CA1077398A - Alumina and anionic phosphate ester for toothpaste - Google Patents
Alumina and anionic phosphate ester for toothpasteInfo
- Publication number
- CA1077398A CA1077398A CA243,514A CA243514A CA1077398A CA 1077398 A CA1077398 A CA 1077398A CA 243514 A CA243514 A CA 243514A CA 1077398 A CA1077398 A CA 1077398A
- Authority
- CA
- Canada
- Prior art keywords
- toothpaste
- weight
- phosphate ester
- anionic phosphate
- ester
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000606 toothpaste Substances 0.000 title claims abstract description 42
- 229940034610 toothpaste Drugs 0.000 title claims abstract description 38
- -1 anionic phosphate ester Chemical class 0.000 title claims abstract description 14
- 229910019142 PO4 Inorganic materials 0.000 title claims abstract description 12
- 239000010452 phosphate Substances 0.000 title claims abstract description 12
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 title abstract description 6
- 239000000203 mixture Substances 0.000 claims abstract description 19
- 229910052782 aluminium Inorganic materials 0.000 claims abstract description 12
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims abstract description 12
- 239000000463 material Substances 0.000 claims abstract description 12
- 239000004094 surface-active agent Substances 0.000 claims abstract description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 7
- 238000005498 polishing Methods 0.000 claims abstract description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 5
- 150000001340 alkali metals Chemical class 0.000 claims abstract description 5
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 5
- 150000005690 diesters Chemical class 0.000 claims abstract description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims abstract description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 3
- 239000001257 hydrogen Substances 0.000 claims abstract description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims abstract description 3
- 238000000227 grinding Methods 0.000 claims description 7
- KZNNRLXBDAAMDZ-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane trihydrate Chemical compound O.O.O.O=[Al]O[Al]=O KZNNRLXBDAAMDZ-UHFFFAOYSA-N 0.000 claims description 7
- 239000002002 slurry Substances 0.000 claims description 6
- 239000002245 particle Substances 0.000 claims description 3
- 239000002253 acid Substances 0.000 description 10
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 9
- 229910052708 sodium Inorganic materials 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 239000004411 aluminium Substances 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- ZBJVLWIYKOAYQH-UHFFFAOYSA-N naphthalen-2-yl 2-hydroxybenzoate Chemical compound OC1=CC=CC=C1C(=O)OC1=CC=C(C=CC=C2)C2=C1 ZBJVLWIYKOAYQH-UHFFFAOYSA-N 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 150000004684 trihydrates Chemical class 0.000 description 4
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- MXRIRQGCELJRSN-UHFFFAOYSA-N O.O.O.[Al] Chemical compound O.O.O.[Al] MXRIRQGCELJRSN-UHFFFAOYSA-N 0.000 description 2
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- ZPUCINDJVBIVPJ-LJISPDSOSA-N cocaine Chemical compound O([C@H]1C[C@@H]2CC[C@@H](N2C)[C@H]1C(=O)OC)C(=O)C1=CC=CC=C1 ZPUCINDJVBIVPJ-LJISPDSOSA-N 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- 239000000551 dentifrice Substances 0.000 description 2
- 239000000796 flavoring agent Substances 0.000 description 2
- 235000019634 flavors Nutrition 0.000 description 2
- 229940091249 fluoride supplement Drugs 0.000 description 2
- 229940104869 fluorosilicate Drugs 0.000 description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 2
- 239000003349 gelling agent Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 150000003014 phosphoric acid esters Chemical class 0.000 description 2
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N sarcosine Chemical compound C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- YUOWTJMRMWQJDA-UHFFFAOYSA-J tin(iv) fluoride Chemical compound [F-].[F-].[F-].[F-].[Sn+4] YUOWTJMRMWQJDA-UHFFFAOYSA-J 0.000 description 2
- BHHYHSUAOQUXJK-UHFFFAOYSA-L zinc fluoride Chemical compound F[Zn]F BHHYHSUAOQUXJK-UHFFFAOYSA-L 0.000 description 2
- LFJJOPDNPVFCNZ-UHFFFAOYSA-N 2-[hexadecanoyl(methyl)amino]acetic acid Chemical compound CCCCCCCCCCCCCCCC(=O)N(C)CC(O)=O LFJJOPDNPVFCNZ-UHFFFAOYSA-N 0.000 description 1
- NGOZDSMNMIRDFP-UHFFFAOYSA-N 2-[methyl(tetradecanoyl)amino]acetic acid Chemical group CCCCCCCCCCCCCC(=O)N(C)CC(O)=O NGOZDSMNMIRDFP-UHFFFAOYSA-N 0.000 description 1
- UBLAMKHIFZBBSS-UHFFFAOYSA-N 3-Methylbutyl pentanoate Chemical compound CCCCC(=O)OCCC(C)C UBLAMKHIFZBBSS-UHFFFAOYSA-N 0.000 description 1
- XGRSAFKZAGGXJV-UHFFFAOYSA-N 3-azaniumyl-3-cyclohexylpropanoate Chemical compound OC(=O)CC(N)C1CCCCC1 XGRSAFKZAGGXJV-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241000206575 Chondrus crispus Species 0.000 description 1
- 229910021594 Copper(II) fluoride Inorganic materials 0.000 description 1
- 101100353161 Drosophila melanogaster prel gene Proteins 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 244000024873 Mentha crispa Species 0.000 description 1
- 235000014749 Mentha crispa Nutrition 0.000 description 1
- 101100221174 Mus musculus Cnst gene Proteins 0.000 description 1
- 101100238304 Mus musculus Morc1 gene Proteins 0.000 description 1
- 244000227633 Ocotea pretiosa Species 0.000 description 1
- 235000004263 Ocotea pretiosa Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 108010077895 Sarcosine Proteins 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 235000016639 Syzygium aromaticum Nutrition 0.000 description 1
- 244000223014 Syzygium aromaticum Species 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- JUNWLZAGQLJVLR-UHFFFAOYSA-J calcium diphosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])(=O)OP([O-])([O-])=O JUNWLZAGQLJVLR-UHFFFAOYSA-J 0.000 description 1
- 229940043256 calcium pyrophosphate Drugs 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 125000004803 chlorobenzyl group Chemical group 0.000 description 1
- GWFAVIIMQDUCRA-UHFFFAOYSA-L copper(ii) fluoride Chemical compound [F-].[F-].[Cu+2] GWFAVIIMQDUCRA-UHFFFAOYSA-L 0.000 description 1
- 235000019821 dicalcium diphosphate Nutrition 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- DGTVXEHQMSJRPE-UHFFFAOYSA-N difluorophosphinic acid Chemical compound OP(F)(F)=O DGTVXEHQMSJRPE-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000004673 fluoride salts Chemical class 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910001679 gibbsite Inorganic materials 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910001385 heavy metal Inorganic materials 0.000 description 1
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000006390 lc 2 Substances 0.000 description 1
- GLVAUDGFNGKCSF-UHFFFAOYSA-N mercaptopurine Chemical compound S=C1NC=NC2=C1NC=N2 GLVAUDGFNGKCSF-UHFFFAOYSA-N 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 210000000214 mouth Anatomy 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000000963 oxybis(methylene) group Chemical group [H]C([H])(*)OC([H])([H])* 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- ZMRUPTIKESYGQW-UHFFFAOYSA-N propranolol hydrochloride Chemical compound [H+].[Cl-].C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 ZMRUPTIKESYGQW-UHFFFAOYSA-N 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 235000019992 sake Nutrition 0.000 description 1
- 229940043230 sarcosine Drugs 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 1
- 229960004711 sodium monofluorophosphate Drugs 0.000 description 1
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000001587 sorbitan monostearate Substances 0.000 description 1
- 235000011076 sorbitan monostearate Nutrition 0.000 description 1
- 229940035048 sorbitan monostearate Drugs 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 150000005691 triesters Chemical class 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 230000010148 water-pollination Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q11/00—Preparations for care of the teeth, of the oral cavity or of dentures; Dentifrices, e.g. toothpastes; Mouth rinses
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/19—Cosmetics or similar toiletry preparations characterised by the composition containing inorganic ingredients
- A61K8/26—Aluminium; Compounds thereof
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/55—Phosphorus compounds
- A61K8/556—Derivatives containing from 2 to 10 oxyalkylene groups
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Oral & Maxillofacial Surgery (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB179875A GB1475252A (en) | 1975-01-15 | 1975-01-15 | Toothpaste composition |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1077398A true CA1077398A (en) | 1980-05-13 |
Family
ID=9728203
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA243,514A Expired CA1077398A (en) | 1975-01-15 | 1976-01-14 | Alumina and anionic phosphate ester for toothpaste |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4123517A (enExample) |
| AU (1) | AU507230B2 (enExample) |
| BE (1) | BE837515A (enExample) |
| CA (1) | CA1077398A (enExample) |
| CH (1) | CH620360A5 (enExample) |
| DE (1) | DE2600709C2 (enExample) |
| DK (2) | DK14576A (enExample) |
| ES (1) | ES444256A1 (enExample) |
| FR (1) | FR2357242A1 (enExample) |
| GB (1) | GB1475252A (enExample) |
| IT (1) | IT1052936B (enExample) |
| MX (1) | MX143070A (enExample) |
| PH (1) | PH11907A (enExample) |
| SE (1) | SE418054B (enExample) |
| ZA (1) | ZA758013B (enExample) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4212856A (en) * | 1977-12-07 | 1980-07-15 | Lever Brothers Company | Toothpaste |
| GB1594878A (en) * | 1978-05-19 | 1981-08-05 | Colgate Palmolive Co | Dentifrices |
| GB1599689A (en) * | 1978-05-25 | 1981-10-07 | Colgate Palmolive Co | Dental cream composition |
| PH15413A (en) * | 1978-11-01 | 1983-01-07 | Unilever Nv | Improvements in and relating to dentifrices and their preparation |
| US4264580A (en) * | 1979-04-23 | 1981-04-28 | Barberio Giacinto G | Dental cream composition |
| JPS5663915A (en) * | 1979-10-27 | 1981-05-30 | Lion Corp | Tooth paste composition |
| US4301143A (en) * | 1979-12-17 | 1981-11-17 | Colgate-Palmolive Company | Dental cream composition |
| AU555948B2 (en) * | 1980-08-19 | 1986-10-16 | Colgate-Palmolive Pty. Ltd. | Stable dentifrice |
| GB2084463B (en) * | 1980-09-24 | 1984-05-31 | Colgate Palmolive Co | Dentifrices |
| JPS5788112A (en) * | 1980-11-20 | 1982-06-01 | Lion Corp | Tooth-paste composition |
| GB2098063B (en) * | 1981-05-08 | 1984-12-12 | Colgate Palmolive Co | Dentifrice composition containing anionic phosphate esters |
| US4526778A (en) * | 1981-11-19 | 1985-07-02 | Colgate-Palmolive Company | Stable dentifrice containing neutral siliceouse polishing agent |
| GB2109682B (en) * | 1981-11-19 | 1985-09-11 | Colgate Palmolive Co | Stable dentifrice |
| US4448766A (en) * | 1982-04-29 | 1984-05-15 | Colgate-Palmolive Company | Dentifrice composition |
| US4455294A (en) * | 1982-11-17 | 1984-06-19 | Colgate-Palmolive Company | Stable dentifrice containing acidic siliceous polishing agent |
| US4490353A (en) * | 1983-07-13 | 1984-12-25 | Colgate-Palmolive Company | Antiplaque dentifrice with improved fluoride stability |
| US4528182A (en) * | 1983-07-13 | 1985-07-09 | Colgate-Palmolive Company | Stable antiplaque dentifrice with improved foaming |
| GB8803328D0 (en) * | 1988-02-12 | 1988-03-09 | Alcan Int Ltd | Alumina hydrates |
| GB8803329D0 (en) * | 1988-02-12 | 1988-03-09 | Alcan Int Ltd | Alumina hydrates |
| GB8828018D0 (en) * | 1988-12-01 | 1989-01-05 | Unilever Plc | Topical composition |
| US4988498A (en) * | 1989-07-27 | 1991-01-29 | Unilever Patent Holdings B.V. | Oral compositions |
| RU2119328C1 (ru) * | 1996-05-28 | 1998-09-27 | Галина Ивановна Ронь | Зубная паста |
| JP5613559B2 (ja) | 2007-06-12 | 2014-10-22 | ローディア インコーポレイティド | オーラルケア配合物における、モノ−、ジ−及びポリオールアルコキシレートホスフェートエステル、及びその使用方法 |
| US9066889B2 (en) | 2009-05-21 | 2015-06-30 | Golden Products Llc | Non-fluoride containing dietary supplement toothpaste and methods of using the same |
| US9889089B2 (en) | 2016-04-04 | 2018-02-13 | Golden Products Llc | Dietary supplement non-fluoride toothpaste and methods of making and using same |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3227617A (en) * | 1955-04-25 | 1966-01-04 | Colgate Palmolive Co | Fluoride dentifrice composition |
| US3034967A (en) * | 1955-08-08 | 1962-05-15 | Colgate Palmolive Co | Fluoride dentifrice with insoluble alkali metal metaphosphate and aluminum compound polishing material |
| US3060098A (en) * | 1957-11-18 | 1962-10-23 | Lever Brothers Ltd | Dentifrice |
| US3227618A (en) * | 1964-03-09 | 1966-01-04 | Colgate Palmolive Co | Dentifrice composition containing sodium monofluorophosphate |
| GB1277586A (en) * | 1968-10-29 | 1972-06-14 | Unilever Ltd | Toothpastes |
| GB1277585A (en) * | 1968-10-29 | 1972-06-14 | Unilever Ltd | Toothpastes |
| US3956478A (en) * | 1968-12-20 | 1976-05-11 | Colgate-Palmolive Company | Dentifrice composition |
| US3822345A (en) * | 1971-03-19 | 1974-07-02 | Colgate Palmolive Co | Dentifrice composition |
| US3670076A (en) * | 1970-03-31 | 1972-06-13 | Indiana University Foundation | Dental prophylaxis composition comprising alumina of particular particle size |
| US3937805A (en) * | 1971-11-10 | 1976-02-10 | Colgate-Palmolive Company | Method of making dentifrice compositions containing insolubilized salts of 1,6-di-(p-chlorophenyl biguanido) hexane |
| US3957968A (en) * | 1973-08-20 | 1976-05-18 | Colgate-Palmolive Company | Dentifrices containing flat flakes of alpha-alumina |
-
1975
- 1975-01-15 GB GB179875A patent/GB1475252A/en not_active Expired
- 1975-12-29 ZA ZA758013A patent/ZA758013B/xx unknown
- 1975-12-30 SE SE7514749A patent/SE418054B/xx not_active IP Right Cessation
- 1975-12-31 US US05/645,743 patent/US4123517A/en not_active Expired - Lifetime
-
1976
- 1976-01-05 MX MX162844A patent/MX143070A/es unknown
- 1976-01-06 AU AU10041/76A patent/AU507230B2/en not_active Expired
- 1976-01-09 FR FR7600431A patent/FR2357242A1/fr active Granted
- 1976-01-09 DE DE2600709A patent/DE2600709C2/de not_active Expired - Lifetime
- 1976-01-12 PH PH17959A patent/PH11907A/en unknown
- 1976-01-13 ES ES444256A patent/ES444256A1/es not_active Expired
- 1976-01-13 BE BE163473A patent/BE837515A/xx unknown
- 1976-01-14 IT IT47630/76A patent/IT1052936B/it active
- 1976-01-14 CA CA243,514A patent/CA1077398A/en not_active Expired
- 1976-01-14 DK DK14576*#A patent/DK14576A/da not_active Application Discontinuation
- 1976-01-15 CH CH46676A patent/CH620360A5/de not_active IP Right Cessation
-
1987
- 1987-06-16 DK DK306287A patent/DK306287D0/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| MX143070A (es) | 1981-03-10 |
| FR2357242B1 (enExample) | 1982-02-05 |
| CH620360A5 (enExample) | 1980-11-28 |
| DK306287A (da) | 1987-06-16 |
| SE7514749L (sv) | 1976-07-16 |
| GB1475252A (en) | 1977-06-01 |
| US4123517A (en) | 1978-10-31 |
| PH11907A (en) | 1978-09-08 |
| ZA758013B (en) | 1977-08-31 |
| DK14576A (da) | 1976-07-16 |
| AU507230B2 (en) | 1980-02-07 |
| SE418054B (sv) | 1981-05-04 |
| DE2600709C2 (de) | 1990-06-21 |
| DE2600709A1 (de) | 1976-07-22 |
| ES444256A1 (es) | 1977-05-01 |
| DK306287D0 (da) | 1987-06-16 |
| IT1052936B (it) | 1981-08-31 |
| AU1004176A (en) | 1977-07-14 |
| BE837515A (fr) | 1976-05-03 |
| FR2357242A1 (fr) | 1978-02-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1077398A (en) | Alumina and anionic phosphate ester for toothpaste | |
| CA1043264A (en) | Dentifrices | |
| CA1103168A (en) | Dentrifrices containing amorphous silica | |
| CA1259927A (en) | Polishing composition and dentifrice | |
| US3911104A (en) | Gel dentifrices | |
| US4314990A (en) | Toothpaste compositions | |
| US3906090A (en) | Clear dentifrice | |
| US4144322A (en) | Reduction of abrasiveness in dentrifices | |
| US3105013A (en) | Fluoride dentifrices containing calcined aluminum silicate abrasives | |
| JP2003532663A (ja) | 清浄性の高い歯磨き剤 | |
| US4174387A (en) | Reduction of abrasiveness in dentifrices | |
| EP0518608B1 (en) | Taste preserving, mild oral hygiene compositions | |
| US4828833A (en) | Dentifrice having decreased abrasivity | |
| SK8612001A3 (en) | Fine suspensions of poorly soluble calcium salts and their use in dental care products | |
| GB2149661A (en) | Dentifrices | |
| JPS61134310A (ja) | 望ましい稠度を有するゲル歯磨 | |
| US4060599A (en) | Dentifrices | |
| GB1186706A (en) | Dentifrice Compositions | |
| US3911102A (en) | Dentifrices | |
| DK157728B (da) | Pakket tandplejemiddel | |
| CA1095421A (en) | Reduction of abrasiveness of dentifrices containing a siliceous and calcined alumina abrasive system | |
| JP2003530336A (ja) | 歯垢抑制液体歯清浄ゲル | |
| JP2003530337A (ja) | 歯垢抑制液体歯清浄製剤 | |
| US4407788A (en) | Dentifrice | |
| CA1170187A (en) | Synthetic zeolite-containing dentifrice |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |