphael Farhi | Reversible aerodynamic disc and gyroscopic toy |
| US3742643A (en) * | 1972-05-05 | 1973-07-03 | C Keith | Flying device |
| US3828466A (en) * | 1972-06-22 | 1974-08-13 | E Geiger | Flying saucer |
| US4023805A (en) * | 1974-05-01 | 1977-05-17 | Harry Sherrill | Tricky disk |
| US3939602A (en) * | 1975-05-27 | 1976-02-24 | Marvin Glass & Associates | Circular air glider |
| FR2349495A1 (fr) * | 1976-04-29 | 1977-11-25 | Baudchon Christian | Aile circulaire |
| DE2725383A1 (de) * | 1976-06-07 | 1977-12-15 | Reginald Clucas | Verfahren und vorrichtung zur erzeugung von auftrieb bei land-, see- und luftfahrzeugen |
| US4104822B2 (en) * | 1976-12-03 | 1989-06-27 | Rotating circular airfoil | |
| US4114885A (en) * | 1976-12-10 | 1978-09-19 | Morrow Larry N | Throwing disc |
-
1979
- 1979-01-16 US US06/003,992 patent/US4456265A/en not_active Expired - Lifetime
-
1980
- 1980-01-08 CA CA000343215A patent/CA1151694A/en not_active Expired
- 1980-01-10 DE DE19803000758 patent/DE3000758A1/de active Granted
- 1980-01-10 AU AU54519/80A patent/AU5451980A/en not_active Abandoned
- 1980-01-14 JP JP346080A patent/JPS5599498A/ja active Pending
- 1980-01-14 IT IT8047595A patent/IT8047595A0/it unknown
- 1980-01-14 ES ES1980255192U patent/ES255192Y/es not_active Expired
- 1980-01-15 NL NL8000233A patent/NL8000233A/nl unknown
- 1980-01-15 FR FR8000829A patent/FR2446661A1/fr not_active Withdrawn
- 1980-01-15 BR BR8000246A patent/BR8000246A/pt unknown
- 1980-01-15 LU LU82086A patent/LU82086A1/fr unknown
- 1980-01-16 FI FI800127A patent/FI800127A7/fi not_active Application Discontinuation
- 1980-01-16 BE BE0/198992A patent/BE881184A/nl unknown
- 1980-01-16 DK DK18080A patent/DK18080A/da unknown
- 1980-01-16 GB GB8001519A patent/GB2039760B/en not_active Expired
- 1980-01-16 SE SE8000355A patent/SE441895B/sv not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE3000758C2 (cg-RX-API-DMAC7.html) | 1988-09-01 |
| JPS5599498A (en) | 1980-07-29 |
| LU82086A1 (fr) | 1980-06-06 |
| BE881184A (nl) | 1980-05-16 |
| SE8000355L (sv) | 1980-07-17 |
| ES255192U (es) | 1981-05-01 |
| FI800127A7 (fi) | 1981-01-01 |
| SE441895B (sv) | 1985-11-18 |
| US4456265A (en) | 1984-06-26 |
| BR8000246A (pt) | 1980-09-30 |
| ES255192Y (es) | 1981-11-16 |
| FR2446661A1 (fr) | 1980-08-14 |
| IT8047595A0 (it) | 1980-01-14 |
| DK18080A (da) | 1980-07-17 |
| NL8000233A (nl) | 1980-07-18 |
| GB2039760A (en) | 1980-08-20 |
| GB2039760B (en) | 1983-08-17 |
| AU5451980A (en) | 1980-07-24 |
| DE3000758A1 (de) | 1980-07-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1151694A (en) | Gliding ring | |
| US4560358A (en) | Gliding ring | |
| US4906007A (en) | Hand-throwable flying toy | |
| US4132029A (en) | Pyramid flyer | |
| US8454405B2 (en) | Flying toy having gyroscopic and gliding components | |
| US5030157A (en) | Flying toy having fluid displaceable blades | |
| US3724122A (en) | Flying saucer | |
| US5269716A (en) | Flying toy with radial airfoils | |
| US4463954A (en) | Aquatic device | |
| EP0698406B1 (en) | flying toy | |
| EP0107682A1 (en) | A boomerang | |
| US7294036B2 (en) | Flying disc | |
| US5213539A (en) | Returning flying ring toy | |
| US9370726B2 (en) | Air cone flyer | |
| US4051622A (en) | Free flying aerodynamic toy with high stability | |
| AU641926B2 (en) | Returning flying ring toy and improved airfoil | |
| AU2003100939A4 (en) | Boomerang | |
| GB2410905A (en) | Flying disc with convexly curved rim. | |
| CA1293007C (en) | Flying device | |
| KR200327694Y1 (ko) | 양방향 투척이 가능한 부메랑 | |
| JP2005130902A (ja) | ブーメラン | |
| CA2130648A1 (en) | Flying toy |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |