CA1062836A - Flame retardant polycarbonate composition - Google Patents
Flame retardant polycarbonate compositionInfo
- Publication number
- CA1062836A CA1062836A CA211,459A CA211459A CA1062836A CA 1062836 A CA1062836 A CA 1062836A CA 211459 A CA211459 A CA 211459A CA 1062836 A CA1062836 A CA 1062836A
- Authority
- CA
- Canada
- Prior art keywords
- additive
- composition
- flame retardant
- aromatic
- disodium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 title claims abstract description 21
- 239000003063 flame retardant Substances 0.000 title claims abstract description 21
- 239000000203 mixture Substances 0.000 title claims abstract description 21
- 239000004417 polycarbonate Substances 0.000 title abstract description 19
- 229920000515 polycarbonate Polymers 0.000 title abstract description 18
- 239000000654 additive Substances 0.000 claims abstract description 41
- 230000000996 additive effect Effects 0.000 claims abstract description 28
- 125000003118 aryl group Chemical group 0.000 claims abstract description 18
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims abstract description 15
- 150000003839 salts Chemical class 0.000 claims abstract description 15
- 229910052751 metal Inorganic materials 0.000 claims abstract description 12
- 239000002184 metal Substances 0.000 claims abstract description 12
- 229920000642 polymer Polymers 0.000 claims abstract description 12
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000000460 chlorine Substances 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 6
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical group [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 229910052731 fluorine Inorganic materials 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 150000001735 carboxylic acids Chemical class 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- SAQSTQBVENFSKT-UHFFFAOYSA-M TCA-sodium Chemical group [Na+].[O-]C(=O)C(Cl)(Cl)Cl SAQSTQBVENFSKT-UHFFFAOYSA-M 0.000 claims 1
- UMIVMLKFARKXIF-UAIGNFCESA-L [Na+].[Na+].[O-]C(=O)C(\Br)=C(\Br)C([O-])=O Chemical group [Na+].[Na+].[O-]C(=O)C(\Br)=C(\Br)C([O-])=O UMIVMLKFARKXIF-UAIGNFCESA-L 0.000 claims 1
- 150000001342 alkaline earth metals Chemical class 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- FPFJTBQQZWBMAZ-UHFFFAOYSA-L disodium;2,2,3,3,4,4-hexafluoropentanedioate Chemical group [Na+].[Na+].[O-]C(=O)C(F)(F)C(F)(F)C(F)(F)C([O-])=O FPFJTBQQZWBMAZ-UHFFFAOYSA-L 0.000 claims 1
- 229920001169 thermoplastic Polymers 0.000 abstract 1
- 239000004416 thermosoftening plastic Substances 0.000 abstract 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 9
- -1 aromatic carboxylic acids Chemical class 0.000 description 8
- 238000000034 method Methods 0.000 description 5
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000002243 precursor Substances 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 239000000370 acceptor Substances 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 230000015556 catabolic process Effects 0.000 description 3
- 238000006731 degradation reaction Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 238000010998 test method Methods 0.000 description 3
- DEIGXXQKDWULML-UHFFFAOYSA-N 1,2,5,6,9,10-hexabromocyclododecane Chemical compound BrC1CCC(Br)C(Br)CCC(Br)C(Br)CCC1Br DEIGXXQKDWULML-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 239000011575 calcium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000000593 degrading effect Effects 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 229910052701 rubidium Inorganic materials 0.000 description 2
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 229910052712 strontium Inorganic materials 0.000 description 2
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 2
- DJHWAIPYZDRNMH-UHFFFAOYSA-N 1,2,3,4,5-pentabromo-6-(2-bromophenyl)benzene Chemical group BrC1=CC=CC=C1C1=C(Br)C(Br)=C(Br)C(Br)=C1Br DJHWAIPYZDRNMH-UHFFFAOYSA-N 0.000 description 1
- CCUWGJDGLACFQT-UHFFFAOYSA-N 2,2,3,3,4,4-hexafluoropentanedioic acid Chemical compound OC(=O)C(F)(F)C(F)(F)C(F)(F)C(O)=O CCUWGJDGLACFQT-UHFFFAOYSA-N 0.000 description 1
- YMTYZTXUZLQUSF-UHFFFAOYSA-N 3,3'-Dimethylbisphenol A Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=CC=2)=C1 YMTYZTXUZLQUSF-UHFFFAOYSA-N 0.000 description 1
- 101100099490 Alkalihalobacillus halodurans (strain ATCC BAA-125 / DSM 18197 / FERM 7344 / JCM 9153 / C-125) thiY gene Proteins 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- 241000784713 Cupido Species 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000005325 alkali earth metal hydroxides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 229940106691 bisphenol a Drugs 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- SCIOEXXGYMZORL-UHFFFAOYSA-L calcium;1,2,3,4,7,7-hexachlorobicyclo[2.2.1]hept-5-ene-5-carboxylate Chemical compound [Ca+2].ClC1C(Cl)C2(Cl)C(C(=O)[O-])=CC1(Cl)C2(Cl)Cl.ClC1C(Cl)C2(Cl)C(C(=O)[O-])=CC1(Cl)C2(Cl)Cl SCIOEXXGYMZORL-UHFFFAOYSA-L 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 159000000006 cesium salts Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- HCTVWSOKIJULET-LQDWTQKMSA-M phenoxymethylpenicillin potassium Chemical compound [K+].N([C@H]1[C@H]2SC([C@@H](N2C1=O)C([O-])=O)(C)C)C(=O)COC1=CC=CC=C1 HCTVWSOKIJULET-LQDWTQKMSA-M 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 150000003071 polychlorinated biphenyls Chemical group 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/09—Carboxylic acids; Metal salts thereof; Anhydrides thereof
- C08K5/098—Metal salts of carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/09—Carboxylic acids; Metal salts thereof; Anhydrides thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Fireproofing Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/429,644 US4066618A (en) | 1973-12-28 | 1973-12-28 | Flame retardant polycarbonate composition |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1062836A true CA1062836A (en) | 1979-09-18 |
Family
ID=23704127
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA211,459A Expired CA1062836A (en) | 1973-12-28 | 1974-10-15 | Flame retardant polycarbonate composition |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4066618A (OSRAM) |
| JP (1) | JPS5929611B2 (OSRAM) |
| BR (1) | BR7410857D0 (OSRAM) |
| CA (1) | CA1062836A (OSRAM) |
| DE (1) | DE2460946A1 (OSRAM) |
| FR (1) | FR2256222B1 (OSRAM) |
| GB (1) | GB1495954A (OSRAM) |
| IT (1) | IT1027810B (OSRAM) |
| NL (1) | NL7416731A (OSRAM) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4320049A (en) * | 1980-07-14 | 1982-03-16 | Mobay Chemical Corporation | Flame retarding agents for polycarbonates |
| US4464497A (en) * | 1982-12-15 | 1984-08-07 | General Electric Company | Carbon black filled flame retardant polycarbonate compositions |
| US4600742A (en) * | 1984-08-17 | 1986-07-15 | The Lubrizol Corporation | Polycarbonate compositions |
| US4632949A (en) * | 1984-12-31 | 1986-12-30 | Mobay Chemical Corporation | Flame retarding agents for polycarbonates |
| US4578409A (en) * | 1985-01-14 | 1986-03-25 | Mobay Chemical Corporation | Flame retarding silanes |
| JPH03175218A (ja) * | 1989-12-04 | 1991-07-30 | Mitsubishi Electric Corp | 床暖房パネル |
| US4994510A (en) * | 1990-04-05 | 1991-02-19 | General Electric Company | Poly(carbonate-siloxane) with reduced tendency to burn |
| US6995212B2 (en) | 2003-08-08 | 2006-02-07 | Bayer Materialscience Llc | Flame retardant, thermoplastic polycarbonate molding compositions |
| JP6605456B2 (ja) * | 2013-10-08 | 2019-11-13 | コベストロ、ドイチュラント、アクチエンゲゼルシャフト | ポリシロキサン−ポリカーボネートブロック共縮合物 |
| WO2015052106A2 (en) * | 2013-10-08 | 2015-04-16 | Bayer Materialscience Ag | Process for preparing polysiloxane-polycarbonate block cocondensates using a salt of a weak acid |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2758918A (en) * | 1955-03-14 | 1956-08-14 | Shell Dev | Plant regulators |
| US2839553A (en) * | 1955-03-14 | 1958-06-17 | Shell Dev | Polyhalogeno bicyclic acids |
| US3365470A (en) * | 1964-05-08 | 1968-01-23 | Universal Oil Prod Co | Halo-substituted polyhydrodialkanotricyclic dicarboxylic acids, derivatives and a method of preparation thereof |
| US3288813A (en) * | 1964-08-26 | 1966-11-29 | Velsicol Chemical Corp | 5, 6, 7, 8, 9, 9-hexachloro-1, 2, 3, 4, 4alpha, 5, 8, 8alpha-octahydro-1, 4, 5, 8-dimethanonaphthalene-2, 3-dicarboxylic acid and 5, 6, 7, 8, 9, 9-hexachloro-1, 2, 3, 4,4alpha, 5, 8, 8alpha-octahydro-1, 4, 5, 8-dimethanonaphthalene-2, 3-dicarboxylic anhydride |
| US3535300A (en) * | 1967-10-12 | 1970-10-20 | Mobay Chemical Corp | Flame resistant polycarbonates |
| US3522204A (en) * | 1968-07-01 | 1970-07-28 | American Cyanamid Co | Synergistic flame-retardant compositions |
-
1973
- 1973-12-28 US US05/429,644 patent/US4066618A/en not_active Expired - Lifetime
-
1974
- 1974-10-15 CA CA211,459A patent/CA1062836A/en not_active Expired
- 1974-12-06 JP JP49141107A patent/JPS5929611B2/ja not_active Expired
- 1974-12-16 GB GB54244/74A patent/GB1495954A/en not_active Expired
- 1974-12-19 IT IT30732/74A patent/IT1027810B/it active
- 1974-12-20 NL NL7416731A patent/NL7416731A/xx not_active Application Discontinuation
- 1974-12-21 DE DE19742460946 patent/DE2460946A1/de not_active Withdrawn
- 1974-12-26 BR BR10857/74A patent/BR7410857D0/pt unknown
- 1974-12-27 FR FR7443101A patent/FR2256222B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2256222A1 (OSRAM) | 1975-07-25 |
| IT1027810B (it) | 1978-12-20 |
| JPS5097642A (OSRAM) | 1975-08-02 |
| US4066618A (en) | 1978-01-03 |
| NL7416731A (nl) | 1975-07-01 |
| JPS5929611B2 (ja) | 1984-07-21 |
| BR7410857D0 (pt) | 1975-09-02 |
| AU7586174A (en) | 1976-06-03 |
| DE2460946A1 (de) | 1975-07-10 |
| FR2256222B1 (OSRAM) | 1980-04-18 |
| GB1495954A (en) | 1977-12-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3951910A (en) | Flame retardant polycarbonate composition | |
| US3948851A (en) | Flame retardant polycarbonate composition | |
| US3933734A (en) | Flame retardant polycarbonate composition | |
| US4093590A (en) | Flame retardant polycarbonate composition | |
| US3953399A (en) | Flame retardant polycarbonate composition | |
| CA1048678A (en) | Flame retardant polycarbonate composition | |
| US3940366A (en) | Flame retardant polycarbonate composition | |
| US3926908A (en) | Flame retardant polycarbonate composition | |
| US3931100A (en) | Flame retardant polycarbonate composition | |
| US4469833A (en) | Flame retardant polycarbonate compositions | |
| CA1062836A (en) | Flame retardant polycarbonate composition | |
| US3953396A (en) | Flame retardant polycarbonate composition | |
| US3917559A (en) | Flame retardant polycarbonate composition | |
| CA1063282A (en) | Flame retardant polycarbonate composition | |
| US3796772A (en) | Flame retardant polymer composition containing in admixture calcium titanate | |
| US4104246A (en) | Non-opaque flame-retardant polycarbonate composition | |
| US4579896A (en) | Flame retardant polycarbonate compositions | |
| US4153595A (en) | Flame retardant polycarbonate composition | |
| CA1068842A (en) | Flame retardant polycarbonate composition | |
| US4039509A (en) | Non-opaque flame retardant polycarbonate composition | |
| US3852238A (en) | Flame retardant polycarbonate composition | |
| US4032506A (en) | Flame retardant polycarbonate composition | |
| US4111977A (en) | Flame retardant polycarbonate composition | |
| US4033930A (en) | Flame retardant polycarbonate composition | |
| US4506046A (en) | Flame retardant polycarbonate compositions |