CA1129588A - Transparent polyamides, processes for producing them, and their use for the production of moulded articles - Google Patents
Transparent polyamides, processes for producing them, and their use for the production of moulded articlesInfo
- Publication number
- CA1129588A CA1129588A CA337,676A CA337676A CA1129588A CA 1129588 A CA1129588 A CA 1129588A CA 337676 A CA337676 A CA 337676A CA 1129588 A CA1129588 A CA 1129588A
- Authority
- CA
- Canada
- Prior art keywords
- atoms
- alkyl
- formula
- hydrogen
- alkylene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004952 Polyamide Substances 0.000 title claims abstract description 50
- 229920002647 polyamide Polymers 0.000 title claims abstract description 50
- 238000000034 method Methods 0.000 title claims abstract description 18
- 238000004519 manufacturing process Methods 0.000 title abstract description 8
- 239000001257 hydrogen Substances 0.000 claims abstract description 21
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 21
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 8
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 6
- 125000001997 phenyl group Chemical class [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 6
- 125000003107 substituted aryl group Chemical group 0.000 claims abstract description 6
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims abstract description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 66
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 38
- 125000000217 alkyl group Chemical group 0.000 claims description 38
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 26
- 239000000203 mixture Substances 0.000 claims description 18
- 150000004985 diamines Chemical class 0.000 claims description 15
- 125000002947 alkylene group Chemical group 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 125000004817 pentamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 claims description 7
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 claims description 6
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 claims description 6
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims description 5
- 150000001555 benzenes Chemical class 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract description 18
- -1 R2 = H Chemical group 0.000 abstract description 10
- 238000010521 absorption reaction Methods 0.000 abstract description 4
- 230000007062 hydrolysis Effects 0.000 abstract description 4
- 238000006460 hydrolysis reaction Methods 0.000 abstract description 4
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 abstract 3
- 238000006243 chemical reaction Methods 0.000 description 25
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 22
- 150000003839 salts Chemical class 0.000 description 21
- 150000001875 compounds Chemical class 0.000 description 16
- 238000005984 hydrogenation reaction Methods 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 238000006068 polycondensation reaction Methods 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- ZNBNBTIDJSKEAM-UHFFFAOYSA-N 4-[7-hydroxy-2-[5-[5-[6-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxan-2-yl]-3-methyloxolan-2-yl]-5-methyloxolan-2-yl]-2,8-dimethyl-1,10-dioxaspiro[4.5]decan-9-yl]-2-methyl-3-propanoyloxypentanoic acid Chemical compound C1C(O)C(C)C(C(C)C(OC(=O)CC)C(C)C(O)=O)OC11OC(C)(C2OC(C)(CC2)C2C(CC(O2)C2C(CC(C)C(O)(CO)O2)C)C)CC1 ZNBNBTIDJSKEAM-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- HPGJOUYGWKFYQW-UHFFFAOYSA-N diphenyl benzene-1,4-dicarboxylate Chemical compound C=1C=C(C(=O)OC=2C=CC=CC=2)C=CC=1C(=O)OC1=CC=CC=C1 HPGJOUYGWKFYQW-UHFFFAOYSA-N 0.000 description 4
- 229910000378 hydroxylammonium sulfate Inorganic materials 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- BUAVBORLHRCLMY-UHFFFAOYSA-N 11,11-dimethyl-2-propan-2-yl-1-azacyclododeca-4,8,12-triene Chemical compound CC(C)C1CC=CCCC=CCC(C)(C)C=N1 BUAVBORLHRCLMY-UHFFFAOYSA-N 0.000 description 3
- UNNGUFMVYQJGTD-UHFFFAOYSA-N 2-Ethylbutanal Chemical compound CCC(CC)C=O UNNGUFMVYQJGTD-UHFFFAOYSA-N 0.000 description 3
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 230000009477 glass transition Effects 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 238000006317 isomerization reaction Methods 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000010948 rhodium Substances 0.000 description 3
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 3
- 229910003450 rhodium oxide Inorganic materials 0.000 description 3
- IZOLJROVHBOURY-UHFFFAOYSA-N 11,11-diethyl-2-pentan-3-yl-1-azacyclododec-12-ene Chemical compound CCC(CC)C1CCCCCCCCC(CC)(CC)C=N1 IZOLJROVHBOURY-UHFFFAOYSA-N 0.000 description 2
- MYZAWOWDJUQPAS-UHFFFAOYSA-N 11,11-dimethyl-2-phenyl-1-azacyclododeca-4,8,12-triene Chemical compound N1=CC(C)(C)CC=CCCC=CCC1C1=CC=CC=C1 MYZAWOWDJUQPAS-UHFFFAOYSA-N 0.000 description 2
- MICKYOBSRYQTBZ-UHFFFAOYSA-N 11-methyl-2-pent-3-en-2-yl-1-azacyclododeca-4,8,12-triene Chemical compound CC=CC(C)C1CC=CCCC=CCC(C)C=N1 MICKYOBSRYQTBZ-UHFFFAOYSA-N 0.000 description 2
- PTQSIWIKVXOBIQ-UHFFFAOYSA-N 12-ethyl-2-methyltetradecane-1,11-diamine Chemical compound CCC(CC)C(N)CCCCCCCCC(C)CN PTQSIWIKVXOBIQ-UHFFFAOYSA-N 0.000 description 2
- DPQHRXRAZHNGRU-UHFFFAOYSA-N 2,4,4-trimethylhexane-1,6-diamine Chemical compound NCC(C)CC(C)(C)CCN DPQHRXRAZHNGRU-UHFFFAOYSA-N 0.000 description 2
- FZZMTSNZRBFGGU-UHFFFAOYSA-N 2-chloro-7-fluoroquinazolin-4-amine Chemical compound FC1=CC=C2C(N)=NC(Cl)=NC2=C1 FZZMTSNZRBFGGU-UHFFFAOYSA-N 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- TUVFMMNANXKTRP-UHFFFAOYSA-N Ethenamine, N-methylene- Chemical compound C=CN=C TUVFMMNANXKTRP-UHFFFAOYSA-N 0.000 description 2
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 125000006267 biphenyl group Chemical group 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 230000007717 exclusion Effects 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical class NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- XKBQSUGDDYFSTO-UHFFFAOYSA-N n-(11-amino-2,2,12-trimethyltrideca-4,8-dienylidene)hydroxylamine Chemical compound CC(C)C(N)CC=CCCC=CCC(C)(C)C=NO XKBQSUGDDYFSTO-UHFFFAOYSA-N 0.000 description 2
- DIFJYPRAXNPQSM-UHFFFAOYSA-N n-(11-amino-2,2,12-trimethyltridecylidene)hydroxylamine Chemical compound CC(C)C(N)CCCCCCCCC(C)(C)C=NO DIFJYPRAXNPQSM-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- XXJGBENTLXFVFI-UHFFFAOYSA-N 1-amino-methylene Chemical compound N[CH2] XXJGBENTLXFVFI-UHFFFAOYSA-N 0.000 description 1
- FKFHKVCXOFXYSK-UHFFFAOYSA-N 1-cyclohexyl-n-(cyclohexylidenemethyl)methanimine Chemical compound C1CCCCC1C=NC=C1CCCCC1 FKFHKVCXOFXYSK-UHFFFAOYSA-N 0.000 description 1
- ZEIHVTGSMDVOBJ-UHFFFAOYSA-N 1-cyclopentyl-n-(cyclopentylidenemethyl)methanimine Chemical compound C1CCCC1C=NC=C1CCCC1 ZEIHVTGSMDVOBJ-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- XLRULVHCDYONHI-UHFFFAOYSA-N 11,11-diethyl-2-pentan-3-yl-1-azacyclododeca-4,8,12-triene Chemical compound CCC(CC)C1CC=CCCC=CCC(CC)(CC)C=N1 XLRULVHCDYONHI-UHFFFAOYSA-N 0.000 description 1
- AGDMMBRAZUXBSJ-UHFFFAOYSA-N 11,11-dimethyl-2-propan-2-yl-1-azacyclododec-12-ene Chemical compound CC(C)C1CCCCCCCCC(C)(C)C=N1 AGDMMBRAZUXBSJ-UHFFFAOYSA-N 0.000 description 1
- CUBYHOYPWBPMNS-UHFFFAOYSA-N 11,11-dimethyl-2-propan-2-yl-azacyclododecane Chemical compound CC(C)C1CCCCCCCCC(C)(C)CN1 CUBYHOYPWBPMNS-UHFFFAOYSA-N 0.000 description 1
- ORQORZZIDRCLDN-UHFFFAOYSA-N 2,2,12-triethyltetradecane-1,11-diamine Chemical compound CCC(CC)C(N)CCCCCCCCC(CC)(CC)CN ORQORZZIDRCLDN-UHFFFAOYSA-N 0.000 description 1
- WDIUCIDPHVGGKD-UHFFFAOYSA-N 2-ethyl-n-(2-ethylbut-1-enyl)butan-1-imine Chemical compound CCC(CC)C=NC=C(CC)CC WDIUCIDPHVGGKD-UHFFFAOYSA-N 0.000 description 1
- SXSKAWDSYGQTAC-UHFFFAOYSA-N 2-methyl-n-(2-methylprop-1-enyl)propan-1-imine Chemical compound CC(C)C=NC=C(C)C SXSKAWDSYGQTAC-UHFFFAOYSA-N 0.000 description 1
- VXDHQYLFEYUMFY-UHFFFAOYSA-N 2-methylprop-2-en-1-amine Chemical compound CC(=C)CN VXDHQYLFEYUMFY-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- KHCHDTPQBNDGAK-UHFFFAOYSA-N 4-ethyl-2-methylhexane-1,6-diamine Chemical compound NCCC(CC)CC(C)CN KHCHDTPQBNDGAK-UHFFFAOYSA-N 0.000 description 1
- KYARBIJYVGJZLB-UHFFFAOYSA-N 7-amino-4-hydroxy-2-naphthalenesulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KYARBIJYVGJZLB-UHFFFAOYSA-N 0.000 description 1
- FDZUQHGOHLHDAD-UHFFFAOYSA-N CCNC=CC=C(C)C=C Chemical compound CCNC=CC=C(C)C=C FDZUQHGOHLHDAD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical class CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical class CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000004955 Trogamid T Substances 0.000 description 1
- 125000005263 alkylenediamine group Chemical group 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 150000003939 benzylamines Chemical class 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- KVFDZFBHBWTVID-UHFFFAOYSA-N cyclohexanecarbaldehyde Chemical compound O=CC1CCCCC1 KVFDZFBHBWTVID-UHFFFAOYSA-N 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- DWNAQMUDCDVSLT-UHFFFAOYSA-N diphenyl phthalate Chemical compound C=1C=CC=C(C(=O)OC=2C=CC=CC=2)C=1C(=O)OC1=CC=CC=C1 DWNAQMUDCDVSLT-UHFFFAOYSA-N 0.000 description 1
- GCPCLEKQVMKXJM-UHFFFAOYSA-N ethoxy(diethyl)alumane Chemical compound CCO[Al](CC)CC GCPCLEKQVMKXJM-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- HZCVMHDBECNRTL-UHFFFAOYSA-N n-(11-amino-2,12-dimethylpentadeca-4,8,13-trienylidene)hydroxylamine Chemical compound CC=CC(C)C(N)CC=CCCC=CCC(C)C=NO HZCVMHDBECNRTL-UHFFFAOYSA-N 0.000 description 1
- ULVISLMXHHFXFN-UHFFFAOYSA-N n-(11-amino-2,2-dimethyl-11-phenylundeca-4,8-dienylidene)hydroxylamine Chemical compound ON=CC(C)(C)CC=CCCC=CCC(N)C1=CC=CC=C1 ULVISLMXHHFXFN-UHFFFAOYSA-N 0.000 description 1
- GTUGTQZAVJESCS-UHFFFAOYSA-N n-(2-methylprop-1-enyl)cyclohexanimine Chemical compound CC(C)=CN=C1CCCCC1 GTUGTQZAVJESCS-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- BMGNSKKZFQMGDH-FDGPNNRMSA-L nickel(2+);(z)-4-oxopent-2-en-2-olate Chemical compound [Ni+2].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O BMGNSKKZFQMGDH-FDGPNNRMSA-L 0.000 description 1
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical group C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229910003445 palladium oxide Inorganic materials 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229940067157 phenylhydrazine Drugs 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 229910001925 ruthenium oxide Inorganic materials 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- DUIOPKIIICUYRZ-UHFFFAOYSA-N semicarbazide Chemical compound NNC(N)=O DUIOPKIIICUYRZ-UHFFFAOYSA-N 0.000 description 1
- 150000007659 semicarbazones Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000002311 subsequent effect Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000003503 terephthalic acid derivatives Chemical class 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/26—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyamides (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1077178 | 1978-10-18 | ||
| CH10771/78-6 | 1978-10-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1129588A true CA1129588A (en) | 1982-08-10 |
Family
ID=4366690
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA337,676A Expired CA1129588A (en) | 1978-10-18 | 1979-10-16 | Transparent polyamides, processes for producing them, and their use for the production of moulded articles |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4297480A (enExample) |
| EP (1) | EP0012712B1 (enExample) |
| JP (2) | JPS5556125A (enExample) |
| CA (1) | CA1129588A (enExample) |
| DE (1) | DE2963644D1 (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3366159D1 (en) * | 1982-01-29 | 1986-10-23 | Ciba Geigy Ag | Transparent, cross-linkable polyamides |
| EP0085652B1 (de) * | 1982-01-29 | 1985-03-13 | Ciba-Geigy Ag | 1,10-substituierte 10-Amino-deca-3,7-dien-nitrile und Verfahren zu deren Herstellung |
| JP2562863Y2 (ja) * | 1991-06-11 | 1998-02-16 | 株式会社ケーヒン | 定流量弁 |
| US20110028679A1 (en) * | 2007-11-26 | 2011-02-03 | Cognis Ip Management Gmbh | Polyamides Prepared From Long-Chain Dicarboxylic Acids and Methods for Making the Polyamides |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2277125A (en) * | 1939-10-05 | 1942-03-24 | Du Pont | Preparation of polyamides |
| NL264738A (enExample) * | 1959-10-29 | |||
| US3145193A (en) * | 1959-10-29 | 1964-08-18 | Grace W R & Co | Polyamides from a mixture of isophthalic acid, terephthalic acid and branched chain aliphatic diamine |
| NL264981A (enExample) * | 1961-05-08 | |||
| NL126608C (enExample) * | 1961-05-08 | |||
| US3563959A (en) * | 1966-06-25 | 1971-02-16 | Dynamit Nobel Ag | Process for the production of transparent polyamides which are resistant to boiling |
| GB1251520A (enExample) | 1968-11-04 | 1971-10-27 | ||
| US3706802A (en) * | 1969-09-26 | 1972-12-19 | Universal Oil Prod Co | N-(2,2-di-substituted-vinyl)-arylimines |
| CH570389A5 (enExample) * | 1972-06-16 | 1975-12-15 | Ciba Geigy Ag | |
| CH630932A5 (de) * | 1977-10-28 | 1982-07-15 | Ciba Geigy Ag | Verfahren zur herstellung von neuen transparenten polyamiden. |
-
1979
- 1979-10-09 US US06/083,142 patent/US4297480A/en not_active Expired - Lifetime
- 1979-10-12 EP EP79810124A patent/EP0012712B1/de not_active Expired
- 1979-10-12 DE DE7979810124T patent/DE2963644D1/de not_active Expired
- 1979-10-16 CA CA337,676A patent/CA1129588A/en not_active Expired
- 1979-10-18 JP JP13366879A patent/JPS5556125A/ja active Granted
-
1987
- 1987-11-25 JP JP62295418A patent/JPS63146926A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0144247B2 (enExample) | 1989-09-26 |
| DE2963644D1 (en) | 1982-10-28 |
| EP0012712A1 (de) | 1980-06-25 |
| JPS5556125A (en) | 1980-04-24 |
| JPS63146926A (ja) | 1988-06-18 |
| US4297480A (en) | 1981-10-27 |
| JPS6331498B2 (enExample) | 1988-06-24 |
| EP0012712B1 (de) | 1982-09-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2647146A (en) | Process for the preparation of diprimary diamines | |
| CA1129588A (en) | Transparent polyamides, processes for producing them, and their use for the production of moulded articles | |
| US2891088A (en) | Di(cyanoalkyl) and di(cyanoalkenyl) polyhydrocarbylxylylenes | |
| CA1127798A (en) | Transparent copolyamides, processes for producing them, and the use thereof for the production of molded articles | |
| US4355177A (en) | Substituted 11-amino-undeca-4,8-dienal and 11-amino-undecanal derivatives and processes for their preparation | |
| US4433137A (en) | Transparent polyamide from branched chain arylene diamine | |
| US4210742A (en) | Transparent polyamides from branched chain diamine | |
| JPH0132850B2 (enExample) | ||
| US4210743A (en) | Transparent polyamides from branched chain diamines | |
| US4487947A (en) | Substituted 1,11-diaminoundecanes, processes for producing them, and their use | |
| US4258177A (en) | Transparent copolyamide from 1,10-disubstituted C10 diamine | |
| US4429110A (en) | Transparent polyamide from branched chain arylalkyl diamine | |
| US4506099A (en) | Process for producing substituted 1,11-diaminoundecanes | |
| CA1127797A (en) | Transparent copolyamides, processes for producing them, and the use thereof for the production of moulded articles | |
| CA1120192A (en) | Aliphatic polyamides | |
| US4279834A (en) | Method for synthesizing dinitriles, products obtained thereby and their derivatives | |
| DE2434966A1 (de) | O,o,o',o'-tetraalkylsubstituierte biscyclohexanole | |
| GB1604698A (en) | Production of polyamides |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |