CA1023382A - Benzyl chrysanthemumates - Google Patents
Benzyl chrysanthemumatesInfo
- Publication number
- CA1023382A CA1023382A CA147,040A CA147040A CA1023382A CA 1023382 A CA1023382 A CA 1023382A CA 147040 A CA147040 A CA 147040A CA 1023382 A CA1023382 A CA 1023382A
- Authority
- CA
- Canada
- Prior art keywords
- chrysanthemumates
- benzyl
- benzyl chrysanthemumates
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/74—Esters of carboxylic acids having an esterified carboxyl group bound to a carbon atom of a ring other than a six-membered aromatic ring
- C07C69/743—Esters of carboxylic acids having an esterified carboxyl group bound to a carbon atom of a ring other than a six-membered aromatic ring of acids with a three-membered ring and with unsaturation outside the ring
- C07C69/747—Chrysanthemumic acid esters
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US16703771A | 1971-07-28 | 1971-07-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1023382A true CA1023382A (en) | 1977-12-27 |
Family
ID=22605687
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA147,040A Expired CA1023382A (en) | 1971-07-28 | 1972-07-13 | Benzyl chrysanthemumates |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3792079A (OSRAM) |
| JP (1) | JPS4828632A (OSRAM) |
| BE (1) | BE786808A (OSRAM) |
| CA (1) | CA1023382A (OSRAM) |
| FR (1) | FR2147310B1 (OSRAM) |
| GB (1) | GB1336098A (OSRAM) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2326077C2 (de) * | 1972-05-25 | 1985-12-12 | National Research Development Corp., London | Ungesättigte Cyclopropancarbonsäuren und deren Derivate, deren Herstellung und diese enthaltende Insektizide |
| US3956498A (en) * | 1973-02-09 | 1976-05-11 | S. C. Johnson & Son, Inc. | Insecticidal compositions containing 1,2,4-oxadiazole and thiadiazole esters |
| US4021466A (en) * | 1973-10-08 | 1977-05-03 | Shell Oil Company | Cyclopropane carboxylates |
| JPS5710842B2 (OSRAM) * | 1973-10-18 | 1982-03-01 | ||
| IL45320A (en) * | 1974-07-22 | 1980-03-31 | Nechama S Kosower | Cyclopropane fatty acids alkoxyalkyl esters and their use as membrane mobility agents in plant and animal cells |
| GB1518508A (en) * | 1974-12-05 | 1978-07-19 | Ici Ltd | Cyclopropane carboxylic acid esters useful as insecticide |
| US3987079A (en) * | 1974-12-05 | 1976-10-19 | Imperial Chemical Industries Limited | Vinyl ethers |
| JPS5233652A (en) * | 1975-09-05 | 1977-03-14 | Wellcome Found | Process for manufacture of vinylcyclopropane carboxylic acid esters |
| US4183950A (en) * | 1976-12-22 | 1980-01-15 | Bayer Aktiengesellschaft | Combating arthropods with 2,2-dimethyl-3-vinyl-cyclopropane carboxylic acid esters of halogenated benzyl alcohols |
| DE2819788A1 (de) * | 1978-05-05 | 1979-11-08 | Bayer Ag | Benzylester mit fluorsubstituierten aether- und/oder thioaethergruppen und ihre verwendung als insektizide |
| CA1150300A (en) * | 1978-10-13 | 1983-07-19 | Robert J.G. Searle | 2,6-dihalobenzyl esters and their use as pesticides |
| GB2035301B (en) * | 1978-10-13 | 1982-12-08 | Shell Int Research | 2-bromobenzyl esters of alkenyl cyclopropane carboxylic acids and their use as pesticides |
| US4259349A (en) * | 1978-10-13 | 1981-03-31 | Shell Oil Company | Halobenzyl ester pesticides |
| DE3060562D1 (en) * | 1979-02-14 | 1982-08-12 | Ici Plc | Esters of halogenated substituted cyclopropanoic acids, their preparation and use as insecticides |
| US4219565A (en) * | 1979-06-26 | 1980-08-26 | Shell Oil Company | Oxyimino-substituted cyclopropanecarboxylate pesticides |
| DE3005722A1 (de) * | 1980-02-15 | 1981-08-20 | Bayer Ag, 5090 Leverkusen | Trifluormethylbenzylester, verfahren zu deren herstellung und deren verwendung in schaedlingsbekaempfungsmitteln |
| EP0031199B1 (en) * | 1979-12-21 | 1983-12-14 | Imperial Chemical Industries Plc | Substituted benzyl esters of cyclopropane carboxylic acids and their preparation, compositions containing them and methods of combating insect pests therewith, and substituted benzyl alcohols |
| US4370346A (en) * | 1979-12-21 | 1983-01-25 | Imperial Chemical Industries Plc | Halogenated esters |
| US4375476A (en) * | 1980-10-14 | 1983-03-01 | Fmc Corporation | Insecticidal (2,6-dimethyl-3-substituted phenyl)methyl cyclopropanecarboxylates |
| DE3145448A1 (de) * | 1980-11-18 | 1982-08-26 | Kuraray Co., Ltd., Kurashiki, Okayama | Substitutierter bezylester einer 2,2-dimethyl-3-(2,2-dihalogenvinyl)cyclopropancarbonsaeure, diese enthaltende pestizide mittel sowie verfahren zur bekaempfung von schaedlingen |
| EP0057795B1 (en) * | 1981-01-21 | 1985-07-10 | Imperial Chemical Industries Plc | Halobenzyl esters of haloalkenylcyclopropane acids, their preparation, compositions and method of combating insect pests therewith |
| US4477679A (en) * | 1983-03-01 | 1984-10-16 | Cpc International Inc. | Production of alkyl-5-substituted-3-furoate compounds |
| FR2687666A1 (fr) * | 1992-02-21 | 1993-08-27 | Roussel Uclaf | Nouveaux esters pyrethrinouiques, derives de l'alcool 6-(trifluoromethyl) benzylique, leur procede de preparation et leur application comme pesticides. |
| FR2708600B1 (fr) * | 1993-08-05 | 1995-09-15 | Roussel Uclaf | Nouveaux dérivés de l'alcool 6-trifluorométhyl benzylique, leur procédé de préparation et leur application comme pesticides. |
-
0
- BE BE786808D patent/BE786808A/xx unknown
-
1971
- 1971-07-28 US US00167037A patent/US3792079A/en not_active Expired - Lifetime
-
1972
- 1972-07-13 CA CA147,040A patent/CA1023382A/en not_active Expired
- 1972-07-19 GB GB3377772A patent/GB1336098A/en not_active Expired
- 1972-07-28 JP JP47075207A patent/JPS4828632A/ja active Pending
- 1972-07-28 FR FR7227384A patent/FR2147310B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BE786808A (fr) | 1973-01-29 |
| FR2147310A1 (OSRAM) | 1973-03-09 |
| JPS4828632A (OSRAM) | 1973-04-16 |
| US3792079A (en) | 1974-02-12 |
| FR2147310B1 (OSRAM) | 1977-08-26 |
| GB1336098A (en) | 1973-11-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU450078B2 (en) | SUBSTITUTED-p-MENTHANES | |
| CA1023382A (en) | Benzyl chrysanthemumates | |
| AU475506B2 (en) | Compost-toilet | |
| AU463807B2 (en) | Furyland furfuryl-benzomorphanes | |
| AU462106B2 (en) | Alkoxysiloxanols | |
| AU3256971A (en) | Medicament-container | |
| AU476056B2 (en) | Thienobenzazepines | |
| AU474208B2 (en) | 3-trifluoro-methylanilides | |
| AU462761B2 (en) | 2-aminoquinoxalines | |
| AU456376B2 (en) | Weed-extractor | |
| AU467477B2 (en) | QUINOXALINE-din-OXIDES | |
| AU468156B2 (en) | 5-nitroimidazoles | |
| AU456320B2 (en) | Cikir bibd syrveukkabce ststem | |
| AU463139B2 (en) | Multiseeders | |
| AU466226B1 (en) | Wall-plugs | |
| AU470596B2 (en) | N-aryl-ureas | |
| AU3244971A (en) | Clipshade | |
| AU2792771A (en) | Paddleboat | |
| AU449833B2 (en) | Fascines | |
| AU455851B2 (en) | Hub-mounting | |
| AU456985B2 (en) | Carrier-bags | |
| AU461032B2 (en) | Gastropodicical nitrosalicylanilides | |
| AU454300B2 (en) | Oestratrienes | |
| AU462302B2 (en) | Aminoisoquinolines | |
| AU444883B2 (en) | N-sulphenyl-carbamates |