CA1070696A - Process for the production of 3-hydroxy-1,2,4-triazole derivatives - Google Patents
Process for the production of 3-hydroxy-1,2,4-triazole derivativesInfo
- Publication number
- CA1070696A CA1070696A CA234,232A CA234232A CA1070696A CA 1070696 A CA1070696 A CA 1070696A CA 234232 A CA234232 A CA 234232A CA 1070696 A CA1070696 A CA 1070696A
- Authority
- CA
- Canada
- Prior art keywords
- carbon atoms
- group
- formula
- reaction
- process according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title abstract description 10
- LZTSCEYDCZBRCJ-UHFFFAOYSA-N 1,2-dihydro-1,2,4-triazol-3-one Chemical class OC=1N=CNN=1 LZTSCEYDCZBRCJ-UHFFFAOYSA-N 0.000 title abstract description 5
- 238000004519 manufacturing process Methods 0.000 title abstract description 4
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 abstract description 10
- 125000000217 alkyl group Chemical group 0.000 abstract description 9
- 125000000753 cycloalkyl group Chemical group 0.000 abstract description 5
- 125000003342 alkenyl group Chemical group 0.000 abstract description 4
- 125000000304 alkynyl group Chemical group 0.000 abstract description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract description 2
- 239000005864 Sulphur Substances 0.000 abstract description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract description 2
- 150000001875 compounds Chemical class 0.000 abstract description 2
- 239000001301 oxygen Substances 0.000 abstract description 2
- 229910052760 oxygen Inorganic materials 0.000 abstract description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 20
- 125000004432 carbon atom Chemical group C* 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 229960000583 acetic acid Drugs 0.000 description 10
- 239000012362 glacial acetic acid Substances 0.000 description 10
- 239000002244 precipitate Substances 0.000 description 10
- -1 1,5-disubstituted 3-hydroxy-1,2,4-triazoles Chemical class 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 125000004494 ethyl ester group Chemical group 0.000 description 6
- PVZDOUYIWSZEAW-UHFFFAOYSA-N ethyl n-[cyano(propan-2-yl)amino]carbamate Chemical compound CCOC(=O)NN(C#N)C(C)C PVZDOUYIWSZEAW-UHFFFAOYSA-N 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- OWIUPIRUAQMTTK-UHFFFAOYSA-N carbazic acid Chemical compound NNC(O)=O OWIUPIRUAQMTTK-UHFFFAOYSA-N 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- CWUWXTPGCLRBFM-UHFFFAOYSA-N ethyl n-[cyano(ethyl)amino]carbamate Chemical compound CCOC(=O)NN(CC)C#N CWUWXTPGCLRBFM-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000004414 alkyl thio group Chemical group 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 150000003014 phosphoric acid esters Chemical class 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- GKQXPTHQTXCXEV-UHFFFAOYSA-N (4-chlorophenyl)methanethiol Chemical compound SCC1=CC=C(Cl)C=C1 GKQXPTHQTXCXEV-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ULIKDJVNUXNQHS-UHFFFAOYSA-N 2-Propene-1-thiol Chemical compound SCC=C ULIKDJVNUXNQHS-UHFFFAOYSA-N 0.000 description 1
- OFRNLKJZLIGKBN-UHFFFAOYSA-N 3-ethoxy-2-ethyl-1h-1,2,4-triazol-5-one Chemical compound CCOC1=NC(O)=NN1CC OFRNLKJZLIGKBN-UHFFFAOYSA-N 0.000 description 1
- GPLIEVZOSLZRMR-UHFFFAOYSA-N 3-methylsulfanyl-2-propan-2-yl-1h-1,2,4-triazol-5-one Chemical compound CSC1=NC(O)=NN1C(C)C GPLIEVZOSLZRMR-UHFFFAOYSA-N 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- KVTSUFTVEIJZMV-UHFFFAOYSA-N [cyano(propan-2-yl)amino]carbamic acid Chemical compound CC(C)N(C#N)NC(O)=O KVTSUFTVEIJZMV-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005055 alkyl alkoxy group Chemical group 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- KWSBBPRKGSJZJO-UHFFFAOYSA-N ethyl n-(cyclopentylamino)carbamate Chemical compound CCOC(=O)NNC1CCCC1 KWSBBPRKGSJZJO-UHFFFAOYSA-N 0.000 description 1
- CWYKSVVUHGYPDF-UHFFFAOYSA-N ethyl n-(ethylamino)carbamate Chemical compound CCNNC(=O)OCC CWYKSVVUHGYPDF-UHFFFAOYSA-N 0.000 description 1
- MLTULEYOSHBHGE-UHFFFAOYSA-N ethyl n-[butan-2-yl(cyano)amino]carbamate Chemical compound CCOC(=O)NN(C#N)C(C)CC MLTULEYOSHBHGE-UHFFFAOYSA-N 0.000 description 1
- NTXLVYSQEUYSFS-UHFFFAOYSA-N ethyl n-[cyano(cyclopentyl)amino]carbamate Chemical compound CCOC(=O)NN(C#N)C1CCCC1 NTXLVYSQEUYSFS-UHFFFAOYSA-N 0.000 description 1
- PHFSVEDDEVZFHJ-UHFFFAOYSA-N ethyl n-[cyano(methyl)amino]carbamate Chemical compound CCOC(=O)NN(C)C#N PHFSVEDDEVZFHJ-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D249/12—Oxygen or sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1177174A CH601266A5 (enExample) | 1974-08-29 | 1974-08-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1070696A true CA1070696A (en) | 1980-01-29 |
Family
ID=4376715
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA234,232A Expired CA1070696A (en) | 1974-08-29 | 1975-08-27 | Process for the production of 3-hydroxy-1,2,4-triazole derivatives |
Country Status (18)
| Country | Link |
|---|---|
| JP (1) | JPS5910351B2 (enExample) |
| AT (1) | AT342587B (enExample) |
| AU (1) | AU499371B2 (enExample) |
| BE (1) | BE832830A (enExample) |
| CA (1) | CA1070696A (enExample) |
| CH (1) | CH601266A5 (enExample) |
| CS (1) | CS193522B2 (enExample) |
| DD (1) | DD122535A5 (enExample) |
| DE (1) | DE2537973A1 (enExample) |
| ES (1) | ES440532A1 (enExample) |
| FR (1) | FR2283132A1 (enExample) |
| GB (1) | GB1512456A (enExample) |
| HU (1) | HU172771B (enExample) |
| IL (1) | IL48008A (enExample) |
| NL (1) | NL7510012A (enExample) |
| NZ (1) | NZ178271A (enExample) |
| SU (1) | SU577989A3 (enExample) |
| ZA (1) | ZA755512B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3070073D1 (en) * | 1979-10-22 | 1985-03-14 | Glaxo Group Ltd | 1,2,4-triazole derivatives, processes for their production and pharmaceutical compositions containing them |
| DE3068712D1 (en) * | 1979-10-23 | 1984-08-30 | Glaxo Group Ltd | Aminoalkyl compounds, their production and pharmaceutical compositions containing them |
| ES8301948A1 (es) * | 1981-04-09 | 1983-02-01 | Hoechst Ag | "procedimiento para la preparacion de 3-hidroxi-1,2,4-triazoles". |
| DE3939952A1 (de) * | 1989-12-02 | 1991-06-06 | Bayer Ag | Substituierte triazolinone |
| MY113324A (en) * | 1994-11-21 | 2002-01-31 | Bayer Ip Gmbh | Triazolyl derivatives |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE792451A (fr) * | 1971-12-10 | 1973-06-08 | Ciba Geigy | Esters triazolyliques d'acides phosphores et produits pesticides qui encontiennent |
| BE792449A (fr) * | 1971-12-10 | 1973-06-08 | Ciba Geigy | Esters triazolyliques d'acides oxygenes du phosphore et produits pesticides qui en renferment |
| IL42316A (en) * | 1972-06-16 | 1976-02-29 | Ciba Geigy Ag | Triazolyl organophosphorus derivatives,their manufacture and their use as pesticides |
| DE2250572A1 (de) * | 1972-10-14 | 1974-04-18 | Bayer Ag | N,n-dimethyl-o-triazolyl-carbaminsaeureester, verfahren zu ihrer herstellung und ihre verwendung als insektizide und akarizide |
| NL7316469A (enExample) * | 1972-12-08 | 1974-06-11 | ||
| DE2301400C2 (de) * | 1973-01-12 | 1984-12-13 | Bayer Ag, 5090 Leverkusen | 0-Triazolyl-thionophosphor(phosphon)-säureester und -esteramide, Verfahren zu ihrer Herstellung und ihre Verwendung als Insektizide und Akarizide |
-
1974
- 1974-08-29 CH CH1177174A patent/CH601266A5/xx not_active IP Right Cessation
-
1975
- 1975-07-31 NZ NZ178271A patent/NZ178271A/xx unknown
- 1975-08-15 CS CS755621A patent/CS193522B2/cs unknown
- 1975-08-18 SU SU7502163216A patent/SU577989A3/ru active
- 1975-08-25 NL NL7510012A patent/NL7510012A/xx not_active Application Discontinuation
- 1975-08-26 DE DE19752537973 patent/DE2537973A1/de active Granted
- 1975-08-27 DD DD188052A patent/DD122535A5/xx unknown
- 1975-08-27 HU HU75CI00001600A patent/HU172771B/hu unknown
- 1975-08-27 CA CA234,232A patent/CA1070696A/en not_active Expired
- 1975-08-27 GB GB35411/75A patent/GB1512456A/en not_active Expired
- 1975-08-28 AT AT664775A patent/AT342587B/de active
- 1975-08-28 IL IL48008A patent/IL48008A/xx unknown
- 1975-08-28 AU AU84345/75A patent/AU499371B2/en not_active Expired
- 1975-08-28 ES ES440532A patent/ES440532A1/es not_active Expired
- 1975-08-28 BE BE159531A patent/BE832830A/xx not_active IP Right Cessation
- 1975-08-28 ZA ZA00755512A patent/ZA755512B/xx unknown
- 1975-08-28 FR FR7526487A patent/FR2283132A1/fr active Granted
- 1975-08-29 JP JP50104879A patent/JPS5910351B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CS193522B2 (en) | 1979-10-31 |
| IL48008A (en) | 1979-07-25 |
| DE2537973C2 (enExample) | 1989-04-06 |
| ZA755512B (en) | 1976-07-28 |
| JPS5148668A (en) | 1976-04-26 |
| IL48008A0 (en) | 1975-11-25 |
| GB1512456A (en) | 1978-06-01 |
| NL7510012A (nl) | 1976-03-02 |
| AT342587B (de) | 1978-04-10 |
| SU577989A3 (ru) | 1977-10-25 |
| FR2283132A1 (fr) | 1976-03-26 |
| ES440532A1 (es) | 1977-03-01 |
| HU172771B (hu) | 1978-12-28 |
| AU8434575A (en) | 1977-03-03 |
| FR2283132B1 (enExample) | 1978-04-07 |
| DE2537973A1 (de) | 1976-03-11 |
| CH601266A5 (enExample) | 1978-06-30 |
| NZ178271A (en) | 1978-04-03 |
| AU499371B2 (en) | 1979-04-12 |
| JPS5910351B2 (ja) | 1984-03-08 |
| BE832830A (fr) | 1976-03-01 |
| ATA664775A (de) | 1977-08-15 |
| DD122535A5 (enExample) | 1976-10-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1070696A (en) | Process for the production of 3-hydroxy-1,2,4-triazole derivatives | |
| US4990622A (en) | Process for the preparation of 2-chloro-5-chloromethylpyridine | |
| CN112390725B (zh) | 一种酰胺类化合物的制备方法 | |
| US6180787B1 (en) | Process for preparing o-(3-amino-2-hydroxy-propyl)-hydroxymic acid halides | |
| US4076938A (en) | Process for the production of 3-hydroxy-1,2,4-triazole derivatives | |
| US5103011A (en) | Preparation of 2-chloro-5- methyl-pyridine | |
| GB1594450A (en) | 1,3-oxathiolane sulphoxides and their use in the preparation of 5,6-dihydro-2-methyl-1,4-oxathiin derivatives | |
| US4082762A (en) | 4-(2-halophenyl)-1,2,4-triazole-3-thiol compounds | |
| CA1082199A (en) | Derivatives of indazole and the preparation thereof | |
| US4150043A (en) | 0-(2,3-Epoxypropyl)-hydroximic acid esters | |
| EP0125777B1 (en) | Process and intermediates for preparation of 4-acetyl-2-substituted-imidazoles | |
| US4055572A (en) | Process for the production of 3-hydroxy-1,2,4-triazole derivatives | |
| EP0309626B1 (en) | Process for the preparation of dibenzothiepin derivative | |
| US4565869A (en) | Dicarbamates | |
| US4958025A (en) | Preparation of 2-chloro-5-chloromethylpyridine | |
| EP0033214A2 (en) | Process for preparing therapeutically active triazoles | |
| US4250101A (en) | Bis-epoxy-dialkoxy-alkanes | |
| US4495354A (en) | Process for bicyclic diketones | |
| EP0116452B1 (en) | Improvements in or relating to the synthesis of nizatidine | |
| EP0578849A1 (en) | Process for the preparation of 1,3-dioxane-4,6-dione derivates | |
| US4987247A (en) | Production of tetrahydrophthalimide compound | |
| US3994915A (en) | Preparation of substituted oxazoles | |
| US4134914A (en) | 1-Acyl-4-substituted phenyl thiosemicarbazides | |
| JP2805114B2 (ja) | α,β−不飽和ケトエステル誘導体 | |
| US4885388A (en) | 2-methyl-4-fluoro-phenols and their preparation |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |