CA1053673A - Pharmacologically active benzoyl benzofurans and benzothiophenes - Google Patents
Pharmacologically active benzoyl benzofurans and benzothiophenesInfo
- Publication number
- CA1053673A CA1053673A CA223,045A CA223045A CA1053673A CA 1053673 A CA1053673 A CA 1053673A CA 223045 A CA223045 A CA 223045A CA 1053673 A CA1053673 A CA 1053673A
- Authority
- CA
- Canada
- Prior art keywords
- phenyl
- benzofuran
- hydrogen
- dimethylbenzoyl
- ethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical class C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 title description 29
- DZRJNLPOTUVETG-UHFFFAOYSA-N 1-benzofuran-2-yl(phenyl)methanone Chemical class C=1C2=CC=CC=C2OC=1C(=O)C1=CC=CC=C1 DZRJNLPOTUVETG-UHFFFAOYSA-N 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 claims abstract description 145
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 142
- 239000001257 hydrogen Substances 0.000 claims abstract description 34
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 34
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims abstract description 33
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims abstract description 28
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 28
- 125000005037 alkyl phenyl group Chemical group 0.000 claims abstract description 26
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 24
- 150000003839 salts Chemical class 0.000 claims abstract description 23
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims abstract description 17
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 17
- 239000002253 acid Substances 0.000 claims abstract description 15
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims abstract description 15
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims abstract description 14
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 13
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 11
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 9
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims abstract description 8
- 125000005059 halophenyl group Chemical group 0.000 claims abstract description 8
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract 8
- 229910052760 oxygen Inorganic materials 0.000 claims abstract 8
- 239000001301 oxygen Substances 0.000 claims abstract 8
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims abstract 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract 5
- 229910052717 sulfur Inorganic materials 0.000 claims abstract 5
- 239000011593 sulfur Substances 0.000 claims abstract 5
- 238000000034 method Methods 0.000 claims description 109
- -1 3,5-dimethylphenyl Chemical group 0.000 claims description 66
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 45
- YMDNODNLFSHHCV-UHFFFAOYSA-N 2-chloro-n,n-diethylethanamine Chemical compound CCN(CC)CCCl YMDNODNLFSHHCV-UHFFFAOYSA-N 0.000 claims description 15
- 239000002904 solvent Substances 0.000 claims description 14
- 150000001412 amines Chemical class 0.000 claims description 12
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 11
- 125000005843 halogen group Chemical group 0.000 claims description 8
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical group C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 claims description 6
- XHYZJDRBGWWJJK-UHFFFAOYSA-N (3,5-dimethylphenyl)-[2-(4-hydroxyphenyl)-1-benzofuran-3-yl]methanone Chemical compound CC1=CC(C)=CC(C(=O)C=2C3=CC=CC=C3OC=2C=2C=CC(O)=CC=2)=C1 XHYZJDRBGWWJJK-UHFFFAOYSA-N 0.000 claims description 5
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 5
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 5
- JFAOHVGKAOICSQ-UHFFFAOYSA-N [2-[4-[2-(diethylamino)ethoxy]phenyl]-1-benzofuran-3-yl]-(3,5-dimethylphenyl)methanone Chemical compound C1=CC(OCCN(CC)CC)=CC=C1C1=C(C(=O)C=2C=C(C)C=C(C)C=2)C2=CC=CC=C2O1 JFAOHVGKAOICSQ-UHFFFAOYSA-N 0.000 claims description 3
- 125000003386 piperidinyl group Chemical group 0.000 claims description 3
- 238000010992 reflux Methods 0.000 claims description 3
- ZLGPPDTZDDAZSJ-UHFFFAOYSA-N [5-chloro-2-(4-hydroxyphenyl)-1-benzofuran-3-yl]-(3,5-dimethylphenyl)methanone Chemical compound CC1=CC(C)=CC(C(=O)C=2C3=CC(Cl)=CC=C3OC=2C=2C=CC(O)=CC=2)=C1 ZLGPPDTZDDAZSJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims 11
- KMJBOJIVELWVDH-UHFFFAOYSA-N [5-chloro-2-[4-[2-(diethylamino)ethoxy]phenyl]-1-benzofuran-3-yl]-(3,5-dimethylphenyl)methanone Chemical compound C1=CC(OCCN(CC)CC)=CC=C1C1=C(C(=O)C=2C=C(C)C=C(C)C=2)C2=CC(Cl)=CC=C2O1 KMJBOJIVELWVDH-UHFFFAOYSA-N 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 claims 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- 230000000694 effects Effects 0.000 abstract description 11
- 239000003218 coronary vasodilator agent Substances 0.000 abstract description 6
- 206010002383 Angina Pectoris Diseases 0.000 abstract description 3
- 230000000144 pharmacologic effect Effects 0.000 abstract description 3
- 125000001475 halogen functional group Chemical group 0.000 abstract 1
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical group C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 240
- 239000000243 solution Substances 0.000 description 59
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 56
- 230000000875 corresponding effect Effects 0.000 description 53
- 238000006243 chemical reaction Methods 0.000 description 41
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 37
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 32
- 239000000203 mixture Substances 0.000 description 31
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 27
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 26
- 239000011541 reaction mixture Substances 0.000 description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 25
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 24
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 24
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 20
- 150000001907 coumarones Chemical class 0.000 description 17
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 17
- 239000000047 product Substances 0.000 description 17
- 229960001701 chloroform Drugs 0.000 description 16
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 16
- 238000006467 substitution reaction Methods 0.000 description 16
- 230000017858 demethylation Effects 0.000 description 15
- 238000010520 demethylation reaction Methods 0.000 description 15
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 15
- ZJIOBDJEKDUUCI-UHFFFAOYSA-N 3,5-dimethylbenzoyl chloride Chemical compound CC1=CC(C)=CC(C(Cl)=O)=C1 ZJIOBDJEKDUUCI-UHFFFAOYSA-N 0.000 description 14
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 229960000443 hydrochloric acid Drugs 0.000 description 12
- 235000011167 hydrochloric acid Nutrition 0.000 description 12
- 235000019341 magnesium sulphate Nutrition 0.000 description 12
- 229910000027 potassium carbonate Inorganic materials 0.000 description 12
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 12
- 239000007858 starting material Substances 0.000 description 11
- 230000010933 acylation Effects 0.000 description 10
- 238000005917 acylation reaction Methods 0.000 description 10
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 10
- 239000000706 filtrate Substances 0.000 description 9
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 9
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical class SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 9
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical group [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 8
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 8
- 239000004593 Epoxy Substances 0.000 description 8
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 8
- 239000000284 extract Substances 0.000 description 8
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 7
- RFRXIWQYSOIBDI-UHFFFAOYSA-N benzarone Chemical compound CCC=1OC2=CC=CC=C2C=1C(=O)C1=CC=C(O)C=C1 RFRXIWQYSOIBDI-UHFFFAOYSA-N 0.000 description 7
- 239000000543 intermediate Substances 0.000 description 7
- 125000000872 2-diethylaminoethoxy group Chemical group [H]C([H])([H])C([H])([H])N(C([H])([H])C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 description 6
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 6
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 6
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 5
- YFKBXYGUSOXJGS-UHFFFAOYSA-N 1,3-Diphenyl-2-propanone Chemical compound C=1C=CC=CC=1CC(=O)CC1=CC=CC=C1 YFKBXYGUSOXJGS-UHFFFAOYSA-N 0.000 description 5
- WVUULNDRFBHTFG-UHFFFAOYSA-N 3-chloro-n,n-diethylpropan-1-amine Chemical compound CCN(CC)CCCCl WVUULNDRFBHTFG-UHFFFAOYSA-N 0.000 description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 5
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 5
- 150000003840 hydrochlorides Chemical class 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 238000010561 standard procedure Methods 0.000 description 5
- FTHPLWDYWAKYCY-UHFFFAOYSA-N 3,5-dimethoxybenzoyl chloride Chemical compound COC1=CC(OC)=CC(C(Cl)=O)=C1 FTHPLWDYWAKYCY-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 239000005711 Benzoic acid Substances 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Natural products OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 235000010233 benzoic acid Nutrition 0.000 description 4
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 4
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 4
- GKIPXFAANLTWBM-UHFFFAOYSA-N epibromohydrin Chemical compound BrCC1CO1 GKIPXFAANLTWBM-UHFFFAOYSA-N 0.000 description 4
- 239000007903 gelatin capsule Substances 0.000 description 4
- 150000002431 hydrogen Chemical group 0.000 description 4
- 239000004615 ingredient Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 235000019198 oils Nutrition 0.000 description 4
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical compound CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 description 4
- 229920000137 polyphosphoric acid Polymers 0.000 description 4
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 3
- UKHHJBHJLJNZRN-UHFFFAOYSA-N 2-(4-methoxyphenyl)-1-benzofuran Chemical compound C1=CC(OC)=CC=C1C1=CC2=CC=CC=C2O1 UKHHJBHJLJNZRN-UHFFFAOYSA-N 0.000 description 3
- UNWTWBWACFCITQ-UHFFFAOYSA-N 2-[4-(2-bromoethoxy)phenyl]-1-benzofuran Chemical compound C1=CC(OCCBr)=CC=C1C1=CC2=CC=CC=C2O1 UNWTWBWACFCITQ-UHFFFAOYSA-N 0.000 description 3
- FDPIQFFPBKCXEW-UHFFFAOYSA-N 3-(4-methoxyphenyl)-1-benzofuran Chemical compound C1=CC(OC)=CC=C1C1=COC2=CC=CC=C12 FDPIQFFPBKCXEW-UHFFFAOYSA-N 0.000 description 3
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 3
- 241000282472 Canis lupus familiaris Species 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 241001077660 Molo Species 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 235000021355 Stearic acid Nutrition 0.000 description 3
- WSKFSKLSEMNOQZ-UHFFFAOYSA-N [2-[4-(2-bromoethoxy)phenyl]-1-benzofuran-3-yl]-(3,5-dimethylphenyl)methanone Chemical compound CC1=CC(C)=CC(C(=O)C=2C3=CC=CC=C3OC=2C=2C=CC(OCCBr)=CC=2)=C1 WSKFSKLSEMNOQZ-UHFFFAOYSA-N 0.000 description 3
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 3
- 230000017531 blood circulation Effects 0.000 description 3
- 125000005997 bromomethyl group Chemical group 0.000 description 3
- 150000007857 hydrazones Chemical class 0.000 description 3
- 229940039009 isoproterenol Drugs 0.000 description 3
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 235000017550 sodium carbonate Nutrition 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 229940001593 sodium carbonate Drugs 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000008117 stearic acid Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 235000012222 talc Nutrition 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- QLBSWWCIQUETHU-UHFFFAOYSA-N (3,5-dimethylphenyl)-[2-(4-methoxyphenyl)-1-benzofuran-3-yl]methanone Chemical compound C1=CC(OC)=CC=C1C1=C(C(=O)C=2C=C(C)C=C(C)C=2)C2=CC=CC=C2O1 QLBSWWCIQUETHU-UHFFFAOYSA-N 0.000 description 2
- PQTRFNXBQFYCOX-UHFFFAOYSA-N (3,5-dimethylphenyl)-[2-(4-methoxyphenyl)-1-benzothiophen-3-yl]methanone Chemical compound C1=CC(OC)=CC=C1C1=C(C(=O)C=2C=C(C)C=C(C)C=2)C2=CC=CC=C2S1 PQTRFNXBQFYCOX-UHFFFAOYSA-N 0.000 description 2
- GSMMLFWFVBAFDU-UHFFFAOYSA-N (3,5-dimethylphenyl)-[3-(4-methoxyphenyl)-1-benzofuran-2-yl]methanone Chemical compound C1=CC(OC)=CC=C1C1=C(C(=O)C=2C=C(C)C=C(C)C=2)OC2=CC=CC=C12 GSMMLFWFVBAFDU-UHFFFAOYSA-N 0.000 description 2
- ZFBVIXGQRUWLFI-UHFFFAOYSA-N (3,5-dimethylphenyl)-[3-[(4-hydroxyphenyl)methyl]-1-benzofuran-2-yl]methanone Chemical compound CC1=CC(C)=CC(C(=O)C2=C(C3=CC=CC=C3O2)CC=2C=CC(O)=CC=2)=C1 ZFBVIXGQRUWLFI-UHFFFAOYSA-N 0.000 description 2
- HSHZXFYRQUJRKB-UHFFFAOYSA-N (4-chlorophenyl)-[2-(3-hydroxyphenyl)-1-benzofuran-3-yl]methanone Chemical compound OC1=CC=CC(C2=C(C3=CC=CC=C3O2)C(=O)C=2C=CC(Cl)=CC=2)=C1 HSHZXFYRQUJRKB-UHFFFAOYSA-N 0.000 description 2
- JACAUBAVGNBTGS-UHFFFAOYSA-N (4-chlorophenyl)-[2-(4-methoxyphenyl)-1-benzofuran-3-yl]methanone Chemical compound C1=CC(OC)=CC=C1C1=C(C(=O)C=2C=CC(Cl)=CC=2)C2=CC=CC=C2O1 JACAUBAVGNBTGS-UHFFFAOYSA-N 0.000 description 2
- FIFYGLUSBZOAQP-UHFFFAOYSA-N (4-methylphenyl)-[2-[4-(oxiran-2-ylmethoxy)phenyl]-1-benzofuran-3-yl]methanone Chemical compound C1=CC(C)=CC=C1C(=O)C1=C(C=2C=CC(OCC3OC3)=CC=2)OC2=CC=CC=C12 FIFYGLUSBZOAQP-UHFFFAOYSA-N 0.000 description 2
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical class CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 2
- NBZQDHFJJVOLEP-UHFFFAOYSA-N 1-benzofuran-2-yl-(4-methoxyphenyl)methanone Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC2=CC=CC=C2O1 NBZQDHFJJVOLEP-UHFFFAOYSA-N 0.000 description 2
- AQDRSCNQICSNAG-UHFFFAOYSA-N 1-benzofuran-3-yl-(4-methoxyphenyl)methanone Chemical compound C1=CC(OC)=CC=C1C(=O)C1=COC2=CC=CC=C12 AQDRSCNQICSNAG-UHFFFAOYSA-N 0.000 description 2
- FVGWVEVIDOEPGX-UHFFFAOYSA-N 1-ethynyl-4-methoxybenzene Chemical compound COC1=CC=C(C=C1)C#[C-] FVGWVEVIDOEPGX-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- XZRHNAFEYMSXRG-UHFFFAOYSA-N 2,5-dimethylbenzoic acid Chemical compound CC1=CC=C(C)C(C(O)=O)=C1 XZRHNAFEYMSXRG-UHFFFAOYSA-N 0.000 description 2
- ADKCFCOXELVRJV-UHFFFAOYSA-N 2-(4-methoxyphenyl)-1-benzothiophene Chemical compound C1=CC(OC)=CC=C1C1=CC2=CC=CC=C2S1 ADKCFCOXELVRJV-UHFFFAOYSA-N 0.000 description 2
- TVGXSWWMSUBVRH-UHFFFAOYSA-N 2-[(4-methoxyphenyl)methyl]-1-benzofuran Chemical compound C1=CC(OC)=CC=C1CC1=CC2=CC=CC=C2O1 TVGXSWWMSUBVRH-UHFFFAOYSA-N 0.000 description 2
- SSFIIUUCZRZJQE-UHFFFAOYSA-N 2-[4-(2-chloroethoxy)phenyl]-5-methoxy-1-benzofuran Chemical compound C=1C2=CC(OC)=CC=C2OC=1C1=CC=C(OCCCl)C=C1 SSFIIUUCZRZJQE-UHFFFAOYSA-N 0.000 description 2
- VRQWEADXJAMICX-UHFFFAOYSA-N 2-benzyl-3-methoxy-1-benzofuran Chemical compound O1C2=CC=CC=C2C(OC)=C1CC1=CC=CC=C1 VRQWEADXJAMICX-UHFFFAOYSA-N 0.000 description 2
- XQJAHBHCLXUGEP-UHFFFAOYSA-N 2-bromo-1-(4-methoxyphenyl)ethanone Chemical compound COC1=CC=C(C(=O)CBr)C=C1 XQJAHBHCLXUGEP-UHFFFAOYSA-N 0.000 description 2
- 125000006012 2-chloroethoxy group Chemical group 0.000 description 2
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 2
- IZHVBANLECCAGF-UHFFFAOYSA-N 2-hydroxy-3-(octadecanoyloxy)propyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCCCC IZHVBANLECCAGF-UHFFFAOYSA-N 0.000 description 2
- NYYRRBOMNHUCLB-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCCl NYYRRBOMNHUCLB-UHFFFAOYSA-N 0.000 description 2
- ZAHJIGHDYOQKHW-UHFFFAOYSA-N 4-chloro-2-[(4-methoxyphenyl)methyl]-1-benzofuran Chemical compound C1=CC(OC)=CC=C1CC1=CC2=C(Cl)C=CC=C2O1 ZAHJIGHDYOQKHW-UHFFFAOYSA-N 0.000 description 2
- WXVQURJGDUNJCS-UHFFFAOYSA-N 4-methoxy-3,5-dimethylbenzoic acid Chemical compound COC1=C(C)C=C(C(O)=O)C=C1C WXVQURJGDUNJCS-UHFFFAOYSA-N 0.000 description 2
- 206010002091 Anaesthesia Diseases 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 208000001871 Tachycardia Diseases 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 2
- BWQGCMXUZICOBR-UHFFFAOYSA-N [2-[4-(2-bromoethoxy)phenyl]-1-benzofuran-3-yl]-(4-methoxy-3,5-dimethylphenyl)methanone Chemical compound C1=C(C)C(OC)=C(C)C=C1C(=O)C1=C(C=2C=CC(OCCBr)=CC=2)OC2=CC=CC=C12 BWQGCMXUZICOBR-UHFFFAOYSA-N 0.000 description 2
- SXUZUDMBDRVDOP-UHFFFAOYSA-N [3-(4-hydroxyphenyl)-1-benzofuran-2-yl]-phenylmethanone Chemical compound C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC=CC=2)OC2=CC=CC=C12 SXUZUDMBDRVDOP-UHFFFAOYSA-N 0.000 description 2
- 230000037005 anaesthesia Effects 0.000 description 2
- 230000004872 arterial blood pressure Effects 0.000 description 2
- 210000001367 artery Anatomy 0.000 description 2
- 125000005605 benzo group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 230000002057 chronotropic effect Effects 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 2
- 230000001077 hypotensive effect Effects 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- 229940041476 lactose 100 mg Drugs 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 2
- GVWISOJSERXQBM-UHFFFAOYSA-N n-methylpropan-1-amine Chemical compound CCCNC GVWISOJSERXQBM-UHFFFAOYSA-N 0.000 description 2
- 150000003891 oxalate salts Chemical class 0.000 description 2
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 230000000153 supplemental effect Effects 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 230000006794 tachycardia Effects 0.000 description 2
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 2
- 229940124549 vasodilator Drugs 0.000 description 2
- 239000003071 vasodilator agent Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- GHPYJLCQYMAXGG-WCCKRBBISA-N (2R)-2-amino-3-(2-boronoethylsulfanyl)propanoic acid hydrochloride Chemical compound Cl.N[C@@H](CSCCB(O)O)C(O)=O GHPYJLCQYMAXGG-WCCKRBBISA-N 0.000 description 1
- GNZKHWQMINRPJM-UHFFFAOYSA-N (3,5-dimethylphenyl)-[2-(3-methoxyphenyl)-1-benzofuran-3-yl]methanone Chemical compound COC1=CC=CC(C2=C(C3=CC=CC=C3O2)C(=O)C=2C=C(C)C=C(C)C=2)=C1 GNZKHWQMINRPJM-UHFFFAOYSA-N 0.000 description 1
- ZWCUWSFNTRXALH-UHFFFAOYSA-N (3,5-dimethylphenyl)-[3-(4-hydroxyphenyl)-1-benzofuran-2-yl]methanone Chemical compound CC1=CC(C)=CC(C(=O)C2=C(C3=CC=CC=C3O2)C=2C=CC(O)=CC=2)=C1 ZWCUWSFNTRXALH-UHFFFAOYSA-N 0.000 description 1
- OWKCGJOJVDDHLC-UHFFFAOYSA-N (3-benzyl-4-hydroxy-1-benzothiophen-2-yl)-phenylmethanone Chemical compound C=1C=CC=CC=1CC=1C=2C(O)=CC=CC=2SC=1C(=O)C1=CC=CC=C1 OWKCGJOJVDDHLC-UHFFFAOYSA-N 0.000 description 1
- SBLHZHZNVOPLHE-UHFFFAOYSA-N (3-benzyl-4-methoxy-1-benzofuran-2-yl)-phenylmethanone Chemical compound C=1C=CC=CC=1CC=1C=2C(OC)=CC=CC=2OC=1C(=O)C1=CC=CC=C1 SBLHZHZNVOPLHE-UHFFFAOYSA-N 0.000 description 1
- XLHIXVUGVLSANB-UHFFFAOYSA-N (3-benzyl-4-methoxy-1-benzothiophen-2-yl)-phenylmethanone Chemical compound C=1C=CC=CC=1CC=1C=2C(OC)=CC=CC=2SC=1C(=O)C1=CC=CC=C1 XLHIXVUGVLSANB-UHFFFAOYSA-N 0.000 description 1
- OVOGYCPXIRQDKC-UHFFFAOYSA-N (3-chlorophenyl)-[2-[4-(oxiran-2-ylmethoxy)phenyl]-1-benzofuran-3-yl]methanone Chemical compound ClC1=CC=CC(C(=O)C=2C3=CC=CC=C3OC=2C=2C=CC(OCC3OC3)=CC=2)=C1 OVOGYCPXIRQDKC-UHFFFAOYSA-N 0.000 description 1
- PQIRZVMCMAOMEW-UHFFFAOYSA-N (3-chlorophenyl)-[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-1-benzofuran-3-yl]methanone Chemical compound C1=CC(OCC(O)CNC(C)C)=CC=C1C1=C(C(=O)C=2C=C(Cl)C=CC=2)C2=CC=CC=C2O1 PQIRZVMCMAOMEW-UHFFFAOYSA-N 0.000 description 1
- OZJWVBUODOYPTQ-UHFFFAOYSA-N (4-butoxyphenyl)-[2-[4-[2-(diethylamino)ethoxy]phenyl]-1-benzofuran-3-yl]methanone Chemical compound C1=CC(OCCCC)=CC=C1C(=O)C1=C(C=2C=CC(OCCN(CC)CC)=CC=2)OC2=CC=CC=C12 OZJWVBUODOYPTQ-UHFFFAOYSA-N 0.000 description 1
- GGZRZMBMDYQDFJ-UHFFFAOYSA-N (4-chloro-1-benzofuran-2-yl)-(4-methoxyphenyl)methanone Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC2=C(Cl)C=CC=C2O1 GGZRZMBMDYQDFJ-UHFFFAOYSA-N 0.000 description 1
- WDVXTQKMZCYFJD-UHFFFAOYSA-N (4-chlorophenyl)-[2-(4-hydroxyphenyl)-1-benzofuran-3-yl]methanone Chemical compound C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC(Cl)=CC=2)C2=CC=CC=C2O1 WDVXTQKMZCYFJD-UHFFFAOYSA-N 0.000 description 1
- ONXVXGATOXNIKL-UHFFFAOYSA-N (4-chlorophenyl)-[2-[4-(oxiran-2-ylmethoxy)phenyl]-1-benzofuran-3-yl]methanone Chemical compound C1=CC(Cl)=CC=C1C(=O)C1=C(C=2C=CC(OCC3OC3)=CC=2)OC2=CC=CC=C12 ONXVXGATOXNIKL-UHFFFAOYSA-N 0.000 description 1
- BIFWCLUIXRQPJL-UHFFFAOYSA-N (4-chlorophenyl)-[2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-1-benzofuran-3-yl]methanone Chemical compound C1=CC(OCC(O)CNC(C)C)=CC=C1C1=C(C(=O)C=2C=CC(Cl)=CC=2)C2=CC=CC=C2O1 BIFWCLUIXRQPJL-UHFFFAOYSA-N 0.000 description 1
- UJWLGSCHLMSUFJ-UHFFFAOYSA-N (4-chlorophenyl)-[3-(4-hydroxyphenyl)-1-benzofuran-2-yl]methanone Chemical compound C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC(Cl)=CC=2)OC2=CC=CC=C12 UJWLGSCHLMSUFJ-UHFFFAOYSA-N 0.000 description 1
- SXRBJFIFHXCSKN-UHFFFAOYSA-N (4-chlorophenyl)-[3-(4-methoxyphenyl)-1-benzofuran-2-yl]methanone Chemical compound C1=CC(OC)=CC=C1C1=C(C(=O)C=2C=CC(Cl)=CC=2)OC2=CC=CC=C12 SXRBJFIFHXCSKN-UHFFFAOYSA-N 0.000 description 1
- SYSZENVIJHPFNL-UHFFFAOYSA-N (alpha-D-mannosyl)7-beta-D-mannosyl-diacetylchitobiosyl-L-asparagine, isoform B (protein) Chemical compound COC1=CC=C(I)C=C1 SYSZENVIJHPFNL-UHFFFAOYSA-N 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- VEFLKXRACNJHOV-UHFFFAOYSA-N 1,3-dibromopropane Chemical compound BrCCCBr VEFLKXRACNJHOV-UHFFFAOYSA-N 0.000 description 1
- LUUBDQOTMGETBR-UHFFFAOYSA-N 1-(1-benzofuran-2-yl)-2-methoxy-2-phenylethanone Chemical compound C=1C2=CC=CC=C2OC=1C(=O)C(OC)C1=CC=CC=C1 LUUBDQOTMGETBR-UHFFFAOYSA-N 0.000 description 1
- ACVUUWHIJPFOLC-UHFFFAOYSA-N 1-benzofuran oxalic acid Chemical compound OC(=O)C(O)=O.C1=CC=C2OC=CC2=C1 ACVUUWHIJPFOLC-UHFFFAOYSA-N 0.000 description 1
- ZQGAXHXHVKVERC-UHFFFAOYSA-N 1-benzofuran-2-carbonitrile Chemical compound C1=CC=C2OC(C#N)=CC2=C1 ZQGAXHXHVKVERC-UHFFFAOYSA-N 0.000 description 1
- LTHMASCHPKLOPL-UHFFFAOYSA-N 1-benzofuran-2-yl-(2-hydroxyphenyl)methanone Chemical compound OC1=CC=CC=C1C(=O)C1=CC2=CC=CC=C2O1 LTHMASCHPKLOPL-UHFFFAOYSA-N 0.000 description 1
- VLLADTXGBAUFMW-UHFFFAOYSA-N 1-benzofuran-3-carbonitrile Chemical compound C1=CC=C2C(C#N)=COC2=C1 VLLADTXGBAUFMW-UHFFFAOYSA-N 0.000 description 1
- QAPAAMJNJUBIMZ-UHFFFAOYSA-N 1-benzofuran;hydrochloride Chemical compound Cl.C1=CC=C2OC=CC2=C1 QAPAAMJNJUBIMZ-UHFFFAOYSA-N 0.000 description 1
- RCYHXESNWFYTCU-UHFFFAOYSA-N 1-benzothiophene-2-carbonitrile Chemical compound C1=CC=C2SC(C#N)=CC2=C1 RCYHXESNWFYTCU-UHFFFAOYSA-N 0.000 description 1
- MGBRPGMQNVRQCG-UHFFFAOYSA-N 2,5-dimethylbenzoyl chloride Chemical compound CC1=CC=C(C)C(C(Cl)=O)=C1 MGBRPGMQNVRQCG-UHFFFAOYSA-N 0.000 description 1
- CHFRPZRSAMQOGI-UHFFFAOYSA-N 2-[(2-methoxyphenyl)methyl]-1-benzofuran Chemical compound COC1=CC=CC=C1CC1=CC2=CC=CC=C2O1 CHFRPZRSAMQOGI-UHFFFAOYSA-N 0.000 description 1
- FTZAIDZYFMAGFP-UHFFFAOYSA-N 2-benzyl-1-benzofuran-3-ol Chemical compound O1C2=CC=CC=C2C(O)=C1CC1=CC=CC=C1 FTZAIDZYFMAGFP-UHFFFAOYSA-N 0.000 description 1
- DDVJANDQVXXXLH-UHFFFAOYSA-N 2-benzyl-3-methoxy-1-benzothiophene Chemical compound S1C2=CC=CC=C2C(OC)=C1CC1=CC=CC=C1 DDVJANDQVXXXLH-UHFFFAOYSA-N 0.000 description 1
- VERNQKPCGNEQJD-UHFFFAOYSA-N 2-bromo-3-(2-bromo-4-fluorophenyl)-4-methylphenol 2-bromo-6-ethylphenol Chemical compound BrC1=C(C=CC(=C1)F)C=1C(=C(C=CC1C)O)Br.BrC1=C(C(=CC=C1)CC)O VERNQKPCGNEQJD-UHFFFAOYSA-N 0.000 description 1
- FMRKYXVZQWHGDA-UHFFFAOYSA-N 2-bromo-5-chlorophenol Chemical compound OC1=CC(Cl)=CC=C1Br FMRKYXVZQWHGDA-UHFFFAOYSA-N 0.000 description 1
- 125000006016 2-bromoethoxy group Chemical group 0.000 description 1
- DVIHKVWYFXLBEM-UHFFFAOYSA-N 2-hydroxybenzoyl chloride Chemical compound OC1=CC=CC=C1C(Cl)=O DVIHKVWYFXLBEM-UHFFFAOYSA-N 0.000 description 1
- KRSXGTAVHIDVPM-UHFFFAOYSA-N 2-phenoxyacetophenone Chemical compound C=1C=CC=CC=1C(=O)COC1=CC=CC=C1 KRSXGTAVHIDVPM-UHFFFAOYSA-N 0.000 description 1
- QYSPXFAQSGSHON-UHFFFAOYSA-N 2-phenyl-1-benzofuran-3-ol Chemical compound O1C2=CC=CC=C2C(O)=C1C1=CC=CC=C1 QYSPXFAQSGSHON-UHFFFAOYSA-N 0.000 description 1
- OWBVULKHVZHYPN-UHFFFAOYSA-N 3,4,5-trimethylbenzoic acid Chemical compound CC1=CC(C(O)=O)=CC(C)=C1C OWBVULKHVZHYPN-UHFFFAOYSA-N 0.000 description 1
- GUXPELMEYCDGIS-UHFFFAOYSA-N 3,4,5-trimethylbenzoyl chloride Chemical compound CC1=CC(C(Cl)=O)=CC(C)=C1C GUXPELMEYCDGIS-UHFFFAOYSA-N 0.000 description 1
- CFNNQXOPPGQFHV-UHFFFAOYSA-N 3,4-diethoxybenzoyl chloride Chemical compound CCOC1=CC=C(C(Cl)=O)C=C1OCC CFNNQXOPPGQFHV-UHFFFAOYSA-N 0.000 description 1
- CXKCZFDUOYMOOP-UHFFFAOYSA-N 3,5-dichlorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC(Cl)=C1 CXKCZFDUOYMOOP-UHFFFAOYSA-N 0.000 description 1
- CEVKIWPXUZOANJ-UHFFFAOYSA-N 3,5-diethylbenzoyl chloride Chemical compound CCC1=CC(CC)=CC(C(Cl)=O)=C1 CEVKIWPXUZOANJ-UHFFFAOYSA-N 0.000 description 1
- HULPPSASFRRIEG-UHFFFAOYSA-N 3-(4-methoxyphenyl)-1-benzothiophene Chemical compound C1=CC(OC)=CC=C1C1=CSC2=CC=CC=C12 HULPPSASFRRIEG-UHFFFAOYSA-N 0.000 description 1
- XLRZKRIXQNGNGH-UHFFFAOYSA-N 3-[(4-methoxyphenyl)methyl]-1-benzofuran Chemical compound C1=CC(OC)=CC=C1CC1=COC2=CC=CC=C12 XLRZKRIXQNGNGH-UHFFFAOYSA-N 0.000 description 1
- LLVGALSBYIKGJD-UHFFFAOYSA-N 3-[4-(1-benzofuran-2-yl)phenoxy]-n,n-diethylpropan-1-amine Chemical compound C1=CC(OCCCN(CC)CC)=CC=C1C1=CC2=CC=CC=C2O1 LLVGALSBYIKGJD-UHFFFAOYSA-N 0.000 description 1
- JXHHNJORXBXRBY-UHFFFAOYSA-N 3-propoxybenzoyl chloride Chemical compound CCCOC1=CC=CC(C(Cl)=O)=C1 JXHHNJORXBXRBY-UHFFFAOYSA-N 0.000 description 1
- QDUSNAVRRIDNCI-UHFFFAOYSA-N 4-[3-(3,5-dimethylphenyl)-1-benzofuran-2-yl]phenol Chemical compound CC1=CC(C)=CC(C=2C3=CC=CC=C3OC=2C=2C=CC(O)=CC=2)=C1 QDUSNAVRRIDNCI-UHFFFAOYSA-N 0.000 description 1
- TUXYZHVUPGXXQG-UHFFFAOYSA-N 4-bromobenzoic acid Chemical compound OC(=O)C1=CC=C(Br)C=C1 TUXYZHVUPGXXQG-UHFFFAOYSA-N 0.000 description 1
- GZFGOTFRPZRKDS-UHFFFAOYSA-N 4-bromophenol Chemical compound OC1=CC=C(Br)C=C1 GZFGOTFRPZRKDS-UHFFFAOYSA-N 0.000 description 1
- VZXOZSQDJJNBRC-UHFFFAOYSA-N 4-chlorobenzenethiol Chemical compound SC1=CC=C(Cl)C=C1 VZXOZSQDJJNBRC-UHFFFAOYSA-N 0.000 description 1
- KTTOTNGHDCXYDG-UHFFFAOYSA-N 5-bromo-2-[4-(2-chloroethoxy)phenyl]-1-benzofuran Chemical compound C1=CC(OCCCl)=CC=C1C1=CC2=CC(Br)=CC=C2O1 KTTOTNGHDCXYDG-UHFFFAOYSA-N 0.000 description 1
- NWJSWPAUARLDLI-UHFFFAOYSA-N 5-chloro-2-(4-methoxyphenyl)-1-benzofuran Chemical compound C1=CC(OC)=CC=C1C1=CC2=CC(Cl)=CC=C2O1 NWJSWPAUARLDLI-UHFFFAOYSA-N 0.000 description 1
- WFTFWCVAZUWSHB-UHFFFAOYSA-N 6-chloro-2-(4-methoxyphenyl)-1-benzofuran Chemical compound C1=CC(OC)=CC=C1C1=CC2=CC=C(Cl)C=C2O1 WFTFWCVAZUWSHB-UHFFFAOYSA-N 0.000 description 1
- WELLFDNBSPDHSW-UHFFFAOYSA-N 7-ethyl-2-(4-methoxyphenyl)-1-benzofuran Chemical compound O1C=2C(CC)=CC=CC=2C=C1C1=CC=C(OC)C=C1 WELLFDNBSPDHSW-UHFFFAOYSA-N 0.000 description 1
- SKTFQHRVFFOHTQ-UHFFFAOYSA-N 8-bromo-1,3-dimethyl-7h-purine-2,6-dione Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC(Br)=N2 SKTFQHRVFFOHTQ-UHFFFAOYSA-N 0.000 description 1
- FJNCXZZQNBKEJT-UHFFFAOYSA-N 8beta-hydroxymarrubiin Natural products O1C(=O)C2(C)CCCC3(C)C2C1CC(C)(O)C3(O)CCC=1C=COC=1 FJNCXZZQNBKEJT-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical class C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- MPKZCYNFTJVVQS-UHFFFAOYSA-N C(C)(C)(C)C=1C=C(C(=O)Cl)C=C(C1)C(C)(C)C.C(C)(C)(C)C1=CC=C(C(=O)Cl)C=C1.C(CC)C1=CC=C(C(=O)Cl)C=C1.C(C)C=1C=C(C(=O)Cl)C=C(C1)CC Chemical compound C(C)(C)(C)C=1C=C(C(=O)Cl)C=C(C1)C(C)(C)C.C(C)(C)(C)C1=CC=C(C(=O)Cl)C=C1.C(CC)C1=CC=C(C(=O)Cl)C=C1.C(C)C=1C=C(C(=O)Cl)C=C(C1)CC MPKZCYNFTJVVQS-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 208000001953 Hypotension Diseases 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical class O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N Theophylline Natural products O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 1
- VYDNEWWOJPMSKX-UHFFFAOYSA-N [2-(2-hydroxyphenyl)-1-benzofuran-3-yl]-(4-methylphenyl)methanone Chemical compound C1=CC(C)=CC=C1C(=O)C1=C(C=2C(=CC=CC=2)O)OC2=CC=CC=C12 VYDNEWWOJPMSKX-UHFFFAOYSA-N 0.000 description 1
- MPYQDIIPDZDGNM-UHFFFAOYSA-N [2-(4-hydroxyphenyl)-1-benzofuran-3-yl]-(3,4,5-trimethylphenyl)methanone Chemical compound CC1=C(C)C(C)=CC(C(=O)C=2C3=CC=CC=C3OC=2C=2C=CC(O)=CC=2)=C1 MPYQDIIPDZDGNM-UHFFFAOYSA-N 0.000 description 1
- VTFZPCUCXXROQP-UHFFFAOYSA-N [2-(4-hydroxyphenyl)-1-benzofuran-3-yl]-(4-methylphenyl)methanone Chemical compound C1=CC(C)=CC=C1C(=O)C1=C(C=2C=CC(O)=CC=2)OC2=CC=CC=C12 VTFZPCUCXXROQP-UHFFFAOYSA-N 0.000 description 1
- WFWWZNURLRQXRZ-UHFFFAOYSA-N [2-(4-hydroxyphenyl)-1-benzofuran-3-yl]-phenylmethanone Chemical compound C1=CC(O)=CC=C1C1=C(C(=O)C=2C=CC=CC=2)C2=CC=CC=C2O1 WFWWZNURLRQXRZ-UHFFFAOYSA-N 0.000 description 1
- FRXMQZACCFHTNO-UHFFFAOYSA-N [2-(4-methoxyphenyl)-1-benzofuran-3-yl]-(4-methylphenyl)methanone Chemical compound C1=CC(OC)=CC=C1C1=C(C(=O)C=2C=CC(C)=CC=2)C2=CC=CC=C2O1 FRXMQZACCFHTNO-UHFFFAOYSA-N 0.000 description 1
- QAHCABLDJOYNAG-UHFFFAOYSA-N [2-[4-(2-bromoethoxy)phenyl]-1-benzofuran-3-yl]-(2,5-dimethoxy-4-methylphenyl)methanone Chemical compound C1=C(C)C(OC)=CC(C(=O)C=2C3=CC=CC=C3OC=2C=2C=CC(OCCBr)=CC=2)=C1OC QAHCABLDJOYNAG-UHFFFAOYSA-N 0.000 description 1
- KWRMOFCHXOOBHK-UHFFFAOYSA-N [2-[4-(2-bromoethoxy)phenyl]-1-benzofuran-3-yl]-(3,5-dimethoxyphenyl)methanone Chemical compound COC1=CC(OC)=CC(C(=O)C=2C3=CC=CC=C3OC=2C=2C=CC(OCCBr)=CC=2)=C1 KWRMOFCHXOOBHK-UHFFFAOYSA-N 0.000 description 1
- OPTJWFSQDCHEKX-UHFFFAOYSA-N [2-[4-(2-bromoethoxy)phenyl]-1-benzofuran-3-yl]-(4-butoxyphenyl)methanone Chemical compound C1=CC(OCCCC)=CC=C1C(=O)C1=C(C=2C=CC(OCCBr)=CC=2)OC2=CC=CC=C12 OPTJWFSQDCHEKX-UHFFFAOYSA-N 0.000 description 1
- TYKTVWZBRDEZRL-UHFFFAOYSA-N [2-[4-(2-bromoethoxy)phenyl]-1-benzofuran-3-yl]-(4-methoxyphenyl)methanone Chemical compound C1=CC(OC)=CC=C1C(=O)C1=C(C=2C=CC(OCCBr)=CC=2)OC2=CC=CC=C12 TYKTVWZBRDEZRL-UHFFFAOYSA-N 0.000 description 1
- VIDSSESNEMRVDV-UHFFFAOYSA-N [2-[4-(oxiran-2-ylmethoxy)phenyl]-1-benzofuran-3-yl]-phenylmethanone Chemical compound C=1C=CC=CC=1C(=O)C(C1=CC=CC=C1O1)=C1C(C=C1)=CC=C1OCC1CO1 VIDSSESNEMRVDV-UHFFFAOYSA-N 0.000 description 1
- YBRMBMCQDPANGL-UHFFFAOYSA-N [2-[4-[2-(diethylamino)ethoxy]phenyl]-1-benzofuran-3-yl]-(2,3,5-trichlorophenyl)methanone Chemical compound C1=CC(OCCN(CC)CC)=CC=C1C1=C(C(=O)C=2C(=C(Cl)C=C(Cl)C=2)Cl)C2=CC=CC=C2O1 YBRMBMCQDPANGL-UHFFFAOYSA-N 0.000 description 1
- MPXBVZPAGBSXDQ-UHFFFAOYSA-N [2-[4-[2-(diethylamino)ethoxy]phenyl]-1-benzofuran-3-yl]-(3,5-diethylphenyl)methanone Chemical compound C1=CC(OCCN(CC)CC)=CC=C1C1=C(C(=O)C=2C=C(CC)C=C(CC)C=2)C2=CC=CC=C2O1 MPXBVZPAGBSXDQ-UHFFFAOYSA-N 0.000 description 1
- BRRASJRRNFKTCU-UHFFFAOYSA-N [2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-1-benzofuran-3-yl]-(4-methylphenyl)methanone Chemical compound C1=CC(OCC(O)CNC(C)C)=CC=C1C1=C(C(=O)C=2C=CC(C)=CC=2)C2=CC=CC=C2O1 BRRASJRRNFKTCU-UHFFFAOYSA-N 0.000 description 1
- LWNQEZFMVICVRD-UHFFFAOYSA-N [2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]-1-benzofuran-3-yl]-phenylmethanone Chemical compound C1=CC(OCC(O)CNC(C)C)=CC=C1C1=C(C(=O)C=2C=CC=CC=2)C2=CC=CC=C2O1 LWNQEZFMVICVRD-UHFFFAOYSA-N 0.000 description 1
- HKJVXXHGRSLOJS-UHFFFAOYSA-N [2-[4-[3-(diethylamino)propoxy]phenyl]-1-benzofuran-3-yl]-(3,5-dimethylphenyl)methanone Chemical compound C1=CC(OCCCN(CC)CC)=CC=C1C1=C(C(=O)C=2C=C(C)C=C(C)C=2)C2=CC=CC=C2O1 HKJVXXHGRSLOJS-UHFFFAOYSA-N 0.000 description 1
- DZUUPBQSALYZPE-UHFFFAOYSA-N [2-[[4-[2-(diethylamino)ethoxy]phenyl]methyl]-1-benzofuran-3-yl]-(3,5-dimethylphenyl)methanone Chemical compound C1=CC(OCCN(CC)CC)=CC=C1CC1=C(C(=O)C=2C=C(C)C=C(C)C=2)C2=CC=CC=C2O1 DZUUPBQSALYZPE-UHFFFAOYSA-N 0.000 description 1
- IALAMZFRMUNOIB-UHFFFAOYSA-N [6-chloro-2-[4-[2-(diethylamino)ethoxy]phenyl]-1-benzofuran-3-yl]-(3,5-dimethylphenyl)methanone Chemical compound C1=CC(OCCN(CC)CC)=CC=C1C1=C(C(=O)C=2C=C(C)C=C(C)C=2)C2=CC=C(Cl)C=C2O1 IALAMZFRMUNOIB-UHFFFAOYSA-N 0.000 description 1
- ILXDAXZQNSOSAE-UHFFFAOYSA-N [AlH3].[Cl] Chemical compound [AlH3].[Cl] ILXDAXZQNSOSAE-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- BVQDBYUODQZEQT-UHFFFAOYSA-N [N+](=O)([O-])C1=CC=C(C=C1)O.C(C)(C)(C)C1=CC=C(C=C1)O Chemical compound [N+](=O)([O-])C1=CC=C(C=C1)O.C(C)(C)(C)C1=CC=C(C=C1)O BVQDBYUODQZEQT-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 101150035861 alkG gene Proteins 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000002431 aminoalkoxy group Chemical group 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 239000004004 anti-anginal agent Substances 0.000 description 1
- 229940124345 antianginal agent Drugs 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 1
- VEFXTGTZJOWDOF-UHFFFAOYSA-N benzene;hydrate Chemical compound O.C1=CC=CC=C1 VEFXTGTZJOWDOF-UHFFFAOYSA-N 0.000 description 1
- AEMOLEFTQBMNLQ-DTEWXJGMSA-N beta-D-galacturonic acid Chemical compound O[C@@H]1O[C@H](C(O)=O)[C@H](O)[C@H](O)[C@H]1O AEMOLEFTQBMNLQ-DTEWXJGMSA-N 0.000 description 1
- ZLYFWIZGRHGKMM-UHFFFAOYSA-N bis(1-benzofuran-2-yl)methanone Chemical class C1=CC=C2OC(C(C=3OC4=CC=CC=C4C=3)=O)=CC2=C1 ZLYFWIZGRHGKMM-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- PASHVRUKOFIRIK-UHFFFAOYSA-L calcium sulfate dihydrate Chemical compound O.O.[Ca+2].[O-]S([O-])(=O)=O PASHVRUKOFIRIK-UHFFFAOYSA-L 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- OJYGBLRPYBAHRT-IPQSZEQASA-N chloralose Chemical compound O1[C@H](C(Cl)(Cl)Cl)O[C@@H]2[C@@H](O)[C@@H]([C@H](O)CO)O[C@@H]21 OJYGBLRPYBAHRT-IPQSZEQASA-N 0.000 description 1
- 229950009941 chloralose Drugs 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000006011 chloroethoxy group Chemical group 0.000 description 1
- FIMJSWFMQJGVAM-UHFFFAOYSA-N chloroform;hydrate Chemical compound O.ClC(Cl)Cl FIMJSWFMQJGVAM-UHFFFAOYSA-N 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 230000002596 correlated effect Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical compound C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000000950 dibromo group Chemical group Br* 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002118 epoxides Chemical group 0.000 description 1
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 1
- 210000003191 femoral vein Anatomy 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 229940074045 glyceryl distearate Drugs 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000006485 halo alkoxy phenyl group Chemical group 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000001145 hydrido group Chemical group *[H] 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 208000021822 hypotensive Diseases 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 230000003601 intercostal effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 238000005065 mining Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229960004715 morphine sulfate Drugs 0.000 description 1
- GRVOTVYEFDAHCL-RTSZDRIGSA-N morphine sulfate pentahydrate Chemical compound O.O.O.O.O.OS(O)(=O)=O.O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O.O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O GRVOTVYEFDAHCL-RTSZDRIGSA-N 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-N palmitic acid group Chemical group C(CCCCCCCCCCCCCCC)(=O)O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229960000292 pectin Drugs 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 210000003516 pericardium Anatomy 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- XOFYZVNMUHMLCC-ZPOLXVRWSA-N prednisone Chemical compound O=C1C=C[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1 XOFYZVNMUHMLCC-ZPOLXVRWSA-N 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- RBWSWDPRDBEWCR-RKJRWTFHSA-N sodium;(2r)-2-[(2r)-3,4-dihydroxy-5-oxo-2h-furan-2-yl]-2-hydroxyethanolate Chemical compound [Na+].[O-]C[C@@H](O)[C@H]1OC(=O)C(O)=C1O RBWSWDPRDBEWCR-RKJRWTFHSA-N 0.000 description 1
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical compound [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 230000002311 subsequent effect Effects 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 229960000278 theophylline Drugs 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F1/00—Compounds containing elements of Groups 1 or 11 of the Periodic Table
- C07F1/08—Copper compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D307/80—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/54—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D333/56—Radicals substituted by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Furan Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US46200874A | 1974-04-18 | 1974-04-18 | |
| US51580874A | 1974-10-17 | 1974-10-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1053673A true CA1053673A (en) | 1979-05-01 |
Family
ID=27040202
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA223,045A Expired CA1053673A (en) | 1974-04-18 | 1975-03-25 | Pharmacologically active benzoyl benzofurans and benzothiophenes |
Country Status (7)
| Country | Link |
|---|---|
| CA (1) | CA1053673A (de) |
| DE (1) | DE2517296A1 (de) |
| FR (1) | FR2267770B1 (de) |
| GB (1) | GB1464242A (de) |
| IE (1) | IE42353B1 (de) |
| IL (1) | IL46980A (de) |
| NL (1) | NL7504647A (de) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4933351A (en) * | 1983-10-31 | 1990-06-12 | Merck Frosst Canada, Inc. | Benzofuran 2-carbox amides useful as inhibitors of leukoriene biosynthesis |
| US4663347A (en) * | 1983-10-31 | 1987-05-05 | Merck Frosst Canada, Inc. | Benzofuran 2-carboxylic acid esters useful as inhibitors of leukotriene biosynthesis |
| US4822803A (en) * | 1983-10-31 | 1989-04-18 | Merck Frosst Canada, Inc. | Benzofuran 2-carboxylic acid hydrazides useful as inhibitors of leukotriene biosynthesis |
| TWI240723B (en) * | 2001-06-20 | 2005-10-01 | Wyeth Corp | Substituted naphthyl benzofuran derivatives as inhibitors of plasminogen activator inhibitor-1 (PAI-1) |
| KR20160003647A (ko) | 2013-03-15 | 2016-01-11 | 에피자임, 인코포레이티드 | Carm1 억제제 및 이의 용도 |
-
1975
- 1975-03-13 GB GB1041475A patent/GB1464242A/en not_active Expired
- 1975-03-25 CA CA223,045A patent/CA1053673A/en not_active Expired
- 1975-03-31 IL IL46980A patent/IL46980A/xx unknown
- 1975-04-16 FR FR7511781A patent/FR2267770B1/fr not_active Expired
- 1975-04-18 DE DE19752517296 patent/DE2517296A1/de not_active Withdrawn
- 1975-04-18 IE IE886/75A patent/IE42353B1/en unknown
- 1975-04-18 NL NL7504647A patent/NL7504647A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| IE42353B1 (en) | 1980-07-30 |
| IL46980A0 (en) | 1975-05-22 |
| IE42353L (en) | 1975-10-18 |
| GB1464242A (en) | 1977-02-09 |
| DE2517296A1 (de) | 1975-11-06 |
| FR2267770B1 (de) | 1979-08-10 |
| AU7985075A (en) | 1976-10-07 |
| FR2267770A1 (de) | 1975-11-14 |
| NL7504647A (nl) | 1975-10-21 |
| IL46980A (en) | 1978-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4001426A (en) | Substituted benzofurans and benzothiophenes | |
| CA1301170C (en) | Benzofuran 7-carboxamides useful as antiemetic or antipsyschotic agents | |
| DE60104717T2 (de) | Benzothiophenderivate, verhahren zu ihrer herstellung und ihre verwendung | |
| US3947470A (en) | Substituted benzofurans and benzothiophenes | |
| CA1167036A (en) | Synthesis of acylated benzothiophenes | |
| AU2001252574B2 (en) | Novel bicyclic compounds | |
| AT504859B1 (de) | Verfahren zur herstellung von 3-(4-(2-aminoethoxy)benzoyl)-2-aryl-6- hydroxybenzo(b)thiophenen | |
| EP0147044B1 (de) | Benzofurancarboxamide, Verfahren zu ihrer Herstellung und pharmazeutische Zubereitungen die sie enthalten | |
| CH691125A5 (de) | Verfahren zur Herstellung kristalliner Solvate von 3-(4-(2-Aminoethoxy)benzoyl)-2-aryl-6-hydroxy-benzo(b)thiophenen. | |
| CA1053673A (en) | Pharmacologically active benzoyl benzofurans and benzothiophenes | |
| US3983245A (en) | Certain 4-(3-azacycloalkoxy or azacycloalkylmethoxy)benzoylbenzofurans or benzothiophenes | |
| US4024273A (en) | Coronary vasodilator and anti-anginal compositions comprising substituted benzofurans and benzothiophenes and methods of producing coronary vasodilation and anti-anginal activity | |
| US3929836A (en) | 2-(2-Lower alkylamino-1-hydroxy-ethyl)-substituted benzofurans | |
| EP0380588A4 (en) | Certain 3-substituted 2-alkyl benzofuran derivatives | |
| EP0156331B1 (de) | Benzofuranderivate, Verfahren zu ihrer Herstellung und sie enthaltende antihypertensive Mittel | |
| NZ208894A (en) | Aroyl-benzofuran and-benzothiophene acetic and propanoic acid derivatives and pharmaceutical compositions | |
| CA1150289A (en) | Preparation of 2,3-dihydro-2,2-dimethyl-7- hydroxy benzofuran | |
| US3969415A (en) | 1-(2-Naphthyl)-2,3-butadien-1-ols | |
| GB1564269A (en) | Substituted alkylamines and process for preparing them | |
| US3880891A (en) | Substituted benzofurans | |
| CA1124718A (en) | 1-[3-(3,4,5-trimethoxyphenoxy)-2-hydroxypropyl]-4- aryl piperazine derivatives | |
| US3975537A (en) | Pharmaceutical compositions and methods of producing coronary vasodilation | |
| CA1220787A (en) | 1,1,2-triphenyl-but-1-ene derivatives possessing anti- oestrogenic activities | |
| EP0226447A2 (de) | Heteroaromatische Acetylene als blutdrucksenkende Mittel | |
| US3985896A (en) | Benzophenalenofurans |