CA1046067A - 1,2,4-oxidiazole and thiadiazole esters and composition containing same - Google Patents
1,2,4-oxidiazole and thiadiazole esters and composition containing sameInfo
- Publication number
- CA1046067A CA1046067A CA191,313A CA191313A CA1046067A CA 1046067 A CA1046067 A CA 1046067A CA 191313 A CA191313 A CA 191313A CA 1046067 A CA1046067 A CA 1046067A
- Authority
- CA
- Canada
- Prior art keywords
- acid
- trans
- chrysanthemumic
- carbon atoms
- benzyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000004867 thiadiazoles Chemical class 0.000 title abstract description 7
- 239000000203 mixture Substances 0.000 title description 18
- 239000002253 acid Substances 0.000 claims abstract description 26
- -1 furylmethyl Chemical group 0.000 claims abstract description 25
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 18
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 16
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 12
- XLOPRKKSAJMMEW-SFYZADRCSA-N (+)-trans-chrysanthemic acid Chemical compound CC(C)=C[C@@H]1[C@@H](C(O)=O)C1(C)C XLOPRKKSAJMMEW-SFYZADRCSA-N 0.000 claims abstract description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 10
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 10
- 239000001301 oxygen Substances 0.000 claims abstract description 10
- KSJBHWGZQXGMNL-UHFFFAOYSA-N 1,2,2,3-tetramethylcyclopropane-1-carboxylic acid Chemical compound CC1C(C)(C)C1(C)C(O)=O KSJBHWGZQXGMNL-UHFFFAOYSA-N 0.000 claims abstract description 9
- 150000001735 carboxylic acids Chemical class 0.000 claims abstract description 9
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 8
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 8
- 239000011593 sulfur Substances 0.000 claims abstract description 8
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 7
- 125000001424 substituent group Chemical group 0.000 claims abstract description 7
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 6
- 150000002367 halogens Chemical class 0.000 claims abstract description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 6
- VEQMUQZKBLIXLT-UHFFFAOYSA-N 2,3-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1C(C)C1C(O)=O VEQMUQZKBLIXLT-UHFFFAOYSA-N 0.000 claims abstract 8
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 claims abstract 5
- 150000001875 compounds Chemical class 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical group CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 9
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 3
- XLOPRKKSAJMMEW-UHFFFAOYSA-N chrysanthemic acid Chemical group CC(C)=CC1C(C(O)=O)C1(C)C XLOPRKKSAJMMEW-UHFFFAOYSA-N 0.000 claims 1
- 150000002148 esters Chemical class 0.000 abstract description 8
- 239000002917 insecticide Substances 0.000 abstract description 7
- BBVIDBNAYOIXOE-UHFFFAOYSA-N 1,2,4-oxadiazole Chemical compound C=1N=CON=1 BBVIDBNAYOIXOE-UHFFFAOYSA-N 0.000 abstract description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- 239000002904 solvent Substances 0.000 description 12
- 230000000749 insecticidal effect Effects 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 231100000167 toxic agent Toxicity 0.000 description 6
- 239000003440 toxic substance Substances 0.000 description 6
- VEUMBMHMMCOFAG-UHFFFAOYSA-N 2,3-dihydrooxadiazole Chemical compound N1NC=CO1 VEUMBMHMMCOFAG-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 235000008504 concentrate Nutrition 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 231100001225 mammalian toxicity Toxicity 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 3
- 241000238631 Hexapoda Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- VQXSOUPNOZTNAI-UHFFFAOYSA-N Pyrethrin I Natural products CC(=CC1CC1C(=O)OC2CC(=O)C(=C2C)CC=C/C=C)C VQXSOUPNOZTNAI-UHFFFAOYSA-N 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- 241000607479 Yersinia pestis Species 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 150000002923 oximes Chemical class 0.000 description 3
- 229960005235 piperonyl butoxide Drugs 0.000 description 3
- HYJYGLGUBUDSLJ-UHFFFAOYSA-N pyrethrin Natural products CCC(=O)OC1CC(=C)C2CC3OC3(C)C2C2OC(=O)C(=C)C12 HYJYGLGUBUDSLJ-UHFFFAOYSA-N 0.000 description 3
- VJFUPGQZSXIULQ-XIGJTORUSA-N pyrethrin II Chemical compound CC1(C)[C@H](/C=C(\C)C(=O)OC)[C@H]1C(=O)O[C@@H]1C(C)=C(C\C=C/C=C)C(=O)C1 VJFUPGQZSXIULQ-XIGJTORUSA-N 0.000 description 3
- 235000017550 sodium carbonate Nutrition 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 229940001593 sodium carbonate Drugs 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 230000002195 synergetic effect Effects 0.000 description 3
- XCARGDPHZYJCMU-UHFFFAOYSA-N 2-chloro-n'-hydroxyethanimidamide Chemical compound ClCC(N)=NO XCARGDPHZYJCMU-UHFFFAOYSA-N 0.000 description 2
- XECLIXXHUYTYJD-UHFFFAOYSA-N 5-benzyl-3-(chloromethyl)-1,2,4-oxadiazole Chemical compound ClCC1=NOC(CC=2C=CC=CC=2)=N1 XECLIXXHUYTYJD-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 241001674044 Blattodea Species 0.000 description 2
- 241000255925 Diptera Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 240000004460 Tanacetum coccineum Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- ROVGZAWFACYCSP-MQBLHHJJSA-N [2-methyl-4-oxo-3-[(2z)-penta-2,4-dienyl]cyclopent-2-en-1-yl] (1r,3r)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OC1C(C)=C(C\C=C/C=C)C(=O)C1 ROVGZAWFACYCSP-MQBLHHJJSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 235000013350 formula milk Nutrition 0.000 description 2
- 125000004970 halomethyl group Chemical group 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- WEVYAHXRMPXWCK-UHFFFAOYSA-N methyl cyanide Natural products CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 2
- FVYBAJYRRIYNBN-UHFFFAOYSA-N n'-hydroxy-2-phenylethanimidamide Chemical compound ON=C(N)CC1=CC=CC=C1 FVYBAJYRRIYNBN-UHFFFAOYSA-N 0.000 description 2
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 2
- 229940015367 pyrethrum Drugs 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000011369 resultant mixture Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- PNVPNXKRAUBJGW-UHFFFAOYSA-N (2-chloroacetyl) 2-chloroacetate Chemical compound ClCC(=O)OC(=O)CCl PNVPNXKRAUBJGW-UHFFFAOYSA-N 0.000 description 1
- UGUHFDPGDQDVGX-UHFFFAOYSA-N 1,2,3-thiadiazole Chemical group C1=CSN=N1 UGUHFDPGDQDVGX-UHFFFAOYSA-N 0.000 description 1
- 150000005071 1,2,4-oxadiazoles Chemical class 0.000 description 1
- SFHVXKNMCGSLAR-UHFFFAOYSA-N 2,2,3,3-tetramethylcyclopropanecarboxylic acid Chemical compound CC1(C)C(C(O)=O)C1(C)C SFHVXKNMCGSLAR-UHFFFAOYSA-N 0.000 description 1
- BFNMOMYTTGHNGJ-UHFFFAOYSA-N 2,2-dimethylcyclopropane-1-carboxylic acid Chemical compound CC1(C)CC1C(O)=O BFNMOMYTTGHNGJ-UHFFFAOYSA-N 0.000 description 1
- RVXJYJRESXKWTN-UHFFFAOYSA-N 2-iminoacetic acid;hydrochloride Chemical class Cl.OC(=O)C=N RVXJYJRESXKWTN-UHFFFAOYSA-N 0.000 description 1
- XNRCGJVOJYKMSA-UHFFFAOYSA-N 5-[bis[2-(2-butoxyethoxy)ethoxy]methyl]-1,3-benzodioxole Chemical compound CCCCOCCOCCOC(OCCOCCOCCCC)C1=CC=C2OCOC2=C1 XNRCGJVOJYKMSA-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 241000257303 Hymenoptera Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000257226 Muscidae Species 0.000 description 1
- WABPPBHOPMUJHV-UHFFFAOYSA-N Sesamex Chemical compound CCOCCOCCOC(C)OC1=CC=C2OCOC2=C1 WABPPBHOPMUJHV-UHFFFAOYSA-N 0.000 description 1
- 150000007960 acetonitrile Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- UJZCQRGCXCBYQS-UHFFFAOYSA-N bis(prop-2-ynoxy)phosphorylbenzene Chemical compound C#CCOP(=O)(OCC#C)C1=CC=CC=C1 UJZCQRGCXCBYQS-UHFFFAOYSA-N 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- YMGUBTXCNDTFJI-UHFFFAOYSA-N cyclopropanecarboxylic acid Chemical compound OC(=O)C1CC1 YMGUBTXCNDTFJI-UHFFFAOYSA-N 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 238000004945 emulsification Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- ACINVZYWNZKNCF-UHFFFAOYSA-N ethyl 2-phenyliminoacetate;hydrochloride Chemical compound Cl.CCOC(=O)C=NC1=CC=CC=C1 ACINVZYWNZKNCF-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 235000014666 liquid concentrate Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- AEXITZJSLGALNH-UHFFFAOYSA-N n'-hydroxyethanimidamide Chemical compound CC(N)=NO AEXITZJSLGALNH-UHFFFAOYSA-N 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000002728 pyrethroid Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 239000006097 ultraviolet radiation absorber Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA313,978A CA1068280A (en) | 1973-02-09 | 1978-10-23 | 1,2,4-oxidiazole and thiadiazole esters and composition containing same |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US331164A US3879407A (en) | 1973-02-09 | 1973-02-09 | 1,2,4-Oxadiazole and thiadiazole esters and compositions containing same |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1046067A true CA1046067A (en) | 1979-01-09 |
Family
ID=23292867
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA191,313A Expired CA1046067A (en) | 1973-02-09 | 1974-01-30 | 1,2,4-oxidiazole and thiadiazole esters and composition containing same |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3879407A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS49109539A (cg-RX-API-DMAC7.html) |
| AU (1) | AU6521474A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1046067A (cg-RX-API-DMAC7.html) |
| DE (1) | DE2406786A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2217336B3 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1437152A (cg-RX-API-DMAC7.html) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3956498A (en) * | 1973-02-09 | 1976-05-11 | S. C. Johnson & Son, Inc. | Insecticidal compositions containing 1,2,4-oxadiazole and thiadiazole esters |
| FR2307531A1 (fr) * | 1975-04-16 | 1976-11-12 | Cassenne Lab Sa | Nouveaux derives de l'oxadiazole et leurs sels, procede de preparation et application a titre de medicaments |
| US4163792A (en) * | 1975-05-13 | 1979-08-07 | Ciba-Geigy Corporation | Insecticidal oxadiazole esters |
| US4096272A (en) * | 1977-05-13 | 1978-06-20 | Stauffer Chemical Company | Phenoxyoxadiazole cyclopropane carboxylates as insecticides |
| US4096273A (en) * | 1977-05-13 | 1978-06-20 | Stauffer Chemical Company | 3-Benzyl-5-[2-(4-chlorophenyl)3-methyl butyryloxy alkyl] oxadiazole insecticides |
| US4134985A (en) * | 1977-05-13 | 1979-01-16 | Stauffer Chemical Company | 5-cyclopropane carboxylate oxadiazoles as insecticides and acaricides |
| EP0000452B1 (fr) * | 1977-07-12 | 1981-05-06 | Synthelabo | Dérivés d'oxadiazole-1,2,4, leur préparation et leur application en thérapeutique. |
| FR2500451B1 (fr) * | 1981-02-26 | 1986-09-26 | Roussel Uclaf | Esters d'alcools heterocycliques derives du thiazole ou du thiadiazole, leur procede de preparation et les compositions pesticides les renfermant |
| DE4232418A1 (de) * | 1992-09-28 | 1994-03-31 | Bayer Ag | Verwendung von substituierten 1,2,4-Oxadiazolderivaten zur Bekämpfung von Endoparasiten, neue substituierte 1,2,4-Oxadiazolderivate und Verfahren zu ihrer Herstellung |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3270028A (en) * | 1963-05-08 | 1966-08-30 | Acraf | Certain 3-aryl-1, 2, 4-oxadiazoles |
| FR1451294A (fr) * | 1965-05-18 | 1966-01-07 | Rhone Poulenc Sa | Nouveaux esters phosphoriques, leur préparation et leur emploi |
-
1973
- 1973-02-09 US US331164A patent/US3879407A/en not_active Expired - Lifetime
-
1974
- 1974-01-30 CA CA191,313A patent/CA1046067A/en not_active Expired
- 1974-01-31 GB GB463274A patent/GB1437152A/en not_active Expired
- 1974-02-05 AU AU65214/74A patent/AU6521474A/en not_active Expired
- 1974-02-08 DE DE19742406786 patent/DE2406786A1/de not_active Ceased
- 1974-02-08 FR FR7404377A patent/FR2217336B3/fr not_active Expired
- 1974-02-09 JP JP49016730A patent/JPS49109539A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| GB1437152A (cg-RX-API-DMAC7.html) | 1976-05-26 |
| AU6521474A (en) | 1975-08-07 |
| US3879407A (en) | 1975-04-22 |
| FR2217336A1 (cg-RX-API-DMAC7.html) | 1974-09-06 |
| FR2217336B3 (cg-RX-API-DMAC7.html) | 1976-11-26 |
| JPS49109539A (cg-RX-API-DMAC7.html) | 1974-10-18 |
| DE2406786A1 (de) | 1974-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3666789A (en) | Cyclopropanecarboxylic acid esters | |
| US4551547A (en) | Biocidal 2-aryl-1, 3-cyclopentanedione enol ester compounds | |
| CA1312876C (en) | 2,3,5,6-tetrafluorobenzyl (+)1r-trans-2,2-dimethyl -3-(2,2-dichlorovinyl)-cyclopropanecarboxylate | |
| US4176189A (en) | Insecticidal and acaricidal hydantoin N-methylol esters | |
| US3542928A (en) | Insecticidal compositions | |
| US4632698A (en) | Biocidal 2-aryl-1,3-cyclopentanedione enol ester compounds | |
| US4083863A (en) | Process for the preparation of cyclopropane carboxylic acids and esters | |
| US3934023A (en) | Insecticidal d-cis, trans-chrysanthemates | |
| CA1046067A (en) | 1,2,4-oxidiazole and thiadiazole esters and composition containing same | |
| US3966959A (en) | Insecticidal and acaricidal, pyrethroid compounds | |
| IL34187A (en) | Diphenylmethane derivatives,process for the preparation thereof and compositions containing the same | |
| US4091111A (en) | Substituted-acetic acid ester | |
| US3702333A (en) | Cyclopropanecarboxylic acid esters possessing pesticidal properties | |
| CA1052797A (en) | Spiro-cyclopropanes | |
| CA1068280A (en) | 1,2,4-oxidiazole and thiadiazole esters and composition containing same | |
| US3956498A (en) | Insecticidal compositions containing 1,2,4-oxadiazole and thiadiazole esters | |
| US4453975A (en) | Herbicidal composition | |
| US4237163A (en) | Hydrazono-substituted cyclopropanecarboxylate pesticides | |
| US4208409A (en) | N-[(phosphinyl or phosphinothioyl)amino]thio-methylcarbamates and pesticidal methods | |
| US4316044A (en) | Isovaleric acid derivatives | |
| EP0037851A2 (en) | Carboxylates, a process for their production, an insecticidal and/or acaricidal composition and the use of the compounds as insecticides and/or acaricides | |
| SI9620006A (en) | Novel carboxylic ester derivatives, the preparation procedure, insecticides and insect repellents containing these derivatives | |
| US4439446A (en) | Fluorine-containing oxyiminocyclopropanecarboxylates | |
| JPS58188863A (ja) | シクロプロパンカルボン酸のn−メチルヒダントインのエステル、それらの製造法、寄生虫駆除への使用及びそれらを含有する組成物 | |
| US4151293A (en) | Insecticidal pyrazole-4-methanol esters |