CA1065207A - Internally coated reaction vessel for use in olefinic polymerization - Google Patents
Internally coated reaction vessel for use in olefinic polymerizationInfo
- Publication number
- CA1065207A CA1065207A CA247,960A CA247960A CA1065207A CA 1065207 A CA1065207 A CA 1065207A CA 247960 A CA247960 A CA 247960A CA 1065207 A CA1065207 A CA 1065207A
- Authority
- CA
- Canada
- Prior art keywords
- alkyl group
- carbon atoms
- poly
- group containing
- aromatic amine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000006116 polymerization reaction Methods 0.000 title claims abstract description 49
- 238000006243 chemical reaction Methods 0.000 title abstract description 38
- 238000000576 coating method Methods 0.000 claims abstract description 38
- 239000011248 coating agent Substances 0.000 claims abstract description 37
- 229920000642 polymer Polymers 0.000 claims abstract description 31
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims abstract description 18
- 150000004982 aromatic amines Chemical class 0.000 claims abstract description 18
- 150000001412 amines Chemical class 0.000 claims description 57
- 239000000243 solution Substances 0.000 claims description 50
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical group [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 42
- 238000000034 method Methods 0.000 claims description 40
- 125000000217 alkyl group Chemical group 0.000 claims description 29
- 150000001875 compounds Chemical class 0.000 claims description 28
- 230000008569 process Effects 0.000 claims description 26
- 125000004432 carbon atom Chemical group C* 0.000 claims description 24
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 claims description 24
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 claims description 17
- 239000007795 chemical reaction product Substances 0.000 claims description 17
- 229910052736 halogen Inorganic materials 0.000 claims description 17
- 150000002367 halogens Chemical class 0.000 claims description 17
- 229940018564 m-phenylenediamine Drugs 0.000 claims description 17
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 12
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 claims description 11
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical group [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 9
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 claims description 8
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical class C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 claims description 8
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical group [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 claims description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 125000001118 alkylidene group Chemical group 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 5
- 229940018563 3-aminophenol Drugs 0.000 claims description 4
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 claims description 4
- JPYHHZQJCSQRJY-UHFFFAOYSA-N Phloroglucinol Natural products CCC=CCC=CCC=CCC=CCCCCC(=O)C1=C(O)C=C(O)C=C1O JPYHHZQJCSQRJY-UHFFFAOYSA-N 0.000 claims description 3
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 3
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 claims description 3
- 229960001553 phloroglucinol Drugs 0.000 claims description 3
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 claims 1
- 229960001755 resorcinol Drugs 0.000 claims 1
- 239000000178 monomer Substances 0.000 abstract description 25
- 239000000203 mixture Substances 0.000 abstract description 11
- -1 vinyl halides Chemical class 0.000 abstract description 11
- 239000008199 coating composition Substances 0.000 abstract description 7
- 125000002573 ethenylidene group Chemical group [*]=C=C([H])[H] 0.000 abstract description 6
- 239000004615 ingredient Substances 0.000 abstract description 5
- 230000000379 polymerizing effect Effects 0.000 abstract description 3
- 229920002554 vinyl polymer Polymers 0.000 abstract description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- 239000003054 catalyst Substances 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- 239000000047 product Substances 0.000 description 11
- 239000007787 solid Substances 0.000 description 11
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 9
- 238000010438 heat treatment Methods 0.000 description 9
- 239000011347 resin Substances 0.000 description 8
- 229920005989 resin Polymers 0.000 description 8
- 238000005507 spraying Methods 0.000 description 7
- 238000007792 addition Methods 0.000 description 6
- 238000013019 agitation Methods 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 238000006482 condensation reaction Methods 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 5
- 229910052753 mercury Inorganic materials 0.000 description 5
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- WQGWDDDVZFFDIG-UHFFFAOYSA-N pyrogallol Chemical class OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 239000007921 spray Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- 150000004984 aromatic diamines Chemical class 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 238000010557 suspension polymerization reaction Methods 0.000 description 3
- 238000012546 transfer Methods 0.000 description 3
- 150000003738 xylenes Chemical class 0.000 description 3
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- RUOKPLVTMFHRJE-UHFFFAOYSA-N benzene-1,2,3-triamine Chemical class NC1=CC=CC(N)=C1N RUOKPLVTMFHRJE-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- SNVLJLYUUXKWOJ-UHFFFAOYSA-N methylidenecarbene Chemical group C=[C] SNVLJLYUUXKWOJ-UHFFFAOYSA-N 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- CPRMKOQKXYSDML-UHFFFAOYSA-M rubidium hydroxide Chemical compound [OH-].[Rb+] CPRMKOQKXYSDML-UHFFFAOYSA-M 0.000 description 2
- 238000007790 scraping Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 1
- XTNHVTIXTMOWGU-UHFFFAOYSA-N 2,3,4-triaminophenol Chemical class NC1=CC=C(O)C(N)=C1N XTNHVTIXTMOWGU-UHFFFAOYSA-N 0.000 description 1
- PCAXITAPTVOLGL-UHFFFAOYSA-N 2,3-diaminophenol Chemical class NC1=CC=CC(O)=C1N PCAXITAPTVOLGL-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- MFGOFGRYDNHJTA-UHFFFAOYSA-N 2-amino-1-(2-fluorophenyl)ethanol Chemical compound NCC(O)C1=CC=CC=C1F MFGOFGRYDNHJTA-UHFFFAOYSA-N 0.000 description 1
- SWZVJOLLQTWFCW-UHFFFAOYSA-N 2-chlorobenzene-1,3-diol Chemical compound OC1=CC=CC(O)=C1Cl SWZVJOLLQTWFCW-UHFFFAOYSA-N 0.000 description 1
- SBYMUDUGTIKLCR-UHFFFAOYSA-N 2-chloroethenylbenzene Chemical compound ClC=CC1=CC=CC=C1 SBYMUDUGTIKLCR-UHFFFAOYSA-N 0.000 description 1
- AEPWOCLBLLCOGZ-UHFFFAOYSA-N 2-cyanoethyl prop-2-enoate Chemical compound C=CC(=O)OCCC#N AEPWOCLBLLCOGZ-UHFFFAOYSA-N 0.000 description 1
- JQVAPEJNIZULEK-UHFFFAOYSA-N 4-chlorobenzene-1,3-diol Chemical compound OC1=CC=C(Cl)C(O)=C1 JQVAPEJNIZULEK-UHFFFAOYSA-N 0.000 description 1
- IHJBOVQRFCCUJJ-UHFFFAOYSA-N 4-methylbenzene-1,3-diamine;hydrochloride Chemical compound Cl.CC1=CC=C(N)C=C1N IHJBOVQRFCCUJJ-UHFFFAOYSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- IMROMDMJAWUWLK-UHFFFAOYSA-N Ethenol Chemical compound OC=C IMROMDMJAWUWLK-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 241000193803 Therea Species 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- CWQSNJSRIUPVNR-UHFFFAOYSA-M [OH-].[Fr+] Chemical compound [OH-].[Fr+] CWQSNJSRIUPVNR-UHFFFAOYSA-M 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000010062 adhesion mechanism Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- MIAUJDCQDVWHEV-UHFFFAOYSA-N benzene-1,2-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1S(O)(=O)=O MIAUJDCQDVWHEV-UHFFFAOYSA-N 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- INLLPKCGLOXCIV-UHFFFAOYSA-N bromoethene Chemical compound BrC=C INLLPKCGLOXCIV-UHFFFAOYSA-N 0.000 description 1
- NSGQRLUGQNBHLD-UHFFFAOYSA-N butan-2-yl butan-2-yloxycarbonyloxy carbonate Chemical compound CCC(C)OC(=O)OOC(=O)OC(C)CC NSGQRLUGQNBHLD-UHFFFAOYSA-N 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- HUCVOHYBFXVBRW-UHFFFAOYSA-M caesium hydroxide Inorganic materials [OH-].[Cs+] HUCVOHYBFXVBRW-UHFFFAOYSA-M 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000000571 coke Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 235000019628 coolness Nutrition 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000012674 dispersion polymerization Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000000383 hazardous chemical Substances 0.000 description 1
- 231100000206 health hazard Toxicity 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229960004337 hydroquinone Drugs 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000003780 insertion Methods 0.000 description 1
- 230000037431 insertion Effects 0.000 description 1
- 229940006116 lithium hydroxide Drugs 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229940065472 octyl acrylate Drugs 0.000 description 1
- ANISOHQJBAQUQP-UHFFFAOYSA-N octyl prop-2-enoate Chemical compound CCCCCCCCOC(=O)C=C ANISOHQJBAQUQP-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000004894 pentylamino group Chemical group C(CCCC)N* 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- DYFXGORUJGZJCA-UHFFFAOYSA-N phenylmethanediamine Chemical class NC(N)C1=CC=CC=C1 DYFXGORUJGZJCA-UHFFFAOYSA-N 0.000 description 1
- SNGARVZXPNQWEY-UHFFFAOYSA-N phenylmethanediol Chemical class OC(O)C1=CC=CC=C1 SNGARVZXPNQWEY-UHFFFAOYSA-N 0.000 description 1
- CCDXIADKBDSBJU-UHFFFAOYSA-N phenylmethanetriol Chemical class OC(O)(O)C1=CC=CC=C1 CCDXIADKBDSBJU-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- 229940079877 pyrogallol Drugs 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000005622 tetraalkylammonium hydroxides Chemical class 0.000 description 1
- 150000003613 toluenes Chemical class 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 1
- 235000019801 trisodium phosphate Nutrition 0.000 description 1
- 229940117958 vinyl acetate Drugs 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G73/00—Macromolecular compounds obtained by reactions forming a linkage containing nitrogen with or without oxygen or carbon in the main chain of the macromolecule, not provided for in groups C08G12/00 - C08G71/00
- C08G73/02—Polyamines
- C08G73/026—Wholly aromatic polyamines
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2/00—Processes of polymerisation
- C08F2/002—Scale prevention in a polymerisation reactor or its auxiliary parts
- C08F2/004—Scale prevention in a polymerisation reactor or its auxiliary parts by a prior coating on the reactor walls
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polymerisation Methods In General (AREA)
- Other Resins Obtained By Reactions Not Involving Carbon-To-Carbon Unsaturated Bonds (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Treatments Of Macromolecular Shaped Articles (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/574,037 US4024301A (en) | 1975-05-02 | 1975-05-02 | Internally coated reaction vessel for use in olefinic polymerization |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1065207A true CA1065207A (en) | 1979-10-30 |
Family
ID=24294428
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA247,960A Expired CA1065207A (en) | 1975-05-02 | 1976-03-15 | Internally coated reaction vessel for use in olefinic polymerization |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4024301A (enExample) |
| JP (1) | JPS6054323B2 (enExample) |
| AT (1) | AT352391B (enExample) |
| AU (1) | AU502809B2 (enExample) |
| BE (1) | BE840600A (enExample) |
| BR (1) | BR7602161A (enExample) |
| CA (1) | CA1065207A (enExample) |
| CH (1) | CH608505A5 (enExample) |
| DE (1) | DE2618634A1 (enExample) |
| ES (1) | ES447543A1 (enExample) |
| FR (1) | FR2309275A1 (enExample) |
| GB (1) | GB1523041A (enExample) |
| IN (1) | IN144205B (enExample) |
| MX (1) | MX144894A (enExample) |
| NL (1) | NL7603334A (enExample) |
| NZ (1) | NZ180169A (enExample) |
| PH (1) | PH11959A (enExample) |
| TR (1) | TR18864A (enExample) |
| YU (1) | YU110176A (enExample) |
| ZA (1) | ZA761369B (enExample) |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5223187A (en) * | 1975-08-14 | 1977-02-21 | Shin Etsu Chem Co Ltd | Process for polymerizing vinyl monomers |
| US4081248A (en) * | 1976-08-16 | 1978-03-28 | The B. F. Goodrich Company | Internally coated reaction vessel for use in olefinic polymerization |
| GB1589404A (en) * | 1976-12-23 | 1981-05-13 | Ici Australia Ltd | Halogenated a-olefin polymerisation process and reactor therefor |
| US4068059A (en) * | 1977-02-17 | 1978-01-10 | The B. F. Goodrich Company | Internally coated reaction vessel for use in olefinic polymerization |
| US4220743A (en) * | 1977-03-08 | 1980-09-02 | Ici Australia Limited | Process for aqueous dispersion polymerization of vinyl halide monomers in coated reactor |
| US4080173A (en) * | 1977-06-20 | 1978-03-21 | The B. F. Goodrich Company | Internally coated reaction vessel for use in olefinic polymerization |
| US4117216A (en) * | 1977-09-02 | 1978-09-26 | The B. F. Goodrich Company | Inversion polymerization process for producing vinyl resins |
| US4117215A (en) * | 1977-09-02 | 1978-09-26 | The B. F. Goodrich Company | Inversion polymerization process for producing vinyl resins |
| EP0003875B1 (en) * | 1978-02-24 | 1981-06-24 | Imperial Chemical Industries Plc | Coating product for use in a reactor for vinyl halide polymerisation process, the reactor and the process |
| US4359560A (en) * | 1978-06-13 | 1982-11-16 | Air Products And Chemicals, Inc. | Method for reducing wall fouling in vinyl chloride polymerization |
| ZA794091B (en) * | 1978-08-29 | 1980-10-29 | Ici Ltd | New epoxy resin and use as build-up suppressant coating in polymerisation reactors and in vinyl halide polymerisations |
| US4224424A (en) * | 1978-09-01 | 1980-09-23 | Air Products And Chemicals, Inc. | Pretreatment of a reactor with alkali metal carbonate and bicarbonates to reduce wall fouling in vinyl chloride polymerization |
| AU526104B2 (en) * | 1978-09-08 | 1982-12-16 | Geon Company, The | Polymerization of vinyl chloride |
| JPS55115412A (en) * | 1979-02-28 | 1980-09-05 | Mitsui Toatsu Chem Inc | Polymerization of vinyl chloride |
| JPS55160004A (en) * | 1979-05-30 | 1980-12-12 | Mitsui Toatsu Chem Inc | Polymerization of vinyl chloride |
| US4267291A (en) * | 1979-09-14 | 1981-05-12 | The B. F. Goodrich Company | Process for coating reactors using organic compound vapor application |
| US4263421A (en) * | 1979-09-14 | 1981-04-21 | The B. F. Goodrich Company | Process for coating reactors using organic compound vapor application |
| JPH0138544B2 (enExample) * | 1980-08-18 | 1989-08-15 | Goodrich Co B F | |
| EP0058169A4 (en) * | 1980-08-25 | 1982-12-27 | Goodrich Co B F | INTERIOR COVERED REACTION CONTAINER FOR USE IN THE EMULSION POLYMERIZATION OF OLEFIN MONOMERS. |
| US4579758A (en) * | 1981-01-16 | 1986-04-01 | The B. F. Goodrich Company | Internally coated reaction vessel for use in olefinic polymerization |
| JPS6030681B2 (ja) * | 1981-03-23 | 1985-07-18 | 信越化学工業株式会社 | エチレン性二重結合を有する単量体の重合方法 |
| US4420591A (en) * | 1982-04-05 | 1983-12-13 | Air Products And Chemicals, Inc. | Method for reducing wall fouling in vinyl chloride polymerization |
| US4451625A (en) * | 1982-08-05 | 1984-05-29 | Air Products And Chemicals, Inc. | Reduction of wall fouling in the suspension polymerization of vinyl chloride homopolymer |
| US4719089A (en) * | 1984-09-11 | 1988-01-12 | The B. F. Goodrich Company | Internally coated reaction vessel for use in olefinic polymerization |
| US4613483A (en) * | 1984-11-07 | 1986-09-23 | The B. F. Goodrich Company | Coated polymerization vessels and methods for use thereof |
| TW438818B (en) * | 1998-02-05 | 2001-06-07 | Shinetsu Chemical Co | Process for producing a polymer by polymerization of a monomer having an ethylenic double bond |
| EA200800129A1 (ru) * | 2003-11-20 | 2008-04-28 | Солвей (Сосьете Аноним) | Псевдоазеотропная композиция, содержащая дихлорпропанол, и способ ее получения |
| US8173823B2 (en) * | 2005-05-20 | 2012-05-08 | Solvay (Société Anonyme) | Method for making an epoxide |
| KR20080037618A (ko) | 2005-05-20 | 2008-04-30 | 솔베이(소시에떼아노님) | 폴리히드록실화 지방족 탄화수소 및 염소화제 간의 반응에의한 클로로히드린 제조 방법 |
| EP2043984A1 (en) * | 2006-06-14 | 2009-04-08 | Solvay S.A. | Crude glycerol-based product, process for its purification and its use in the manufacture of dichloropropanol |
| US20100032617A1 (en) * | 2007-02-20 | 2010-02-11 | Solvay (Societe Anonyme) | Process for manufacturing epichlorohydrin |
| FR2913421B1 (fr) * | 2007-03-07 | 2009-05-15 | Solvay | Procede de fabrication de dichloropropanol. |
| FR2913684B1 (fr) * | 2007-03-14 | 2012-09-14 | Solvay | Procede de fabrication de dichloropropanol |
| TW200911740A (en) | 2007-06-01 | 2009-03-16 | Solvay | Process for manufacturing a chlorohydrin |
| TW200911693A (en) * | 2007-06-12 | 2009-03-16 | Solvay | Aqueous composition containing a salt, manufacturing process and use |
| TWI500609B (zh) * | 2007-06-12 | 2015-09-21 | Solvay | 含有環氧氯丙烷的產品,其製備及其不同應用中的用途 |
| EP2207617A1 (en) * | 2007-10-02 | 2010-07-21 | SOLVAY (Société Anonyme) | Use of compositions containing silicon for improving the corrosion resistance of vessels |
| FR2925045B1 (fr) | 2007-12-17 | 2012-02-24 | Solvay | Produit a base de glycerol, procede pour son obtention et son utilisation dans la fabrication de dichloropropanol |
| TWI478875B (zh) * | 2008-01-31 | 2015-04-01 | Solvay | 使水性組成物中之有機物質降解之方法 |
| WO2009121853A1 (en) | 2008-04-03 | 2009-10-08 | Solvay (Société Anonyme) | Composition comprising glycerol, process for obtaining same and use thereof in the manufacture of dichloropropanol |
| FR2935968B1 (fr) | 2008-09-12 | 2010-09-10 | Solvay | Procede pour la purification de chlorure d'hydrogene |
| FR2939434B1 (fr) * | 2008-12-08 | 2012-05-18 | Solvay | Procede de traitement de glycerol. |
| WO2012041816A1 (en) | 2010-09-30 | 2012-04-05 | Solvay Sa | Derivative of epichlorohydrin of natural origin |
| CN104371047B (zh) * | 2014-11-12 | 2016-09-14 | 天伟化工有限公司 | 一种氯乙烯聚合釜防粘釜剂喷涂的方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL55188C (enExample) * | 1936-08-17 | |||
| US3440197A (en) * | 1966-05-05 | 1969-04-22 | Gen Electric | Coating solutions and methods for preparing and using the same |
| US3515709A (en) * | 1967-08-02 | 1970-06-02 | Dow Chemical Co | Process for eliminating polymer build-up on reactor walls during polymerization of water-insoluble monoethylenically unsaturated liquid monomers |
| US3738974A (en) * | 1969-11-20 | 1973-06-12 | Japan Atomic Energy Res Inst | Liquid phase process for the polymerization of unsaturated monomers |
| US3678006A (en) * | 1971-01-07 | 1972-07-18 | Hughes Aircraft Co | Curable polyphenylene copolymers and resin compositions |
| US3778423A (en) * | 1971-06-28 | 1973-12-11 | Universal Pvc Resins | Method for reducing polymer deposit in polymerization of vinyl chloride |
| US3849179A (en) * | 1973-08-27 | 1974-11-19 | Goodrich Co B F | Internally coated reaction vessel and process for coating the same |
-
1975
- 1975-05-02 US US05/574,037 patent/US4024301A/en not_active Expired - Lifetime
-
1976
- 1976-03-02 NZ NZ180169A patent/NZ180169A/xx unknown
- 1976-03-03 AU AU11611/76A patent/AU502809B2/en not_active Expired
- 1976-03-05 ZA ZA761369A patent/ZA761369B/xx unknown
- 1976-03-15 CA CA247,960A patent/CA1065207A/en not_active Expired
- 1976-03-31 NL NL7603334A patent/NL7603334A/xx not_active Application Discontinuation
- 1976-04-05 CH CH421276A patent/CH608505A5/xx not_active IP Right Cessation
- 1976-04-08 BR BR2161/76A patent/BR7602161A/pt unknown
- 1976-04-09 JP JP51040185A patent/JPS6054323B2/ja not_active Expired
- 1976-04-09 BE BE166029A patent/BE840600A/xx unknown
- 1976-04-19 IN IN665/CAL/76A patent/IN144205B/en unknown
- 1976-04-20 MX MX164343A patent/MX144894A/es unknown
- 1976-04-28 DE DE19762618634 patent/DE2618634A1/de not_active Withdrawn
- 1976-04-29 FR FR7612830A patent/FR2309275A1/fr active Granted
- 1976-04-30 GB GB17610/76A patent/GB1523041A/en not_active Expired
- 1976-04-30 ES ES447543A patent/ES447543A1/es not_active Expired
- 1976-04-30 AT AT319576A patent/AT352391B/de not_active IP Right Cessation
- 1976-04-30 PH PH18388A patent/PH11959A/en unknown
- 1976-05-03 TR TR18864A patent/TR18864A/xx unknown
- 1976-05-04 YU YU01101/76A patent/YU110176A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| MX144894A (es) | 1981-12-01 |
| FR2309275B1 (enExample) | 1981-02-27 |
| ES447543A1 (es) | 1977-07-01 |
| BE840600A (fr) | 1976-08-02 |
| TR18864A (tr) | 1977-10-17 |
| AU502809B2 (en) | 1979-08-09 |
| JPS6054323B2 (ja) | 1985-11-29 |
| ZA761369B (en) | 1977-02-23 |
| US4024301A (en) | 1977-05-17 |
| PH11959A (en) | 1978-09-25 |
| CH608505A5 (enExample) | 1979-01-15 |
| GB1523041A (en) | 1978-08-31 |
| IN144205B (enExample) | 1978-04-08 |
| NZ180169A (en) | 1978-03-06 |
| FR2309275A1 (fr) | 1976-11-26 |
| YU110176A (en) | 1982-05-31 |
| ATA319576A (de) | 1979-02-15 |
| JPS51134777A (en) | 1976-11-22 |
| DE2618634A1 (de) | 1976-11-11 |
| NL7603334A (nl) | 1976-11-04 |
| BR7602161A (pt) | 1976-11-09 |
| AT352391B (de) | 1979-09-10 |
| AU1161176A (en) | 1977-09-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1065207A (en) | Internally coated reaction vessel for use in olefinic polymerization | |
| US4255470A (en) | Process for preventing polymer buildup in a polymerization reactor | |
| US4080173A (en) | Internally coated reaction vessel for use in olefinic polymerization | |
| US4024330A (en) | Internally coated reaction vessel and process for coating the same | |
| US4081248A (en) | Internally coated reaction vessel for use in olefinic polymerization | |
| EP0020541B1 (en) | Coating polymerization reactors with oligomer coatings derived from reaction products of substituted phenols | |
| US4579758A (en) | Internally coated reaction vessel for use in olefinic polymerization | |
| CA1181899A (en) | Method for polymerization of vinyl chloride | |
| CA1134683A (en) | Coating polymerization reactors with oligomers derived from polyhydric phenols plus a bleach | |
| EP0042725B1 (en) | Process for suspension-polymerizing vinyl chloride | |
| CA1064785A (en) | Internally coated reaction vessel and process for coating the same | |
| CA1251017A (en) | Process | |
| GB1592403A (en) | Internally coated reaction vessel for use in olefinic polymerization | |
| US6288177B1 (en) | Process for producing a vinyl chloride polymer in the presence of a chelating agent | |
| EP0069765B1 (en) | Internally coated reaction vessel for use in olefinic polymerization | |
| CA1264396A (en) | Internally coated reaction vessel for use in olefinic polymerization | |
| EP0070296B1 (en) | Internally coated reaction vessel for use in olefinic polymerization | |
| CA1147098A (en) | Coating polymerization reactors with the reaction products of thiodiphenols and a bleach | |
| NO761167L (enExample) | ||
| JPH0617365B2 (ja) | 重合体スケールの付着防止方法 | |
| CA2081075A1 (en) | Polymer scale preventive agent, polymerization vessel effective in preventing polymer scale deposition, and process of producing polymer using said vessel |