CA1094749A - Resin rheology control process and catalyst therefor - Google Patents
Resin rheology control process and catalyst thereforInfo
- Publication number
- CA1094749A CA1094749A CA302,516A CA302516A CA1094749A CA 1094749 A CA1094749 A CA 1094749A CA 302516 A CA302516 A CA 302516A CA 1094749 A CA1094749 A CA 1094749A
- Authority
- CA
- Canada
- Prior art keywords
- catalyst
- support
- water
- aluminum
- resin
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003054 catalyst Substances 0.000 title claims abstract description 62
- 238000000034 method Methods 0.000 title claims abstract description 16
- 230000008569 process Effects 0.000 title claims abstract description 9
- 238000000518 rheometry Methods 0.000 title claims abstract description 5
- 229920005989 resin Polymers 0.000 title claims description 21
- 239000011347 resin Substances 0.000 title claims description 21
- 238000004519 manufacturing process Methods 0.000 claims abstract description 7
- 230000001105 regulatory effect Effects 0.000 claims abstract description 5
- 229920005672 polyolefin resin Polymers 0.000 claims abstract 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 48
- 239000011651 chromium Substances 0.000 claims description 41
- 229910052782 aluminium Inorganic materials 0.000 claims description 40
- -1 aluminum compound Chemical class 0.000 claims description 25
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 23
- 229910052804 chromium Inorganic materials 0.000 claims description 23
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 19
- 239000011148 porous material Substances 0.000 claims description 18
- 239000012298 atmosphere Substances 0.000 claims description 9
- 238000000071 blow moulding Methods 0.000 claims description 9
- 239000007795 chemical reaction product Substances 0.000 claims description 8
- 239000000155 melt Substances 0.000 claims description 8
- 238000006116 polymerization reaction Methods 0.000 claims description 8
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 6
- 239000005977 Ethylene Substances 0.000 claims description 6
- 229910052809 inorganic oxide Inorganic materials 0.000 claims description 4
- 230000003197 catalytic effect Effects 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 238000000354 decomposition reaction Methods 0.000 claims description 3
- 229920013716 polyethylene resin Polymers 0.000 claims description 3
- 239000002685 polymerization catalyst Substances 0.000 claims description 2
- 235000010210 aluminium Nutrition 0.000 claims 6
- 230000000379 polymerizing effect Effects 0.000 claims 2
- 229910002028 silica xerogel Inorganic materials 0.000 claims 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 abstract description 14
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 abstract description 6
- 239000000741 silica gel Substances 0.000 abstract description 4
- 229910002027 silica gel Inorganic materials 0.000 abstract description 4
- 150000001875 compounds Chemical class 0.000 description 35
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- 239000000499 gel Substances 0.000 description 13
- 239000000463 material Substances 0.000 description 9
- 229920000642 polymer Polymers 0.000 description 9
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 230000004044 response Effects 0.000 description 7
- 239000003638 chemical reducing agent Substances 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 5
- 229910000085 borane Inorganic materials 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 4
- 150000001845 chromium compounds Chemical class 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 3
- 241001163743 Perlodes Species 0.000 description 3
- 229940037003 alum Drugs 0.000 description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 229910052796 boron Inorganic materials 0.000 description 3
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical class [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 238000000151 deposition Methods 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 229910052755 nonmetal Inorganic materials 0.000 description 2
- 150000002903 organophosphorus compounds Chemical class 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- WOZZOSDBXABUFO-UHFFFAOYSA-N tri(butan-2-yloxy)alumane Chemical compound [Al+3].CCC(C)[O-].CCC(C)[O-].CCC(C)[O-] WOZZOSDBXABUFO-UHFFFAOYSA-N 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- LALRXNPLTWZJIJ-UHFFFAOYSA-N triethylborane Chemical compound CCB(CC)CC LALRXNPLTWZJIJ-UHFFFAOYSA-N 0.000 description 2
- ZMZGFLUUZLELNE-UHFFFAOYSA-N 2,3,5-triiodobenzoic acid Chemical compound OC(=O)C1=CC(I)=CC(I)=C1I ZMZGFLUUZLELNE-UHFFFAOYSA-N 0.000 description 1
- YHQXBTXEYZIYOV-UHFFFAOYSA-N 3-methylbut-1-ene Chemical compound CC(C)C=C YHQXBTXEYZIYOV-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000005234 alkyl aluminium group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- JPUHCPXFQIXLMW-UHFFFAOYSA-N aluminium triethoxide Chemical compound CCO[Al](OCC)OCC JPUHCPXFQIXLMW-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- WRMFBHHNOHZECA-UHFFFAOYSA-N butan-2-olate Chemical compound CCC(C)[O-] WRMFBHHNOHZECA-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- AIGRXSNSLVJMEA-FQEVSTJZSA-N ethoxy-(4-nitrophenoxy)-phenyl-sulfanylidene-$l^{5}-phosphane Chemical compound O([P@@](=S)(OCC)C=1C=CC=CC=1)C1=CC=C([N+]([O-])=O)C=C1 AIGRXSNSLVJMEA-FQEVSTJZSA-N 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 239000003348 petrochemical agent Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- IKNCGYCHMGNBCP-UHFFFAOYSA-N propan-1-olate Chemical compound CCC[O-] IKNCGYCHMGNBCP-UHFFFAOYSA-N 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical compound CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 1
- 238000009966 trimming Methods 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Catalysts (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA350,112A CA1109447A (en) | 1977-05-25 | 1980-04-17 | Alpha olefin polymerization catalyst and preparation thereof |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US80058677A | 1977-05-25 | 1977-05-25 | |
| US800,586 | 1977-05-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1094749A true CA1094749A (en) | 1981-01-27 |
Family
ID=25178793
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA302,516A Expired CA1094749A (en) | 1977-05-25 | 1978-05-03 | Resin rheology control process and catalyst therefor |
Country Status (24)
| Country | Link |
|---|---|
| JP (1) | JPS53146287A (enExample) |
| AU (1) | AU3589478A (enExample) |
| BE (1) | BE867488A (enExample) |
| BR (1) | BR7803329A (enExample) |
| CA (1) | CA1094749A (enExample) |
| DD (1) | DD137111A5 (enExample) |
| DE (1) | DE2820860A1 (enExample) |
| DK (1) | DK229478A (enExample) |
| ES (2) | ES470105A1 (enExample) |
| FI (1) | FI781634A7 (enExample) |
| FR (1) | FR2391773A1 (enExample) |
| GB (1) | GB1604708A (enExample) |
| GR (1) | GR65605B (enExample) |
| IT (1) | IT1096324B (enExample) |
| LU (1) | LU79699A1 (enExample) |
| MX (1) | MX6326E (enExample) |
| NL (1) | NL186163C (enExample) |
| NO (1) | NO155292C (enExample) |
| NZ (1) | NZ187359A (enExample) |
| PH (1) | PH13805A (enExample) |
| PL (1) | PL112965B1 (enExample) |
| PT (1) | PT68070B (enExample) |
| SE (1) | SE7805965L (enExample) |
| ZA (1) | ZA782752B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4356294A (en) * | 1980-10-24 | 1982-10-26 | National Petro Chemicals Corp. | Production of polyolefins having improved ESCR |
| DE4134146A1 (de) * | 1991-10-16 | 1993-04-22 | Basf Ag | Phillips-katalysator und seine verwendung zur herstellung von ethylenhomopolymerisaten und -copolymerisaten |
| DE19643512A1 (de) * | 1996-10-22 | 1998-04-23 | Basf Ag | Verfahren zur Herstellung von geträgerten Chromkatalysatoren |
| US6989344B2 (en) * | 2002-12-27 | 2006-01-24 | Univation Technologies, Llc | Supported chromium oxide catalyst for the production of broad molecular weight polyethylene |
| EP2447287B1 (en) | 2009-06-26 | 2017-07-26 | Japan Polyethylene Corporation | Polyethylene resin, catalyst used for production of the same, method for producing the same, hollow plastic molded article containing polyethylene resin, and use of the hollow plastic molded article |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4910596A (enExample) * | 1972-05-29 | 1974-01-30 | ||
| JPS5134394A (enExample) * | 1974-09-18 | 1976-03-24 | Hitachi Ltd | |
| JPS5743087B2 (enExample) * | 1974-09-26 | 1982-09-13 | ||
| IT1054410B (it) * | 1975-11-21 | 1981-11-10 | Mitsui Petrochemical Ind | Catalizzatori per la polimerizzazione delle alfa olefine |
| US4100104A (en) * | 1977-01-13 | 1978-07-11 | National Petro Chemicals Corporation | Catalytic materials as for olefin polymerization |
-
1978
- 1978-05-03 CA CA302,516A patent/CA1094749A/en not_active Expired
- 1978-05-08 AU AU35894/78A patent/AU3589478A/en active Pending
- 1978-05-12 DE DE19782820860 patent/DE2820860A1/de not_active Ceased
- 1978-05-15 ZA ZA00782752A patent/ZA782752B/xx unknown
- 1978-05-16 GB GB19876/78A patent/GB1604708A/en not_active Expired
- 1978-05-19 PH PH21162A patent/PH13805A/en unknown
- 1978-05-19 JP JP5901178A patent/JPS53146287A/ja active Granted
- 1978-05-22 DD DD78205502A patent/DD137111A5/xx unknown
- 1978-05-22 PT PT68070A patent/PT68070B/pt unknown
- 1978-05-23 FR FR7815278A patent/FR2391773A1/fr active Granted
- 1978-05-23 ES ES470105A patent/ES470105A1/es not_active Expired
- 1978-05-23 FI FI781634A patent/FI781634A7/fi not_active Application Discontinuation
- 1978-05-24 LU LU79699A patent/LU79699A1/xx unknown
- 1978-05-24 BR BR7803329A patent/BR7803329A/pt unknown
- 1978-05-24 NL NLAANVRAGE7805620,A patent/NL186163C/xx not_active IP Right Cessation
- 1978-05-24 IT IT23767/78A patent/IT1096324B/it active
- 1978-05-24 PL PL1978207066A patent/PL112965B1/pl unknown
- 1978-05-24 NZ NZ187359A patent/NZ187359A/xx unknown
- 1978-05-24 DK DK229478A patent/DK229478A/da unknown
- 1978-05-24 NO NO781806A patent/NO155292C/no unknown
- 1978-05-24 GR GR56318A patent/GR65605B/el unknown
- 1978-05-24 SE SE7805965A patent/SE7805965L/xx unknown
- 1978-05-25 BE BE188048A patent/BE867488A/xx not_active IP Right Cessation
- 1978-05-29 MX MX787102U patent/MX6326E/es unknown
-
1979
- 1979-02-27 ES ES478118A patent/ES478118A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL186163C (nl) | 1990-10-01 |
| AU3589478A (en) | 1979-11-15 |
| NO155292C (no) | 1987-03-11 |
| BE867488A (fr) | 1978-11-27 |
| NL186163B (nl) | 1990-05-01 |
| DE2820860A1 (de) | 1978-11-30 |
| ZA782752B (en) | 1979-05-30 |
| LU79699A1 (fr) | 1979-02-02 |
| NO781806L (no) | 1978-11-28 |
| SE7805965L (sv) | 1978-11-26 |
| ES478118A1 (es) | 1979-05-16 |
| PL112965B1 (en) | 1980-11-29 |
| GR65605B (en) | 1980-10-14 |
| ES470105A1 (es) | 1979-10-01 |
| NL7805620A (nl) | 1978-11-28 |
| DK229478A (da) | 1978-11-26 |
| JPS53146287A (en) | 1978-12-20 |
| MX6326E (es) | 1985-04-09 |
| BR7803329A (pt) | 1979-01-02 |
| NO155292B (no) | 1986-12-01 |
| FR2391773B1 (enExample) | 1984-12-14 |
| NZ187359A (en) | 1980-11-28 |
| JPS646207B2 (enExample) | 1989-02-02 |
| FI781634A7 (fi) | 1978-11-26 |
| GB1604708A (en) | 1981-12-16 |
| PH13805A (en) | 1980-10-01 |
| PL207066A1 (pl) | 1979-06-04 |
| IT1096324B (it) | 1985-08-26 |
| FR2391773A1 (fr) | 1978-12-22 |
| IT7823767A0 (it) | 1978-05-24 |
| DD137111A5 (de) | 1979-08-15 |
| PT68070A (en) | 1978-06-01 |
| PT68070B (en) | 1979-10-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1080206A (en) | Olefin polymerization catalyst | |
| US3985676A (en) | Catalyst composition and method for the preparation thereof | |
| EP0055863B1 (en) | Catalyst, method for making and use of same for polymerizing olefins | |
| US4504638A (en) | Ethylene polymers made from phosphate supported chromium catalyst | |
| US4444964A (en) | Polymerization process using phosphate supported chromium catalyst | |
| US4364855A (en) | Production of aluminum phosphate from concentrated mass | |
| US4444965A (en) | Olefin polymerization using chromium on an aluminum phosphate produced from a concentrated mass | |
| KR100601257B1 (ko) | 단량체 중합용 촉매 조성물 | |
| EP0055864B2 (en) | Catalyst and use of same for polymerizing olefins | |
| US4049896A (en) | Olefin polymerization catalyst | |
| US4593079A (en) | Resin rheology control process and catalyst therefor | |
| JP2001510865A (ja) | 高活性ポリエチレン触媒 | |
| CA2280740A1 (en) | Ziegler-natta catalyst for ethylene polymerization or copolymerization | |
| CA1094749A (en) | Resin rheology control process and catalyst therefor | |
| GB1584469A (en) | Polymerization catalyst | |
| EP0291824A2 (en) | Improved chromium catalyst compositions | |
| US4192775A (en) | Olefin polymerization catalyst | |
| JPH06157628A (ja) | α−オレフィンの重合用フィリップス触媒 | |
| US5021379A (en) | Olefin polymerization | |
| CN106467583B (zh) | 一种用于乙烯聚合的催化剂组分、其制备方法及应用 | |
| EP0435627A2 (en) | Supported olefin polymerization catalyst | |
| CA1080207A (en) | Olefin polymerization catalyst | |
| US4189402A (en) | Supported catalyst for olefin polymerization | |
| US5104950A (en) | Olefin polymerization | |
| US4276399A (en) | Supported catalyst from chromium for olefin polymerization |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry | ||
| MKEX | Expiry |
Effective date: 19980127 |