CA1042461A - Pesticidal 1,3,5-triazapenta-1,4-dienes - Google Patents
Pesticidal 1,3,5-triazapenta-1,4-dienesInfo
- Publication number
- CA1042461A CA1042461A CA203,058A CA203058A CA1042461A CA 1042461 A CA1042461 A CA 1042461A CA 203058 A CA203058 A CA 203058A CA 1042461 A CA1042461 A CA 1042461A
- Authority
- CA
- Canada
- Prior art keywords
- parts
- formula
- compound according
- compound
- test
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- HLSFBFYQBSVXBS-UHFFFAOYSA-N n-(aminomethylidene)methanimidamide Chemical class N=CNC=N HLSFBFYQBSVXBS-UHFFFAOYSA-N 0.000 title claims abstract 3
- 230000000361 pesticidal effect Effects 0.000 title 1
- 238000002360 preparation method Methods 0.000 claims abstract description 11
- 238000000034 method Methods 0.000 claims abstract description 6
- 241000607479 Yersinia pestis Species 0.000 claims abstract description 5
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 4
- 239000001257 hydrogen Substances 0.000 claims abstract description 3
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 claims abstract 4
- 150000001875 compounds Chemical class 0.000 claims description 23
- 241000238876 Acari Species 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 241001465754 Metazoa Species 0.000 claims description 2
- 241000500891 Insecta Species 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- -1 hydrogen halogen Chemical class 0.000 abstract description 2
- 239000013543 active substance Substances 0.000 description 28
- 239000008187 granular material Substances 0.000 description 8
- 241000196324 Embryophyta Species 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000000839 emulsion Substances 0.000 description 6
- 239000002689 soil Substances 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 239000005995 Aluminium silicate Substances 0.000 description 5
- 235000012211 aluminium silicate Nutrition 0.000 description 5
- 230000000749 insecticidal effect Effects 0.000 description 5
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 239000007921 spray Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 230000000895 acaricidal effect Effects 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 239000004495 emulsifiable concentrate Substances 0.000 description 4
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 3
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 241000233866 Fungi Species 0.000 description 3
- 241000244206 Nematoda Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 3
- 235000019993 champagne Nutrition 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 238000010790 dilution Methods 0.000 description 3
- 239000012895 dilution Substances 0.000 description 3
- 229920000151 polyglycol Polymers 0.000 description 3
- 239000010695 polyglycol Substances 0.000 description 3
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 230000009885 systemic effect Effects 0.000 description 3
- 241001124076 Aphididae Species 0.000 description 2
- 241001425390 Aphis fabae Species 0.000 description 2
- 241000426497 Chilo suppressalis Species 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 2
- 241000219146 Gossypium Species 0.000 description 2
- 241000256244 Heliothis virescens Species 0.000 description 2
- 241000238631 Hexapoda Species 0.000 description 2
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 2
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 2
- 241000258916 Leptinotarsa decemlineata Species 0.000 description 2
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 2
- 241000243784 Meloidogyne arenaria Species 0.000 description 2
- 244000046052 Phaseolus vulgaris Species 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 241000949016 Rhipicephalus bursa Species 0.000 description 2
- 241000238680 Rhipicephalus microplus Species 0.000 description 2
- 240000003768 Solanum lycopersicum Species 0.000 description 2
- 241000256250 Spodoptera littoralis Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 241001454293 Tetranychus urticae Species 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 235000013601 eggs Nutrition 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 2
- 229920005610 lignin Polymers 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000002574 poison Substances 0.000 description 2
- 231100000614 poison Toxicity 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 235000012222 talc Nutrition 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 239000004563 wettable powder Substances 0.000 description 2
- QFBDCSDDHUBEGG-UHFFFAOYSA-N 1,2-dibutylnaphthalene;sodium Chemical compound [Na].C1=CC=CC2=C(CCCC)C(CCCC)=CC=C21 QFBDCSDDHUBEGG-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 241000254032 Acrididae Species 0.000 description 1
- 241000238888 Argasidae Species 0.000 description 1
- 241000221198 Basidiomycota Species 0.000 description 1
- 241000238660 Blattidae Species 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000907223 Bruchinae Species 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000257161 Calliphoridae Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241001124134 Chrysomelidae Species 0.000 description 1
- 241001414835 Cimicidae Species 0.000 description 1
- 241000255749 Coccinellidae Species 0.000 description 1
- 241000254173 Coleoptera Species 0.000 description 1
- 241000256113 Culicidae Species 0.000 description 1
- 241000254171 Curculionidae Species 0.000 description 1
- 241001466044 Delphacidae Species 0.000 description 1
- 241000131287 Dermestidae Species 0.000 description 1
- 241001414830 Diaspididae Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical class NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 1
- 240000002024 Gossypium herbaceum Species 0.000 description 1
- 235000004341 Gossypium herbaceum Nutrition 0.000 description 1
- 241000238816 Gryllidae Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- 241000238889 Ixodidae Species 0.000 description 1
- 241001124557 Lymantriidae Species 0.000 description 1
- 241000257226 Muscidae Species 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- 241000256259 Noctuidae Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000233654 Oomycetes Species 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 241001415279 Pseudococcidae Species 0.000 description 1
- 241000258921 Pulicidae Species 0.000 description 1
- 241000255893 Pyralidae Species 0.000 description 1
- 241001124072 Reduviidae Species 0.000 description 1
- 241000254062 Scarabaeidae Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 241000254107 Tenebrionidae Species 0.000 description 1
- 241000255588 Tephritidae Species 0.000 description 1
- 241001454295 Tetranychidae Species 0.000 description 1
- 241000896028 Tettigoniidae Species 0.000 description 1
- 241000130767 Tineidae Species 0.000 description 1
- 241000131339 Tipulidae Species 0.000 description 1
- 240000006677 Vicia faba Species 0.000 description 1
- 235000010749 Vicia faba Nutrition 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229940115440 aluminum sodium silicate Drugs 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 231100000162 fungitoxic Toxicity 0.000 description 1
- 230000002464 fungitoxic effect Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 230000001069 nematicidal effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- RBXVOQPAMPBADW-UHFFFAOYSA-N nitrous acid;phenol Chemical class ON=O.OC1=CC=CC=C1 RBXVOQPAMPBADW-UHFFFAOYSA-N 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- 230000003032 phytopathogenic effect Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000012217 sodium aluminium silicate Nutrition 0.000 description 1
- 239000000429 sodium aluminium silicate Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- KZOJQMWTKJDSQJ-UHFFFAOYSA-M sodium;2,3-dibutylnaphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S([O-])(=O)=O)=C(CCCC)C(CCCC)=CC2=C1 KZOJQMWTKJDSQJ-UHFFFAOYSA-M 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C257/00—Compounds containing carboxyl groups, the doubly-bound oxygen atom of a carboxyl group being replaced by a doubly-bound nitrogen atom, this nitrogen atom not being further bound to an oxygen atom, e.g. imino-ethers, amidines
- C07C257/10—Compounds containing carboxyl groups, the doubly-bound oxygen atom of a carboxyl group being replaced by a doubly-bound nitrogen atom, this nitrogen atom not being further bound to an oxygen atom, e.g. imino-ethers, amidines with replacement of the other oxygen atom of the carboxyl group by nitrogen atoms, e.g. amidines
- C07C257/18—Compounds containing carboxyl groups, the doubly-bound oxygen atom of a carboxyl group being replaced by a doubly-bound nitrogen atom, this nitrogen atom not being further bound to an oxygen atom, e.g. imino-ethers, amidines with replacement of the other oxygen atom of the carboxyl group by nitrogen atoms, e.g. amidines having carbon atoms of amidino groups bound to carbon atoms of six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH924373A CH580910A5 (enExample) | 1973-06-25 | 1973-06-25 | |
| CH575574 | 1974-04-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1042461A true CA1042461A (en) | 1978-11-14 |
Family
ID=25698327
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA203,058A Expired CA1042461A (en) | 1973-06-25 | 1974-06-21 | Pesticidal 1,3,5-triazapenta-1,4-dienes |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3875230A (enExample) |
| JP (1) | JPS5035331A (enExample) |
| AR (1) | AR213823A1 (enExample) |
| BG (1) | BG21833A3 (enExample) |
| BR (1) | BR7405131D0 (enExample) |
| CA (1) | CA1042461A (enExample) |
| DD (1) | DD114211A5 (enExample) |
| DE (1) | DE2429747A1 (enExample) |
| FR (1) | FR2234275B1 (enExample) |
| GB (1) | GB1471044A (enExample) |
| IL (1) | IL44905A (enExample) |
| KE (1) | KE3005A (enExample) |
| NL (1) | NL7407738A (enExample) |
| OA (1) | OA04723A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4128652A (en) * | 1976-04-20 | 1978-12-05 | Pfizer Inc. | Triazapentadienes as acaricides |
| US4163056A (en) * | 1977-09-29 | 1979-07-31 | Ciba-Geigy Corporation | Pesticidal triazapentadienes |
| JPS62108485U (enExample) * | 1985-12-26 | 1987-07-10 | ||
| GB8903592D0 (en) * | 1989-02-16 | 1989-04-05 | Boots Co Plc | Therapeutic agents |
| AU2811501A (en) * | 2000-03-28 | 2001-10-04 | Sumitomo Chemical Company, Limited | Amidine compounds and their use as pesticides |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3781355A (en) * | 1969-12-12 | 1973-12-25 | Boots Pure Drug Co Ltd | Pesticidal compounds and compositions |
-
1974
- 1974-05-28 IL IL44905A patent/IL44905A/en unknown
- 1974-06-10 NL NL7407738A patent/NL7407738A/xx not_active Application Discontinuation
- 1974-06-12 US US478679A patent/US3875230A/en not_active Expired - Lifetime
- 1974-06-19 FR FR7421291A patent/FR2234275B1/fr not_active Expired
- 1974-06-21 DD DD179367A patent/DD114211A5/xx unknown
- 1974-06-21 CA CA203,058A patent/CA1042461A/en not_active Expired
- 1974-06-21 OA OA55224A patent/OA04723A/xx unknown
- 1974-06-21 DE DE2429747A patent/DE2429747A1/de not_active Withdrawn
- 1974-06-24 GB GB2795474A patent/GB1471044A/en not_active Expired
- 1974-06-24 BR BR5131/74A patent/BR7405131D0/pt unknown
- 1974-06-24 BG BG027057A patent/BG21833A3/xx unknown
- 1974-06-24 AR AR254344A patent/AR213823A1/es active
- 1974-06-25 JP JP49072730A patent/JPS5035331A/ja active Pending
-
1979
- 1979-11-23 KE KE3005A patent/KE3005A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL44905A0 (en) | 1974-07-31 |
| BR7405131D0 (pt) | 1975-01-07 |
| GB1471044A (en) | 1977-04-21 |
| AU6950074A (en) | 1975-12-04 |
| FR2234275A1 (enExample) | 1975-01-17 |
| FR2234275B1 (enExample) | 1976-12-24 |
| AR213823A1 (es) | 1979-03-30 |
| IL44905A (en) | 1977-03-31 |
| DD114211A5 (enExample) | 1975-07-20 |
| OA04723A (fr) | 1980-08-31 |
| US3875230A (en) | 1975-04-01 |
| NL7407738A (enExample) | 1974-12-30 |
| DE2429747A1 (de) | 1975-01-23 |
| KE3005A (en) | 1979-12-14 |
| BG21833A3 (bg) | 1976-09-20 |
| JPS5035331A (enExample) | 1975-04-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4012506A (en) | Pyrimidyl thio- and dithio-phosphoric acid esters | |
| CA1042461A (en) | Pesticidal 1,3,5-triazapenta-1,4-dienes | |
| US4028377A (en) | O,S-dialkyl- and O-alkyl-S-alkoxyalkyl-S-1,2,4-oxa-diazolyl-3-methylene dithiophosphates | |
| US3957924A (en) | O,s-dialkyl urido thiophosphates | |
| US3898306A (en) | O-(2-vinyl phenyl) thiolphosphates | |
| US4172080A (en) | Phosphorus esters of 1-cyanoethyl-1,2,4-triazol-3-ols | |
| US3968222A (en) | Insecticidal O,S-dialkyl esters of pyridylthio-and-pyridyldithio-phosphoric acids | |
| US4044124A (en) | Triazolylphosphorus compounds | |
| US3920671A (en) | Certain phosphorus acid esters | |
| US4140795A (en) | Pesticidal 1,3,5-triazapenta-1,4-dienes | |
| US3927149A (en) | O-(methyl or ethyl)-O(S) lower alkyl-O-(4-phenoxyphenyl)phosphates | |
| IL43144A (en) | Thiophosphoric acid amide esters their preparation and their use in insecticidal acaricidal and nematicidal compositions | |
| US3957801A (en) | O,s-dialkyl esters of pyridylthio- and pyridyldithiophosphoric acid | |
| US3925517A (en) | Phosphorylformamidines | |
| US3935250A (en) | N-lower alkyl, N-lower alkyliminomethyl carbamic acid esters of αnaphthol and substituted phenols | |
| US3988445A (en) | Control of insects with O-(methyl or ethyl)-O(S)-lower alkoxyl-O-(4-phenoxyphenyl)-phosphates | |
| US3884998A (en) | S-diphenylmethyl-dithiophosphates | |
| CA1047521A (en) | Thiolphosphoric acid esters | |
| US3934011A (en) | Combating insects and acarids with S-diphenylmethyl-dithiophosphates | |
| US3948921A (en) | O-ethyl-S-(propyl, butyl or propargyl)-S-[2,6-dichloropicolyl-(3)]-dithiophosphates | |
| US3919129A (en) | Certain phosphorus acid esters | |
| US4005158A (en) | O-(2-vinylphenyl)-thiol-phosphates | |
| US3969442A (en) | O-(2-Vinylphenyl)-thiolphosphates | |
| US3957802A (en) | O,s-dialkyl esters of pyridylthio- and pyridyldithio-phosphoric acid | |
| US3968223A (en) | Control of insects and acarids with O-(2-vinylphenyl)-thiolphosphates |