CA1145677A - Phosphate buffer in toothpaste with high level of humectant - Google Patents
Phosphate buffer in toothpaste with high level of humectantInfo
- Publication number
- CA1145677A CA1145677A CA000362354A CA362354A CA1145677A CA 1145677 A CA1145677 A CA 1145677A CA 000362354 A CA000362354 A CA 000362354A CA 362354 A CA362354 A CA 362354A CA 1145677 A CA1145677 A CA 1145677A
- Authority
- CA
- Canada
- Prior art keywords
- toothpaste
- water
- fluoride
- humectant
- composition
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000606 toothpaste Substances 0.000 title claims abstract description 66
- 239000003906 humectant Substances 0.000 title claims abstract description 20
- 229940034610 toothpaste Drugs 0.000 title claims description 42
- 239000008363 phosphate buffer Substances 0.000 title 1
- 239000000203 mixture Substances 0.000 claims abstract description 65
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims abstract description 54
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims abstract description 39
- 239000000377 silicon dioxide Substances 0.000 claims abstract description 27
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 23
- 239000000796 flavoring agent Substances 0.000 claims abstract description 12
- 239000002002 slurry Substances 0.000 claims abstract description 9
- 229910019142 PO4 Inorganic materials 0.000 claims abstract description 8
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 claims abstract description 7
- 239000010452 phosphate Substances 0.000 claims abstract description 5
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 12
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical group [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 8
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 claims description 7
- 239000006172 buffering agent Substances 0.000 claims description 7
- 239000000600 sorbitol Substances 0.000 claims description 7
- 235000010356 sorbitol Nutrition 0.000 claims description 7
- 235000013355 food flavoring agent Nutrition 0.000 claims description 6
- 235000011187 glycerol Nutrition 0.000 claims description 6
- 235000013024 sodium fluoride Nutrition 0.000 claims description 6
- 239000011775 sodium fluoride Substances 0.000 claims description 6
- 235000003599 food sweetener Nutrition 0.000 claims description 4
- 239000003765 sweetening agent Substances 0.000 claims description 4
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 3
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 claims description 3
- TVXBFESIOXBWNM-UHFFFAOYSA-N Xylitol Natural products OCCC(O)C(O)C(O)CCO TVXBFESIOXBWNM-UHFFFAOYSA-N 0.000 claims description 2
- 150000008051 alkyl sulfates Chemical class 0.000 claims description 2
- OGBUMNBNEWYMNJ-UHFFFAOYSA-N batilol Chemical class CCCCCCCCCCCCCCCCCCOCC(O)CO OGBUMNBNEWYMNJ-UHFFFAOYSA-N 0.000 claims description 2
- HEBKCHPVOIAQTA-UHFFFAOYSA-N meso ribitol Natural products OCC(O)C(O)C(O)CO HEBKCHPVOIAQTA-UHFFFAOYSA-N 0.000 claims description 2
- 239000000811 xylitol Substances 0.000 claims description 2
- 235000010447 xylitol Nutrition 0.000 claims description 2
- HEBKCHPVOIAQTA-SCDXWVJYSA-N xylitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)CO HEBKCHPVOIAQTA-SCDXWVJYSA-N 0.000 claims description 2
- 229960002675 xylitol Drugs 0.000 claims description 2
- 229960001047 methyl salicylate Drugs 0.000 claims 1
- 235000019634 flavors Nutrition 0.000 abstract description 6
- 235000021317 phosphate Nutrition 0.000 abstract description 5
- 239000000463 material Substances 0.000 description 13
- -1 fluoride ions Chemical class 0.000 description 11
- 210000003298 dental enamel Anatomy 0.000 description 9
- 239000011734 sodium Substances 0.000 description 8
- 239000003082 abrasive agent Substances 0.000 description 7
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 239000002562 thickening agent Substances 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 5
- 238000005498 polishing Methods 0.000 description 5
- 239000000230 xanthan gum Substances 0.000 description 5
- 235000010493 xanthan gum Nutrition 0.000 description 5
- 229920001285 xanthan gum Polymers 0.000 description 5
- 229940082509 xanthan gum Drugs 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 229920002125 Sokalan® Polymers 0.000 description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- 125000000129 anionic group Chemical group 0.000 description 4
- 230000002272 anti-calculus Effects 0.000 description 4
- 230000002882 anti-plaque Effects 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 4
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 3
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 239000000872 buffer Substances 0.000 description 3
- 125000002091 cationic group Chemical group 0.000 description 3
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 3
- 229940071826 hydroxyethyl cellulose Drugs 0.000 description 3
- 235000019799 monosodium phosphate Nutrition 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 3
- 229910000162 sodium phosphate Inorganic materials 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical compound OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000004287 bisbiguanides Chemical class 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 235000010418 carrageenan Nutrition 0.000 description 2
- 239000000679 carrageenan Substances 0.000 description 2
- 229920001525 carrageenan Polymers 0.000 description 2
- 229940113118 carrageenan Drugs 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 2
- 229910000397 disodium phosphate Inorganic materials 0.000 description 2
- 235000019800 disodium phosphate Nutrition 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N phosphine group Chemical group P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical class [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 2
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 2
- CJSBVQVTGSIUAN-UHFFFAOYSA-M (2,6-dimethyl-4-phenylheptan-4-yl)-dimethyl-(2-phenoxyethyl)azanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1OCC[N+](C)(C)C(CC(C)C)(CC(C)C)C1=CC=CC=C1 CJSBVQVTGSIUAN-UHFFFAOYSA-M 0.000 description 1
- 229910019670 (NH4)H2PO4 Inorganic materials 0.000 description 1
- BMVLUGUCGASAAK-UHFFFAOYSA-M 1-hexadecylpyridin-1-ium;fluoride Chemical compound [F-].CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1 BMVLUGUCGASAAK-UHFFFAOYSA-M 0.000 description 1
- UBLAMKHIFZBBSS-UHFFFAOYSA-N 3-Methylbutyl pentanoate Chemical compound CCCCC(=O)OCCC(C)C UBLAMKHIFZBBSS-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 108010011485 Aspartame Proteins 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 239000004135 Bone phosphate Substances 0.000 description 1
- HZZDXVXOETXUEY-UHFFFAOYSA-N CC.[Na].[Na] Chemical compound CC.[Na].[Na] HZZDXVXOETXUEY-UHFFFAOYSA-N 0.000 description 1
- 101100283604 Caenorhabditis elegans pigk-1 gene Proteins 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- GHXZTYHSJHQHIJ-UHFFFAOYSA-N Chlorhexidine Chemical compound C=1C=C(Cl)C=CC=1NC(N)=NC(N)=NCCCCCCN=C(N)N=C(N)NC1=CC=C(Cl)C=C1 GHXZTYHSJHQHIJ-UHFFFAOYSA-N 0.000 description 1
- 241000206575 Chondrus crispus Species 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- UDIPTWFVPPPURJ-UHFFFAOYSA-M Cyclamate Chemical compound [Na+].[O-]S(=O)(=O)NC1CCCCC1 UDIPTWFVPPPURJ-UHFFFAOYSA-M 0.000 description 1
- 229930182827 D-tryptophan Natural products 0.000 description 1
- QIVBCDIJIAJPQS-SECBINFHSA-N D-tryptophane Chemical compound C1=CC=C2C(C[C@@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-SECBINFHSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 240000001238 Gaultheria procumbens Species 0.000 description 1
- 235000007297 Gaultheria procumbens Nutrition 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 229920000569 Gum karaya Polymers 0.000 description 1
- 244000024873 Mentha crispa Species 0.000 description 1
- 235000014749 Mentha crispa Nutrition 0.000 description 1
- 244000246386 Mentha pulegium Species 0.000 description 1
- 235000016257 Mentha pulegium Nutrition 0.000 description 1
- 235000004357 Mentha x piperita Nutrition 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 244000227633 Ocotea pretiosa Species 0.000 description 1
- 235000004263 Ocotea pretiosa Nutrition 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 229940027983 antiseptic and disinfectant quaternary ammonium compound Drugs 0.000 description 1
- 239000000605 aspartame Substances 0.000 description 1
- IAOZJIPTCAWIRG-QWRGUYRKSA-N aspartame Chemical compound OC(=O)C[C@H](N)C(=O)N[C@H](C(=O)OC)CC1=CC=CC=C1 IAOZJIPTCAWIRG-QWRGUYRKSA-N 0.000 description 1
- 235000010357 aspartame Nutrition 0.000 description 1
- 229960003438 aspartame Drugs 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 229920003090 carboxymethyl hydroxyethyl cellulose Polymers 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- YMKDRGPMQRFJGP-UHFFFAOYSA-M cetylpyridinium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1 YMKDRGPMQRFJGP-UHFFFAOYSA-M 0.000 description 1
- 229960001927 cetylpyridinium chloride Drugs 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229960003260 chlorhexidine Drugs 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000010634 clove oil Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000000625 cyclamic acid and its Na and Ca salt Substances 0.000 description 1
- 210000004268 dentin Anatomy 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 1
- 229910000396 dipotassium phosphate Inorganic materials 0.000 description 1
- 235000019797 dipotassium phosphate Nutrition 0.000 description 1
- DDXLVDQZPFLQMZ-UHFFFAOYSA-M dodecyl(trimethyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)C DDXLVDQZPFLQMZ-UHFFFAOYSA-M 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- JEGUKCSWCFPDGT-UHFFFAOYSA-N h2o hydrate Chemical compound O.O JEGUKCSWCFPDGT-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 1
- 235000001050 hortel pimenta Nutrition 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 235000010494 karaya gum Nutrition 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- 229960001462 sodium cyclamate Drugs 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- DIORMHZUUKOISG-UHFFFAOYSA-N sulfoformic acid Chemical compound OC(=O)S(O)(=O)=O DIORMHZUUKOISG-UHFFFAOYSA-N 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000013595 supernatant sample Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000271 synthetic detergent Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 1
- 229910000404 tripotassium phosphate Inorganic materials 0.000 description 1
- 235000019798 tripotassium phosphate Nutrition 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q11/00—Preparations for care of the teeth, of the oral cavity or of dentures; Dentifrices, e.g. toothpastes; Mouth rinses
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/19—Cosmetics or similar toiletry preparations characterised by the composition containing inorganic ingredients
- A61K8/20—Halogens; Compounds thereof
- A61K8/21—Fluorides; Derivatives thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/19—Cosmetics or similar toiletry preparations characterised by the composition containing inorganic ingredients
- A61K8/24—Phosphorous; Compounds thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/19—Cosmetics or similar toiletry preparations characterised by the composition containing inorganic ingredients
- A61K8/25—Silicon; Compounds thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K2800/00—Properties of cosmetic compositions or active ingredients thereof or formulation aids used therein and process related aspects
- A61K2800/40—Chemical, physico-chemical or functional or structural properties of particular ingredients
- A61K2800/52—Stabilizers
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Oral & Maxillofacial Surgery (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US84,485 | 1979-10-15 | ||
| US06/084,485 US4314990A (en) | 1979-10-15 | 1979-10-15 | Toothpaste compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1145677A true CA1145677A (en) | 1983-05-03 |
Family
ID=22185254
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000362354A Expired CA1145677A (en) | 1979-10-15 | 1980-10-14 | Phosphate buffer in toothpaste with high level of humectant |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4314990A (esLanguage) |
| JP (1) | JPS5695111A (esLanguage) |
| CA (1) | CA1145677A (esLanguage) |
| GR (1) | GR69614B (esLanguage) |
| PH (1) | PH15450A (esLanguage) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5215740A (en) * | 1991-10-25 | 1993-06-01 | Church & Dwight Co., Inc. | Buffering system for anticalculus dentifrices |
Families Citing this family (77)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4381318A (en) * | 1981-01-05 | 1983-04-26 | Ici Americas Inc. | Maltitol containing gel base systems |
| US4357314A (en) * | 1981-01-05 | 1982-11-02 | Ici Americas Inc. | Maltitol containing toothpaste |
| DE3114492A1 (de) * | 1981-04-10 | 1982-10-28 | Degussa Ag, 6000 Frankfurt | Zahnpflegemittel |
| NO158361C (no) * | 1981-07-03 | 1988-08-31 | Intradal Nv | Tannpleiemiddel med antikaries-virkning. |
| US4448778A (en) * | 1981-08-03 | 1984-05-15 | Ici Americas Inc. | Maltitol containing gel base systems |
| GB2109682B (en) * | 1981-11-19 | 1985-09-11 | Colgate Palmolive Co | Stable dentifrice |
| US4545979A (en) * | 1982-02-22 | 1985-10-08 | Warner-Lambert Company | Dental hygiene compositions |
| US4401648A (en) * | 1982-03-29 | 1983-08-30 | Colgate-Palmolive Company | Dental cream composition |
| US4999184A (en) * | 1982-06-22 | 1991-03-12 | The Procter & Gamble Company | Oral compositions |
| US4885155A (en) * | 1982-06-22 | 1989-12-05 | The Procter & Gamble Company | Anticalculus compositions using pyrophosphate salt |
| US4806339A (en) * | 1982-06-22 | 1989-02-21 | The Procter & Gamble Company | Oral compositions |
| US4515772A (en) * | 1982-06-22 | 1985-05-07 | The Procter & Gamble Company | Oral compositions |
| US4540576A (en) * | 1982-08-02 | 1985-09-10 | Johnson & Johnson Dental Products Company | Neutral topical sodium fluoride gel |
| US4455294A (en) * | 1982-11-17 | 1984-06-19 | Colgate-Palmolive Company | Stable dentifrice containing acidic siliceous polishing agent |
| GB8316382D0 (en) * | 1983-06-16 | 1983-07-20 | Beecham Group Plc | Toothpaste |
| US4485089A (en) * | 1983-10-17 | 1984-11-27 | Hercules Incorporated | Gel toothpastes |
| US4550018A (en) * | 1984-02-22 | 1985-10-29 | Warner-Lambert Company | Dental hygiene compositions |
| US4568540A (en) * | 1984-04-18 | 1986-02-04 | Johnson & Johnson | Oral hygiene compositions |
| SE453721B (sv) * | 1984-11-06 | 1988-02-29 | Georgios Palaghias | Skoljlosning innehallande fosfatjondonator for att forhindra uppkomsten av oral korrosion av dentala legeringar |
| IN166518B (esLanguage) * | 1985-08-30 | 1990-05-19 | Colgate Palmolive Co | |
| US4806340A (en) * | 1985-09-13 | 1989-02-21 | Colgate-Palmolive Company | Anticalculus oral composition |
| US5011679A (en) * | 1989-05-30 | 1991-04-30 | Nabisco Brands, Inc. | Raw hide having a coating containing an inorganic pyrophosphate |
| US5114704A (en) * | 1989-05-30 | 1992-05-19 | Nabisco Brands, Inc. | Raw hide having a coating containing an inorganic pyrophosphate |
| US5047231A (en) * | 1989-05-30 | 1991-09-10 | Nabisco Brands, Inc. | Raw hide containing an inorganic pyrophosphate |
| US5015485A (en) * | 1989-05-30 | 1991-05-14 | Nabisco Brands, Inc. | Dog biscuits having a coating containing an inorganic pyrophosphate |
| US5000940A (en) * | 1989-05-30 | 1991-03-19 | Nabisco Brands, Inc. | Devices, compositions and the like having or containing an inorganic pyrophosphate |
| US5000943A (en) * | 1989-05-30 | 1991-03-19 | Nabisco Brands, Inc. | Canine biscuits containing an inorganic pyrophosphate |
| US5094870A (en) * | 1989-05-30 | 1992-03-10 | Nabisco Brands, Inc. | Canine biscuits containing an inorganic pyrophosphate |
| US5000973A (en) * | 1989-05-30 | 1991-03-19 | Nabisco Brands, Inc. | Nutritionally-balanced canine biscuits containing an inorganic pyrophosphate |
| US5089255A (en) * | 1989-06-26 | 1992-02-18 | Colgate-Palmolive Company | Dental remineralization |
| JPH09507231A (ja) * | 1993-12-29 | 1997-07-22 | ザ、プロクター、エンド、ギャンブル、カンパニー | チモールを含有したタタール抑制歯磨組成物 |
| US5669942A (en) * | 1994-03-16 | 1997-09-23 | Mccullough; David Keith | Abrasive sanding paste |
| US5702686A (en) * | 1995-07-18 | 1997-12-30 | John O. Butler Company | Clear dentrifice gel for interdental brushes |
| US6086372A (en) * | 1997-06-04 | 2000-07-11 | Block Drug Company, Inc. | Dental and oral preparation |
| WO1999036048A1 (en) * | 1998-01-15 | 1999-07-22 | Block Drug Company, Inc. | Stable dental and oral preparations for removing tobacco tar and common food stains, as well as refreshing the mouth |
| US6238648B1 (en) * | 1999-03-25 | 2001-05-29 | The Procter & Gamble Company | Anti-caries oral care compositions and their methods of use |
| US7041277B2 (en) * | 2000-03-10 | 2006-05-09 | Cadbury Adams Usa Llc | Chewing gum and confectionery compositions with encapsulated stain removing agent compositions, and methods of making and using the same |
| US6562090B1 (en) | 2000-08-28 | 2003-05-13 | Hercules Incorporated | Fluid abrasive suspension for use in dentifrices |
| WO2003017046A2 (en) * | 2001-08-14 | 2003-02-27 | Variant Holdings, Llc. | System for marketing goods and services utilizing computerized central and remote facilities |
| MXPA04006541A (es) * | 2002-01-03 | 2004-10-04 | Procter & Gamble | Composiciones bucales estables que contienen complejos de fosfopeptido de caseina y fluoruro. |
| US7445769B2 (en) * | 2002-10-31 | 2008-11-04 | Cadbury Adams Usa Llc | Compositions for removing stains from dental surfaces and methods of making and using the same |
| US8524198B2 (en) * | 2003-06-20 | 2013-09-03 | Donald W. Bailey | Xylitol dental maintenance system |
| US20100158820A1 (en) * | 2003-06-20 | 2010-06-24 | Bailey Donald W | Xylitol dental maintenance system |
| US20080317681A1 (en) * | 2003-07-11 | 2008-12-25 | Petros Gebreselassie | Compositions containing a stain removing complex, and methods of making and using the same |
| US7390518B2 (en) | 2003-07-11 | 2008-06-24 | Cadbury Adams Usa, Llc | Stain removing chewing gum composition |
| US20060263474A1 (en) * | 2005-05-23 | 2006-11-23 | Cadbury Adams Usa Llc. | Enhanced flavor-release comestible compositions and methods for same |
| US8389032B2 (en) * | 2005-05-23 | 2013-03-05 | Kraft Foods Global Brands Llc | Delivery system for active components as part of an edible composition having selected particle size |
| US8597703B2 (en) * | 2005-05-23 | 2013-12-03 | Kraft Foods Global Brands Llc | Delivery system for active components as part of an edible composition including a ratio of encapsulating material and active component |
| US20060263473A1 (en) * | 2005-05-23 | 2006-11-23 | Cadbury Adams Usa Llc | Compressed delivery system for active components as part of an edible composition |
| US8591972B2 (en) * | 2005-05-23 | 2013-11-26 | Kraft Foods Global Brands Llc | Delivery system for coated active components as part of an edible composition |
| US8591974B2 (en) | 2003-11-21 | 2013-11-26 | Kraft Foods Global Brands Llc | Delivery system for two or more active components as part of an edible composition |
| US8389031B2 (en) * | 2005-05-23 | 2013-03-05 | Kraft Foods Global Brands Llc | Coated delivery system for active components as part of an edible composition |
| US8591973B2 (en) * | 2005-05-23 | 2013-11-26 | Kraft Foods Global Brands Llc | Delivery system for active components and a material having preselected hydrophobicity as part of an edible composition |
| US20050112236A1 (en) * | 2003-11-21 | 2005-05-26 | Navroz Boghani | Delivery system for active components as part of an edible composition having preselected tensile strength |
| US8591968B2 (en) * | 2005-05-23 | 2013-11-26 | Kraft Foods Global Brands Llc | Edible composition including a delivery system for active components |
| US9271904B2 (en) * | 2003-11-21 | 2016-03-01 | Intercontinental Great Brands Llc | Controlled release oral delivery systems |
| US7641892B2 (en) * | 2004-07-29 | 2010-01-05 | Cadburry Adams USA, LLC | Tooth whitening compositions and delivery systems therefor |
| US20060068058A1 (en) * | 2004-09-30 | 2006-03-30 | Cadbury Adams Usa Llc | Thermally stable, high tensile strength encapsulation compositions for actives |
| US7955630B2 (en) | 2004-09-30 | 2011-06-07 | Kraft Foods Global Brands Llc | Thermally stable, high tensile strength encapsulated actives |
| US7727565B2 (en) | 2004-08-25 | 2010-06-01 | Cadbury Adams Usa Llc | Liquid-filled chewing gum composition |
| US20060263476A1 (en) * | 2004-08-25 | 2006-11-23 | Cadbury Adams Usa, Llc. | Center-filled chewing gum with barrier layer |
| US20060068059A1 (en) * | 2004-09-30 | 2006-03-30 | Cadbury Adams Usa Llc | Encapsulated compositions and methods of preparation |
| US9198448B2 (en) | 2005-02-07 | 2015-12-01 | Intercontinental Great Brands Llc | Stable tooth whitening gum with reactive ingredients |
| US7851005B2 (en) * | 2005-05-23 | 2010-12-14 | Cadbury Adams Usa Llc | Taste potentiator compositions and beverages containing same |
| US7851006B2 (en) * | 2005-05-23 | 2010-12-14 | Cadbury Adams Usa Llc | Taste potentiator compositions and beverages containing same |
| AU2006249857B2 (en) * | 2005-05-23 | 2010-05-13 | Intercontinental Great Brands Llc | Taste potentiator compositions and edible confectionery and chewing gum products containing same |
| US20070053972A1 (en) * | 2005-09-08 | 2007-03-08 | Cadbury Adams Usa Llc. | Gelatin capsules containing actives |
| US20070178187A1 (en) * | 2006-01-27 | 2007-08-02 | Cadbury Adams Usa Llc | Chewing gum compositions including free neotame sweetener compositions |
| US20070178188A1 (en) * | 2006-01-27 | 2007-08-02 | Cadbury Adams Usa Llc | Chewing gum compositions including free neotame sweetener compositions |
| US20080267891A1 (en) * | 2007-04-30 | 2008-10-30 | Colgate-Palmolive Company | Oral Care Composition To Reduce Or Eliminate Dental Sensitivity |
| WO2008141333A1 (en) * | 2007-05-14 | 2008-11-20 | Cadbury Adams Usa Llc | Taste potentiator compositions in oral delivery systems |
| US8758729B2 (en) | 2009-05-18 | 2014-06-24 | Colgate-Palmolive Company | Oral compositions containing polyguanidinium compounds and methods of manufacture and use thereof |
| TWI499430B (zh) | 2009-12-17 | 2015-09-11 | Colgate Palmolive Co | 抗侵蝕的牙膏組成物 |
| PH12012501524A1 (en) | 2010-01-29 | 2012-10-22 | Colgate Palmolive Co | Oral care product for sensitive enamel care |
| CN107569427A (zh) * | 2017-10-17 | 2018-01-12 | 贵州云山环保再生循环科技有限公司 | 一种含夜交藤提取物的中药保健牙膏 |
| CN107753331A (zh) * | 2017-10-17 | 2018-03-06 | 贵州云山环保再生循环科技有限公司 | 一种含天师栗的中药保健牙膏 |
| EP3946639A4 (en) * | 2019-04-25 | 2023-07-05 | Colgate-Palmolive Company | ORAL CARE COMPOSITIONS AND METHODS OF USE |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3538230A (en) * | 1966-12-05 | 1970-11-03 | Lever Brothers Ltd | Oral compositions containing silica xerogels as cleaning and polishing agents |
| US3551559A (en) * | 1968-07-16 | 1970-12-29 | Lever Brothers Ltd | Process for producing deaerated toothpaste |
| US3705940A (en) * | 1969-02-07 | 1972-12-12 | Degussa | Silicic acid-containing dentifrice |
| US3689637A (en) * | 1969-07-11 | 1972-09-05 | Lever Brothers Ltd | Dentifrice composition |
| US3911104A (en) * | 1970-09-21 | 1975-10-07 | Colgate Palmolive Co | Gel dentifrices |
| US3911102A (en) * | 1970-09-21 | 1975-10-07 | Colgate Palmolive Co | Dentifrices |
| US3803301A (en) * | 1971-06-03 | 1974-04-09 | Colgate Palmolive Co | Clear toothpastes containing visible agglomerates |
| US3711604A (en) * | 1971-07-19 | 1973-01-16 | Colgate Palmolive Co | Fluoride containing transparent dentifrice |
| BE789477A (fr) * | 1971-10-01 | 1973-01-15 | Colgate Palmolive Co | Procede de fabrication de dentifrices exempts de gaz |
| GB1400153A (en) * | 1971-10-05 | 1975-07-16 | Unilever Ltd | Tooth-pastes |
| GB1400154A (en) * | 1971-10-22 | 1975-07-16 | Unilever Ltd | Toothpaste |
| GB1408922A (en) | 1972-02-02 | 1975-10-08 | Blendax Werke Schneider Co | Process and composition for the remineralisation and prevention of demineralisation of human teeth |
| US3935306A (en) * | 1972-04-11 | 1976-01-27 | Colgate-Palmolive Company | Toothpaste formulations |
| US3929987A (en) * | 1972-07-03 | 1975-12-30 | Colgate Palmolive Co | Toothpaste |
| GB1433743A (en) * | 1972-07-21 | 1976-04-28 | Unilever Ltd | Toothpastes |
| US3893840A (en) * | 1972-09-06 | 1975-07-08 | Huber Corp J M | Amorphous precipitated siliceous pigments and methods for their production |
| US3928541A (en) * | 1972-09-05 | 1975-12-23 | Huber Corp J M | Amorphous precipitated siliceous pigments for cosmetic or dentrifrice use and methods for their production |
| US3906090A (en) * | 1972-09-07 | 1975-09-16 | Colgate Palmolive Co | Clear dentifrice |
| ZA737495B (en) * | 1972-10-30 | 1975-05-28 | Colgate Palmolive Co | Toothpastes |
| US3939262A (en) * | 1974-01-21 | 1976-02-17 | Monsanto Company | Dentifrices |
| US4159280A (en) * | 1976-09-15 | 1979-06-26 | J. M. Huber Corporation | Therapeutic dentifrices in unlined container and methods |
| US4141969A (en) * | 1977-02-22 | 1979-02-27 | Colgate-Palmolive Company | Dentifrices containing amorphous silica |
| GR68943B (esLanguage) * | 1977-12-20 | 1982-03-29 | Huber Corp J M |
-
1979
- 1979-10-15 US US06/084,485 patent/US4314990A/en not_active Expired - Lifetime
-
1980
- 1980-10-08 GR GR63082A patent/GR69614B/el unknown
- 1980-10-14 CA CA000362354A patent/CA1145677A/en not_active Expired
- 1980-10-14 PH PH24722A patent/PH15450A/en unknown
- 1980-10-15 JP JP14307180A patent/JPS5695111A/ja active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5215740A (en) * | 1991-10-25 | 1993-06-01 | Church & Dwight Co., Inc. | Buffering system for anticalculus dentifrices |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5695111A (en) | 1981-08-01 |
| GR69614B (esLanguage) | 1982-07-05 |
| US4314990B1 (esLanguage) | 1991-09-03 |
| US4314990A (en) | 1982-02-09 |
| PH15450A (en) | 1983-01-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1145677A (en) | Phosphate buffer in toothpaste with high level of humectant | |
| US4254101A (en) | Toothpaste compositions | |
| US4885155A (en) | Anticalculus compositions using pyrophosphate salt | |
| US4515772A (en) | Oral compositions | |
| US4590066A (en) | Oral compositions | |
| US4684518A (en) | Oral compositions | |
| EP0297213B1 (en) | Oral treatment and use of an oral composition | |
| CA1203754A (en) | Oral hygiene compositions | |
| CA2000168C (en) | Oral compositions | |
| US3227617A (en) | Fluoride dentifrice composition | |
| GB2164256A (en) | Toothpaste compositions | |
| US4726943A (en) | Anti-caries composition | |
| US4772461A (en) | Oral compositions | |
| US4999184A (en) | Oral compositions | |
| US4806339A (en) | Oral compositions | |
| EP0249398A2 (en) | Oral compositions | |
| CA1128420A (en) | Methyloxathiazinone dioxide in oral compositions | |
| US4455293A (en) | Stable dentifrice containing neutral siliceous polishing agent | |
| CA1333885C (en) | Toothpaste | |
| GB2204487A (en) | Oral compositions | |
| JPH0764713B2 (ja) | 新規組成物 | |
| WO1998002135A1 (en) | Stabilized stannous-containing compositions for oral care | |
| IE41676B1 (en) | Oral hygiene compositions | |
| EP0311259A2 (en) | Oral compositions | |
| JPS6041047B2 (ja) | 歯磨組成物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |