CA1145099A - Polyphenylene oxide copolymers - Google Patents
Polyphenylene oxide copolymersInfo
- Publication number
- CA1145099A CA1145099A CA000325422A CA325422A CA1145099A CA 1145099 A CA1145099 A CA 1145099A CA 000325422 A CA000325422 A CA 000325422A CA 325422 A CA325422 A CA 325422A CA 1145099 A CA1145099 A CA 1145099A
- Authority
- CA
- Canada
- Prior art keywords
- formula
- phenol
- vinyl
- alkenylphenol
- oxide copolymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004721 Polyphenylene oxide Substances 0.000 title claims abstract description 23
- 229920006380 polyphenylene oxide Polymers 0.000 title claims abstract description 21
- 229920001577 copolymer Polymers 0.000 claims abstract description 20
- 239000003054 catalyst Substances 0.000 claims abstract description 19
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 claims abstract description 4
- 238000000034 method Methods 0.000 claims description 22
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 15
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 claims description 14
- -1 hydrocarbon radicals Chemical class 0.000 claims description 13
- 239000011572 manganese Substances 0.000 claims description 12
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 9
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical group C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- WREVCRYZAWNLRZ-UHFFFAOYSA-N 2-allyl-6-methyl-phenol Chemical compound CC1=CC=CC(CC=C)=C1O WREVCRYZAWNLRZ-UHFFFAOYSA-N 0.000 claims description 6
- 239000004793 Polystyrene Substances 0.000 claims description 6
- 229920002223 polystyrene Polymers 0.000 claims description 6
- 239000005062 Polybutadiene Substances 0.000 claims description 5
- 229920002857 polybutadiene Polymers 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 239000007789 gas Substances 0.000 claims description 4
- 239000003446 ligand Substances 0.000 claims description 4
- 239000011541 reaction mixture Substances 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 4
- 229920002554 vinyl polymer Polymers 0.000 claims description 4
- WAKHLWOJMHVUJC-FYWRMAATSA-N (2e)-2-hydroxyimino-1,2-diphenylethanol Chemical group C=1C=CC=CC=1C(=N/O)\C(O)C1=CC=CC=C1 WAKHLWOJMHVUJC-FYWRMAATSA-N 0.000 claims description 3
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- WAKHLWOJMHVUJC-UHFFFAOYSA-N benzoin alpha-oxime Natural products C=1C=CC=CC=1C(=NO)C(O)C1=CC=CC=C1 WAKHLWOJMHVUJC-UHFFFAOYSA-N 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 150000002430 hydrocarbons Chemical class 0.000 claims description 3
- 239000003999 initiator Substances 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- 229910052723 transition metal Inorganic materials 0.000 claims description 3
- 150000003624 transition metals Chemical class 0.000 claims description 3
- ZGWWUDNVAQKNJG-UHFFFAOYSA-N 2,6-bis(ethenyl)phenol Chemical compound OC1=C(C=C)C=CC=C1C=C ZGWWUDNVAQKNJG-UHFFFAOYSA-N 0.000 claims description 2
- BKNHBPOZNKMOTO-UHFFFAOYSA-N 2-ethenyl-6-methylphenol Chemical compound CC1=CC=CC(C=C)=C1O BKNHBPOZNKMOTO-UHFFFAOYSA-N 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 229930195735 unsaturated hydrocarbon Natural products 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims 3
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 2
- LWOXJLQPZSEEOD-UHFFFAOYSA-N 2-ethenyl-6-ethylphenol Chemical compound CCC1=CC=CC(C=C)=C1O LWOXJLQPZSEEOD-UHFFFAOYSA-N 0.000 claims 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 abstract description 2
- 239000013522 chelant Substances 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000000178 monomer Substances 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 5
- 229910052748 manganese Inorganic materials 0.000 description 5
- 150000002923 oximes Chemical class 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- 229920000265 Polyparaphenylene Polymers 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000007334 copolymerization reaction Methods 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000002635 aromatic organic solvent Substances 0.000 description 2
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- BTYLJLLMYNHHNC-UHFFFAOYSA-N 1-hydroxy-1-phenylbutan-2-one Chemical compound CCC(=O)C(O)C1=CC=CC=C1 BTYLJLLMYNHHNC-UHFFFAOYSA-N 0.000 description 1
- WCVOGSZTONGSQY-UHFFFAOYSA-N 2,4,6-trichloroanisole Chemical compound COC1=C(Cl)C=C(Cl)C=C1Cl WCVOGSZTONGSQY-UHFFFAOYSA-N 0.000 description 1
- RGWXSQCOYFRTKU-UHFFFAOYSA-N 2,6-didodecylphenol Chemical compound CCCCCCCCCCCCC1=CC=CC(CCCCCCCCCCCC)=C1O RGWXSQCOYFRTKU-UHFFFAOYSA-N 0.000 description 1
- METWAQRCMRWDAW-UHFFFAOYSA-N 2,6-diethylphenol Chemical compound CCC1=CC=CC(CC)=C1O METWAQRCMRWDAW-UHFFFAOYSA-N 0.000 description 1
- ATGFTMUSEPZNJD-UHFFFAOYSA-N 2,6-diphenylphenol Chemical compound OC1=C(C=2C=CC=CC=2)C=CC=C1C1=CC=CC=C1 ATGFTMUSEPZNJD-UHFFFAOYSA-N 0.000 description 1
- NAILKKRDWBJCNH-UHFFFAOYSA-N 2,6-dipropylphenol Chemical class CCCC1=CC=CC(CCC)=C1O NAILKKRDWBJCNH-UHFFFAOYSA-N 0.000 description 1
- HOEFKWVMQYMLHU-UHFFFAOYSA-N 2-hydroxyimino-1,2-bis(4-methoxyphenyl)ethanol Chemical compound C1=CC(OC)=CC=C1C(O)C(=NO)C1=CC=C(OC)C=C1 HOEFKWVMQYMLHU-UHFFFAOYSA-N 0.000 description 1
- QKLLBCGVADVPKD-UHFFFAOYSA-N 3-hydroxyimino-2-methylbutan-2-ol Chemical compound ON=C(C)C(C)(C)O QKLLBCGVADVPKD-UHFFFAOYSA-N 0.000 description 1
- LJOBNZKCJNRMFE-UHFFFAOYSA-N 3-hydroxyiminobutan-2-ol Chemical compound CC(O)C(C)=NO LJOBNZKCJNRMFE-UHFFFAOYSA-N 0.000 description 1
- RIGUXCDLUKALKD-UHFFFAOYSA-N 4-hydroxyimino-2-methylpentan-2-ol Chemical compound ON=C(C)CC(C)(C)O RIGUXCDLUKALKD-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- 102100024133 Coiled-coil domain-containing protein 50 Human genes 0.000 description 1
- 239000004243 E-number Substances 0.000 description 1
- 235000019227 E-number Nutrition 0.000 description 1
- 101000910772 Homo sapiens Coiled-coil domain-containing protein 50 Proteins 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 244000028419 Styrax benzoin Species 0.000 description 1
- 235000000126 Styrax benzoin Nutrition 0.000 description 1
- 235000008411 Sumatra benzointree Nutrition 0.000 description 1
- 238000004847 absorption spectroscopy Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000003934 aromatic aldehydes Chemical class 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 229960002130 benzoin Drugs 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- RAABOESOVLLHRU-UHFFFAOYSA-N diazene Chemical compound N=N RAABOESOVLLHRU-UHFFFAOYSA-N 0.000 description 1
- 229910000071 diazene Inorganic materials 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- FRLYCQKXKFBTAL-UHFFFAOYSA-N ethene;2-hydroxybenzaldehyde Chemical group C=C.OC1=CC=CC=C1C=O.OC1=CC=CC=C1C=O FRLYCQKXKFBTAL-UHFFFAOYSA-N 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- 238000010559 graft polymerization reaction Methods 0.000 description 1
- 235000019382 gum benzoic Nutrition 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 238000005691 oxidative coupling reaction Methods 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003739 xylenols Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G65/00—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule
- C08G65/34—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives
- C08G65/38—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives derived from phenols
- C08G65/44—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives derived from phenols by oxidation of phenols
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F283/00—Macromolecular compounds obtained by polymerising monomers on to polymers provided for in subclass C08G
- C08F283/06—Macromolecular compounds obtained by polymerising monomers on to polymers provided for in subclass C08G on to polyethers, polyoxymethylenes or polyacetals
- C08F283/08—Macromolecular compounds obtained by polymerising monomers on to polymers provided for in subclass C08G on to polyethers, polyoxymethylenes or polyacetals on to polyphenylene oxides
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyethers (AREA)
- Graft Or Block Polymers (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Macromonomer-Based Addition Polymer (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/904,272 US4207406A (en) | 1978-05-09 | 1978-05-09 | Process for preparing polyphenylene oxide copolymers |
| US904,272 | 1978-05-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1145099A true CA1145099A (en) | 1983-04-19 |
Family
ID=25418863
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000325422A Expired CA1145099A (en) | 1978-05-09 | 1979-04-12 | Polyphenylene oxide copolymers |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4207406A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS54161700A (cg-RX-API-DMAC7.html) |
| AU (1) | AU4678179A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1145099A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2917819A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2425456A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB2020296B (cg-RX-API-DMAC7.html) |
| NL (1) | NL7903370A (cg-RX-API-DMAC7.html) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS55112260A (en) * | 1979-02-23 | 1980-08-29 | Sumitomo Chem Co Ltd | Manufacture of graft copolymer |
| US4287321A (en) * | 1979-12-10 | 1981-09-01 | General Electric Company | Poly(phenylene ether)poly(vinyl aromatic) compositions |
| DE3047366A1 (de) * | 1980-12-16 | 1982-07-22 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von polyphenylenaethern |
| JPS5827719A (ja) * | 1981-08-11 | 1983-02-18 | Mitsubishi Chem Ind Ltd | 側鎖にアリル基を有するポリフエニレンエ−テル |
| US4564656A (en) * | 1983-10-19 | 1986-01-14 | General Electric Company | Preparation of graft copolymers of polyphenylene ether and rubber, optionally including poly(alkenyl aromatic) |
| US5091480A (en) * | 1984-03-06 | 1992-02-25 | The B. F. Goodrich Company | Comb-like polymers and graft copolymers from polyarylene polyether macromonomers |
| US4806601A (en) * | 1984-11-08 | 1989-02-21 | The B. F. Goodrich Company | Polyarylene polyethers with pendant vinyl and ethynyl groups and process for preparation thereof |
| US4634742A (en) * | 1984-11-08 | 1987-01-06 | The B. F. Goodrich Company | Polyarylene polyethers with pendant vinyl groups and process for preparation thereof |
| EP0309025B1 (en) * | 1987-09-09 | 1995-05-17 | Asahi Kasei Kogyo Kabushiki Kaisha | A cured polyphenylene ether resin and a curable polyphenylene ether resin |
| US5218030A (en) * | 1989-02-08 | 1993-06-08 | Asahi Kasei Kogyo Kabushiki Kaisha | Curable polyphenylene ether resin composition and a cured resin composition obtainable therefrom |
| US20080085989A1 (en) * | 2006-10-05 | 2008-04-10 | Gary William Yeager | Poly(arylene ether) copolymer |
| US20080076885A1 (en) * | 2006-09-21 | 2008-03-27 | Gary William Yeager | Poly(arylene ether) composition and method |
| WO2008036454A1 (en) * | 2006-09-21 | 2008-03-27 | Sabic Innovative Plastics Ip B.V. | Poly (arylene ether) copolymer |
| US20080076884A1 (en) * | 2006-09-21 | 2008-03-27 | Gary William Yeager | Poly(arylene ether) composition and method |
| CN111286023B (zh) * | 2019-12-06 | 2022-07-08 | 中国科学院大连化学物理研究所 | 一种负载型催化剂及其在制备可交联聚苯醚中的应用 |
Family Cites Families (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3382212A (en) * | 1959-06-17 | 1968-05-07 | Gen Tire & Rubber Co | Process for preparing polyphenylene ethers |
| US3219626A (en) * | 1961-05-29 | 1965-11-23 | Gen Electric | Process for oxidizing phenols to polyphenyl ethers and diphenoquinones |
| NL295699A (cg-RX-API-DMAC7.html) * | 1962-07-24 | |||
| NL295748A (cg-RX-API-DMAC7.html) * | 1962-07-24 | |||
| US3257357A (en) * | 1963-04-01 | 1966-06-21 | Du Pont | Copolymers of polyphenylene ethers |
| NL293968A (cg-RX-API-DMAC7.html) * | 1963-06-12 | |||
| US3257358A (en) * | 1963-07-02 | 1966-06-21 | Du Pont | 2, 6-dichloro-1, 4-polyphenylene ether |
| US3220979A (en) * | 1964-03-27 | 1965-11-30 | Sun Oil Co | Preparation of aromatic phenols |
| US3342892A (en) * | 1964-08-07 | 1967-09-19 | Eastman Kodak Co | Preparation of linear polyaryl ethers |
| GB1125620A (en) * | 1965-01-06 | 1968-08-28 | Gen Electric | Improvements in polymeric blends |
| DE1570458A1 (de) * | 1965-07-14 | 1969-09-18 | Dynamit Nobel Ag | Verfahren zur Herstellung von Polyphenylenoxyden |
| DE1595609C3 (de) * | 1966-03-24 | 1974-03-21 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Polyarylene them |
| US3455880A (en) * | 1966-11-14 | 1969-07-15 | Asahi Chemical Ind | Process for producing polyphenylene ethers |
| US3440217A (en) * | 1967-01-11 | 1969-04-22 | North American Rockwell | Process for controlling the chain length of poly(phenylene oxides) |
| DE1745432C3 (de) * | 1967-02-03 | 1973-09-13 | Sumitomo Chemical Co. Ltd., Osaka (Japan) | Verfahren zur Herstellung von makro molekularen Polyphenylenoxiden |
| FR1568257A (cg-RX-API-DMAC7.html) * | 1967-03-28 | 1969-05-23 | ||
| US3356761A (en) * | 1967-04-12 | 1967-12-05 | Gen Electric | Melt processable polyphenylene ether and process |
| US3384619A (en) * | 1967-05-18 | 1968-05-21 | Toyo Rayon Co Ltd | Process for manufacture of polyphenylene ethers |
| DK134784C (da) * | 1968-12-28 | 1977-06-06 | Sumitomo Chemical Co | Fremgangsmade til fremstilling af modificerede polyphenylenoxider med forbedret varmebestandighed |
| DE2061116B2 (de) * | 1969-12-16 | 1973-02-01 | Sumitomo Chemical Co Ltd , Osaka (Japan) | Verfahren zur herstellung von polyphenylenoxiden |
| JPS4826395B1 (cg-RX-API-DMAC7.html) * | 1970-12-01 | 1973-08-09 | ||
| JPS5213395B2 (cg-RX-API-DMAC7.html) * | 1971-08-07 | 1977-04-14 | ||
| JPS4826398A (cg-RX-API-DMAC7.html) * | 1971-08-09 | 1973-04-06 | ||
| DE2305618A1 (de) * | 1973-02-06 | 1974-08-15 | Hoechst Ag | Polyphenylenaether |
| US3956242A (en) * | 1974-07-24 | 1976-05-11 | General Electric Company | Preparation of polyphenylene oxide using a manganese (II) ω-hydroxyoxime chelate reaction promoter |
| US4054553A (en) * | 1975-06-02 | 1977-10-18 | General Electric Company | Polyphenylene oxide process |
| US4097462A (en) * | 1976-01-23 | 1978-06-27 | General Electric Company | Process for making polyphenylene oxides |
-
1978
- 1978-05-09 US US05/904,272 patent/US4207406A/en not_active Expired - Lifetime
-
1979
- 1979-03-07 GB GB7907968A patent/GB2020296B/en not_active Expired
- 1979-04-12 CA CA000325422A patent/CA1145099A/en not_active Expired
- 1979-04-27 NL NL7903370A patent/NL7903370A/xx not_active Application Discontinuation
- 1979-05-03 DE DE19792917819 patent/DE2917819A1/de active Granted
- 1979-05-08 JP JP5535579A patent/JPS54161700A/ja active Pending
- 1979-05-08 AU AU46781/79A patent/AU4678179A/en not_active Abandoned
- 1979-05-08 FR FR7911571A patent/FR2425456A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| GB2020296B (en) | 1982-08-18 |
| AU4678179A (en) | 1979-11-15 |
| GB2020296A (en) | 1979-11-14 |
| JPS54161700A (en) | 1979-12-21 |
| NL7903370A (nl) | 1979-11-13 |
| FR2425456A1 (fr) | 1979-12-07 |
| DE2917819A1 (de) | 1979-11-15 |
| US4207406A (en) | 1980-06-10 |
| DE2917819C2 (cg-RX-API-DMAC7.html) | 1987-11-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1145099A (en) | Polyphenylene oxide copolymers | |
| US5091480A (en) | Comb-like polymers and graft copolymers from polyarylene polyether macromonomers | |
| CN1034418C (zh) | 用环状酸酐对聚苯醚或相类似聚合物改性的方法 | |
| US4092294A (en) | Method for preparing polyphenylene ethers | |
| CA1073594A (en) | Polyphenylene ether and process for preparing the same | |
| US4098846A (en) | Polyphenylene oxide polystyrene product-by-process | |
| Chung | Synthesis of polyalcohols via Ziegler-Natta polymerization | |
| CA1159190A (en) | Method of manufacturing a graft copolymer comprising polyphenylene ether | |
| Nugent et al. | Synthesis of face-to-face metallocene polymers | |
| US3970640A (en) | Process for the production of polyphenylene ethers having a desired polymerization degree | |
| US5124410A (en) | Reactive graft polymers | |
| US4477651A (en) | Process for preparing polyphenylene oxides | |
| US4927894A (en) | Method for preparation of aryloxytriazine-capped polyphenylene ethers | |
| EP0446682A1 (en) | Method for preparing hydroxyalkyl-functionalized polyphenylene ether | |
| Asami et al. | Preparation and Radical Polymerization of p-Vinylphenoxyl Polytetrahydrofuran Macromer | |
| US3900445A (en) | Process for the preparation of polyphenylene ethers with cuprous and cupric amine catalyst | |
| US4517341A (en) | Process for preparing polyphenylene oxide-rubber graft copolymers and products obtained thereby | |
| US4287321A (en) | Poly(phenylene ether)poly(vinyl aromatic) compositions | |
| US4196278A (en) | Method for the controlled polymerization of polyphenylene oxide polymers | |
| US4189417A (en) | Process for the polymerization of alkenyl aromatic monomers in the presence of polyphenylene oxides | |
| US4093597A (en) | Polymerization of 2,6-di-substituted phenols | |
| US4184034A (en) | Manganese benzoin-imine catalysts and process of preparing polyphenylene ethers using said compounds as catalysts | |
| US4118348A (en) | Method for preparing blends of rubber, a polyphenylene ether resin and an alkenyl aromatic addition polymer | |
| US4808674A (en) | Aryl ester-grafted polyphenylene ethers and phenylene ether-amide graft copolymers prepared therefrom | |
| Cakmak et al. | Synthesis of triblock copolymers via photopolymerization of styrene and methyl methacrylate using macrophotoinitiators possessing poly (ethylene glycol) units |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |