CA1094749A - Resin rheology control process and catalyst therefor - Google Patents
Resin rheology control process and catalyst thereforInfo
- Publication number
- CA1094749A CA1094749A CA302,516A CA302516A CA1094749A CA 1094749 A CA1094749 A CA 1094749A CA 302516 A CA302516 A CA 302516A CA 1094749 A CA1094749 A CA 1094749A
- Authority
- CA
- Canada
- Prior art keywords
- catalyst
- support
- water
- aluminum
- resin
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000003054 catalyst Substances 0.000 title claims abstract description 62
- 238000000034 method Methods 0.000 title claims abstract description 16
- 230000008569 process Effects 0.000 title claims abstract description 9
- 238000000518 rheometry Methods 0.000 title claims abstract description 5
- 229920005989 resin Polymers 0.000 title claims description 21
- 239000011347 resin Substances 0.000 title claims description 21
- 238000004519 manufacturing process Methods 0.000 claims abstract description 7
- 230000001105 regulatory effect Effects 0.000 claims abstract description 5
- 229920005672 polyolefin resin Polymers 0.000 claims abstract 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 48
- 239000011651 chromium Substances 0.000 claims description 41
- 229910052782 aluminium Inorganic materials 0.000 claims description 40
- -1 aluminum compound Chemical class 0.000 claims description 25
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 23
- 229910052804 chromium Inorganic materials 0.000 claims description 23
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 19
- 239000011148 porous material Substances 0.000 claims description 18
- 239000012298 atmosphere Substances 0.000 claims description 9
- 238000000071 blow moulding Methods 0.000 claims description 9
- 239000007795 chemical reaction product Substances 0.000 claims description 8
- 239000000155 melt Substances 0.000 claims description 8
- 238000006116 polymerization reaction Methods 0.000 claims description 8
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 6
- 239000005977 Ethylene Substances 0.000 claims description 6
- 229910052809 inorganic oxide Inorganic materials 0.000 claims description 4
- 230000003197 catalytic effect Effects 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 238000000354 decomposition reaction Methods 0.000 claims description 3
- 229920013716 polyethylene resin Polymers 0.000 claims description 3
- 239000002685 polymerization catalyst Substances 0.000 claims description 2
- 235000010210 aluminium Nutrition 0.000 claims 6
- 230000000379 polymerizing effect Effects 0.000 claims 2
- 229910002028 silica xerogel Inorganic materials 0.000 claims 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 abstract description 14
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 abstract description 6
- 239000000741 silica gel Substances 0.000 abstract description 4
- 229910002027 silica gel Inorganic materials 0.000 abstract description 4
- 150000001875 compounds Chemical class 0.000 description 35
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- 239000000499 gel Substances 0.000 description 13
- 239000000463 material Substances 0.000 description 9
- 229920000642 polymer Polymers 0.000 description 9
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 230000004044 response Effects 0.000 description 7
- 239000003638 chemical reducing agent Substances 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 5
- 229910000085 borane Inorganic materials 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 4
- 150000001845 chromium compounds Chemical class 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 3
- 241001163743 Perlodes Species 0.000 description 3
- 229940037003 alum Drugs 0.000 description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 229910052796 boron Inorganic materials 0.000 description 3
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical class [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 238000000151 deposition Methods 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 229910052755 nonmetal Inorganic materials 0.000 description 2
- 150000002903 organophosphorus compounds Chemical class 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- WOZZOSDBXABUFO-UHFFFAOYSA-N tri(butan-2-yloxy)alumane Chemical compound [Al+3].CCC(C)[O-].CCC(C)[O-].CCC(C)[O-] WOZZOSDBXABUFO-UHFFFAOYSA-N 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- LALRXNPLTWZJIJ-UHFFFAOYSA-N triethylborane Chemical compound CCB(CC)CC LALRXNPLTWZJIJ-UHFFFAOYSA-N 0.000 description 2
- ZMZGFLUUZLELNE-UHFFFAOYSA-N 2,3,5-triiodobenzoic acid Chemical compound OC(=O)C1=CC(I)=CC(I)=C1I ZMZGFLUUZLELNE-UHFFFAOYSA-N 0.000 description 1
- YHQXBTXEYZIYOV-UHFFFAOYSA-N 3-methylbut-1-ene Chemical compound CC(C)C=C YHQXBTXEYZIYOV-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000005234 alkyl aluminium group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- JPUHCPXFQIXLMW-UHFFFAOYSA-N aluminium triethoxide Chemical compound CCO[Al](OCC)OCC JPUHCPXFQIXLMW-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- WRMFBHHNOHZECA-UHFFFAOYSA-N butan-2-olate Chemical compound CCC(C)[O-] WRMFBHHNOHZECA-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- AIGRXSNSLVJMEA-FQEVSTJZSA-N ethoxy-(4-nitrophenoxy)-phenyl-sulfanylidene-$l^{5}-phosphane Chemical compound O([P@@](=S)(OCC)C=1C=CC=CC=1)C1=CC=C([N+]([O-])=O)C=C1 AIGRXSNSLVJMEA-FQEVSTJZSA-N 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 239000003348 petrochemical agent Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- IKNCGYCHMGNBCP-UHFFFAOYSA-N propan-1-olate Chemical compound CCC[O-] IKNCGYCHMGNBCP-UHFFFAOYSA-N 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical compound CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 1
- 238000009966 trimming Methods 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Catalysts (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA350,112A CA1109447A (en) | 1977-05-25 | 1980-04-17 | Alpha olefin polymerization catalyst and preparation thereof |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US80058677A | 1977-05-25 | 1977-05-25 | |
| US800,586 | 1977-05-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1094749A true CA1094749A (en) | 1981-01-27 |
Family
ID=25178793
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA302,516A Expired CA1094749A (en) | 1977-05-25 | 1978-05-03 | Resin rheology control process and catalyst therefor |
Country Status (24)
| Country | Link |
|---|---|
| JP (1) | JPS53146287A (OSRAM) |
| AU (1) | AU3589478A (OSRAM) |
| BE (1) | BE867488A (OSRAM) |
| BR (1) | BR7803329A (OSRAM) |
| CA (1) | CA1094749A (OSRAM) |
| DD (1) | DD137111A5 (OSRAM) |
| DE (1) | DE2820860A1 (OSRAM) |
| DK (1) | DK229478A (OSRAM) |
| ES (2) | ES470105A1 (OSRAM) |
| FI (1) | FI781634A7 (OSRAM) |
| FR (1) | FR2391773A1 (OSRAM) |
| GB (1) | GB1604708A (OSRAM) |
| GR (1) | GR65605B (OSRAM) |
| IT (1) | IT1096324B (OSRAM) |
| LU (1) | LU79699A1 (OSRAM) |
| MX (1) | MX6326E (OSRAM) |
| NL (1) | NL186163C (OSRAM) |
| NO (1) | NO155292C (OSRAM) |
| NZ (1) | NZ187359A (OSRAM) |
| PH (1) | PH13805A (OSRAM) |
| PL (1) | PL112965B1 (OSRAM) |
| PT (1) | PT68070B (OSRAM) |
| SE (1) | SE7805965L (OSRAM) |
| ZA (1) | ZA782752B (OSRAM) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4356294A (en) * | 1980-10-24 | 1982-10-26 | National Petro Chemicals Corp. | Production of polyolefins having improved ESCR |
| DE4134146A1 (de) * | 1991-10-16 | 1993-04-22 | Basf Ag | Phillips-katalysator und seine verwendung zur herstellung von ethylenhomopolymerisaten und -copolymerisaten |
| DE19643512A1 (de) * | 1996-10-22 | 1998-04-23 | Basf Ag | Verfahren zur Herstellung von geträgerten Chromkatalysatoren |
| US6989344B2 (en) * | 2002-12-27 | 2006-01-24 | Univation Technologies, Llc | Supported chromium oxide catalyst for the production of broad molecular weight polyethylene |
| WO2010150410A1 (ja) * | 2009-06-26 | 2010-12-29 | 日本ポリエチレン株式会社 | ポリエチレン系樹脂、その製造触媒及び製造方法、並びにポリエチレン系樹脂を含む中空プラスチック成形品およびその用途 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4910596A (OSRAM) * | 1972-05-29 | 1974-01-30 | ||
| JPS5134394A (OSRAM) * | 1974-09-18 | 1976-03-24 | Hitachi Ltd | |
| JPS5743087B2 (OSRAM) * | 1974-09-26 | 1982-09-13 | ||
| IT1054410B (it) * | 1975-11-21 | 1981-11-10 | Mitsui Petrochemical Ind | Catalizzatori per la polimerizzazione delle alfa olefine |
| US4100104A (en) * | 1977-01-13 | 1978-07-11 | National Petro Chemicals Corporation | Catalytic materials as for olefin polymerization |
-
1978
- 1978-05-03 CA CA302,516A patent/CA1094749A/en not_active Expired
- 1978-05-08 AU AU35894/78A patent/AU3589478A/en active Pending
- 1978-05-12 DE DE19782820860 patent/DE2820860A1/de not_active Ceased
- 1978-05-15 ZA ZA00782752A patent/ZA782752B/xx unknown
- 1978-05-16 GB GB19876/78A patent/GB1604708A/en not_active Expired
- 1978-05-19 JP JP5901178A patent/JPS53146287A/ja active Granted
- 1978-05-19 PH PH21162A patent/PH13805A/en unknown
- 1978-05-22 PT PT68070A patent/PT68070B/pt unknown
- 1978-05-22 DD DD78205502A patent/DD137111A5/xx unknown
- 1978-05-23 FR FR7815278A patent/FR2391773A1/fr active Granted
- 1978-05-23 FI FI781634A patent/FI781634A7/fi not_active Application Discontinuation
- 1978-05-23 ES ES470105A patent/ES470105A1/es not_active Expired
- 1978-05-24 IT IT23767/78A patent/IT1096324B/it active
- 1978-05-24 BR BR7803329A patent/BR7803329A/pt unknown
- 1978-05-24 GR GR56318A patent/GR65605B/el unknown
- 1978-05-24 LU LU79699A patent/LU79699A1/xx unknown
- 1978-05-24 PL PL1978207066A patent/PL112965B1/pl unknown
- 1978-05-24 NO NO781806A patent/NO155292C/no unknown
- 1978-05-24 SE SE7805965A patent/SE7805965L/xx unknown
- 1978-05-24 NZ NZ187359A patent/NZ187359A/xx unknown
- 1978-05-24 NL NLAANVRAGE7805620,A patent/NL186163C/xx not_active IP Right Cessation
- 1978-05-24 DK DK229478A patent/DK229478A/da unknown
- 1978-05-25 BE BE188048A patent/BE867488A/xx not_active IP Right Cessation
- 1978-05-29 MX MX787102U patent/MX6326E/es unknown
-
1979
- 1979-02-27 ES ES478118A patent/ES478118A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS53146287A (en) | 1978-12-20 |
| LU79699A1 (fr) | 1979-02-02 |
| PT68070A (en) | 1978-06-01 |
| FR2391773A1 (fr) | 1978-12-22 |
| DE2820860A1 (de) | 1978-11-30 |
| BE867488A (fr) | 1978-11-27 |
| ZA782752B (en) | 1979-05-30 |
| PT68070B (en) | 1979-10-26 |
| ES470105A1 (es) | 1979-10-01 |
| ES478118A1 (es) | 1979-05-16 |
| PH13805A (en) | 1980-10-01 |
| NO155292C (no) | 1987-03-11 |
| IT1096324B (it) | 1985-08-26 |
| FI781634A7 (fi) | 1978-11-26 |
| DK229478A (da) | 1978-11-26 |
| NL7805620A (nl) | 1978-11-28 |
| AU3589478A (en) | 1979-11-15 |
| NZ187359A (en) | 1980-11-28 |
| GR65605B (en) | 1980-10-14 |
| MX6326E (es) | 1985-04-09 |
| NO781806L (no) | 1978-11-28 |
| PL112965B1 (en) | 1980-11-29 |
| SE7805965L (sv) | 1978-11-26 |
| FR2391773B1 (OSRAM) | 1984-12-14 |
| PL207066A1 (pl) | 1979-06-04 |
| JPS646207B2 (OSRAM) | 1989-02-02 |
| NL186163B (nl) | 1990-05-01 |
| IT7823767A0 (it) | 1978-05-24 |
| DD137111A5 (de) | 1979-08-15 |
| NO155292B (no) | 1986-12-01 |
| GB1604708A (en) | 1981-12-16 |
| BR7803329A (pt) | 1979-01-02 |
| NL186163C (nl) | 1990-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1080206A (en) | Olefin polymerization catalyst | |
| US3985676A (en) | Catalyst composition and method for the preparation thereof | |
| EP0055863B1 (en) | Catalyst, method for making and use of same for polymerizing olefins | |
| US4504638A (en) | Ethylene polymers made from phosphate supported chromium catalyst | |
| US4444964A (en) | Polymerization process using phosphate supported chromium catalyst | |
| US4444965A (en) | Olefin polymerization using chromium on an aluminum phosphate produced from a concentrated mass | |
| EP0055864B2 (en) | Catalyst and use of same for polymerizing olefins | |
| US4049896A (en) | Olefin polymerization catalyst | |
| US4593079A (en) | Resin rheology control process and catalyst therefor | |
| JP2001510865A (ja) | 高活性ポリエチレン触媒 | |
| CA2280740A1 (en) | Ziegler-natta catalyst for ethylene polymerization or copolymerization | |
| CA1094749A (en) | Resin rheology control process and catalyst therefor | |
| GB1584469A (en) | Polymerization catalyst | |
| EP0291824A2 (en) | Improved chromium catalyst compositions | |
| US4192775A (en) | Olefin polymerization catalyst | |
| JPH06157628A (ja) | α−オレフィンの重合用フィリップス触媒 | |
| US5021379A (en) | Olefin polymerization | |
| CN106467583B (zh) | 一种用于乙烯聚合的催化剂组分、其制备方法及应用 | |
| EP0435627A2 (en) | Supported olefin polymerization catalyst | |
| CA1080207A (en) | Olefin polymerization catalyst | |
| US4189402A (en) | Supported catalyst for olefin polymerization | |
| US5104950A (en) | Olefin polymerization | |
| US4276399A (en) | Supported catalyst from chromium for olefin polymerization | |
| US4260706A (en) | Olefin polymerization catalyst | |
| EP0405554A2 (en) | Propylene polymerization catalyst and method |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry | ||
| MKEX | Expiry |
Effective date: 19980127 |