CA1064929A - Metal complexes of bis-hydrazones and a process for their manufacture - Google Patents
Metal complexes of bis-hydrazones and a process for their manufactureInfo
- Publication number
- CA1064929A CA1064929A CA234,686A CA234686A CA1064929A CA 1064929 A CA1064929 A CA 1064929A CA 234686 A CA234686 A CA 234686A CA 1064929 A CA1064929 A CA 1064929A
- Authority
- CA
- Canada
- Prior art keywords
- denotes
- atoms
- group
- formula
- bis
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910052751 metal Inorganic materials 0.000 title abstract description 25
- 239000002184 metal Substances 0.000 title abstract description 25
- 238000000034 method Methods 0.000 title description 6
- 238000004519 manufacturing process Methods 0.000 title description 2
- -1 heterocyclic radical Chemical class 0.000 claims abstract description 33
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 29
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 22
- 239000003446 ligand Substances 0.000 claims abstract description 16
- 150000003254 radicals Chemical class 0.000 claims abstract description 11
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims abstract description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims abstract description 9
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims abstract description 8
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 claims abstract description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 7
- 150000005840 aryl radicals Chemical class 0.000 claims abstract description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims abstract description 5
- 229910052759 nickel Inorganic materials 0.000 claims abstract description 5
- 125000004434 sulfur atom Chemical group 0.000 claims abstract description 5
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052793 cadmium Inorganic materials 0.000 claims abstract description 4
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical group [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052802 copper Inorganic materials 0.000 claims abstract description 4
- 239000010949 copper Substances 0.000 claims abstract description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052725 zinc Inorganic materials 0.000 claims abstract description 4
- 239000011701 zinc Substances 0.000 claims abstract description 4
- GOLORTLGFDVFDW-UHFFFAOYSA-N 3-(1h-benzimidazol-2-yl)-7-(diethylamino)chromen-2-one Chemical compound C1=CC=C2NC(C3=CC4=CC=C(C=C4OC3=O)N(CC)CC)=NC2=C1 GOLORTLGFDVFDW-UHFFFAOYSA-N 0.000 claims abstract description 3
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 3
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 claims abstract description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 37
- 125000005843 halogen group Chemical group 0.000 claims description 16
- 125000003545 alkoxy group Chemical group 0.000 claims description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 10
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 8
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 6
- 125000004429 atom Chemical group 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 4
- 125000005236 alkanoylamino group Chemical group 0.000 claims description 4
- 125000005115 alkyl carbamoyl group Chemical group 0.000 claims description 4
- 229910021529 ammonia Inorganic materials 0.000 claims description 4
- 125000005116 aryl carbamoyl group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000004104 aryloxy group Chemical group 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 125000004442 acylamino group Chemical group 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000001769 aryl amino group Chemical group 0.000 claims description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 claims 1
- 125000002252 acyl group Chemical group 0.000 claims 1
- QUQFTIVBFKLPCL-UHFFFAOYSA-L copper;2-amino-3-[(2-amino-2-carboxylatoethyl)disulfanyl]propanoate Chemical compound [Cu+2].[O-]C(=O)C(N)CSSCC(N)C([O-])=O QUQFTIVBFKLPCL-UHFFFAOYSA-L 0.000 claims 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims 1
- 239000004922 lacquer Substances 0.000 abstract description 2
- 239000004033 plastic Substances 0.000 abstract description 2
- 229920003023 plastic Polymers 0.000 abstract description 2
- 238000004040 coloring Methods 0.000 abstract 1
- FPVGTPBMTFTMRT-NSKUCRDLSA-L fast yellow Chemical compound [Na+].[Na+].C1=C(S([O-])(=O)=O)C(N)=CC=C1\N=N\C1=CC=C(S([O-])(=O)=O)C=C1 FPVGTPBMTFTMRT-NSKUCRDLSA-L 0.000 abstract 1
- 235000019233 fast yellow AB Nutrition 0.000 abstract 1
- 150000001299 aldehydes Chemical class 0.000 description 9
- 150000002576 ketones Chemical class 0.000 description 8
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical class NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 7
- 239000000049 pigment Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 5
- 150000007857 hydrazones Chemical class 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- 239000004417 polycarbonate Substances 0.000 description 4
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- GRTWTWVTJBXKTG-UHFFFAOYSA-N 4,5,6,7-tetrachloro-3-hydrazinylisoindol-1-one Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C2=C1C(=NN)NC2=O GRTWTWVTJBXKTG-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 150000004985 diamines Chemical class 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- HMXQIFUGFZEJEO-UHFFFAOYSA-N 1,2-dihydropyrrol-3-one Chemical compound O=C1CNC=C1 HMXQIFUGFZEJEO-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- JHZOXYGFQMROFJ-UHFFFAOYSA-N 3,5-dibromo-2-hydroxybenzaldehyde Chemical compound OC1=C(Br)C=C(Br)C=C1C=O JHZOXYGFQMROFJ-UHFFFAOYSA-N 0.000 description 2
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 2
- APVGWZCNIAHMDT-UHFFFAOYSA-N 4-hydroxy-2-oxo-1H-quinoline-3-carbaldehyde Chemical compound C1=CC=C2C(O)=C(C=O)C(O)=NC2=C1 APVGWZCNIAHMDT-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- ZQTQPYJGMWHXMO-UHFFFAOYSA-N OOOOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOOOO ZQTQPYJGMWHXMO-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 150000004696 coordination complex Chemical class 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- PXZQEOJJUGGUIB-UHFFFAOYSA-N isoindolin-1-one Chemical class C1=CC=C2C(=O)NCC2=C1 PXZQEOJJUGGUIB-UHFFFAOYSA-N 0.000 description 2
- 229910052748 manganese Inorganic materials 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229940078487 nickel acetate tetrahydrate Drugs 0.000 description 2
- OINIXPNQKAZCRL-UHFFFAOYSA-L nickel(2+);diacetate;tetrahydrate Chemical compound O.O.O.O.[Ni+2].CC([O-])=O.CC([O-])=O OINIXPNQKAZCRL-UHFFFAOYSA-L 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 239000001052 yellow pigment Substances 0.000 description 2
- XAMBIJWZVIZZOG-UHFFFAOYSA-N (4-methylphenyl)hydrazine Chemical compound CC1=CC=C(NN)C=C1 XAMBIJWZVIZZOG-UHFFFAOYSA-N 0.000 description 1
- LEXOZHHIDPMMAC-YFHOEESVSA-N (z)-1-phenylethylidenehydrazine Chemical compound N/N=C(/C)C1=CC=CC=C1 LEXOZHHIDPMMAC-YFHOEESVSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 description 1
- UXFYNFPNBZUUIB-UHFFFAOYSA-N 1-(2-aminoethylamino)anthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NCCN UXFYNFPNBZUUIB-UHFFFAOYSA-N 0.000 description 1
- VBCRKWSYAUTZLB-UHFFFAOYSA-N 1-(4-chlorophenyl)-3-methyl-5-oxo-4h-pyrazole-4-carbaldehyde Chemical compound O=C1C(C=O)C(C)=NN1C1=CC=C(Cl)C=C1 VBCRKWSYAUTZLB-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- GIOGTAPCGVGOTJ-UHFFFAOYSA-N 1-n',1-n'-dimethyl-4-phenyldiazenylcyclohexa-2,4-diene-1,1-diamine Chemical compound C1=CC(N(C)C)(N)CC=C1N=NC1=CC=CC=C1 GIOGTAPCGVGOTJ-UHFFFAOYSA-N 0.000 description 1
- XTBAPWCYTNCZTO-UHFFFAOYSA-N 1H-isoindolone Natural products C1=CC=C2C(=O)N=CC2=C1 XTBAPWCYTNCZTO-UHFFFAOYSA-N 0.000 description 1
- MWBNOVWJWBPBPN-UHFFFAOYSA-N 2,4-dihydroxy-1h-quinoline-2-carbaldehyde Chemical compound C1=CC=C2C(O)=CC(O)(C=O)NC2=C1 MWBNOVWJWBPBPN-UHFFFAOYSA-N 0.000 description 1
- AVYGCQXNNJPXSS-UHFFFAOYSA-N 2,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC=C1Cl AVYGCQXNNJPXSS-UHFFFAOYSA-N 0.000 description 1
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical class CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 1
- JWYUFVNJZUSCSM-UHFFFAOYSA-N 2-aminobenzimidazole Chemical compound C1=CC=C2NC(N)=NC2=C1 JWYUFVNJZUSCSM-UHFFFAOYSA-N 0.000 description 1
- UHGULLIUJBCTEF-UHFFFAOYSA-N 2-aminobenzothiazole Chemical compound C1=CC=C2SC(N)=NC2=C1 UHGULLIUJBCTEF-UHFFFAOYSA-N 0.000 description 1
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- NTCCNERMXRIPTR-UHFFFAOYSA-N 2-hydroxy-1-naphthaldehyde Chemical compound C1=CC=CC2=C(C=O)C(O)=CC=C21 NTCCNERMXRIPTR-UHFFFAOYSA-N 0.000 description 1
- NUGOTBXFVWXVTE-UHFFFAOYSA-N 2-hydroxy-3-nitrobenzaldehyde Chemical compound OC1=C(C=O)C=CC=C1[N+]([O-])=O NUGOTBXFVWXVTE-UHFFFAOYSA-N 0.000 description 1
- DOTFNTYQQLWVFT-UHFFFAOYSA-N 2-hydroxy-5-[(2-methoxyphenyl)diazenyl]benzaldehyde Chemical compound COC1=CC=CC=C1N=NC1=CC=C(O)C(C=O)=C1 DOTFNTYQQLWVFT-UHFFFAOYSA-N 0.000 description 1
- IHFRMUGEILMHNU-UHFFFAOYSA-N 2-hydroxy-5-nitrobenzaldehyde Chemical compound OC1=CC=C([N+]([O-])=O)C=C1C=O IHFRMUGEILMHNU-UHFFFAOYSA-N 0.000 description 1
- XPVBLJIHHYLHOE-UHFFFAOYSA-N 2-hydroxy-5-phenyldiazenylbenzaldehyde Chemical compound C1=C(C=O)C(O)=CC=C1N=NC1=CC=CC=C1 XPVBLJIHHYLHOE-UHFFFAOYSA-N 0.000 description 1
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- OMDCDHDQQCPOKX-UHFFFAOYSA-N 2-phenoxy-3H-isoindol-1-one Chemical compound O(C1=CC=CC=C1)N1C(C2=CC=CC=C2C1)=O OMDCDHDQQCPOKX-UHFFFAOYSA-N 0.000 description 1
- HZYCUVLOBNNEKD-UHFFFAOYSA-N 2-quinolin-2-ylacetaldehyde Chemical compound C1=CC=CC2=NC(CC=O)=CC=C21 HZYCUVLOBNNEKD-UHFFFAOYSA-N 0.000 description 1
- FABVMBDCVAJXMB-UHFFFAOYSA-N 3,5-dichloro-2-hydroxybenzaldehyde Chemical compound OC1=C(Cl)C=C(Cl)C=C1C=O FABVMBDCVAJXMB-UHFFFAOYSA-N 0.000 description 1
- UEEWBVSMWMLMSC-UHFFFAOYSA-N 3-acetyl-6-chloro-4-hydroxy-1h-quinolin-2-one Chemical compound C1=CC(Cl)=CC2=C(O)C(C(=O)C)=C(O)N=C21 UEEWBVSMWMLMSC-UHFFFAOYSA-N 0.000 description 1
- LOZJNNNVLREXGU-UHFFFAOYSA-N 3-amino-4,5,6,7-tetrachloroisoindol-1-one Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C2=C1C(N)=NC2=O LOZJNNNVLREXGU-UHFFFAOYSA-N 0.000 description 1
- VTKJEYAWBPOMMA-UHFFFAOYSA-N 3-amino-4,5,6,7-tetraphenoxyisoindol-1-one Chemical compound N=C1NC(=O)C(C(=C(OC=2C=CC=CC=2)C=2OC=3C=CC=CC=3)OC=3C=CC=CC=3)=C1C=2OC1=CC=CC=C1 VTKJEYAWBPOMMA-UHFFFAOYSA-N 0.000 description 1
- UOAWYMQFZRSWCL-UHFFFAOYSA-N 3-amino-4,5,7-trichloro-6-ethoxyisoindol-1-one Chemical compound ClC1=C(Cl)C(OCC)=C(Cl)C2=C1C(=N)NC2=O UOAWYMQFZRSWCL-UHFFFAOYSA-N 0.000 description 1
- DXOZLVKWNOFJEB-UHFFFAOYSA-N 3-amino-4,5,7-trichloro-6-methoxyisoindol-1-one Chemical compound ClC1=C(Cl)C(OC)=C(Cl)C2=C1C(=N)NC2=O DXOZLVKWNOFJEB-UHFFFAOYSA-N 0.000 description 1
- FBFYJKCQSJNNPL-UHFFFAOYSA-N 3-amino-4,5,7-trichloro-6-methylsulfanylisoindol-1-one Chemical compound ClC1=C(Cl)C(SC)=C(Cl)C2=C1C(N)=NC2=O FBFYJKCQSJNNPL-UHFFFAOYSA-N 0.000 description 1
- NOFJASWEFDKODU-UHFFFAOYSA-N 3-amino-5,6-dichloroisoindol-1-one Chemical compound ClC1=C(Cl)C=C2C(N)=NC(=O)C2=C1 NOFJASWEFDKODU-UHFFFAOYSA-N 0.000 description 1
- NALAKUWQZSUUCV-UHFFFAOYSA-N 3-amino-5,7-dichloro-4,6-dimethoxyisoindol-1-one Chemical compound COC1=C(Cl)C(OC)=C2C(=N)NC(=O)C2=C1Cl NALAKUWQZSUUCV-UHFFFAOYSA-N 0.000 description 1
- KLICXIFDRLZSGO-UHFFFAOYSA-N 3-amino-6-chloroisoindol-1-one Chemical compound ClC1=CC=C2C(N)=NC(=O)C2=C1 KLICXIFDRLZSGO-UHFFFAOYSA-N 0.000 description 1
- RCEQJAZJQDYBSL-UHFFFAOYSA-N 3-amino-6-ethoxyisoindol-1-one Chemical compound CCOC1=CC=C2C(=N)NC(=O)C2=C1 RCEQJAZJQDYBSL-UHFFFAOYSA-N 0.000 description 1
- AYSYFLHEZBKBHJ-UHFFFAOYSA-N 3-amino-6-methoxyisoindol-1-one Chemical compound COC1=CC=C2C(N)=NC(=O)C2=C1 AYSYFLHEZBKBHJ-UHFFFAOYSA-N 0.000 description 1
- QSOBIPHMKDGPKR-UHFFFAOYSA-N 3-amino-6-methylisoindol-1-one Chemical compound CC1=CC=C2C(N)=NC(=O)C2=C1 QSOBIPHMKDGPKR-UHFFFAOYSA-N 0.000 description 1
- JWKUYVREWFAFLB-UHFFFAOYSA-N 3-amino-6-methylsulfanylisoindol-1-one Chemical compound CSC1=CC=C2C(=N)NC(=O)C2=C1 JWKUYVREWFAFLB-UHFFFAOYSA-N 0.000 description 1
- RTVGYOCUHIVTIY-UHFFFAOYSA-N 3-amino-6-methylsulfonylisoindol-1-one Chemical compound CS(=O)(=O)C1=CC=C2C(=N)NC(=O)C2=C1 RTVGYOCUHIVTIY-UHFFFAOYSA-N 0.000 description 1
- NWODCABIQVPNBA-UHFFFAOYSA-N 3-amino-6-nitroisoindol-1-one Chemical compound [O-][N+](=O)C1=CC=C2C(N)=NC(=O)C2=C1 NWODCABIQVPNBA-UHFFFAOYSA-N 0.000 description 1
- MCRRMASEMUHCNO-UHFFFAOYSA-N 3-amino-6-phenoxyisoindol-1-one Chemical compound C=1C=C2C(=N)NC(=O)C2=CC=1OC1=CC=CC=C1 MCRRMASEMUHCNO-UHFFFAOYSA-N 0.000 description 1
- CDPPJWFJXVLIIW-UHFFFAOYSA-N 3-amino-6-phenylisoindol-1-one Chemical compound C=1C=C2C(=N)NC(=O)C2=CC=1C1=CC=CC=C1 CDPPJWFJXVLIIW-UHFFFAOYSA-N 0.000 description 1
- LOZPOKCWMBZWBP-UHFFFAOYSA-N 3-amino-7-chloroisoindol-1-one Chemical compound C1=CC=C(Cl)C2=C1C(N)=NC2=O LOZPOKCWMBZWBP-UHFFFAOYSA-N 0.000 description 1
- SMTLWUNXQBUCBT-UHFFFAOYSA-N 3-amino-7-nitroisoindol-1-one Chemical compound [O-][N+](=O)C1=CC=CC2=C1C(=O)NC2=N SMTLWUNXQBUCBT-UHFFFAOYSA-N 0.000 description 1
- GSCPDZHWVNUUFI-UHFFFAOYSA-N 3-aminobenzamide Chemical compound NC(=O)C1=CC=CC(N)=C1 GSCPDZHWVNUUFI-UHFFFAOYSA-N 0.000 description 1
- MMBYJYAFFGKUDC-UHFFFAOYSA-N 3-aminoisoindol-1-one Chemical compound C1=CC=C2C(N)=NC(=O)C2=C1 MMBYJYAFFGKUDC-UHFFFAOYSA-N 0.000 description 1
- CNFIMWKSZDXZPU-UHFFFAOYSA-N 3-benzoyl-4-hydroxy-1H-quinolin-2-one Chemical compound OC=1NC2=CC=CC=C2C(=O)C=1C(=O)C1=CC=CC=C1 CNFIMWKSZDXZPU-UHFFFAOYSA-N 0.000 description 1
- QNAAQOLWUDNQFY-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1.NC1=CC=CC(Cl)=C1 QNAAQOLWUDNQFY-UHFFFAOYSA-N 0.000 description 1
- NCBZRJODKRCREW-KWCOIAHCSA-N 3-methoxyaniline Chemical compound COC1=CC=C[11C](N)=C1 NCBZRJODKRCREW-KWCOIAHCSA-N 0.000 description 1
- NOGXLNSDDOXIGP-UHFFFAOYSA-N 3-methyl-1-(4-methylphenyl)-5-oxo-4h-pyrazole-4-carbaldehyde Chemical compound O=C1C(C=O)C(C)=NN1C1=CC=C(C)C=C1 NOGXLNSDDOXIGP-UHFFFAOYSA-N 0.000 description 1
- RGDIXYRCPLMSGT-UHFFFAOYSA-N 3-methyl-5-oxo-1-phenyl-4h-pyrazole-4-carbaldehyde Chemical compound O=C1C(C=O)C(C)=NN1C1=CC=CC=C1 RGDIXYRCPLMSGT-UHFFFAOYSA-N 0.000 description 1
- FRKPCXYPIHAOFI-UHFFFAOYSA-N 3-methylaniline Chemical compound [CH2]C1=CC=CC(N)=C1 FRKPCXYPIHAOFI-UHFFFAOYSA-N 0.000 description 1
- ICNFHJVPAJKPHW-UHFFFAOYSA-N 4,4'-Thiodianiline Chemical compound C1=CC(N)=CC=C1SC1=CC=C(N)C=C1 ICNFHJVPAJKPHW-UHFFFAOYSA-N 0.000 description 1
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 1
- YEUZYKFEIVNUNP-UHFFFAOYSA-N 4,5,6,7-tetrabromo-3,3-dimethoxy-2h-isoindol-1-one Chemical compound BrC1=C(Br)C(Br)=C(Br)C2=C1C(OC)(OC)NC2=O YEUZYKFEIVNUNP-UHFFFAOYSA-N 0.000 description 1
- SVHKTIOSRIDIQJ-UHFFFAOYSA-N 4-[2,3-bis(4-aminophenoxy)propoxy]aniline Chemical compound C1=CC(N)=CC=C1OCC(OC=1C=CC(N)=CC=1)COC1=CC=C(N)C=C1 SVHKTIOSRIDIQJ-UHFFFAOYSA-N 0.000 description 1
- QNZWAJZEJAOVPN-UHFFFAOYSA-N 4-chloro-2-hydroxybenzaldehyde Chemical compound OC1=CC(Cl)=CC=C1C=O QNZWAJZEJAOVPN-UHFFFAOYSA-N 0.000 description 1
- IMPPGHMHELILKG-UHFFFAOYSA-N 4-ethoxyaniline Chemical compound CCOC1=CC=C(N)C=C1 IMPPGHMHELILKG-UHFFFAOYSA-N 0.000 description 1
- QODOLPZUMYLXKD-UHFFFAOYSA-N 4-formyl-3-hydroxy-n-phenylnaphthalene-2-carboxamide Chemical compound C1=C2C=CC=CC2=C(C=O)C(O)=C1C(=O)NC1=CC=CC=C1 QODOLPZUMYLXKD-UHFFFAOYSA-N 0.000 description 1
- LPRBZICETYEWOZ-UHFFFAOYSA-N 4-formyl-3-hydroxynaphthalene-2-carboxylic acid Chemical compound C1=CC=C2C(C=O)=C(O)C(C(=O)O)=CC2=C1 LPRBZICETYEWOZ-UHFFFAOYSA-N 0.000 description 1
- WNIIGYLAWCFYOW-UHFFFAOYSA-N 4-hydroxy-2-oxochromene-3-carbaldehyde Chemical compound C1=CC=CC2=C1OC(=O)C(C=O)=C2O WNIIGYLAWCFYOW-UHFFFAOYSA-N 0.000 description 1
- LJMXTWXGOCCHQO-UHFFFAOYSA-N 4-hydroxy-6-oxo-1H-pyrimidine-5-carbaldehyde Chemical compound OC1=NC=NC(O)=C1C=O LJMXTWXGOCCHQO-UHFFFAOYSA-N 0.000 description 1
- ZQGNFKWCLGMTMV-UHFFFAOYSA-N 4-hydroxy-8-methyl-2-oxo-1H-quinoline-3-carbaldehyde Chemical compound O=CC1=C(O)N=C2C(C)=CC=CC2=C1O ZQGNFKWCLGMTMV-UHFFFAOYSA-N 0.000 description 1
- YLOWAZAFHURGIN-UHFFFAOYSA-N 5-acetyl-6-hydroxy-1H-pyrimidine-2,4-dione Chemical compound CC(=O)C1=C(O)NC(=O)NC1=O YLOWAZAFHURGIN-UHFFFAOYSA-N 0.000 description 1
- FUGKCSRLAQKUHG-UHFFFAOYSA-N 5-chloro-2-hydroxybenzaldehyde Chemical compound OC1=CC=C(Cl)C=C1C=O FUGKCSRLAQKUHG-UHFFFAOYSA-N 0.000 description 1
- QWTCDIUTAKSTEW-UHFFFAOYSA-N 5-chloro-4-hydroxy-2-oxo-1H-quinoline-3-carbaldehyde Chemical compound C1=CC(Cl)=C2C(O)=C(C=O)C(O)=NC2=C1 QWTCDIUTAKSTEW-UHFFFAOYSA-N 0.000 description 1
- DENMQUVTTFVHLU-UHFFFAOYSA-N 5-formyl-6-hydroxy-4-methyl-2-oxo-1H-pyridine-3-carbonitrile Chemical compound CC1=C(C=O)C(O)=NC(O)=C1C#N DENMQUVTTFVHLU-UHFFFAOYSA-N 0.000 description 1
- XXKCZVMVIMSQDY-UHFFFAOYSA-N 5-formyl-6-hydroxy-4-methyl-2-oxo-1H-pyridine-3-carboxamide Chemical compound CC1=C(C=O)C(O)=NC(O)=C1C(N)=O XXKCZVMVIMSQDY-UHFFFAOYSA-N 0.000 description 1
- MFBDCSPVDMXRKL-UHFFFAOYSA-N 5-formyl-6-hydroxy-4-methyl-2-oxo-1H-pyridine-3-carboxylic acid Chemical compound CC1=C(C=O)C(O)=NC(O)=C1C(O)=O MFBDCSPVDMXRKL-UHFFFAOYSA-N 0.000 description 1
- XYENIVDTGLFNKT-UHFFFAOYSA-N 6,8-dichloro-4-hydroxy-2-oxo-1H-quinoline-3-carbaldehyde Chemical compound C1=C(Cl)C=C2C(O)=C(C=O)C(O)=NC2=C1Cl XYENIVDTGLFNKT-UHFFFAOYSA-N 0.000 description 1
- DXJGUERXGIHUAW-UHFFFAOYSA-N 6-chloro-4-hydroxy-2-oxo-1H-quinoline-3-carbaldehyde Chemical compound C1=C(Cl)C=C2C(O)=C(C=O)C(O)=NC2=C1 DXJGUERXGIHUAW-UHFFFAOYSA-N 0.000 description 1
- FNILPGXZGRXVHZ-UHFFFAOYSA-N 6-chloro-4-hydroxy-8-methyl-2-oxo-1H-quinoline-3-carbaldehyde Chemical compound O=CC1=C(O)N=C2C(C)=CC(Cl)=CC2=C1O FNILPGXZGRXVHZ-UHFFFAOYSA-N 0.000 description 1
- JHAWWJQGHKGXHA-UHFFFAOYSA-N 6-tert-butylquinoline Chemical compound N1=CC=CC2=CC(C(C)(C)C)=CC=C21 JHAWWJQGHKGXHA-UHFFFAOYSA-N 0.000 description 1
- MFARRYMBRCHYLG-UHFFFAOYSA-N 7,8-dichloro-4-hydroxy-2-oxo-1H-quinoline-3-carbaldehyde Chemical compound ClC1=CC=C2C(O)=C(C=O)C(O)=NC2=C1Cl MFARRYMBRCHYLG-UHFFFAOYSA-N 0.000 description 1
- JYYKLNYKUSBJNZ-UHFFFAOYSA-N 7-amino-2,3-dihydro-[1,4]dithiino[2,3-c]pyrrol-5-one Chemical compound S1CCSC2=C1C(=N)NC2=O JYYKLNYKUSBJNZ-UHFFFAOYSA-N 0.000 description 1
- SWWCVTVFYHZVKB-UHFFFAOYSA-N 7-aminopyrrolo[3,4-b]pyrazin-5-one Chemical compound C1=CN=C2C(N)=NC(=O)C2=N1 SWWCVTVFYHZVKB-UHFFFAOYSA-N 0.000 description 1
- UWEUZIXMALMJDE-UHFFFAOYSA-N 7-bromo-4-formyl-3-hydroxy-n-phenylnaphthalene-2-carboxamide Chemical compound C1=C2C=C(Br)C=CC2=C(C=O)C(O)=C1C(=O)NC1=CC=CC=C1 UWEUZIXMALMJDE-UHFFFAOYSA-N 0.000 description 1
- FLZVFNQWLHNEFR-UHFFFAOYSA-N 7-chloro-4-hydroxy-2-oxo-1H-quinoline-3-carbaldehyde Chemical compound ClC1=CC=C2C(O)=C(C=O)C(O)=NC2=C1 FLZVFNQWLHNEFR-UHFFFAOYSA-N 0.000 description 1
- OYHQOLUKZRVURQ-HZJYTTRNSA-M 9-cis,12-cis-Octadecadienoate Chemical compound CCCCC\C=C/C\C=C/CCCCCCCC([O-])=O OYHQOLUKZRVURQ-HZJYTTRNSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- MQJKPEGWNLWLTK-UHFFFAOYSA-N Dapsone Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 MQJKPEGWNLWLTK-UHFFFAOYSA-N 0.000 description 1
- MHZGKXUYDGKKIU-UHFFFAOYSA-N Decylamine Chemical compound CCCCCCCCCCN MHZGKXUYDGKKIU-UHFFFAOYSA-N 0.000 description 1
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical compound NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 235000018734 Sambucus australis Nutrition 0.000 description 1
- 244000180577 Sambucus australis Species 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 1
- SFYLHIMXJQGKGZ-RQOWECAXSA-N acetaldehyde (Z)-hydrazone Chemical compound C\C=N/N SFYLHIMXJQGKGZ-RQOWECAXSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- DJTZIDSZSYWGKR-UHFFFAOYSA-N acetic acid tetrahydrate Chemical compound O.O.O.O.CC(O)=O DJTZIDSZSYWGKR-UHFFFAOYSA-N 0.000 description 1
- OFLXLNCGODUUOT-UHFFFAOYSA-N acetohydrazide Chemical compound C\C(O)=N\N OFLXLNCGODUUOT-UHFFFAOYSA-N 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 229920003180 amino resin Polymers 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000000732 arylene group Chemical group 0.000 description 1
- WARCRYXKINZHGQ-UHFFFAOYSA-N benzohydrazide Chemical compound NNC(=O)C1=CC=CC=C1 WARCRYXKINZHGQ-UHFFFAOYSA-N 0.000 description 1
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 1
- 229920001727 cellulose butyrate Polymers 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- LLKHYFYYSFYSNF-UHFFFAOYSA-N cyclohexylidenehydrazine Chemical compound NN=C1CCCCC1 LLKHYFYYSFYSNF-UHFFFAOYSA-N 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 239000012975 dibutyltin dilaurate Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- WGPBPWDJBHMRRF-UHFFFAOYSA-N ethyl 4-formyl-5-oxo-1-phenyl-4H-pyrazole-3-carboxylate Chemical compound C1(=CC=CC=C1)N1N=C(C(C1=O)C=O)C(=O)OCC WGPBPWDJBHMRRF-UHFFFAOYSA-N 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- IVJISJACKSSFGE-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine Chemical compound O=C.NC1=NC(N)=NC(N)=N1 IVJISJACKSSFGE-UHFFFAOYSA-N 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000000976 ink Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 229940049918 linoleate Drugs 0.000 description 1
- 235000021388 linseed oil Nutrition 0.000 description 1
- 239000000944 linseed oil Substances 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- JJYPMNFTHPTTDI-UHFFFAOYSA-N meta-toluidine Natural products CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- ARFUXYZIGVDKTR-UHFFFAOYSA-N methyl 4-formyl-3-hydroxynaphthalene-2-carboxylate Chemical compound C1=CC=C2C(C=O)=C(O)C(C(=O)OC)=CC2=C1 ARFUXYZIGVDKTR-UHFFFAOYSA-N 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 1
- QELDWKJGMBINDJ-UHFFFAOYSA-N n-(1-amino-3-oxoisoindol-5-yl)acetamide Chemical compound CC(=O)NC1=CC=C2C(=N)NC(=O)C2=C1 QELDWKJGMBINDJ-UHFFFAOYSA-N 0.000 description 1
- PEMGGJDINLGTON-UHFFFAOYSA-N n-(3-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=CC(N)=C1 PEMGGJDINLGTON-UHFFFAOYSA-N 0.000 description 1
- CHMBIJAOCISYEW-UHFFFAOYSA-N n-(4-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(N)C=C1 CHMBIJAOCISYEW-UHFFFAOYSA-N 0.000 description 1
- GTTFJYUWPUKXJH-UHFFFAOYSA-N n-(4-aminophenyl)benzamide Chemical compound C1=CC(N)=CC=C1NC(=O)C1=CC=CC=C1 GTTFJYUWPUKXJH-UHFFFAOYSA-N 0.000 description 1
- ZKZLYMSNERXONO-UHFFFAOYSA-N n-(4-chloro-2-methylphenyl)-4-formyl-3-hydroxynaphthalene-2-carboxamide Chemical compound CC1=CC(Cl)=CC=C1NC(=O)C1=CC2=CC=CC=C2C(C=O)=C1O ZKZLYMSNERXONO-UHFFFAOYSA-N 0.000 description 1
- AELYZWJKFNAESE-UHFFFAOYSA-N n-(4-chlorophenyl)-4-formyl-3-hydroxynaphthalene-2-carboxamide Chemical compound C1=C2C=CC=CC2=C(C=O)C(O)=C1C(=O)NC1=CC=C(Cl)C=C1 AELYZWJKFNAESE-UHFFFAOYSA-N 0.000 description 1
- SLFVYFOEHHLHDW-UHFFFAOYSA-N n-(trifluoromethyl)aniline Chemical compound FC(F)(F)NC1=CC=CC=C1 SLFVYFOEHHLHDW-UHFFFAOYSA-N 0.000 description 1
- KUDPGZONDFORKU-UHFFFAOYSA-N n-chloroaniline Chemical compound ClNC1=CC=CC=C1 KUDPGZONDFORKU-UHFFFAOYSA-N 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 229940079938 nitrocellulose Drugs 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 230000000485 pigmenting effect Effects 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- JIQXKYSNGXUDJU-UHFFFAOYSA-N propan-2-ylidenehydrazine Chemical compound CC(C)=NN JIQXKYSNGXUDJU-UHFFFAOYSA-N 0.000 description 1
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- DUIOPKIIICUYRZ-UHFFFAOYSA-N semicarbazide Chemical compound NNC(N)=O DUIOPKIIICUYRZ-UHFFFAOYSA-N 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- FNXKBSAUKFCXIK-UHFFFAOYSA-M sodium;hydrogen carbonate;8-hydroxy-7-iodoquinoline-5-sulfonic acid Chemical class [Na+].OC([O-])=O.C1=CN=C2C(O)=C(I)C=C(S(O)(=O)=O)C2=C1 FNXKBSAUKFCXIK-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 125000004149 thio group Chemical group *S* 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B57/00—Other synthetic dyes of known constitution
- C09B57/04—Isoindoline dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Coloring (AREA)
- Photoreceptors In Electrophotography (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CH1210174A CH594721A5 (en, 2012) | 1974-09-05 | 1974-09-05 |
Publications (1)
Publication Number | Publication Date |
---|---|
CA1064929A true CA1064929A (en) | 1979-10-23 |
Family
ID=4379858
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CA234,686A Expired CA1064929A (en) | 1974-09-05 | 1975-09-03 | Metal complexes of bis-hydrazones and a process for their manufacture |
Country Status (11)
Country | Link |
---|---|
US (1) | US4016157A (en, 2012) |
JP (1) | JPS6019341B2 (en, 2012) |
BE (1) | BE833060A (en, 2012) |
CA (1) | CA1064929A (en, 2012) |
CH (1) | CH594721A5 (en, 2012) |
DE (1) | DE2539034A1 (en, 2012) |
ES (1) | ES440719A1 (en, 2012) |
FR (1) | FR2283891A1 (en, 2012) |
GB (1) | GB1519000A (en, 2012) |
NL (1) | NL7510138A (en, 2012) |
SU (1) | SU715031A3 (en, 2012) |
Families Citing this family (8)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CH597324A5 (en, 2012) * | 1974-02-06 | 1978-03-31 | Ciba Geigy Ag | |
US4111947A (en) * | 1974-02-06 | 1978-09-05 | Ciba-Geigy Corporation | Novel metal complexes of azomethines and process for their manufacture |
US4327212A (en) * | 1979-05-29 | 1982-04-27 | Ciba-Geigy Corporation | Isoindoline-azine nickel complex with piperazine |
DE2936748A1 (de) * | 1979-09-12 | 1981-04-02 | Basf Ag, 6700 Ludwigshafen | Neue hydrazone und ihre metallkomplexe |
US7041856B2 (en) * | 2001-10-23 | 2006-05-09 | Sumitomo Chemical Company, Limited | Coupling catalyst and process using the same |
US8332526B2 (en) | 2005-05-25 | 2012-12-11 | Microsoft Corporation | Data communication protocol including negotiation and command compounding |
CN103288883B (zh) * | 2013-06-14 | 2016-05-18 | 桂林理工大学 | [Ni(L)(AcO)(H2O)2]·(C2H3N)的原位合成方法 |
CN103333210B (zh) * | 2013-07-18 | 2016-05-18 | 桂林理工大学 | 一种[Mn(L)(AcO)]·(HOAc)的原位合成方法 |
Family Cites Families (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3290299A (en) * | 1963-06-26 | 1966-12-06 | Interchem Corp | Copper chelate pigments and process of making them |
DE1719064A1 (de) * | 1968-03-15 | 1971-08-12 | Basf Ag | Pigmentfarbstoffe |
DE2142245C3 (de) * | 1971-08-24 | 1980-09-04 | Basf Ag, 6700 Ludwigshafen | Farbstoffe auf der Basis von Imino-isoindolin, deren Herstellung und Verwendung als Pigmente für Lacke und zum Anfärben von Polyestermaterialien |
CH580678A5 (en, 2012) * | 1972-12-04 | 1976-10-15 | Ciba Geigy Ag | |
CH581683A5 (en, 2012) * | 1973-09-07 | 1976-11-15 | Ciba Geigy Ag |
-
1974
- 1974-09-05 CH CH1210174A patent/CH594721A5/xx not_active IP Right Cessation
-
1975
- 1975-08-26 US US05/607,968 patent/US4016157A/en not_active Expired - Lifetime
- 1975-08-27 NL NL7510138A patent/NL7510138A/xx not_active Application Discontinuation
- 1975-09-02 DE DE19752539034 patent/DE2539034A1/de active Granted
- 1975-09-02 JP JP50106433A patent/JPS6019341B2/ja not_active Expired
- 1975-09-03 CA CA234,686A patent/CA1064929A/en not_active Expired
- 1975-09-04 GB GB36422/75A patent/GB1519000A/en not_active Expired
- 1975-09-04 BE BE159731A patent/BE833060A/xx unknown
- 1975-09-04 ES ES440719A patent/ES440719A1/es not_active Expired
- 1975-09-04 SU SU752170652A patent/SU715031A3/ru active
- 1975-09-04 FR FR7527092A patent/FR2283891A1/fr active Granted
Also Published As
Publication number | Publication date |
---|---|
BE833060A (fr) | 1976-03-04 |
CH594721A5 (en, 2012) | 1978-01-31 |
JPS5152434A (en) | 1976-05-10 |
AU8457075A (en) | 1977-03-10 |
DE2539034C2 (en, 2012) | 1988-06-30 |
NL7510138A (nl) | 1976-03-09 |
US4016157A (en) | 1977-04-05 |
FR2283891B1 (en, 2012) | 1978-04-07 |
GB1519000A (en) | 1978-07-26 |
ES440719A1 (es) | 1977-06-16 |
FR2283891A1 (fr) | 1976-04-02 |
SU715031A3 (ru) | 1980-02-05 |
JPS6019341B2 (ja) | 1985-05-15 |
DE2539034A1 (de) | 1976-03-25 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
CA1054617A (en) | Metal complexes of azomethines and process for their manufacture | |
CA1064929A (en) | Metal complexes of bis-hydrazones and a process for their manufacture | |
US3875200A (en) | New bis-2-azomethine pigments, process for their manufacture and their use | |
US4044036A (en) | Metal complexes of bis-azomethines from hydroxy-aldehydes and alkylene diamines | |
CA1050992A (en) | Azomethine pigments | |
CA1242210A (en) | Use of metal complexes of hydrazones as pigments | |
CA1083565A (en) | Monoazo pigments | |
US2396327A (en) | Metallized azo pigments | |
US4564680A (en) | Isoindolazines | |
CA1064950A (en) | Bis-azomethine metal complex colorants of hydroxycoumarin derivatives or hydroxychromone derivatives and process for their manufacture | |
GB2236536A (en) | Pigmentary salts of anionic dye with sterically hindered amines | |
CA1061348A (en) | Iminoisoindolinone metal complex | |
CA1079283A (en) | 2-quinolinyl-1,3-indandione compounds | |
US4259488A (en) | Bis-isoindoline pigments | |
US4077953A (en) | Tri-dentate metal complex azo pigments | |
US4113759A (en) | Metal-containing disazomethine compounds, process for preparing them and their use as colorants | |
CA2116064A1 (en) | Diketopyrrolopyrroles containing nitroxyl groups | |
CA1066292A (en) | Mixed complexes of methine dyes | |
CA1089869A (en) | Metal-containing disazomethine compounds, process for preparing them and their use as colorants | |
US3971739A (en) | Tri or tetradentate metal azo pigment complexes | |
CA1082832A (en) | Perinone compounds, process for preparing them and their use as dyes | |
US4088641A (en) | 4-Methyl-5-(benzimidazolonylazo)-6-hydroxypyridone-2 pigment | |
PL76037B1 (en) | Azo dyestuffs containing triazines and vattable polycyclic quinones[us3655638a] | |
US3882099A (en) | Phenyl-azo-(polycyclic)heterocyclic metal complexes | |
GB2217339A (en) | Benzodipyrrole pigments and dyes |