CA1048044A - Flameproofing of plastics - Google Patents
Flameproofing of plasticsInfo
- Publication number
- CA1048044A CA1048044A CA241,823A CA241823A CA1048044A CA 1048044 A CA1048044 A CA 1048044A CA 241823 A CA241823 A CA 241823A CA 1048044 A CA1048044 A CA 1048044A
- Authority
- CA
- Canada
- Prior art keywords
- carbon atoms
- alkyl
- hydroxy
- phenyl
- oxaphospholane
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004033 plastic Substances 0.000 title claims abstract description 26
- 229920003023 plastic Polymers 0.000 title claims abstract description 26
- 125000004432 carbon atom Chemical group C* 0.000 claims description 55
- 125000000217 alkyl group Chemical group 0.000 claims description 24
- 150000001875 compounds Chemical class 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 20
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 8
- 239000000463 material Substances 0.000 claims description 8
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- 125000001188 haloalkyl group Chemical group 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 125000004848 alkoxyethyl group Chemical group 0.000 claims description 3
- KSGCNIPSUKCZIX-UHFFFAOYSA-N 5-di(propan-2-yloxy)phosphoryl-3,5-dimethyl-2-oxo-2-propan-2-yloxy-1,2$l^{5}-oxaphospholan-3-ol Chemical compound CC(C)OP(=O)(OC(C)C)C1(C)CC(C)(O)P(=O)(OC(C)C)O1 KSGCNIPSUKCZIX-UHFFFAOYSA-N 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 abstract description 21
- 238000006243 chemical reaction Methods 0.000 abstract description 13
- 239000004814 polyurethane Substances 0.000 abstract description 7
- 229920002635 polyurethane Polymers 0.000 abstract description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract description 4
- FXPDGSSSQUFIPW-UHFFFAOYSA-N oxaphospholane Chemical class C1COPC1 FXPDGSSSQUFIPW-UHFFFAOYSA-N 0.000 abstract description 4
- 229920000647 polyepoxide Polymers 0.000 abstract description 2
- XTQFVZIPDQNCPA-UHFFFAOYSA-N (3-hydroxyoxaphospholan-5-yl)phosphonic acid Chemical class OC1CC(P(O)(O)=O)OP1 XTQFVZIPDQNCPA-UHFFFAOYSA-N 0.000 abstract 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 12
- -1 ~0 are described Chemical class 0.000 description 12
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 11
- 239000006260 foam Substances 0.000 description 11
- 229910052708 sodium Inorganic materials 0.000 description 11
- 239000011734 sodium Substances 0.000 description 11
- 239000002904 solvent Substances 0.000 description 9
- LXCYSACZTOKNNS-UHFFFAOYSA-N diethoxy(oxo)phosphanium Chemical compound CCO[P+](=O)OCC LXCYSACZTOKNNS-UHFFFAOYSA-N 0.000 description 8
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 239000000470 constituent Substances 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 229920005862 polyol Polymers 0.000 description 5
- 150000003077 polyols Chemical class 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000009835 boiling Methods 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- KGHIFMQWNYFRHG-UHFFFAOYSA-N 1-hydroxyphospholane Chemical class OP1CCCC1 KGHIFMQWNYFRHG-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- CZHYKKAKFWLGJO-UHFFFAOYSA-N dimethyl phosphite Chemical compound COP([O-])OC CZHYKKAKFWLGJO-UHFFFAOYSA-N 0.000 description 3
- NFORZJQPTUSMRL-UHFFFAOYSA-N dipropan-2-yl hydrogen phosphite Chemical compound CC(C)OP(O)OC(C)C NFORZJQPTUSMRL-UHFFFAOYSA-N 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 150000003018 phosphorus compounds Chemical class 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- XZZNDPSIHUTMOC-UHFFFAOYSA-N triphenyl phosphate Chemical compound C=1C=CC=CC=1OP(OC=1C=CC=CC=1)(=O)OC1=CC=CC=C1 XZZNDPSIHUTMOC-UHFFFAOYSA-N 0.000 description 3
- CVBUKMMMRLOKQR-UHFFFAOYSA-N 1-phenylbutane-1,3-dione Chemical compound CC(=O)CC(=O)C1=CC=CC=C1 CVBUKMMMRLOKQR-UHFFFAOYSA-N 0.000 description 2
- AVNABQMXUUJVKY-UHFFFAOYSA-N 3,3-diethylpentane-2,4-dione Chemical compound CCC(CC)(C(C)=O)C(C)=O AVNABQMXUUJVKY-UHFFFAOYSA-N 0.000 description 2
- GSOHKPVFCOWKPU-UHFFFAOYSA-N 3-methylpentane-2,4-dione Chemical compound CC(=O)C(C)C(C)=O GSOHKPVFCOWKPU-UHFFFAOYSA-N 0.000 description 2
- ZHFHYAWZTUVMSS-UHFFFAOYSA-N 5-dimethoxyphosphoryl-2-methoxy-3,5-dimethyl-2-oxo-1,2$l^{5}-oxaphospholan-3-ol Chemical compound COP(=O)(OC)C1(C)CC(C)(O)P(=O)(OC)O1 ZHFHYAWZTUVMSS-UHFFFAOYSA-N 0.000 description 2
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 244000309464 bull Species 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical compound CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 150000002903 organophosphorus compounds Chemical class 0.000 description 2
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 229920000570 polyether Polymers 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DSAYAFZWRDYBQY-UHFFFAOYSA-N 2,5-dimethylhexa-1,5-diene Chemical group CC(=C)CCC(C)=C DSAYAFZWRDYBQY-UHFFFAOYSA-N 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- KKZUMAMOMRDVKA-UHFFFAOYSA-N 2-chloropropane Chemical group [CH2]C(C)Cl KKZUMAMOMRDVKA-UHFFFAOYSA-N 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- XMTQQYYKAHVGBJ-UHFFFAOYSA-N 3-(3,4-DICHLOROPHENYL)-1,1-DIMETHYLUREA Chemical class CN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XMTQQYYKAHVGBJ-UHFFFAOYSA-N 0.000 description 1
- HXUIDZOMTRMIOE-UHFFFAOYSA-N 3-oxo-3-phenylpropionic acid Chemical compound OC(=O)CC(=O)C1=CC=CC=C1 HXUIDZOMTRMIOE-UHFFFAOYSA-N 0.000 description 1
- PKQIDSVLSKFZQC-UHFFFAOYSA-N 3-oxobutanal Chemical compound CC(=O)CC=O PKQIDSVLSKFZQC-UHFFFAOYSA-N 0.000 description 1
- ICBZSKCTKKUQSY-YUWZRIFDSA-N 4-[(1r,2s)-1-hydroxy-2-(methylamino)propyl]phenol;hydrochloride Chemical compound Cl.CN[C@@H](C)[C@H](O)C1=CC=C(O)C=C1 ICBZSKCTKKUQSY-YUWZRIFDSA-N 0.000 description 1
- KTDCWSFOEMXMAF-UHFFFAOYSA-N 5-diethoxyphosphoryl-2-ethoxy-3,4,5-trimethyl-2-oxo-1,2$l^{5}-oxaphospholan-3-ol Chemical compound CCOP(=O)(OCC)C1(C)OP(=O)(OCC)C(C)(O)C1C KTDCWSFOEMXMAF-UHFFFAOYSA-N 0.000 description 1
- YSDAQNOYMNBXEZ-UHFFFAOYSA-N 5-diethoxyphosphoryl-2-ethoxy-3,5-dimethyl-2-oxo-1,2$l^{5}-oxaphospholan-3-ol Chemical compound CCOP(=O)(OCC)C1(C)CC(C)(O)P(=O)(OCC)O1 YSDAQNOYMNBXEZ-UHFFFAOYSA-N 0.000 description 1
- FLIGWVMJAQZBQZ-UHFFFAOYSA-N 5-diethoxyphosphoryl-2-ethoxy-3-methyl-2-oxo-1,2$l^{5}-oxaphospholan-3-ol Chemical compound CCOP(=O)(OCC)C1CC(C)(O)P(=O)(OCC)O1 FLIGWVMJAQZBQZ-UHFFFAOYSA-N 0.000 description 1
- SPOCZSUOZMVQJL-UHFFFAOYSA-N 5-diethoxyphosphoryl-2-ethoxy-4,4-diethyl-3,5-dimethyl-2-oxo-1,2$l^{5}-oxaphospholan-3-ol Chemical compound CCOP(=O)(OCC)C1(C)OP(=O)(OCC)C(C)(O)C1(CC)CC SPOCZSUOZMVQJL-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910000095 alkaline earth hydride Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- OXLDKMFHLBAHLV-UHFFFAOYSA-N bis(prop-2-enyl) hydrogen phosphite Chemical compound C=CCOP(O)OCC=C OXLDKMFHLBAHLV-UHFFFAOYSA-N 0.000 description 1
- 238000000071 blow moulding Methods 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000006226 butoxyethyl group Chemical group 0.000 description 1
- JSIKBXCPKMPZTN-UHFFFAOYSA-N butyl-trihydroxy-methyl-$l^{5}-phosphane Chemical compound CCCCP(C)(O)(O)O JSIKBXCPKMPZTN-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- JQZRVMZHTADUSY-UHFFFAOYSA-L di(octanoyloxy)tin Chemical compound [Sn+2].CCCCCCCC([O-])=O.CCCCCCCC([O-])=O JQZRVMZHTADUSY-UHFFFAOYSA-L 0.000 description 1
- NZZIMKJIVMHWJC-UHFFFAOYSA-N dibenzoylmethane Chemical compound C=1C=CC=CC=1C(=O)CC(=O)C1=CC=CC=C1 NZZIMKJIVMHWJC-UHFFFAOYSA-N 0.000 description 1
- 125000004989 dicarbonyl group Chemical group 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- ZUNGGJHBMLMRFJ-UHFFFAOYSA-O ethoxy-hydroxy-oxophosphanium Chemical compound CCO[P+](O)=O ZUNGGJHBMLMRFJ-UHFFFAOYSA-O 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- YTPOJOIRRIMIAK-UHFFFAOYSA-N ethyl-trihydroxy-methyl-$l^{5}-phosphane Chemical compound CCP(C)(O)(O)O YTPOJOIRRIMIAK-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- NDOGLIPWGGRQCO-UHFFFAOYSA-N hexane-2,4-dione Chemical compound CCC(=O)CC(C)=O NDOGLIPWGGRQCO-UHFFFAOYSA-N 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000006229 isopropoxyethyl group Chemical group [H]C([H])([H])C([H])(OC([H])([H])C([H])([H])*)C([H])([H])[H] 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- PSJDGRHBIZNOFM-UHFFFAOYSA-N methyl 2-[5-[bis(2-methoxyethoxy)phosphoryl]-3-hydroxy-3,5-dimethyloxaphospholan-2-yl]oxyacetate Chemical compound COCCOP(=O)(OCCOC)C1(C)CC(C)(O)P(OCC(=O)OC)O1 PSJDGRHBIZNOFM-UHFFFAOYSA-N 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 150000002896 organic halogen compounds Chemical class 0.000 description 1
- GLEYNXSWQXJKGK-UHFFFAOYSA-N oxaphospholan-2-ylphosphonic acid Chemical compound OP(O)(=O)P1CCCO1 GLEYNXSWQXJKGK-UHFFFAOYSA-N 0.000 description 1
- RQKYHDHLEMEVDR-UHFFFAOYSA-N oxo-bis(phenylmethoxy)phosphanium Chemical compound C=1C=CC=CC=1CO[P+](=O)OCC1=CC=CC=C1 RQKYHDHLEMEVDR-UHFFFAOYSA-N 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000003017 phosphorus Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 238000010944 pre-mature reactiony Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- PJANXHGTPQOBST-VAWYXSNFSA-N trans-stilbene Chemical group C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/51—Phosphorus bound to oxygen
- C08K5/53—Phosphorus bound to oxygen bound to oxygen and to carbon only
- C08K5/5317—Phosphonic compounds, e.g. R—P(:O)(OR')2
- C08K5/5333—Esters of phosphonic acids
- C08K5/5357—Esters of phosphonic acids cyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/6564—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having phosphorus atoms, with or without nitrogen, oxygen, sulfur, selenium or tellurium atoms, as ring hetero atoms
- C07F9/6571—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having phosphorus atoms, with or without nitrogen, oxygen, sulfur, selenium or tellurium atoms, as ring hetero atoms having phosphorus and oxygen atoms as the only ring hetero atoms
- C07F9/657163—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having phosphorus atoms, with or without nitrogen, oxygen, sulfur, selenium or tellurium atoms, as ring hetero atoms having phosphorus and oxygen atoms as the only ring hetero atoms the ring phosphorus atom being bound to at least one carbon atom
- C07F9/657181—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having phosphorus atoms, with or without nitrogen, oxygen, sulfur, selenium or tellurium atoms, as ring hetero atoms having phosphorus and oxygen atoms as the only ring hetero atoms the ring phosphorus atom being bound to at least one carbon atom the ring phosphorus atom and, at least, one ring oxygen atom being part of a (thio)phosphonic acid derivative
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/51—Phosphorus bound to oxygen
- C08K5/53—Phosphorus bound to oxygen bound to oxygen and to carbon only
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/49—Phosphorus-containing compounds
- C08K5/51—Phosphorus bound to oxygen
- C08K5/53—Phosphorus bound to oxygen bound to oxygen and to carbon only
- C08K5/5317—Phosphonic compounds, e.g. R—P(:O)(OR')2
- C08K5/5333—Esters of phosphonic acids
- C08K5/5373—Esters of phosphonic acids containing heterocyclic rings not representing cyclic esters of phosphonic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Fireproofing Substances (AREA)
- Manufacture Of Porous Articles, And Recovery And Treatment Of Waste Products (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1689574A CH589685A5 (en) | 1974-12-18 | 1974-12-18 | 2-Oxo-5 phosphono-1,2oxaphospholanes - as flame retardants for polymers (NL220676) |
| CH1456575 | 1975-11-11 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1048044A true CA1048044A (en) | 1979-02-06 |
Family
ID=25714730
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA241,823A Expired CA1048044A (en) | 1974-12-18 | 1975-12-16 | Flameproofing of plastics |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4061604A (enExample) |
| JP (1) | JPS5188540A (enExample) |
| CA (1) | CA1048044A (enExample) |
| DE (1) | DE2555452A1 (enExample) |
| FR (1) | FR2295068A1 (enExample) |
| GB (1) | GB1485899A (enExample) |
| NL (1) | NL7514790A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2848016B1 (fr) * | 2002-11-29 | 2005-01-28 | Nexans | Cable ignifuge |
| WO2005123832A1 (en) * | 2004-06-17 | 2005-12-29 | Cheil Industries Inc. | Flameproof thermoplastic resin composition |
| JP2007195491A (ja) * | 2006-01-27 | 2007-08-09 | Yanmar Co Ltd | コンバイン |
| CN120888250B (zh) * | 2025-09-30 | 2025-12-23 | 张家界齐汇新材料有限公司 | 一种耐高温热熔胶膜及其制备方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1300695B (de) * | 1963-12-21 | 1969-08-07 | Henkel & Cie Gmbh | Verfahren zur Herstellung von Formkoerpern, UEberzuegen und Verklebungen auf der Basis von Epoxydpolyaddukten |
| US3490940A (en) * | 1965-06-30 | 1970-01-20 | Fmc Corp | Six and eight membered cyclic phosphonic acid esters resulting from the reaction of an olefin,phosphorus,and oxygen |
| US3812219A (en) * | 1971-05-03 | 1974-05-21 | Rohm & Haas | Ring phosphonates |
| US3870771A (en) * | 1972-03-30 | 1975-03-11 | Hooker Chemicals Plastics Corp | Dialkyl alkyl and aromatic sulfonamidomethyl phosphonates |
| US3873496A (en) * | 1973-06-11 | 1975-03-25 | Fmc Corp | Flame-retardant polyester compositions |
| US3905922A (en) * | 1973-08-08 | 1975-09-16 | Upjohn Co | Flame retardant urethane forms containing alkanol amino phosphonates |
| US3883478A (en) * | 1973-12-07 | 1975-05-13 | Fmc Corp | Flame-Retardant Polyester Fiber Compositions |
| US3970635A (en) * | 1974-01-28 | 1976-07-20 | Monsanto Company | Fire retardant polyester fibers |
| US4002580A (en) * | 1974-09-12 | 1977-01-11 | Gaf Corporation | Fire-retardant polyurethane |
| US3970726A (en) * | 1975-01-23 | 1976-07-20 | Uniroyal, Inc. | Polycyclic phosphate esters and process for preparing same |
-
1975
- 1975-12-10 DE DE19752555452 patent/DE2555452A1/de not_active Withdrawn
- 1975-12-15 US US05/640,992 patent/US4061604A/en not_active Expired - Lifetime
- 1975-12-16 GB GB51520/75A patent/GB1485899A/en not_active Expired
- 1975-12-16 CA CA241,823A patent/CA1048044A/en not_active Expired
- 1975-12-17 FR FR7538620A patent/FR2295068A1/fr active Granted
- 1975-12-18 JP JP50151712A patent/JPS5188540A/ja active Pending
- 1975-12-18 NL NL7514790A patent/NL7514790A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5188540A (enExample) | 1976-08-03 |
| FR2295068B1 (enExample) | 1978-05-19 |
| GB1485899A (en) | 1977-09-14 |
| NL7514790A (nl) | 1976-06-22 |
| DE2555452A1 (de) | 1976-06-24 |
| US4061604A (en) | 1977-12-06 |
| FR2295068A1 (fr) | 1976-07-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4132702A (en) | Phenol esters and amides and polymers stabilized therewith | |
| US3849368A (en) | Fire retardant polymers containing thermally stable cyclic phosphonate esters | |
| US4382042A (en) | Method of preparing oligomeric phosphate esters | |
| JPS6099167A (ja) | 難燃化重合体組成物 | |
| US4333868A (en) | Phosphite ester stabilizers | |
| US3192243A (en) | Phosphorous derivatives of pentaerythritol | |
| US4143101A (en) | 5,5-bis(halomethyl)1,3,2-dioxaphosphorinane compounds | |
| US4458035A (en) | Polyurethane foam having a flame retardant oligomeric phosphate ester | |
| CA1048044A (en) | Flameproofing of plastics | |
| US5084543A (en) | Tin (iv) compounds | |
| US3089850A (en) | Phosphorothiolothionates derived from glycols | |
| US4148820A (en) | Novel phenol stabilizers | |
| EP0684250A1 (en) | New poly(pentaerythrityl diphosphonate) and its use in self-extinguishing termoplastic compositions | |
| JP3483152B2 (ja) | 有機りん化合物及びその製造方法 | |
| US4087403A (en) | Polyphosphinate flame retardants | |
| US3767708A (en) | Aminomethyl phospholenes | |
| US3639532A (en) | Esters and/or amides of acids of phosphorus containing a group having the formula roch2nhco- | |
| EP0617042A1 (en) | Organic phosphorus compounds and flame-retarded resin compositions containing the same | |
| US3907857A (en) | Boric acid ester of 2,2,2-tris-(bromomethyl)-ethanol | |
| US2904569A (en) | Hydrocarbontin derivatives of monomercapto-borate esters | |
| US3830890A (en) | Method of making esters of 1,4-diphosphonyl butene | |
| CN113402712B (zh) | 一种含磷的梯形聚硅氧烷及其制备方法和应用 | |
| US3024217A (en) | Rubber antioxidant | |
| US2928861A (en) | beta-haloalkanesphosphonates | |
| US3898307A (en) | Halogen-containing phosphoric acid esters |