CA1077190A - Stabilized adhesive and curing compositions - Google Patents
Stabilized adhesive and curing compositionsInfo
- Publication number
- CA1077190A CA1077190A CA256,609A CA256609A CA1077190A CA 1077190 A CA1077190 A CA 1077190A CA 256609 A CA256609 A CA 256609A CA 1077190 A CA1077190 A CA 1077190A
- Authority
- CA
- Canada
- Prior art keywords
- composition
- monomer
- group
- allyl
- hydroquinone
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 75
- 239000000853 adhesive Substances 0.000 title description 3
- 230000001070 adhesive effect Effects 0.000 title description 3
- -1 etc.) Chemical class 0.000 claims abstract description 29
- 239000000178 monomer Substances 0.000 claims abstract description 27
- 150000001875 compounds Chemical class 0.000 claims abstract description 24
- 239000003999 initiator Substances 0.000 claims abstract description 15
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims abstract description 9
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 9
- 150000002432 hydroperoxides Chemical class 0.000 claims abstract description 3
- 239000003112 inhibitor Substances 0.000 claims description 27
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- XHGIFBQQEGRTPB-UHFFFAOYSA-N tris(prop-2-enyl) phosphate Chemical compound C=CCOP(=O)(OCC=C)OCC=C XHGIFBQQEGRTPB-UHFFFAOYSA-N 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 5
- 125000000864 peroxy group Chemical group O(O*)* 0.000 claims description 5
- 239000005056 polyisocyanate Substances 0.000 claims description 5
- 230000006641 stabilisation Effects 0.000 claims description 5
- 238000011105 stabilization Methods 0.000 claims description 5
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 230000000977 initiatory effect Effects 0.000 claims description 4
- 229920001228 polyisocyanate Polymers 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 3
- UHESRSKEBRADOO-UHFFFAOYSA-N ethyl carbamate;prop-2-enoic acid Chemical group OC(=O)C=C.CCOC(N)=O UHESRSKEBRADOO-UHFFFAOYSA-N 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 claims description 3
- 230000000087 stabilizing effect Effects 0.000 claims description 3
- 229920002554 vinyl polymer Polymers 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 229940106691 bisphenol a Drugs 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims description 2
- 150000002976 peresters Chemical group 0.000 claims description 2
- 229940048053 acrylate Drugs 0.000 claims 3
- RRAFCDWBNXTKKO-UHFFFAOYSA-N eugenol Chemical group COC1=CC(CC=C)=CC=C1O RRAFCDWBNXTKKO-UHFFFAOYSA-N 0.000 claims 2
- 229940063557 methacrylate Drugs 0.000 claims 2
- 150000001451 organic peroxides Chemical group 0.000 claims 1
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 abstract description 14
- 150000003254 radicals Chemical class 0.000 abstract description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract description 4
- 150000002978 peroxides Chemical class 0.000 abstract description 4
- 150000001252 acrylic acid derivatives Chemical class 0.000 abstract 1
- 229960004337 hydroquinone Drugs 0.000 description 6
- 238000006116 polymerization reaction Methods 0.000 description 6
- 239000004342 Benzoyl peroxide Substances 0.000 description 5
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- 235000019400 benzoyl peroxide Nutrition 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 230000002028 premature Effects 0.000 description 3
- KUDUQBURMYMBIJ-UHFFFAOYSA-N 2-prop-2-enoyloxyethyl prop-2-enoate Chemical compound C=CC(=O)OCCOC(=O)C=C KUDUQBURMYMBIJ-UHFFFAOYSA-N 0.000 description 2
- GNSFRPWPOGYVLO-UHFFFAOYSA-N 3-hydroxypropyl 2-methylprop-2-enoate Chemical compound CC(=C)C(=O)OCCCO GNSFRPWPOGYVLO-UHFFFAOYSA-N 0.000 description 2
- FWMPKHMKIJDEMJ-UHFFFAOYSA-N 4-allyl-2,6-dimethoxyphenol Chemical compound COC1=CC(CC=C)=CC(OC)=C1O FWMPKHMKIJDEMJ-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 208000007542 Paresis Diseases 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 244000028419 Styrax benzoin Species 0.000 description 2
- 235000000126 Styrax benzoin Nutrition 0.000 description 2
- 235000008411 Sumatra benzointree Nutrition 0.000 description 2
- OKKRPWIIYQTPQF-UHFFFAOYSA-N Trimethylolpropane trimethacrylate Chemical compound CC(=C)C(=O)OCC(CC)(COC(=O)C(C)=C)COC(=O)C(C)=C OKKRPWIIYQTPQF-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229960002130 benzoin Drugs 0.000 description 2
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 2
- 239000012965 benzophenone Substances 0.000 description 2
- ISAOCJYIOMOJEB-UHFFFAOYSA-N desyl alcohol Natural products C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 2
- 235000019382 gum benzoic Nutrition 0.000 description 2
- 230000002452 interceptive effect Effects 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 208000012318 pareses Diseases 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 238000010526 radical polymerization reaction Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- WREVCRYZAWNLRZ-UHFFFAOYSA-N 2-allyl-6-methyl-phenol Chemical compound CC1=CC=CC(CC=C)=C1O WREVCRYZAWNLRZ-UHFFFAOYSA-N 0.000 description 1
- QIRNGVVZBINFMX-UHFFFAOYSA-N 2-allylphenol Chemical compound OC1=CC=CC=C1CC=C QIRNGVVZBINFMX-UHFFFAOYSA-N 0.000 description 1
- WFUGQJXVXHBTEM-UHFFFAOYSA-N 2-hydroperoxy-2-(2-hydroperoxybutan-2-ylperoxy)butane Chemical compound CCC(C)(OO)OOC(C)(CC)OO WFUGQJXVXHBTEM-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- OGRORDCCINVZKC-UHFFFAOYSA-N 3-[bis(prop-2-enoxy)methoxy]prop-1-ene Chemical compound C=CCOC(OCC=C)OCC=C OGRORDCCINVZKC-UHFFFAOYSA-N 0.000 description 1
- JVXJWGPWQBPZOI-UHFFFAOYSA-N 4-methyl-2-prop-2-enylphenol Chemical compound CC1=CC=C(O)C(CC=C)=C1 JVXJWGPWQBPZOI-UHFFFAOYSA-N 0.000 description 1
- 239000004641 Diallyl-phthalate Substances 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 229940123457 Free radical scavenger Drugs 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 239000012790 adhesive layer Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- QUDWYFHPNIMBFC-UHFFFAOYSA-N bis(prop-2-enyl) benzene-1,2-dicarboxylate Chemical compound C=CCOC(=O)C1=CC=CC=C1C(=O)OCC=C QUDWYFHPNIMBFC-UHFFFAOYSA-N 0.000 description 1
- QUZSUMLPWDHKCJ-UHFFFAOYSA-N bisphenol A dimethacrylate Chemical compound C1=CC(OC(=O)C(=C)C)=CC=C1C(C)(C)C1=CC=C(OC(=O)C(C)=C)C=C1 QUZSUMLPWDHKCJ-UHFFFAOYSA-N 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Chemical compound CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 125000001867 hydroperoxy group Chemical group [*]OO[H] 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 230000013011 mating Effects 0.000 description 1
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 1
- SNVLJLYUUXKWOJ-UHFFFAOYSA-N methylidenecarbene Chemical compound C=[C] SNVLJLYUUXKWOJ-UHFFFAOYSA-N 0.000 description 1
- GYVGXEWAOAAJEU-UHFFFAOYSA-N n,n,4-trimethylaniline Chemical compound CN(C)C1=CC=C(C)C=C1 GYVGXEWAOAAJEU-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 239000000565 sealant Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 description 1
- SWAXTRYEYUTSAP-UHFFFAOYSA-N tert-butyl ethaneperoxoate Chemical compound CC(=O)OOC(C)(C)C SWAXTRYEYUTSAP-UHFFFAOYSA-N 0.000 description 1
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 1
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09J—ADHESIVES; NON-MECHANICAL ASPECTS OF ADHESIVE PROCESSES IN GENERAL; ADHESIVE PROCESSES NOT PROVIDED FOR ELSEWHERE; USE OF MATERIALS AS ADHESIVES
- C09J4/00—Adhesives based on organic non-macromolecular compounds having at least one polymerisable carbon-to-carbon unsaturated bond ; adhesives, based on monomers of macromolecular compounds of groups C09J183/00 - C09J183/16
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Polymerisation Methods In General (AREA)
- Adhesives Or Adhesive Processes (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Polymerization Catalysts (AREA)
- Macromonomer-Based Addition Polymer (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IE153075A IE42438B1 (en) | 1975-07-09 | 1975-07-09 | Stabilized curable compositions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1077190A true CA1077190A (en) | 1980-05-06 |
Family
ID=11028583
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA256,609A Expired CA1077190A (en) | 1975-07-09 | 1976-07-08 | Stabilized adhesive and curing compositions |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS5210393A (enExample) |
| AU (1) | AU512819B2 (enExample) |
| CA (1) | CA1077190A (enExample) |
| DE (1) | DE2631007A1 (enExample) |
| FR (1) | FR2362188A1 (enExample) |
| GB (1) | GB1547481A (enExample) |
| IE (1) | IE42438B1 (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4964938A (en) * | 1987-04-13 | 1990-10-23 | Dymax Corporation | Bonding method using photocurable acrylate adhesive containing perester/tautomeric acid adhesion promoter |
| JPS6420283A (en) * | 1987-07-14 | 1989-01-24 | Toa Gosei Chem Ind | Adhesive composition |
| JP3040032B2 (ja) * | 1992-03-27 | 2000-05-08 | 日東電工株式会社 | 耐熱性にすぐれた感圧性接着剤およびその接着シ―ト類とこれらの製造方法 |
| DE4406858A1 (de) * | 1994-03-02 | 1995-09-07 | Thera Ges Fuer Patente | Präpolymere und daraus hergestellte radikalisch polymerisierbare Zubereitungen sowie Verfahren zu ihrer Herstellung |
| GB0505909D0 (en) * | 2005-03-23 | 2005-04-27 | Univ Leeds | Formulations |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3868409A (en) * | 1969-09-24 | 1975-02-25 | Broadview Chem Corp | Acrylic acid esters |
| US4009044A (en) * | 1975-03-07 | 1977-02-22 | Vasily Vladimirovich Korshak | Adhesive composition |
-
1975
- 1975-07-09 IE IE153075A patent/IE42438B1/en unknown
-
1976
- 1976-07-06 AU AU15621/76A patent/AU512819B2/en not_active Expired
- 1976-07-08 CA CA256,609A patent/CA1077190A/en not_active Expired
- 1976-07-08 FR FR7620863A patent/FR2362188A1/fr active Granted
- 1976-07-09 GB GB2863076A patent/GB1547481A/en not_active Expired
- 1976-07-09 DE DE19762631007 patent/DE2631007A1/de not_active Withdrawn
- 1976-07-09 JP JP8182276A patent/JPS5210393A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| AU512819B2 (en) | 1980-10-30 |
| DE2631007A1 (de) | 1977-01-20 |
| FR2362188A1 (fr) | 1978-03-17 |
| JPS5210393A (en) | 1977-01-26 |
| IE42438B1 (en) | 1980-08-13 |
| IE42438L (en) | 1977-01-09 |
| GB1547481A (en) | 1979-06-20 |
| FR2362188B1 (enExample) | 1981-10-09 |
| JPS6131122B2 (enExample) | 1986-07-18 |
| AU1562176A (en) | 1978-01-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4100141A (en) | Stabilized adhesive and curing compositions | |
| US4380613A (en) | Gasketing and sealing composition | |
| US4287330A (en) | Accelerator for curable compositions | |
| US3988299A (en) | Anaerobic adhesive composition having improved strength at elevated temperature consisting of unsaturated diacrylate monomer and maleimide additive | |
| US4321349A (en) | Accelerator for curable compositions | |
| US4102945A (en) | Filled cyanoacrylate adhesive compositions | |
| US3218305A (en) | Accelerated anaerobic compositions and method of using same | |
| IE43811B1 (en) | Curable acrylate ester compositions containing hydrazine acelerators and acid co-accelerators | |
| US5618857A (en) | Impregnation sealant composition of superior high temperature resistance, and method of making same | |
| US3682875A (en) | Stabilized anaerobic sealant composition | |
| US4490515A (en) | Hot strength cyanoacrylate adhesive composition | |
| US4964938A (en) | Bonding method using photocurable acrylate adhesive containing perester/tautomeric acid adhesion promoter | |
| MXPA02001960A (es) | Composicion curable con energia para producir un adhesivo sensible a presion. | |
| HUE029799T2 (en) | Reinforced cyanoacrylate compositions | |
| CA2029848A1 (en) | Stable thiolene compositions | |
| CA1077190A (en) | Stabilized adhesive and curing compositions | |
| US4043982A (en) | Peroxide initiated polymerizable acrylate-isocyanate monomer compositions | |
| US7067601B2 (en) | Multi-functional alpha-alkoxyalkyl acrylate and methacrylate ester compositions and reworkable polymers formed therefrom | |
| US3944521A (en) | Anaerobic adhesives consisting of polyalkoxy diacrylate ester of bisphenol a monomer and dimethylaminoethyl methacrylate monomer using hydroperoxide as catalyst | |
| US4540738A (en) | Acrylic adhesive composition comprising an alpha amino phosphonic acid or salt having improved stability | |
| US4442267A (en) | Heat resistant toughened adhesive composition | |
| US4103081A (en) | Stabilized anaerobic adhesives | |
| US3651036A (en) | Stable anaerobic curable sealing compositions containing zinc chloride and tetrahydroquinoline | |
| EP0567213A1 (en) | Dental or surgical adhesive filler | |
| JPS5913555B2 (ja) | 耐熱硬化性配合物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |