CA1093618A - Gas operated switches - Google Patents
Gas operated switchesInfo
- Publication number
- CA1093618A CA1093618A CA281,609A CA281609A CA1093618A CA 1093618 A CA1093618 A CA 1093618A CA 281609 A CA281609 A CA 281609A CA 1093618 A CA1093618 A CA 1093618A
- Authority
- CA
- Canada
- Prior art keywords
- switch
- set forth
- tube
- globule
- disposed
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims abstract description 63
- 229910052753 mercury Inorganic materials 0.000 claims abstract description 63
- 239000007788 liquid Substances 0.000 claims abstract description 19
- 239000011521 glass Substances 0.000 claims abstract description 13
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims abstract description 12
- 230000004888 barrier function Effects 0.000 claims abstract description 11
- 230000001590 oxidative effect Effects 0.000 claims abstract description 8
- 229910052759 nickel Inorganic materials 0.000 claims abstract description 6
- 239000004020 conductor Substances 0.000 claims description 47
- 238000010438 heat treatment Methods 0.000 claims description 40
- 239000012530 fluid Substances 0.000 claims description 19
- 239000000463 material Substances 0.000 claims description 8
- 239000011248 coating agent Substances 0.000 claims description 5
- 238000000576 coating method Methods 0.000 claims description 5
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 4
- 229910000679 solder Inorganic materials 0.000 claims description 4
- 229910052738 indium Inorganic materials 0.000 claims description 3
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims description 3
- 230000003405 preventing effect Effects 0.000 claims 2
- 208000036366 Sensation of pressure Diseases 0.000 claims 1
- 239000007789 gas Substances 0.000 description 31
- 230000009471 action Effects 0.000 description 11
- 230000035939 shock Effects 0.000 description 6
- 230000007423 decrease Effects 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 230000008859 change Effects 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical group [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 238000010586 diagram Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- 229910052727 yttrium Inorganic materials 0.000 description 2
- MZAGXDHQGXUDDX-JSRXJHBZSA-N (e,2z)-4-ethyl-2-hydroxyimino-5-nitrohex-3-enamide Chemical compound [O-][N+](=O)C(C)C(/CC)=C/C(=N/O)/C(N)=O MZAGXDHQGXUDDX-JSRXJHBZSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910001120 nichrome Inorganic materials 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 230000003252 repetitive effect Effects 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H29/00—Switches having at least one liquid contact
- H01H29/02—Details
- H01H29/04—Contacts; Containers for liquid contacts
- H01H29/06—Liquid contacts characterised by the material thereof
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H29/00—Switches having at least one liquid contact
- H01H29/28—Switches having at least one liquid contact with level of surface of contact liquid displaced by fluid pressure
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H61/00—Electrothermal relays
- H01H61/02—Electrothermal relays wherein the thermally-sensitive member is heated indirectly, e.g. resistively, inductively
Landscapes
- Physics & Mathematics (AREA)
- Fluid Mechanics (AREA)
- Thermally Actuated Switches (AREA)
- Investigating Or Analysing Materials By Optical Means (AREA)
- Sampling And Sample Adjustment (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/701,936 US4103135A (en) | 1976-07-01 | 1976-07-01 | Gas operated switches |
| US701,936 | 1976-07-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1093618A true CA1093618A (en) | 1981-01-13 |
Family
ID=24819277
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA281,609A Expired CA1093618A (en) | 1976-07-01 | 1977-06-28 | Gas operated switches |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4103135A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS5812692B2 (cg-RX-API-DMAC10.html) |
| BE (1) | BE856331A (cg-RX-API-DMAC10.html) |
| CA (1) | CA1093618A (cg-RX-API-DMAC10.html) |
| CH (1) | CH620045A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2728238C2 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2357050A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1571567A (cg-RX-API-DMAC10.html) |
| IT (1) | IT1115497B (cg-RX-API-DMAC10.html) |
| NL (1) | NL7707133A (cg-RX-API-DMAC10.html) |
| SE (1) | SE427226B (cg-RX-API-DMAC10.html) |
Families Citing this family (78)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4419650A (en) * | 1979-08-23 | 1983-12-06 | Georgina Chrystall Hirtle | Liquid contact relay incorporating gas-containing finely reticular solid motor element for moving conductive liquid |
| US6323447B1 (en) * | 1998-12-30 | 2001-11-27 | Agilent Technologies, Inc. | Electrical contact breaker switch, integrated electrical contact breaker switch, and electrical contact switching method |
| JP2001185017A (ja) * | 1999-12-22 | 2001-07-06 | Agilent Technol Inc | スイッチ装置 |
| US6689976B1 (en) * | 2002-10-08 | 2004-02-10 | Agilent Technologies, Inc. | Electrically isolated liquid metal micro-switches for integrally shielded microcircuits |
| RU2207649C2 (ru) * | 2001-02-12 | 2003-06-27 | Открытое акционерное общество "Электроаппарат" | Электротепловое реле |
| US7078849B2 (en) * | 2001-10-31 | 2006-07-18 | Agilent Technologies, Inc. | Longitudinal piezoelectric optical latching relay |
| US6741767B2 (en) * | 2002-03-28 | 2004-05-25 | Agilent Technologies, Inc. | Piezoelectric optical relay |
| US20030194170A1 (en) * | 2002-04-10 | 2003-10-16 | Wong Marvin Glenn | Piezoelectric optical demultiplexing switch |
| US6750594B2 (en) | 2002-05-02 | 2004-06-15 | Agilent Technologies, Inc. | Piezoelectrically actuated liquid metal switch |
| US6927529B2 (en) | 2002-05-02 | 2005-08-09 | Agilent Technologies, Inc. | Solid slug longitudinal piezoelectric latching relay |
| US6756551B2 (en) | 2002-05-09 | 2004-06-29 | Agilent Technologies, Inc. | Piezoelectrically actuated liquid metal switch |
| RU2223566C1 (ru) * | 2002-06-28 | 2004-02-10 | Тюменский государственный университет | Многопозиционный электрический переключатель, использующий принцип электрокапиллярности |
| US6559420B1 (en) * | 2002-07-10 | 2003-05-06 | Agilent Technologies, Inc. | Micro-switch heater with varying gas sub-channel cross-section |
| US7022926B2 (en) * | 2002-12-12 | 2006-04-04 | Agilent Technologies, Inc. | Ultrasonically milled channel plate for a switch |
| US6774324B2 (en) * | 2002-12-12 | 2004-08-10 | Agilent Technologies, Inc. | Switch and production thereof |
| US6743990B1 (en) | 2002-12-12 | 2004-06-01 | Agilent Technologies, Inc. | Volume adjustment apparatus and method for use |
| US6855898B2 (en) * | 2002-12-12 | 2005-02-15 | Agilent Technologies, Inc. | Ceramic channel plate for a switch |
| US20040112727A1 (en) * | 2002-12-12 | 2004-06-17 | Wong Marvin Glenn | Laser cut channel plate for a switch |
| US6787719B2 (en) * | 2002-12-12 | 2004-09-07 | Agilent Technologies, Inc. | Switch and method for producing the same |
| US7019235B2 (en) * | 2003-01-13 | 2006-03-28 | Agilent Technologies, Inc. | Photoimaged channel plate for a switch |
| US6809277B2 (en) | 2003-01-22 | 2004-10-26 | Agilent Technologies, Inc. | Method for registering a deposited material with channel plate channels, and switch produced using same |
| US6747222B1 (en) | 2003-02-04 | 2004-06-08 | Agilent Technologies, Inc. | Feature formation in a nonphotoimagable material and switch incorporating same |
| US6825429B2 (en) * | 2003-03-31 | 2004-11-30 | Agilent Technologies, Inc. | Hermetic seal and controlled impedance RF connections for a liquid metal micro switch |
| US6870111B2 (en) * | 2003-04-14 | 2005-03-22 | Agilent Technologies, Inc. | Bending mode liquid metal switch |
| US6903287B2 (en) * | 2003-04-14 | 2005-06-07 | Agilent Technologies, Inc. | Liquid metal optical relay |
| US6876132B2 (en) * | 2003-04-14 | 2005-04-05 | Agilent Technologies, Inc. | Method and structure for a solid slug caterpillar piezoelectric relay |
| US6740829B1 (en) | 2003-04-14 | 2004-05-25 | Agilent Technologies, Inc. | Insertion-type liquid metal latching relay |
| US6876133B2 (en) * | 2003-04-14 | 2005-04-05 | Agilent Technologies, Inc. | Latching relay with switch bar |
| US6888977B2 (en) * | 2003-04-14 | 2005-05-03 | Agilent Technologies, Inc. | Polymeric liquid metal optical switch |
| US6762378B1 (en) | 2003-04-14 | 2004-07-13 | Agilent Technologies, Inc. | Liquid metal, latching relay with face contact |
| US6894424B2 (en) * | 2003-04-14 | 2005-05-17 | Agilent Technologies, Inc. | High frequency push-mode latching relay |
| US6876130B2 (en) * | 2003-04-14 | 2005-04-05 | Agilent Technologies, Inc. | Damped longitudinal mode latching relay |
| US7012354B2 (en) * | 2003-04-14 | 2006-03-14 | Agilent Technologies, Inc. | Method and structure for a pusher-mode piezoelectrically actuated liquid metal switch |
| US6900578B2 (en) * | 2003-04-14 | 2005-05-31 | Agilent Technologies, Inc. | High frequency latching relay with bending switch bar |
| US6946775B2 (en) * | 2003-04-14 | 2005-09-20 | Agilent Technologies, Inc. | Method and structure for a slug assisted longitudinal piezoelectrically actuated liquid metal optical switch |
| US6730866B1 (en) | 2003-04-14 | 2004-05-04 | Agilent Technologies, Inc. | High-frequency, liquid metal, latching relay array |
| US6903492B2 (en) * | 2003-04-14 | 2005-06-07 | Agilent Technologies, Inc. | Wetting finger latching piezoelectric relay |
| US6774325B1 (en) | 2003-04-14 | 2004-08-10 | Agilent Technologies, Inc. | Reducing oxides on a switching fluid in a fluid-based switch |
| US6956990B2 (en) * | 2003-04-14 | 2005-10-18 | Agilent Technologies, Inc. | Reflecting wedge optical wavelength multiplexer/demultiplexer |
| US6920259B2 (en) * | 2003-04-14 | 2005-07-19 | Agilent Technologies, Inc. | Longitudinal electromagnetic latching optical relay |
| US6906271B2 (en) * | 2003-04-14 | 2005-06-14 | Agilent Technologies, Inc. | Fluid-based switch |
| US6891315B2 (en) * | 2003-04-14 | 2005-05-10 | Agilent Technologies, Inc. | Shear mode liquid metal switch |
| US6794591B1 (en) | 2003-04-14 | 2004-09-21 | Agilent Technologies, Inc. | Fluid-based switches |
| US7070908B2 (en) * | 2003-04-14 | 2006-07-04 | Agilent Technologies, Inc. | Feature formation in thick-film inks |
| US6903493B2 (en) * | 2003-04-14 | 2005-06-07 | Agilent Technologies, Inc. | Inserting-finger liquid metal relay |
| US6961487B2 (en) * | 2003-04-14 | 2005-11-01 | Agilent Technologies, Inc. | Method and structure for a pusher-mode piezoelectrically actuated liquid metal optical switch |
| US6946776B2 (en) * | 2003-04-14 | 2005-09-20 | Agilent Technologies, Inc. | Method and apparatus for maintaining a liquid metal switch in a ready-to-switch condition |
| US7071432B2 (en) * | 2003-04-14 | 2006-07-04 | Agilent Technologies, Inc. | Reduction of oxides in a fluid-based switch |
| US6882088B2 (en) * | 2003-04-14 | 2005-04-19 | Agilent Technologies, Inc. | Bending-mode latching relay |
| US6891116B2 (en) * | 2003-04-14 | 2005-05-10 | Agilent Technologies, Inc. | Substrate with liquid electrode |
| US6818844B2 (en) * | 2003-04-14 | 2004-11-16 | Agilent Technologies, Inc. | Method and structure for a slug assisted pusher-mode piezoelectrically actuated liquid metal optical switch |
| US6925223B2 (en) * | 2003-04-14 | 2005-08-02 | Agilent Technologies, Inc. | Pressure actuated optical latching relay |
| US6924443B2 (en) * | 2003-04-14 | 2005-08-02 | Agilent Technologies, Inc. | Reducing oxides on a switching fluid in a fluid-based switch |
| US6816641B2 (en) * | 2003-04-14 | 2004-11-09 | Agilent Technologies, Inc. | Method and structure for a solid slug caterpillar piezoelectric optical relay |
| US6831532B2 (en) * | 2003-04-14 | 2004-12-14 | Agilent Technologies, Inc. | Push-mode latching relay |
| US6803842B1 (en) | 2003-04-14 | 2004-10-12 | Agilent Technologies, Inc. | Longitudinal mode solid slug optical latching relay |
| US6768068B1 (en) | 2003-04-14 | 2004-07-27 | Agilent Technologies, Inc. | Method and structure for a slug pusher-mode piezoelectrically actuated liquid metal switch |
| US6876131B2 (en) * | 2003-04-14 | 2005-04-05 | Agilent Technologies, Inc. | High-frequency, liquid metal, latching relay with face contact |
| US6798937B1 (en) | 2003-04-14 | 2004-09-28 | Agilent Technologies, Inc. | Pressure actuated solid slug optical latching relay |
| US6765161B1 (en) | 2003-04-14 | 2004-07-20 | Agilent Technologies, Inc. | Method and structure for a slug caterpillar piezoelectric latching reflective optical relay |
| US6885133B2 (en) * | 2003-04-14 | 2005-04-26 | Agilent Technologies, Inc. | High frequency bending-mode latching relay |
| US6879088B2 (en) * | 2003-04-14 | 2005-04-12 | Agilent Technologies, Inc. | Insertion-type liquid metal latching relay array |
| US6894237B2 (en) * | 2003-04-14 | 2005-05-17 | Agilent Technologies, Inc. | Formation of signal paths to increase maximum signal-carrying frequency of a fluid-based switch |
| US6903490B2 (en) * | 2003-04-14 | 2005-06-07 | Agilent Technologies, Inc. | Longitudinal mode optical latching relay |
| US6770827B1 (en) | 2003-04-14 | 2004-08-03 | Agilent Technologies, Inc. | Electrical isolation of fluid-based switches |
| US7048519B2 (en) * | 2003-04-14 | 2006-05-23 | Agilent Technologies, Inc. | Closed-loop piezoelectric pump |
| US6838959B2 (en) * | 2003-04-14 | 2005-01-04 | Agilent Technologies, Inc. | Longitudinal electromagnetic latching relay |
| US6841746B2 (en) * | 2003-04-14 | 2005-01-11 | Agilent Technologies, Inc. | Bent switching fluid cavity |
| US6879089B2 (en) * | 2003-04-14 | 2005-04-12 | Agilent Technologies, Inc. | Damped longitudinal mode optical latching relay |
| US6750413B1 (en) | 2003-04-25 | 2004-06-15 | Agilent Technologies, Inc. | Liquid metal micro switches using patterned thick film dielectric as channels and a thin ceramic or glass cover plate |
| US6777630B1 (en) | 2003-04-30 | 2004-08-17 | Agilent Technologies, Inc. | Liquid metal micro switches using as channels and heater cavities matching patterned thick film dielectric layers on opposing thin ceramic plates |
| US6759610B1 (en) | 2003-06-05 | 2004-07-06 | Agilent Technologies, Inc. | Multi-layer assembly of stacked LIMMS devices with liquid metal vias |
| US6833520B1 (en) * | 2003-06-16 | 2004-12-21 | Agilent Technologies, Inc. | Suspended thin-film resistor |
| US6759611B1 (en) | 2003-06-16 | 2004-07-06 | Agilent Technologies, Inc. | Fluid-based switches and methods for producing the same |
| US6781074B1 (en) | 2003-07-30 | 2004-08-24 | Agilent Technologies, Inc. | Preventing corrosion degradation in a fluid-based switch |
| US6787720B1 (en) | 2003-07-31 | 2004-09-07 | Agilent Technologies, Inc. | Gettering agent and method to prevent corrosion in a fluid switch |
| JP2006351494A (ja) * | 2005-06-13 | 2006-12-28 | Toyo Denso Co Ltd | 液面レベル検出スイッチ |
| JP2009117078A (ja) * | 2007-11-02 | 2009-05-28 | Yokogawa Electric Corp | リレー |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1598874A (en) * | 1922-01-19 | 1926-09-07 | Absolute Con Tac Tor Corp | Electrical apparatus |
| DE603821C (de) * | 1931-07-30 | 1934-10-11 | Siemens Schuckertwerke Akt Ges | Elektrischer Leistungsschalter mit mindestens einem Fluessigkeitskontakt |
| US2666105A (en) * | 1948-08-10 | 1954-01-12 | Menozzi Giuseppe | Apparatus for signaling the escape of illuminating gas and other similar combustiblegases |
| US2744980A (en) * | 1953-01-05 | 1956-05-08 | Cook Electric Co | Circuit control apparatus |
| US2802918A (en) * | 1955-04-29 | 1957-08-13 | Bell Telephone Labor Inc | Electrostatic relay |
| BE570153A (cg-RX-API-DMAC10.html) * | 1957-08-09 | |||
| NL126264C (cg-RX-API-DMAC10.html) * | 1959-03-20 | |||
| US3144533A (en) * | 1962-03-16 | 1964-08-11 | Fifth Dimension Inc | Mercury relay |
| GB1022301A (en) * | 1963-11-18 | 1966-03-09 | H J Elliott Ltd | A temperature-responsive circuit-controlling instrument |
| DE1301386B (de) * | 1965-12-07 | 1969-08-21 | Telefunken Patent | Quecksilber-Schalter, insbesondere Koppelrelais fuer Fernsprechanlagen |
| US3632941A (en) * | 1970-04-15 | 1972-01-04 | Bell Telephone Labor Inc | Constant impedance coaxial switch |
| US3646490A (en) * | 1970-08-24 | 1972-02-29 | Fifth Dimension Inc | Mercury switch |
| FR2282710A1 (fr) * | 1974-08-19 | 1976-03-19 | Laurent Philippe | Perfectionnement aux contacteurs (ou interrupteurs) electriques et aux relais electriques, temporises ou non, a l'ouverture et/ou a la fermeture |
-
1976
- 1976-07-01 US US05/701,936 patent/US4103135A/en not_active Expired - Lifetime
-
1977
- 1977-06-09 FR FR7718258A patent/FR2357050A1/fr active Granted
- 1977-06-15 GB GB25031/77A patent/GB1571567A/en not_active Expired
- 1977-06-16 JP JP52070603A patent/JPS5812692B2/ja not_active Expired
- 1977-06-23 DE DE2728238A patent/DE2728238C2/de not_active Expired
- 1977-06-23 IT IT24955/77A patent/IT1115497B/it active
- 1977-06-28 NL NL7707133A patent/NL7707133A/xx not_active Application Discontinuation
- 1977-06-28 CA CA281,609A patent/CA1093618A/en not_active Expired
- 1977-06-28 CH CH789377A patent/CH620045A5/de not_active IP Right Cessation
- 1977-06-30 SE SE7707571A patent/SE427226B/xx unknown
- 1977-06-30 BE BE178968A patent/BE856331A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| US4103135A (en) | 1978-07-25 |
| FR2357050A1 (fr) | 1978-01-27 |
| SE427226B (sv) | 1983-03-14 |
| DE2728238A1 (de) | 1978-01-05 |
| BE856331A (fr) | 1977-10-17 |
| FR2357050B1 (cg-RX-API-DMAC10.html) | 1980-07-11 |
| GB1571567A (en) | 1980-07-16 |
| CH620045A5 (cg-RX-API-DMAC10.html) | 1980-10-31 |
| DE2728238C2 (de) | 1983-10-27 |
| IT1115497B (it) | 1986-02-03 |
| NL7707133A (nl) | 1978-01-03 |
| SE7707571L (sv) | 1978-01-02 |
| JPS5812692B2 (ja) | 1983-03-09 |
| JPS534871A (en) | 1978-01-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1093618A (en) | Gas operated switches | |
| US3143167A (en) | Temperature controlled enclosure for testing purposes | |
| US6559420B1 (en) | Micro-switch heater with varying gas sub-channel cross-section | |
| US4419650A (en) | Liquid contact relay incorporating gas-containing finely reticular solid motor element for moving conductive liquid | |
| US3958206A (en) | Chemically augmented electrical fuse | |
| US20020097133A1 (en) | Micro-device with thermal actuator | |
| GB1468404A (en) | Electrical switching devices relays and systems incorporating same | |
| US4583365A (en) | Reticulated electrothermal fluid motor | |
| JPH0757598A (ja) | 形状記憶合金リレー及びスイッチ | |
| GB2162386A (en) | Thermal fuse and the method of manufacturing the same | |
| US3827014A (en) | Thermal protector | |
| US3179774A (en) | Indicating and actuating fuses | |
| CA1106424A (en) | Pressurized fluid circuit interrupting device having a fluid-flow-preventing fusible diaphragm shunted by a fusible element | |
| US3309481A (en) | Thermal switch with thermally collapsible member | |
| US2866884A (en) | Electric heaters for showers | |
| ES1032243U (es) | Un dispositivo de conmutacion electrico termicamente controlado. | |
| US3249722A (en) | Electrical relay employing liquid metal in a capillary tube that is wet by the liquid metal | |
| US3102179A (en) | Liquid contact switch | |
| US4160968A (en) | Normally open, thermal sensitive electrical switching device | |
| US6323446B1 (en) | Rolling ball switch | |
| GB936801A (en) | Thermostatic switches | |
| US4058785A (en) | Current limiting fuse | |
| US3176101A (en) | Liquid contact switch with auxiliary heating means | |
| US4169999A (en) | Thermal-magnetic switch | |
| US2977559A (en) | Low resistance electrolytic tilt device |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |