CA1095915A - Bis(1h-tetrazole-5-carboxamide) compounds - Google Patents
Bis(1h-tetrazole-5-carboxamide) compoundsInfo
- Publication number
- CA1095915A CA1095915A CA294,289A CA294289A CA1095915A CA 1095915 A CA1095915 A CA 1095915A CA 294289 A CA294289 A CA 294289A CA 1095915 A CA1095915 A CA 1095915A
- Authority
- CA
- Canada
- Prior art keywords
- tetrazole
- bis
- carboxamide
- compound
- hydrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- FLABMTVDNODXQV-UHFFFAOYSA-N 2h-tetrazole-5-carboxamide Chemical class NC(=O)C=1N=NNN=1 FLABMTVDNODXQV-UHFFFAOYSA-N 0.000 title claims 2
- 150000003839 salts Chemical class 0.000 claims abstract description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 15
- 239000001257 hydrogen Substances 0.000 claims abstract description 15
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 7
- 150000001875 compounds Chemical class 0.000 claims description 48
- 238000000034 method Methods 0.000 claims description 27
- 230000008569 process Effects 0.000 claims description 21
- 229910052757 nitrogen Inorganic materials 0.000 claims description 13
- 125000005843 halogen group Chemical group 0.000 claims description 12
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 6
- -1 2,4-dimethoxybenzyl Chemical group 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- AJTFKMIYTBCMHT-UHFFFAOYSA-N n-[6-(2h-tetrazole-5-carbonylamino)pyridin-2-yl]-2h-tetrazole-5-carboxamide Chemical compound N1=NNN=C1C(=O)NC(N=1)=CC=CC=1NC(=O)C=1N=NNN=1 AJTFKMIYTBCMHT-UHFFFAOYSA-N 0.000 claims description 4
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- PEWSYZLOJYTSGZ-UHFFFAOYSA-N n-[4-ethoxy-6-(2h-tetrazole-5-carbonylamino)pyridin-2-yl]-2h-tetrazole-5-carboxamide Chemical compound N=1C(NC(=O)C=2NN=NN=2)=CC(OCC)=CC=1NC(=O)C1=NN=NN1 PEWSYZLOJYTSGZ-UHFFFAOYSA-N 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 6
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims 1
- ZYRKLZDLGWQMEH-UHFFFAOYSA-N n-[2-chloro-5-cyano-3-(2h-tetrazole-5-carbonylamino)phenyl]-2h-tetrazole-5-carboxamide Chemical compound C1=C(C#N)C=C(NC(=O)C=2NN=NN=2)C(Cl)=C1NC(=O)C1=NN=NN1 ZYRKLZDLGWQMEH-UHFFFAOYSA-N 0.000 claims 1
- VSSZEBJPHDKAKL-UHFFFAOYSA-N n-[3-cyano-5-(2h-tetrazole-5-carbonylamino)phenyl]-2h-tetrazole-5-carboxamide Chemical compound N=1N=NNC=1C(=O)NC(C=C(C=1)C#N)=CC=1NC(=O)C1=NN=NN1 VSSZEBJPHDKAKL-UHFFFAOYSA-N 0.000 claims 1
- KHHFNEVBKSXKNB-UHFFFAOYSA-N n-[4-chloro-6-(2h-tetrazole-5-carbonylamino)pyridin-2-yl]-2h-tetrazole-5-carboxamide Chemical compound N=1C(NC(=O)C=2NN=NN=2)=CC(Cl)=CC=1NC(=O)C1=NN=NN1 KHHFNEVBKSXKNB-UHFFFAOYSA-N 0.000 claims 1
- 150000003536 tetrazoles Chemical class 0.000 abstract description 17
- 230000003266 anti-allergic effect Effects 0.000 abstract description 6
- 206010003645 Atopy Diseases 0.000 abstract description 5
- 230000000172 allergic effect Effects 0.000 abstract description 5
- 208000010668 atopic eczema Diseases 0.000 abstract description 5
- 125000001589 carboacyl group Chemical group 0.000 abstract description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 abstract description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract description 3
- 125000001475 halogen functional group Chemical group 0.000 abstract 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- 235000013350 formula milk Nutrition 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 241001465754 Metazoa Species 0.000 description 10
- 230000005764 inhibitory process Effects 0.000 description 10
- 241000700159 Rattus Species 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 8
- 230000037396 body weight Effects 0.000 description 8
- 239000000543 intermediate Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 238000004458 analytical method Methods 0.000 description 7
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- 150000003973 alkyl amines Chemical class 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 4
- 239000000427 antigen Substances 0.000 description 4
- 102000036639 antigens Human genes 0.000 description 4
- 108091007433 antigens Proteins 0.000 description 4
- 229960000265 cromoglicic acid Drugs 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 210000003630 histaminocyte Anatomy 0.000 description 4
- VHNQIURBCCNWDN-UHFFFAOYSA-N pyridine-2,6-diamine Chemical compound NC1=CC=CC(N)=N1 VHNQIURBCCNWDN-UHFFFAOYSA-N 0.000 description 4
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Substances C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 3
- RZZPDXZPRHQOCG-OJAKKHQRSA-O CDP-choline(1+) Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OCC[N+](C)(C)C)O[C@H]1N1C(=O)N=C(N)C=C1 RZZPDXZPRHQOCG-OJAKKHQRSA-O 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 208000001718 Immediate Hypersensitivity Diseases 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- 239000000043 antiallergic agent Substances 0.000 description 3
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 3
- 208000002352 blister Diseases 0.000 description 3
- 210000004027 cell Anatomy 0.000 description 3
- VLARUOGDXDTHEH-UHFFFAOYSA-L disodium cromoglycate Chemical compound [Na+].[Na+].O1C(C([O-])=O)=CC(=O)C2=C1C=CC=C2OCC(O)COC1=CC=CC2=C1C(=O)C=C(C([O-])=O)O2 VLARUOGDXDTHEH-UHFFFAOYSA-L 0.000 description 3
- 230000006870 function Effects 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 230000035945 sensitivity Effects 0.000 description 3
- 210000003491 skin Anatomy 0.000 description 3
- 235000011121 sodium hydroxide Nutrition 0.000 description 3
- 229940083608 sodium hydroxide Drugs 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 2
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 2
- LRFVTYWOQMYALW-UHFFFAOYSA-N 9H-xanthine Chemical compound O=C1NC(=O)NC2=C1NC=N2 LRFVTYWOQMYALW-UHFFFAOYSA-N 0.000 description 2
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- 206010020751 Hypersensitivity Diseases 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 208000003455 anaphylaxis Diseases 0.000 description 2
- 229940046545 animal allergen extract Drugs 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 230000003381 solubilizing effect Effects 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 1
- 125000001989 1,3-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([H])C([*:2])=C1[H] 0.000 description 1
- JJFFXMVCAPPKKL-UHFFFAOYSA-N 1-[(4-methoxyphenyl)methyl]tetrazole-5-carbonyl chloride Chemical compound C1=CC(OC)=CC=C1CN1C(C(Cl)=O)=NN=N1 JJFFXMVCAPPKKL-UHFFFAOYSA-N 0.000 description 1
- YCWXOQCYLKOSKL-UHFFFAOYSA-N 2-chloro-5-(trifluoromethyl)benzene-1,3-diamine Chemical compound NC1=CC(C(F)(F)F)=CC(N)=C1Cl YCWXOQCYLKOSKL-UHFFFAOYSA-N 0.000 description 1
- AJYCIEHSLYUBEI-UHFFFAOYSA-N 3,5-diamino-4-chlorobenzonitrile Chemical compound NC1=CC(C#N)=CC(N)=C1Cl AJYCIEHSLYUBEI-UHFFFAOYSA-N 0.000 description 1
- PWINPIZUWNKSPS-UHFFFAOYSA-N 3,5-diaminobenzonitrile Chemical compound NC1=CC(N)=CC(C#N)=C1 PWINPIZUWNKSPS-UHFFFAOYSA-N 0.000 description 1
- QUCTYZZZALATJO-UHFFFAOYSA-N 4-chloropyridine-2,6-diamine Chemical compound NC1=CC(Cl)=CC(N)=N1 QUCTYZZZALATJO-UHFFFAOYSA-N 0.000 description 1
- CSGKYDRAKXKSBT-UHFFFAOYSA-N 4-ethoxypyridine-2,6-diamine Chemical compound CCOC1=CC(N)=NC(N)=C1 CSGKYDRAKXKSBT-UHFFFAOYSA-N 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 101800004538 Bradykinin Proteins 0.000 description 1
- COXVTLYNGOIATD-HVMBLDELSA-N CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O Chemical compound CC1=C(C=CC(=C1)C1=CC(C)=C(C=C1)\N=N\C1=C(O)C2=C(N)C(=CC(=C2C=C1)S(O)(=O)=O)S(O)(=O)=O)\N=N\C1=CC=C2C(=CC(=C(N)C2=C1O)S(O)(=O)=O)S(O)(=O)=O COXVTLYNGOIATD-HVMBLDELSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 206010010744 Conjunctivitis allergic Diseases 0.000 description 1
- 241000699800 Cricetinae Species 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 241000283073 Equus caballus Species 0.000 description 1
- 208000004262 Food Hypersensitivity Diseases 0.000 description 1
- 241000699694 Gerbillinae Species 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- QXZGBUJJYSLZLT-UHFFFAOYSA-N H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg-OH Natural products NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)N1C(C(=O)NCC(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CO)C(=O)N2C(CCC2)C(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CCCN=C(N)N)C(O)=O)CCC1 QXZGBUJJYSLZLT-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 108060003951 Immunoglobulin Proteins 0.000 description 1
- 102100035792 Kininogen-1 Human genes 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 108010058846 Ovalbumin Proteins 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- 241000009328 Perro Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 206010039085 Rhinitis allergic Diseases 0.000 description 1
- 206010048908 Seasonal allergy Diseases 0.000 description 1
- 206010070834 Sensitisation Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 244000250129 Trigonella foenum graecum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 208000002205 allergic conjunctivitis Diseases 0.000 description 1
- 201000010105 allergic rhinitis Diseases 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000001262 anti-secretory effect Effects 0.000 description 1
- 230000000794 anti-serotonin Effects 0.000 description 1
- 230000009830 antibody antigen interaction Effects 0.000 description 1
- 230000000890 antigenic effect Effects 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 239000003420 antiserotonin agent Substances 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 208000024998 atopic conjunctivitis Diseases 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- QXZGBUJJYSLZLT-FDISYFBBSA-N bradykinin Chemical compound NC(=N)NCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1[C@H](C(=O)NCC(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CO)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)CCC1 QXZGBUJJYSLZLT-FDISYFBBSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- 239000000168 bronchodilator agent Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 210000002421 cell wall Anatomy 0.000 description 1
- 239000003874 central nervous system depressant Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000002124 endocrine Effects 0.000 description 1
- 229960003699 evans blue Drugs 0.000 description 1
- 210000003746 feather Anatomy 0.000 description 1
- 210000003754 fetus Anatomy 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 235000020932 food allergy Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 230000008105 immune reaction Effects 0.000 description 1
- 102000018358 immunoglobulin Human genes 0.000 description 1
- 230000001506 immunosuppresive effect Effects 0.000 description 1
- 229960003444 immunosuppressant agent Drugs 0.000 description 1
- 230000001861 immunosuppressant effect Effects 0.000 description 1
- 239000003018 immunosuppressive agent Substances 0.000 description 1
- 208000030603 inherited susceptibility to asthma Diseases 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 229940039009 isoproterenol Drugs 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 229940043515 other immunoglobulins in atc Drugs 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 208000011906 peptic ulcer disease Diseases 0.000 description 1
- 230000035699 permeability Effects 0.000 description 1
- 229940066827 pertussis vaccine Drugs 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000003186 pharmaceutical solution Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 210000002826 placenta Anatomy 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 210000001187 pylorus Anatomy 0.000 description 1
- ZZYXNRREDYWPLN-UHFFFAOYSA-N pyridine-2,3-diamine Chemical compound NC1=CC=CN=C1N ZZYXNRREDYWPLN-UHFFFAOYSA-N 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- IOVGROKTTNBUGK-SJCJKPOMSA-N ritodrine Chemical compound N([C@@H](C)[C@H](O)C=1C=CC(O)=CC=1)CCC1=CC=C(O)C=C1 IOVGROKTTNBUGK-SJCJKPOMSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000001932 seasonal effect Effects 0.000 description 1
- 230000008313 sensitization Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008174 sterile solution Substances 0.000 description 1
- 239000002731 stomach secretion inhibitor Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 229940075420 xanthine Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/761,150 US4076718A (en) | 1977-01-21 | 1977-01-21 | 2,6-Pyridinediyl-bis-tetrazol-5-carboxamides |
| US05/761,501 US4096153A (en) | 1977-01-21 | 1977-01-21 | Arylene-bis-tetrazole-5-carboxamides |
| US761,150 | 1977-01-21 | ||
| US761,501 | 1977-01-21 | ||
| GB1560077 | 1977-04-14 | ||
| GB15,600/77 | 1977-04-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1095915A true CA1095915A (en) | 1981-02-17 |
Family
ID=27257280
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA294,289A Expired CA1095915A (en) | 1977-01-21 | 1978-01-04 | Bis(1h-tetrazole-5-carboxamide) compounds |
Country Status (12)
| Country | Link |
|---|---|
| US (2) | US4076718A (show.php) |
| JP (1) | JPS5392772A (show.php) |
| BE (1) | BE863142A (show.php) |
| CA (1) | CA1095915A (show.php) |
| CH (1) | CH630618A5 (show.php) |
| DE (1) | DE2802508A1 (show.php) |
| DK (1) | DK29878A (show.php) |
| FR (1) | FR2378022A1 (show.php) |
| GB (1) | GB1579915A (show.php) |
| IE (1) | IE46311B1 (show.php) |
| LU (1) | LU78922A1 (show.php) |
| NL (1) | NL7800342A (show.php) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6568628B1 (en) * | 1977-07-28 | 2003-05-27 | Raytheon Company | Shipboard point defense system and elements therefor |
| SI20746A (sl) * | 1998-08-20 | 2002-06-30 | Agouron Pharmaceuticals, Inc. | Nepeptidni GnRH agensi ter metode in vmesne spojine za njihovo pripravo |
| US7101878B1 (en) | 1998-08-20 | 2006-09-05 | Agouron Pharmaceuticals, Inc. | Non-peptide GNRH agents, methods and intermediates for their preparation |
| US20040010033A1 (en) * | 2001-02-20 | 2004-01-15 | Pfizer Inc. | Non-peptide GnRH agents, methods and intermediates for their preparation |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3622596A (en) * | 1960-10-14 | 1971-11-23 | A Wander Sa Dr | Carbanilide compounds |
-
1977
- 1977-01-21 US US05/761,150 patent/US4076718A/en not_active Expired - Lifetime
- 1977-01-21 US US05/761,501 patent/US4096153A/en not_active Expired - Lifetime
-
1978
- 1978-01-04 CA CA294,289A patent/CA1095915A/en not_active Expired
- 1978-01-11 NL NL7800342A patent/NL7800342A/xx not_active Application Discontinuation
- 1978-01-12 GB GB1321/78A patent/GB1579915A/en not_active Expired
- 1978-01-20 FR FR7801619A patent/FR2378022A1/fr active Granted
- 1978-01-20 BE BE184504A patent/BE863142A/xx not_active IP Right Cessation
- 1978-01-20 LU LU78922A patent/LU78922A1/xx unknown
- 1978-01-20 DE DE19782802508 patent/DE2802508A1/de not_active Withdrawn
- 1978-01-20 JP JP571478A patent/JPS5392772A/ja active Pending
- 1978-01-20 IE IE132/78A patent/IE46311B1/en unknown
- 1978-01-20 CH CH63878A patent/CH630618A5/fr not_active IP Right Cessation
- 1978-01-20 DK DK29878A patent/DK29878A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| CH630618A5 (fr) | 1982-06-30 |
| NL7800342A (nl) | 1978-07-25 |
| BE863142A (fr) | 1978-07-20 |
| LU78922A1 (fr) | 1978-06-09 |
| DE2802508A1 (de) | 1978-07-27 |
| FR2378022A1 (fr) | 1978-08-18 |
| IE780132L (en) | 1978-07-21 |
| JPS5392772A (en) | 1978-08-15 |
| IE46311B1 (en) | 1983-05-04 |
| FR2378022B1 (show.php) | 1980-09-19 |
| US4096153A (en) | 1978-06-20 |
| DK29878A (da) | 1978-07-22 |
| GB1579915A (en) | 1980-11-26 |
| US4076718A (en) | 1978-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3966965A (en) | Oxamic acid derivatives for the prevention of immediate type hypersensitivity reactions | |
| Curd et al. | 149. Synthetic antimalarials. Part X. Some aryl-diguanide (“-biguanide”) derivatives | |
| US4209623A (en) | Pyrimidine-5-N-(1H-tetrazol-5-yl)-carboxamides | |
| US4069343A (en) | Oxamic acid derivatives for the prevention of immediate type hypersensitivity reactions | |
| JPS6050197B2 (ja) | 治療剤 | |
| US4129735A (en) | Process for preparing tetrazole-5-carboxamide derivatives | |
| US4036837A (en) | 2 Alkoxyoxamoyl-pyrazines | |
| CA1095915A (en) | Bis(1h-tetrazole-5-carboxamide) compounds | |
| US4691018A (en) | Pyridine derivatives and their use as anti-allergic agents | |
| US4404214A (en) | 2-Pyridinecarboxamide derivatives compositions containing same and method of using same | |
| US4112101A (en) | N-(Pyridyl)-1H-(or 2H) tetrazole-5-carboxamide derivatives for the prevention of immediate type hypersensitivity reactions | |
| US4054666A (en) | Compositions and methods of treating immediate hypersensitivity reactions with thiazolyl oxamic acid derivatives | |
| CA1117112A (en) | Pyrido¬1,2-a|pyrimidine-3-n-(1h-tetrazol-5-yl| carboxamide derivatives | |
| US4044144A (en) | 1H-tetrazole-5-carboxamides | |
| US4160100A (en) | Oxamic acid derivatives | |
| US4054591A (en) | 2-Cyano-3-or 4-(substituted amino)oxanilic acid derivatives | |
| US3937719A (en) | (4-oxo-4h-1-benzopyran-2-yl)-oxamic acid, salts and esters anti-allergic agents | |
| US4154961A (en) | Oxamic acid derivatives | |
| US4191840A (en) | Oxamic acid derivatives | |
| US4006161A (en) | Thio-substituted 2-oxo-indolines | |
| NO139786B (no) | Analogifremgangsmaate for fremstilling av farmasoeytisk aktive n-(5-tetrazolyl)-pyrimido-(1,2-a)kinolin-2-karboksamid-derivater | |
| US4054661A (en) | Pyridyl oxamic acid derivatives and use in the prevention of allergic reactions | |
| US3888858A (en) | 3,4-dihydro-4-oxo-2-quinazolinecarboxylic acids, salts and esters as anti-allergic agents | |
| US4110458A (en) | N-(pyridyl) oxamic acid derivatives | |
| US4054657A (en) | Pyrimidinyl oxamic acids and esters, and compositions and methods for the suppression of allergic manifestations |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |