CA1150090A - Use of zinc salts to increase dye stability in silver halide photographic elements - Google Patents
Use of zinc salts to increase dye stability in silver halide photographic elementsInfo
- Publication number
- CA1150090A CA1150090A CA000393966A CA393966A CA1150090A CA 1150090 A CA1150090 A CA 1150090A CA 000393966 A CA000393966 A CA 000393966A CA 393966 A CA393966 A CA 393966A CA 1150090 A CA1150090 A CA 1150090A
- Authority
- CA
- Canada
- Prior art keywords
- dye
- layer
- silver halide
- zinc salt
- halide emulsion
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 silver halide Chemical class 0.000 title claims abstract description 77
- 150000003751 zinc Chemical class 0.000 title claims abstract description 61
- 229910052709 silver Inorganic materials 0.000 title claims description 74
- 239000004332 silver Substances 0.000 title claims description 74
- 238000012545 processing Methods 0.000 claims abstract description 84
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims abstract description 57
- 239000000203 mixture Substances 0.000 claims abstract description 55
- 239000000463 material Substances 0.000 claims abstract description 48
- 239000011787 zinc oxide Substances 0.000 claims abstract description 29
- 238000000034 method Methods 0.000 claims abstract description 16
- 230000008569 process Effects 0.000 claims abstract description 7
- 239000000975 dye Substances 0.000 claims description 104
- 239000000839 emulsion Substances 0.000 claims description 69
- 239000003795 chemical substances by application Substances 0.000 claims description 13
- 238000011161 development Methods 0.000 claims description 13
- 230000018109 developmental process Effects 0.000 claims description 13
- 230000000694 effects Effects 0.000 claims description 10
- 230000003472 neutralizing effect Effects 0.000 claims description 9
- 230000006872 improvement Effects 0.000 claims description 8
- 239000000987 azo dye Substances 0.000 claims description 3
- 238000009826 distribution Methods 0.000 claims description 3
- 238000007599 discharging Methods 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical class [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 abstract description 5
- 238000009792 diffusion process Methods 0.000 abstract description 3
- 238000012546 transfer Methods 0.000 abstract description 3
- 239000010410 layer Substances 0.000 description 154
- 108010010803 Gelatin Proteins 0.000 description 28
- 229920000159 gelatin Polymers 0.000 description 28
- 239000008273 gelatin Substances 0.000 description 28
- 235000019322 gelatine Nutrition 0.000 description 28
- 235000011852 gelatine desserts Nutrition 0.000 description 28
- 150000001875 compounds Chemical class 0.000 description 14
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 13
- 239000002253 acid Substances 0.000 description 12
- 239000011248 coating agent Substances 0.000 description 12
- 238000000576 coating method Methods 0.000 description 12
- 229910052751 metal Inorganic materials 0.000 description 11
- 239000002184 metal Substances 0.000 description 11
- 239000002667 nucleating agent Substances 0.000 description 11
- 238000011160 research Methods 0.000 description 10
- 150000003839 salts Chemical class 0.000 description 10
- 239000004246 zinc acetate Substances 0.000 description 9
- 235000013904 zinc acetate Nutrition 0.000 description 9
- 229960000314 zinc acetate Drugs 0.000 description 9
- 238000012360 testing method Methods 0.000 description 8
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 7
- 230000008901 benefit Effects 0.000 description 7
- 239000011701 zinc Substances 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 6
- 230000006870 function Effects 0.000 description 6
- 239000011229 interlayer Substances 0.000 description 6
- 239000004816 latex Substances 0.000 description 6
- 229920000126 latex Polymers 0.000 description 6
- 239000005020 polyethylene terephthalate Substances 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- BTANRVKWQNVYAZ-SCSAIBSYSA-N (2R)-butan-2-ol Chemical compound CC[C@@H](C)O BTANRVKWQNVYAZ-SCSAIBSYSA-N 0.000 description 4
- FZUOMLXLXCAPOO-UHFFFAOYSA-N acetic acid;2-tert-butylbenzene-1,4-diol Chemical compound CC(O)=O.CC(C)(C)C1=CC(O)=CC=C1O FZUOMLXLXCAPOO-UHFFFAOYSA-N 0.000 description 4
- 150000002596 lactones Chemical class 0.000 description 4
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- 229910052725 zinc Inorganic materials 0.000 description 4
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 4
- 229960001763 zinc sulfate Drugs 0.000 description 4
- 229910000368 zinc sulfate Inorganic materials 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Inorganic materials [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910021645 metal ion Inorganic materials 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000006069 physical mixture Substances 0.000 description 3
- 229920000139 polyethylene terephthalate Polymers 0.000 description 3
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 3
- 230000003595 spectral effect Effects 0.000 description 3
- BWVQIBKUGHYXLO-UHFFFAOYSA-N 1-(3-methylphenyl)pyrazolidin-3-one Chemical compound CC1=CC=CC(N2NC(=O)CC2)=C1 BWVQIBKUGHYXLO-UHFFFAOYSA-N 0.000 description 2
- MRIBCCHYZOSDOM-UHFFFAOYSA-N 3-(1-phenyltetrazol-5-yl)sulfanylpropanenitrile Chemical compound N#CCCSC1=NN=NN1C1=CC=CC=C1 MRIBCCHYZOSDOM-UHFFFAOYSA-N 0.000 description 2
- LPYUENQFPVNPHY-UHFFFAOYSA-N 3-methoxycatechol Chemical compound COC1=CC=CC(O)=C1O LPYUENQFPVNPHY-UHFFFAOYSA-N 0.000 description 2
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 2
- LRUDIIUSNGCQKF-UHFFFAOYSA-N 5-methyl-1H-benzotriazole Chemical compound C1=C(C)C=CC2=NNN=C21 LRUDIIUSNGCQKF-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- CWNSVVHTTQBGQB-UHFFFAOYSA-N N,N-Diethyldodecanamide Chemical compound CCCCCCCCCCCC(=O)N(CC)CC CWNSVVHTTQBGQB-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 208000003629 Rupture Diseases 0.000 description 2
- 206010070834 Sensitisation Diseases 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 229910052729 chemical element Inorganic materials 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- 239000012992 electron transfer agent Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- ZWDZJRRQSXLOQR-UHFFFAOYSA-N n-butyl-n-phenylacetamide Chemical compound CCCCN(C(C)=O)C1=CC=CC=C1 ZWDZJRRQSXLOQR-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000003605 opacifier Substances 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 239000004848 polyfunctional curative Substances 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- UVWWZGPJRBROMK-UHFFFAOYSA-M potassium;2,5-dihydroxy-4-octadecan-2-ylbenzenesulfonate Chemical compound [K+].CCCCCCCCCCCCCCCCC(C)C1=CC(O)=C(S([O-])(=O)=O)C=C1O UVWWZGPJRBROMK-UHFFFAOYSA-M 0.000 description 2
- 230000008313 sensitization Effects 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 125000006850 spacer group Chemical group 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- ONDPHDOFVYQSGI-UHFFFAOYSA-N zinc nitrate Chemical compound [Zn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ONDPHDOFVYQSGI-UHFFFAOYSA-N 0.000 description 2
- 150000005206 1,2-dihydroxybenzenes Chemical class 0.000 description 1
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 description 1
- XGNFGPFKRNWFGA-UHFFFAOYSA-N 1-(3,4-dimethylphenyl)-4-(hydroxymethyl)-4-methylpyrazolidin-3-one Chemical compound C1=C(C)C(C)=CC=C1N1NC(=O)C(C)(CO)C1 XGNFGPFKRNWFGA-UHFFFAOYSA-N 0.000 description 1
- YGAZCASNSMLPKJ-UHFFFAOYSA-N 1-(3-chlorophenyl)pyrazolidin-3-one Chemical compound ClC1=CC=CC(N2NC(=O)CC2)=C1 YGAZCASNSMLPKJ-UHFFFAOYSA-N 0.000 description 1
- QEWLOWAUHUOAEK-UHFFFAOYSA-N 1-(4-chlorophenyl)pyrazolidin-3-one Chemical compound C1=CC(Cl)=CC=C1N1NC(=O)CC1 QEWLOWAUHUOAEK-UHFFFAOYSA-N 0.000 description 1
- NWUNKFTVLXWQQC-UHFFFAOYSA-N 2,5-di(dodecan-2-yl)benzene-1,4-diol Chemical compound CCCCCCCCCCC(C)C1=CC(O)=C(C(C)CCCCCCCCCC)C=C1O NWUNKFTVLXWQQC-UHFFFAOYSA-N 0.000 description 1
- AYNPIRVEWMUJDE-UHFFFAOYSA-N 2,5-dichlorohydroquinone Chemical compound OC1=CC(Cl)=C(O)C=C1Cl AYNPIRVEWMUJDE-UHFFFAOYSA-N 0.000 description 1
- NPFSRFZITCLTFA-UHFFFAOYSA-N 2-(2-tert-butyl-3,6-dihydroxyphenyl)acetic acid Chemical compound CC(C)(C)C1=C(C=CC(=C1CC(=O)O)O)O NPFSRFZITCLTFA-UHFFFAOYSA-N 0.000 description 1
- AUABZJZJXPSZCN-UHFFFAOYSA-N 2-(dimethylamino)phenol Chemical compound CN(C)C1=CC=CC=C1O AUABZJZJXPSZCN-UHFFFAOYSA-N 0.000 description 1
- JHKKTXXMAQLGJB-UHFFFAOYSA-N 2-(methylamino)phenol Chemical compound CNC1=CC=CC=C1O JHKKTXXMAQLGJB-UHFFFAOYSA-N 0.000 description 1
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical class NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- XPIXWKOZBARZHU-UHFFFAOYSA-N 3,5-bis(bromoamino)phenol Chemical compound OC1=CC(NBr)=CC(NBr)=C1 XPIXWKOZBARZHU-UHFFFAOYSA-N 0.000 description 1
- AJKLCDRWGVLVSH-UHFFFAOYSA-N 4,4-bis(hydroxymethyl)-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(CO)(CO)CN1C1=CC=CC=C1 AJKLCDRWGVLVSH-UHFFFAOYSA-N 0.000 description 1
- WCMSEZVJBZRRHL-UHFFFAOYSA-N 4,4-dimethyl-1-(3-methylphenyl)pyrazolidin-3-one Chemical compound CC1=CC=CC(N2NC(=O)C(C)(C)C2)=C1 WCMSEZVJBZRRHL-UHFFFAOYSA-N 0.000 description 1
- SJSJAWHHGDPBOC-UHFFFAOYSA-N 4,4-dimethyl-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(C)(C)CN1C1=CC=CC=C1 SJSJAWHHGDPBOC-UHFFFAOYSA-N 0.000 description 1
- FJWJYHHBUMICTP-UHFFFAOYSA-N 4,4-dimethylpyrazolidin-3-one Chemical compound CC1(C)CNNC1=O FJWJYHHBUMICTP-UHFFFAOYSA-N 0.000 description 1
- MBAGWXXPOYAQSA-UHFFFAOYSA-N 4-(octadecylamino)benzene-1,2-diol Chemical compound CCCCCCCCCCCCCCCCCCNC1=CC=C(O)C(O)=C1 MBAGWXXPOYAQSA-UHFFFAOYSA-N 0.000 description 1
- CHPDWZOITMMWOU-UHFFFAOYSA-N 4-cyclohexylbenzene-1,2-diol Chemical compound C1=C(O)C(O)=CC=C1C1CCCCC1 CHPDWZOITMMWOU-UHFFFAOYSA-N 0.000 description 1
- QGNGOGOOPUYKMC-UHFFFAOYSA-N 4-hydroxy-6-methylaniline Chemical compound CC1=CC(O)=CC=C1N QGNGOGOOPUYKMC-UHFFFAOYSA-N 0.000 description 1
- VHVBDNDZNOOFQV-UHFFFAOYSA-N 4-methyl-1-(4-methylphenyl)pyrazolidin-3-one Chemical compound N1C(=O)C(C)CN1C1=CC=C(C)C=C1 VHVBDNDZNOOFQV-UHFFFAOYSA-N 0.000 description 1
- XVRRTSAWVKTSSW-UHFFFAOYSA-N 4-methylpyrazolidin-3-one Chemical compound CC1CNNC1=O XVRRTSAWVKTSSW-UHFFFAOYSA-N 0.000 description 1
- FIARATPVIIDWJT-UHFFFAOYSA-N 5-methyl-1-phenylpyrazolidin-3-one Chemical compound CC1CC(=O)NN1C1=CC=CC=C1 FIARATPVIIDWJT-UHFFFAOYSA-N 0.000 description 1
- WYVJDRGXWOXCCH-UHFFFAOYSA-N 5-methylpyrazolidin-3-one Chemical compound CC1CC(=O)NN1 WYVJDRGXWOXCCH-UHFFFAOYSA-N 0.000 description 1
- 125000003341 7 membered heterocyclic group Chemical group 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 101100294106 Caenorhabditis elegans nhr-3 gene Proteins 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 108700034893 EC 6.6.1.- Proteins 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241001527806 Iti Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- BGNXCDMCOKJUMV-UHFFFAOYSA-N Tert-Butylhydroquinone Chemical compound CC(C)(C)C1=CC(O)=CC=C1O BGNXCDMCOKJUMV-UHFFFAOYSA-N 0.000 description 1
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000002511 behenyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- OHJMTUPIZMNBFR-UHFFFAOYSA-N biuret Chemical compound NC(=O)NC(N)=O OHJMTUPIZMNBFR-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 230000009920 chelation Effects 0.000 description 1
- AJPXTSMULZANCB-UHFFFAOYSA-N chlorohydroquinone Chemical compound OC1=CC=C(O)C(Cl)=C1 AJPXTSMULZANCB-UHFFFAOYSA-N 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- 230000000875 corresponding effect Effects 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000000586 desensitisation Methods 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000009975 flexible effect Effects 0.000 description 1
- 238000007646 gravure printing Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 238000005213 imbibition Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- UXZAJSZFFARTEI-GUMHCPJTSA-N methyl (2R,3S)-3-(methanesulfonamido)-2-[(4-phenylcyclohexyl)oxymethyl]piperidine-1-carboxylate Chemical compound COC(=O)N1CCC[C@H](NS(C)(=O)=O)[C@@H]1COC1CCC(CC1)c1ccccc1 UXZAJSZFFARTEI-GUMHCPJTSA-N 0.000 description 1
- 210000004088 microvessel Anatomy 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 239000005445 natural material Substances 0.000 description 1
- 150000002815 nickel Chemical class 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- CMCWWLVWPDLCRM-UHFFFAOYSA-N phenidone Chemical compound N1C(=O)CCN1C1=CC=CC=C1 CMCWWLVWPDLCRM-UHFFFAOYSA-N 0.000 description 1
- 150000004986 phenylenediamines Chemical class 0.000 description 1
- 239000013047 polymeric layer Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- NDGRWYRVNANFNB-UHFFFAOYSA-N pyrazolidin-3-one Chemical compound O=C1CCNN1 NDGRWYRVNANFNB-UHFFFAOYSA-N 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000001429 visible spectrum Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
- 229960001296 zinc oxide Drugs 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/02—Photosensitive materials characterised by the image-forming section
- G03C8/08—Photosensitive materials characterised by the image-forming section the substances transferred by diffusion consisting of organic compounds
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US224,415 | 1981-01-12 | ||
| US06/224,415 US4356250A (en) | 1981-01-12 | 1981-01-12 | Use of zinc salts to increase dye stability |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1150090A true CA1150090A (en) | 1983-07-19 |
Family
ID=22840572
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000393966A Expired CA1150090A (en) | 1981-01-12 | 1982-01-12 | Use of zinc salts to increase dye stability in silver halide photographic elements |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4356250A (cg-RX-API-DMAC10.html) |
| EP (1) | EP0057508B1 (cg-RX-API-DMAC10.html) |
| JP (1) | JPS57136648A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1150090A (cg-RX-API-DMAC10.html) |
| DE (1) | DE3262911D1 (cg-RX-API-DMAC10.html) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4416970A (en) * | 1982-09-29 | 1983-11-22 | Eastman Kodak Company | Use of manganous compounds in image transfer elements |
| US4456674A (en) * | 1982-11-01 | 1984-06-26 | Polaroid Corporation | Color transfer photographic processes and products |
| US4471047A (en) * | 1982-12-20 | 1984-09-11 | Eastman Kodak Company | Use of carbon adsorption deactivating compounds in image transfer elements |
| US4450222A (en) * | 1982-12-20 | 1984-05-22 | Eastman Kodak Company | Use of carbon adsorption deactivating compounds in image transfer elements |
| US4496651A (en) * | 1983-07-25 | 1985-01-29 | Polaroid Corporation | Color transfer photographic processes and products |
| JPH0652384B2 (ja) * | 1984-01-31 | 1994-07-06 | 富士写真フイルム株式会社 | ハロゲン化銀写真感光材料 |
| JPS6146950A (ja) * | 1984-08-10 | 1986-03-07 | Fuji Photo Film Co Ltd | 写真感光材料 |
| US5206208A (en) * | 1991-11-20 | 1993-04-27 | Polaroid Corporation | Stabilization of thermal images |
| DE19832937A1 (de) * | 1998-07-22 | 2000-01-27 | Agfa Gevaert Ag | Farbfotografisches Aufzeichnungsmaterial |
| US6563278B2 (en) * | 1999-07-22 | 2003-05-13 | Noostuff, Inc. | Automated garage door closer |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2788274A (en) * | 1954-04-14 | 1957-04-09 | Gen Aniline & Film Corp | Process of inhibiting the discoloration of photographic color images |
| NL247649A (cg-RX-API-DMAC10.html) * | 1959-01-26 | |||
| US3249432A (en) * | 1960-08-22 | 1966-05-03 | Polaroid Corp | Novel photographic processes |
| US3311472A (en) * | 1963-08-23 | 1967-03-28 | Eastman Kodak Co | Photographic colloid transfer process with a sulfur dioxide adduct tanning developer |
| US4273853A (en) * | 1979-03-30 | 1981-06-16 | Eastman Kodak Company | Metal complexes of copolymers comprising vinylimidazole and their use in photographic elements |
| US3619155A (en) * | 1970-06-01 | 1971-11-09 | Polaroid Corp | Photographic products and processes utilizing a polyvalent metal ion-cross-linked polymeric layer |
| US3647434A (en) * | 1970-06-05 | 1972-03-07 | Polaroid Corp | Integral negative/positive color diffusion transfer process film unit employing in situ generated visible light-reflecting agent |
| BE787860A (fr) * | 1971-08-24 | 1973-02-22 | Eastman Kodak Co | Produit et procede pour la photographie en couleurs |
| DE2220498B2 (de) * | 1972-04-26 | 1979-06-21 | Fuji Photo Film Co., Ltd., Ashigara, Kanagawa (Japan) | Mit einer Polyolefinschicht und einer Haftschicht versehener Papierträger für ein Bildempfangsmaterial für das Silbersalz-Diffusionsfibertragungsverfahren |
| JPS5350735A (en) * | 1976-10-19 | 1978-05-09 | Konishiroku Photo Ind Co Ltd | Photographic material for color diffusion transfer |
-
1981
- 1981-01-12 US US06/224,415 patent/US4356250A/en not_active Expired - Fee Related
-
1982
- 1982-01-12 CA CA000393966A patent/CA1150090A/en not_active Expired
- 1982-01-12 JP JP57002382A patent/JPS57136648A/ja active Granted
- 1982-01-12 EP EP82300152A patent/EP0057508B1/en not_active Expired
- 1982-01-12 DE DE8282300152T patent/DE3262911D1/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE3262911D1 (en) | 1985-05-15 |
| JPS57136648A (en) | 1982-08-23 |
| EP0057508B1 (en) | 1985-04-10 |
| EP0057508A1 (en) | 1982-08-11 |
| JPS6332375B2 (cg-RX-API-DMAC10.html) | 1988-06-29 |
| US4356250A (en) | 1982-10-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4282305A (en) | Receiving elements for image transfer film units | |
| US4273853A (en) | Metal complexes of copolymers comprising vinylimidazole and their use in photographic elements | |
| US3930864A (en) | Auxiliary mordant layer for excess dye formed in integral color transfer assemblage | |
| US4255510A (en) | Development restrainer precursors for photographic elements | |
| CA1150090A (en) | Use of zinc salts to increase dye stability in silver halide photographic elements | |
| US4056394A (en) | Timing layer for color transfer film units comprising copolymer with activation energy to penetration greater than 18 kcal/mole | |
| US4485164A (en) | Oxidants for reducing post-process D-min increase in positive redox dye-releasing image transfer systems | |
| CA1072800A (en) | Timing layer containing a mixture of cellulose acetate and maleic anhydride copolymer | |
| US4529683A (en) | Surfactant-like material in a hydrophilic layer adjacent a stripping layer for diffusion transfer assemblages | |
| US4499174A (en) | Hydrophilic layers adjacent a stripping layer for diffusion transfer assemblages | |
| CA1087899A (en) | Neutralizing layer containing diatomaceous earth, exploded volcanic rock or calcium silicate | |
| US4029849A (en) | Cover sheets with timing layer comprising cellulose acetate and copolymer of maleic anhydride | |
| US4356249A (en) | Timing layers and auxiliary neutralizing layer for color transfer assemblages containing positive-working redox dye-releasers | |
| US4296195A (en) | Two-sheet diffusion transfer assemblages and photographic elements | |
| US4314020A (en) | Color transfers assemblages with two timing layers and a neutralizing layer | |
| US4471045A (en) | 4-Hydroxyalkyl-substituted 3-pyrazolidinone electron transfer agents | |
| US4353973A (en) | Use of oxalic acid or an acid salt thereof in color transfer assemblages | |
| US4358524A (en) | Polymeric vehicle for metallizable dye image-receiving layer | |
| US4415647A (en) | Polymeric vehicle for dye image-receiving layer containing a poly(vinylimidazole) mordant | |
| CA1121641A (en) | Mixture of nondiffusible redox dye-releasers for curve shape control | |
| US4450222A (en) | Use of carbon adsorption deactivating compounds in image transfer elements | |
| US4030920A (en) | Processing compositions containing glycols for color transfer processes comprising direct positive silver halide developement | |
| US4375506A (en) | Timing layers for color transfer assemblages containing positive-working redox dye-releasers and development accelerators | |
| US4357392A (en) | Coversheet for color transfer assemblages | |
| CA1128799A (en) | Photographic use of n-alkyl- or n-aryl-benzisoxazolone as scavengers for oxidized electron transfer agents |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |