CA1150256A - Antihypertensive agents - Google Patents
Antihypertensive agentsInfo
- Publication number
- CA1150256A CA1150256A CA000393428A CA393428A CA1150256A CA 1150256 A CA1150256 A CA 1150256A CA 000393428 A CA000393428 A CA 000393428A CA 393428 A CA393428 A CA 393428A CA 1150256 A CA1150256 A CA 1150256A
- Authority
- CA
- Canada
- Prior art keywords
- oxo
- hexahydro
- naphthyridine
- carboxylic acid
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002220 antihypertensive agent Substances 0.000 title abstract description 8
- 229940030600 antihypertensive agent Drugs 0.000 title abstract description 7
- 150000003839 salts Chemical class 0.000 claims abstract description 62
- 150000001875 compounds Chemical class 0.000 claims description 79
- 238000000034 method Methods 0.000 claims description 59
- 125000004432 carbon atom Chemical group C* 0.000 claims description 39
- XKORCTIIRYKLLG-ARJAWSKDSA-N methyl (z)-3-aminobut-2-enoate Chemical compound COC(=O)\C=C(\C)N XKORCTIIRYKLLG-ARJAWSKDSA-N 0.000 claims description 36
- 125000000217 alkyl group Chemical group 0.000 claims description 30
- 239000000047 product Substances 0.000 claims description 28
- 229910052739 hydrogen Inorganic materials 0.000 claims description 21
- 239000001257 hydrogen Substances 0.000 claims description 21
- YZNHGFBTNUJVQD-UHFFFAOYSA-N 1-benzyl-5-hydroxy-2,6-dihydropyridin-3-one Chemical compound C1C(O)=CC(=O)CN1CC1=CC=CC=C1 YZNHGFBTNUJVQD-UHFFFAOYSA-N 0.000 claims description 18
- -1 4-(2-chlorophenyl)-1,4,5,6,7,8-hexa-hydro-2,7-dimethyl-5-oxo-1,7-naphthyridine-3-carboxylic acid Chemical compound 0.000 claims description 14
- QXJDJDJVOLAJBA-UHFFFAOYSA-N 5-hydroxy-1-methyl-2,6-dihydropyridin-3-one Chemical compound CN1CC(O)=CC(=O)C1 QXJDJDJVOLAJBA-UHFFFAOYSA-N 0.000 claims description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 9
- AXGAABGTCKIJKA-UHFFFAOYSA-N methyl 7-benzyl-2-methyl-4-(2-methylphenyl)-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(CC=2C=CC=CC=2)CC2=O)=C2C1C1=CC=CC=C1C AXGAABGTCKIJKA-UHFFFAOYSA-N 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- ZDVRPKUWYQVVDX-UHFFFAOYSA-N 2-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC=C1C=O ZDVRPKUWYQVVDX-UHFFFAOYSA-N 0.000 claims description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 229910021529 ammonia Inorganic materials 0.000 claims description 5
- QJXCFMJTJYCLFG-UHFFFAOYSA-N 2,3,4,5,6-pentafluorobenzaldehyde Chemical compound FC1=C(F)C(F)=C(C=O)C(F)=C1F QJXCFMJTJYCLFG-UHFFFAOYSA-N 0.000 claims description 4
- UIFVCPMLQXKEEU-UHFFFAOYSA-N 2,3-dimethylbenzaldehyde Chemical compound CC1=CC=CC(C=O)=C1C UIFVCPMLQXKEEU-UHFFFAOYSA-N 0.000 claims description 4
- ZETIVVHRRQLWFW-UHFFFAOYSA-N 3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(C=O)=C1 ZETIVVHRRQLWFW-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 150000001299 aldehydes Chemical class 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- BTFQKIATRPGRBS-UHFFFAOYSA-N o-tolualdehyde Chemical compound CC1=CC=CC=C1C=O BTFQKIATRPGRBS-UHFFFAOYSA-N 0.000 claims description 4
- UKVYVZLTGQVOPX-IHWYPQMZSA-N (z)-3-aminobut-2-enoic acid Chemical compound C\C(N)=C\C(O)=O UKVYVZLTGQVOPX-IHWYPQMZSA-N 0.000 claims description 3
- KKJPYQYRYUUTFS-UHFFFAOYSA-N 5-hydroxy-2,6-dihydro-1h-pyridin-3-one Chemical class OC1=CC(=O)CNC1 KKJPYQYRYUUTFS-UHFFFAOYSA-N 0.000 claims description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 3
- 125000002632 imidazolidinyl group Chemical group 0.000 claims description 3
- MYLGDSJZZLZLEQ-UHFFFAOYSA-N methyl 2,7-dimethyl-4-(2-methylphenyl)-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(C)CC2=O)=C2C1C1=CC=CC=C1C MYLGDSJZZLZLEQ-UHFFFAOYSA-N 0.000 claims description 3
- CLHIMMJDSBJKKC-UHFFFAOYSA-N methyl 2,7-dimethyl-4-(3-nitrophenyl)-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(C)CC2=O)=C2C1C1=CC=CC([N+]([O-])=O)=C1 CLHIMMJDSBJKKC-UHFFFAOYSA-N 0.000 claims description 3
- VOMXICAAMJHQFU-UHFFFAOYSA-N methyl 2-methyl-4-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1h-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CNCC2=O)=C2C1C1=CC=CC=C1C VOMXICAAMJHQFU-UHFFFAOYSA-N 0.000 claims description 3
- BRRNHKCKQRDRGL-UHFFFAOYSA-N methyl 4-(2,6-dichlorophenyl)-2,7-dimethyl-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(C)CC2=O)=C2C1C1=C(Cl)C=CC=C1Cl BRRNHKCKQRDRGL-UHFFFAOYSA-N 0.000 claims description 3
- ORCGNIDKCTUSQH-UHFFFAOYSA-N methyl 4-(3-cyanophenyl)-2,7-dimethyl-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(C)CC2=O)=C2C1C1=CC=CC(C#N)=C1 ORCGNIDKCTUSQH-UHFFFAOYSA-N 0.000 claims description 3
- HZCPZPVBOOTEAT-UHFFFAOYSA-N methyl 7-benzyl-2-methyl-4-(3-nitrophenyl)-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(CC=2C=CC=CC=2)CC2=O)=C2C1C1=CC=CC([N+]([O-])=O)=C1 HZCPZPVBOOTEAT-UHFFFAOYSA-N 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 125000005936 piperidyl group Chemical group 0.000 claims description 3
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 3
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims description 3
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims description 3
- SMUVABOERCFKRW-UHFFFAOYSA-N 2,5-Dimethylbenzaldehyde Chemical compound CC1=CC=C(C)C(C=O)=C1 SMUVABOERCFKRW-UHFFFAOYSA-N 0.000 claims description 2
- DMIYKWPEFRFTPY-UHFFFAOYSA-N 2,6-dichlorobenzaldehyde Chemical compound ClC1=CC=CC(Cl)=C1C=O DMIYKWPEFRFTPY-UHFFFAOYSA-N 0.000 claims description 2
- HPHPTGDPZSEYMB-UHFFFAOYSA-N 2-[benzyl(methyl)amino]ethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCCN(C)CC1=CC=CC=C1 HPHPTGDPZSEYMB-UHFFFAOYSA-N 0.000 claims description 2
- IIBAAYFFTSJSFH-UHFFFAOYSA-N 2-butylbenzaldehyde Chemical compound CCCCC1=CC=CC=C1C=O IIBAAYFFTSJSFH-UHFFFAOYSA-N 0.000 claims description 2
- FPYUJUBAXZAQNL-UHFFFAOYSA-N 2-chlorobenzaldehyde Chemical compound ClC1=CC=CC=C1C=O FPYUJUBAXZAQNL-UHFFFAOYSA-N 0.000 claims description 2
- CMWKITSNTDAEDT-UHFFFAOYSA-N 2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC=C1C=O CMWKITSNTDAEDT-UHFFFAOYSA-N 0.000 claims description 2
- NMTUHPSKJJYGML-UHFFFAOYSA-N 3-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC(C=O)=C1 NMTUHPSKJJYGML-UHFFFAOYSA-N 0.000 claims description 2
- HGZJJKZPPMFIBU-UHFFFAOYSA-N 3-formylbenzonitrile Chemical compound O=CC1=CC=CC(C#N)=C1 HGZJJKZPPMFIBU-UHFFFAOYSA-N 0.000 claims description 2
- ZUSWDTWYONAOPH-UHFFFAOYSA-N [2-(trifluoromethyl)phenyl]hydrazine;hydrochloride Chemical group [Cl-].[NH3+]NC1=CC=CC=C1C(F)(F)F ZUSWDTWYONAOPH-UHFFFAOYSA-N 0.000 claims description 2
- 238000005915 ammonolysis reaction Methods 0.000 claims description 2
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 238000011065 in-situ storage Methods 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- WEGHJOALNXZCCT-UHFFFAOYSA-N methyl 2,7-dimethyl-4-(2-nitrophenyl)-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(C)CC2=O)=C2C1C1=CC=CC=C1[N+]([O-])=O WEGHJOALNXZCCT-UHFFFAOYSA-N 0.000 claims description 2
- SYPLQYLHBKUIMV-UHFFFAOYSA-N methyl 4-(2,3-dimethylphenyl)-2,7-dimethyl-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(C)CC2=O)=C2C1C1=CC=CC(C)=C1C SYPLQYLHBKUIMV-UHFFFAOYSA-N 0.000 claims description 2
- OCNYDYCUUZYBEG-UHFFFAOYSA-N methyl 4-(2-chlorophenyl)-2,7-dimethyl-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(C)CC2=O)=C2C1C1=CC=CC=C1Cl OCNYDYCUUZYBEG-UHFFFAOYSA-N 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 28
- 238000007327 hydrogenolysis reaction Methods 0.000 claims 8
- 230000003197 catalytic effect Effects 0.000 claims 7
- 125000005843 halogen group Chemical group 0.000 claims 4
- NLJJOTULXBWIPK-UHFFFAOYSA-N methyl 7-benzyl-2-methyl-5-oxo-4-[2-(trifluoromethyl)phenyl]-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(CC=2C=CC=CC=2)CC2=O)=C2C1C1=CC=CC=C1C(F)(F)F NLJJOTULXBWIPK-UHFFFAOYSA-N 0.000 claims 3
- OEKFHLSEIBERKC-UHFFFAOYSA-N 2-[benzyl(methyl)amino]ethyl 7-benzyl-2-methyl-5-oxo-4-[2-(trifluoromethyl)phenyl]-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound C=1C=CC=CC=1CN(C)CCOC(=O)C1=C(C)NC(CN(CC=2C=CC=CC=2)CC2=O)=C2C1C1=CC=CC=C1C(F)(F)F OEKFHLSEIBERKC-UHFFFAOYSA-N 0.000 claims 2
- CMWIXLZAEUFSJH-UHFFFAOYSA-N methyl 2,7-dimethyl-5-oxo-4-(2,3,4,5,6-pentafluorophenyl)-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(C)CC2=O)=C2C1C1=C(F)C(F)=C(F)C(F)=C1F CMWIXLZAEUFSJH-UHFFFAOYSA-N 0.000 claims 2
- ONHJMIVIBXCUJO-UHFFFAOYSA-N methyl 2-methyl-5-oxo-4-(2,3,4,5,6-pentafluorophenyl)-4,6,7,8-tetrahydro-1h-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CNCC2=O)=C2C1C1=C(F)C(F)=C(F)C(F)=C1F ONHJMIVIBXCUJO-UHFFFAOYSA-N 0.000 claims 2
- PBZUVIIVPDCLIJ-UHFFFAOYSA-N methyl 2-methyl-5-oxo-4-[2-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-1h-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CNCC2=O)=C2C1C1=CC=CC=C1C(F)(F)F PBZUVIIVPDCLIJ-UHFFFAOYSA-N 0.000 claims 2
- SSKMJHYRFZGRLL-UHFFFAOYSA-N methyl 2-methyl-5-oxo-4-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydro-1h-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CNCC2=O)=C2C1C1=CC=CC(C(F)(F)F)=C1 SSKMJHYRFZGRLL-UHFFFAOYSA-N 0.000 claims 2
- BBZHESFISXGBBY-UHFFFAOYSA-N methyl 4-(2,3-dimethylphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1h-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CNCC2=O)=C2C1C1=CC=CC(C)=C1C BBZHESFISXGBBY-UHFFFAOYSA-N 0.000 claims 2
- XFYMRMNCEJYPFG-UHFFFAOYSA-N methyl 4-(2,5-dimethylphenyl)-2,7-dimethyl-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(C)CC2=O)=C2C1C1=CC(C)=CC=C1C XFYMRMNCEJYPFG-UHFFFAOYSA-N 0.000 claims 2
- PFWLLCCYFZEOJA-UHFFFAOYSA-N methyl 4-(2-butylphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1h-1,7-naphthyridine-3-carboxylate Chemical compound CCCCC1=CC=CC=C1C1C(C(=O)CNC2)=C2NC(C)=C1C(=O)OC PFWLLCCYFZEOJA-UHFFFAOYSA-N 0.000 claims 2
- NWMPUTYYQHGSLL-UHFFFAOYSA-N methyl 7-benzyl-2-methyl-5-oxo-4-(2,3,4,5,6-pentafluorophenyl)-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(CC=2C=CC=CC=2)CC2=O)=C2C1C1=C(F)C(F)=C(F)C(F)=C1F NWMPUTYYQHGSLL-UHFFFAOYSA-N 0.000 claims 2
- DAACOPSRVMLHRA-UHFFFAOYSA-N methyl 7-benzyl-4-(2,3-dimethylphenyl)-2-methyl-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(CC=2C=CC=CC=2)CC2=O)=C2C1C1=CC=CC(C)=C1C DAACOPSRVMLHRA-UHFFFAOYSA-N 0.000 claims 2
- AEEDDXKSSAMDER-UHFFFAOYSA-N methyl 7-benzyl-4-(2-butylphenyl)-2-methyl-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound CCCCC1=CC=CC=C1C1C(C(=O)CN(CC=2C=CC=CC=2)C2)=C2NC(C)=C1C(=O)OC AEEDDXKSSAMDER-UHFFFAOYSA-N 0.000 claims 2
- 125000000538 pentafluorophenyl group Chemical group FC1=C(F)C(F)=C(*)C(F)=C1F 0.000 claims 2
- 125000004193 piperazinyl group Chemical group 0.000 claims 2
- AWTRKFMTCVZCHF-UHFFFAOYSA-N 5-hydroxy-1-methylpiperidin-3-one Chemical compound CN1CC(CC(C1)O)=O AWTRKFMTCVZCHF-UHFFFAOYSA-N 0.000 claims 1
- 125000001589 carboacyl group Chemical group 0.000 claims 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims 1
- 235000019439 ethyl acetate Nutrition 0.000 claims 1
- BPCAFKVTTIITTA-UHFFFAOYSA-N methyl 2,7-dimethyl-5-oxo-4-[2-(trifluoromethyl)phenyl]-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CN(C)CC2=O)=C2C1C1=CC=CC=C1C(F)(F)F BPCAFKVTTIITTA-UHFFFAOYSA-N 0.000 claims 1
- BWEMKBOOYJQYJN-UHFFFAOYSA-N methyl 2-methyl-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1h-1,7-naphthyridine-3-carboxylate Chemical compound COC(=O)C1=C(C)NC(CNCC2=O)=C2C1C1=CC=CC([N+]([O-])=O)=C1 BWEMKBOOYJQYJN-UHFFFAOYSA-N 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 159
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 60
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 59
- 229960004756 ethanol Drugs 0.000 description 53
- 235000019441 ethanol Nutrition 0.000 description 53
- 239000007787 solid Substances 0.000 description 43
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 30
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 30
- 239000000203 mixture Substances 0.000 description 29
- 239000000243 solution Substances 0.000 description 20
- 238000001914 filtration Methods 0.000 description 18
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 16
- 238000001953 recrystallisation Methods 0.000 description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- 229920006395 saturated elastomer Polymers 0.000 description 13
- 239000000706 filtrate Substances 0.000 description 12
- 229940127291 Calcium channel antagonist Drugs 0.000 description 8
- 239000005557 antagonist Substances 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 7
- 239000011575 calcium Substances 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 210000001519 tissue Anatomy 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 230000036772 blood pressure Effects 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 5
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 5
- 229910052791 calcium Inorganic materials 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 108090000312 Calcium Channels Proteins 0.000 description 4
- 102000003922 Calcium Channels Human genes 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 150000002431 hydrogen Chemical group 0.000 description 4
- 238000001727 in vivo Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 206010020772 Hypertension Diseases 0.000 description 3
- 241000283973 Oryctolagus cuniculus Species 0.000 description 3
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 3
- ZTHYODDOHIVTJV-UHFFFAOYSA-N Propyl gallate Chemical compound CCCOC(=O)C1=CC(O)=C(O)C(O)=C1 ZTHYODDOHIVTJV-UHFFFAOYSA-N 0.000 description 3
- 230000000903 blocking effect Effects 0.000 description 3
- 239000000480 calcium channel blocker Substances 0.000 description 3
- 230000000994 depressogenic effect Effects 0.000 description 3
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- 229940073584 methylene chloride Drugs 0.000 description 3
- 210000000056 organ Anatomy 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- SFLSHLFXELFNJZ-QMMMGPOBSA-N (-)-norepinephrine Chemical compound NC[C@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-QMMMGPOBSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 206010002383 Angina Pectoris Diseases 0.000 description 2
- 108091006146 Channels Proteins 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 208000021642 Muscular disease Diseases 0.000 description 2
- 201000009623 Myopathy Diseases 0.000 description 2
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical class [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 235000011054 acetic acid Nutrition 0.000 description 2
- 239000000048 adrenergic agonist Substances 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 230000008485 antagonism Effects 0.000 description 2
- 230000003276 anti-hypertensive effect Effects 0.000 description 2
- 206010003119 arrhythmia Diseases 0.000 description 2
- 230000009460 calcium influx Effects 0.000 description 2
- 230000000747 cardiac effect Effects 0.000 description 2
- 210000000170 cell membrane Anatomy 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000008602 contraction Effects 0.000 description 2
- 201000011634 coronary artery vasospasm Diseases 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 2
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 2
- 125000001475 halogen functional group Chemical group 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000007912 intraperitoneal administration Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229960002748 norepinephrine Drugs 0.000 description 2
- SFLSHLFXELFNJZ-UHFFFAOYSA-N norepinephrine Natural products NCC(O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-UHFFFAOYSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000002831 pharmacologic agent Substances 0.000 description 2
- KIBFBTVPDRASNT-UHFFFAOYSA-N piperidine-3,5-dione Chemical compound O=C1CNCC(=O)C1 KIBFBTVPDRASNT-UHFFFAOYSA-N 0.000 description 2
- 229910001414 potassium ion Inorganic materials 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000011699 spontaneously hypertensive rat Methods 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- PAWSVPVNIXFKOS-IHWYPQMZSA-N (Z)-2-aminobutenoic acid Chemical class C\C=C(/N)C(O)=O PAWSVPVNIXFKOS-IHWYPQMZSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical compound FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 208000001953 Hypotension Diseases 0.000 description 1
- 108010049175 N-substituted Glycines Proteins 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- FKNQFGJONOIPTF-UHFFFAOYSA-N Sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 description 1
- 206010049418 Sudden Cardiac Death Diseases 0.000 description 1
- 241000906446 Theraps Species 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- RLKBOGLIOLFMEK-NSCUHMNNSA-N amino (e)-but-2-enoate Chemical compound C\C=C\C(=O)ON RLKBOGLIOLFMEK-NSCUHMNNSA-N 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 210000000709 aorta Anatomy 0.000 description 1
- 239000008135 aqueous vehicle Substances 0.000 description 1
- 230000006399 behavior Effects 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 150000001669 calcium Chemical class 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000000332 continued effect Effects 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- PYRZPBDTPRQYKG-UHFFFAOYSA-N cyclopentene-1-carboxylic acid Chemical compound OC(=O)C1=CCCC1 PYRZPBDTPRQYKG-UHFFFAOYSA-N 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000002999 depolarising effect Effects 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000004064 dysfunction Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 150000002332 glycine derivatives Chemical class 0.000 description 1
- 208000021822 hypotensive Diseases 0.000 description 1
- 230000001077 hypotensive effect Effects 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229960003390 magnesium sulfate Drugs 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229940057952 methanol Drugs 0.000 description 1
- HTJJZVPGRQYIRP-UHFFFAOYSA-N methyl 7-benzyl-2-methyl-5-oxo-4-[3-(trifluoromethyl)phenyl]-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate;hydrochloride Chemical compound Cl.COC(=O)C1=C(C)NC(CN(CC=2C=CC=CC=2)CC2=O)=C2C1C1=CC=CC(C(F)(F)F)=C1 HTJJZVPGRQYIRP-UHFFFAOYSA-N 0.000 description 1
- ATNVEECLRQSAAB-UHFFFAOYSA-N methyl 7-benzyl-4-(2-butylphenyl)-2-methyl-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate;hydrochloride Chemical compound Cl.CCCCC1=CC=CC=C1C1C(C(=O)CN(CC=2C=CC=CC=2)C2)=C2NC(C)=C1C(=O)OC ATNVEECLRQSAAB-UHFFFAOYSA-N 0.000 description 1
- HGWGJCYSCWPHAU-UHFFFAOYSA-N methyl 7-benzyl-4-(2-fluorophenyl)-2-methyl-5-oxo-1,4,6,8-tetrahydro-1,7-naphthyridine-3-carboxylate;hydrochloride Chemical compound Cl.COC(=O)C1=C(C)NC(CN(CC=2C=CC=CC=2)CC2=O)=C2C1C1=CC=CC=C1F HGWGJCYSCWPHAU-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 210000002464 muscle smooth vascular Anatomy 0.000 description 1
- 230000002107 myocardial effect Effects 0.000 description 1
- YZMHQCWXYHARLS-UHFFFAOYSA-N naphthalene-1,2-disulfonic acid Chemical compound C1=CC=CC2=C(S(O)(=O)=O)C(S(=O)(=O)O)=CC=C21 YZMHQCWXYHARLS-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 230000004648 relaxation of smooth muscle Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 230000003381 solubilizing effect Effects 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 230000035488 systolic blood pressure Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US238,911 | 1981-02-27 | ||
| US06/238,911 US4321384A (en) | 1981-02-27 | 1981-02-27 | Antihypertensive agents |
| US06/297,645 US4365063A (en) | 1981-08-31 | 1981-08-31 | Antihypertensive agents |
| US297,645 | 1981-08-31 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1150256A true CA1150256A (en) | 1983-07-19 |
Family
ID=26932072
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000393428A Expired CA1150256A (en) | 1981-02-27 | 1981-12-30 | Antihypertensive agents |
Country Status (7)
| Country | Link |
|---|---|
| EP (1) | EP0059291B1 (OSRAM) |
| CA (1) | CA1150256A (OSRAM) |
| DE (1) | DE3169626D1 (OSRAM) |
| DK (1) | DK87382A (OSRAM) |
| GB (1) | GB2093834B (OSRAM) |
| GR (1) | GR74727B (OSRAM) |
| IE (1) | IE52010B1 (OSRAM) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3327650A1 (de) * | 1983-07-30 | 1985-02-14 | Gödecke AG, 1000 Berlin | 1,6-naphthyridinon-derivate, verfahren zu deren herstellung und deren verwendung bei der bekaempfung von gefaesserkrankungen |
| DE3431303A1 (de) * | 1984-08-25 | 1986-02-27 | Goedecke Ag | 1,6-naphthyridin-derivate, verfahren zu deren herstellung und deren verwendung |
| US4606864A (en) * | 1985-02-01 | 1986-08-19 | Eastman Kodak Company | Thiophenyl thioacrylate and thiomethacrylate monomers |
| US4710557A (en) * | 1985-02-01 | 1987-12-01 | Eastman Kodak Company | Polymers of thiophenyl thioacrylate and thiomethacrylate monomers |
| US6642222B2 (en) | 1998-10-28 | 2003-11-04 | Abbott Laboratories | Pyrano, piperidino, and thiopyrano compounds and methods of use |
| US6191140B1 (en) * | 1998-10-28 | 2001-02-20 | Abbott Laboratories | Pyrano, piperidino, and thiopyrano compounds and methods of use |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1022214A (en) * | 1963-01-31 | 1966-03-09 | Sterling Drug Inc | Novel 1,3-disubstituted-1,4-dihydro-4-oxo-1,7-naphthyridines and their preparation |
| SE7804318L (sv) * | 1977-05-02 | 1978-11-03 | Merck & Co Inc | Nya naftyridiner |
-
1981
- 1981-12-24 GB GB8138903A patent/GB2093834B/en not_active Expired
- 1981-12-24 DE DE8181306136T patent/DE3169626D1/de not_active Expired
- 1981-12-24 EP EP19810306136 patent/EP0059291B1/en not_active Expired
- 1981-12-30 CA CA000393428A patent/CA1150256A/en not_active Expired
- 1981-12-31 IE IE310081A patent/IE52010B1/en unknown
-
1982
- 1982-01-20 GR GR76063A patent/GR74727B/el unknown
- 1982-02-26 DK DK87382A patent/DK87382A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| GB2093834B (en) | 1984-08-15 |
| EP0059291A1 (en) | 1982-09-08 |
| IE52010B1 (en) | 1987-05-13 |
| IE813100L (en) | 1981-08-27 |
| DE3169626D1 (en) | 1985-05-02 |
| DK87382A (da) | 1982-08-28 |
| GR74727B (OSRAM) | 1984-07-10 |
| EP0059291B1 (en) | 1985-03-27 |
| GB2093834A (en) | 1982-09-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Marciniak et al. | New 1, 4-dihydropyridine derivatives combining calcium antagonism and. alpha.-adrenolytic properties | |
| WO2001085690A1 (en) | 4-alkyl and 4-cycloalkyl derivatives of dihydropyridine npy antagonists | |
| NO162818B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive 1,4-dihyropyridiner. | |
| CA1320204C (en) | Pharmaceutically useful dihydropyridinyldicarboxylate amides and esters | |
| SU1644718A3 (ru) | Способ получени производных пиразоло[3,4- @ ]хинолина или пиридо [2,3- @ ]хиназолина или их солей | |
| IE832058L (en) | 1,4-dihydropyridine derivatives | |
| EP0255710A2 (en) | 1,4-Dihydropyridine derivatives with calcium agonist and alpha-1-antagonist activity | |
| GB1566307A (en) | Indole derivatives of amides and amino esters and process for their manufacture | |
| PL140573B1 (en) | Method of obtaining new dihydropyridine derivatives | |
| CA1150256A (en) | Antihypertensive agents | |
| US4321384A (en) | Antihypertensive agents | |
| US4551534A (en) | Aralkyl or aryloxyalkyl 1,7-naphthyridine-3-carboxylic acid esters | |
| KR890002227B1 (ko) | 약리학적으로 활성인 신규의 피라졸로피리딘류의 제조 방법 | |
| US4446323A (en) | Tetra- and hexa-hydropyrrolo(1,2-a)quinoxaline and azaquinoxaline derivatives | |
| KR900004148B1 (ko) | 피롤로[1,2-a][4,1]벤즈옥사제핀 유도체 | |
| NZ204536A (en) | 1,4-dihydropyridine derivatives and pharmaceutical compositions | |
| US4365063A (en) | Antihypertensive agents | |
| US4505920A (en) | Certain N-substituted-4-aryl-3,5-pyridine dicarboxylates and their antihypertensive use | |
| EP0106276B1 (en) | 1,4-dihydropyridine derivatives | |
| CA1285945C (en) | N-¬¬¬1-(2)naphthylenemethyl or quinol-6-ylmethyl)-4- piperidinyl|amino|-carbonyl|-6-quinolinecarboxamide compounds | |
| US3970661A (en) | 2-Amino, 5-carbamoyl pyridine compounds | |
| US4596873A (en) | 1,4,5,6,7,8-Hexahydro-2-alkyl-4-aryl-5-oxo-1,7-naphthyridine-3-carboxylic acid aromatic esters and pharmaceutically acceptable acid addition salts thereof useful as antihypertensive agents | |
| US4760081A (en) | 1,6-naphthyridine derivatives useful for treating diseases of the blood vessels | |
| JPH03120271A (ja) | 抗虚血活性を有するフェニルアルキルアミン誘導体 | |
| US4546186A (en) | 1,4,5,6,7,8-Hexahydro-2-methyl-5-oxo-4-(2-thiazolyl)-3-quinoline carboxylic acid 2-methyl(phenylmethyl)amino ethyl ester and pharmaceutically acceptable salts |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |