CA1018525A - Route to 4-hydroxy-1,2-benzothiazine-3-carboxamides - Google Patents
Route to 4-hydroxy-1,2-benzothiazine-3-carboxamidesInfo
- Publication number
- CA1018525A CA1018525A CA196,694A CA196694A CA1018525A CA 1018525 A CA1018525 A CA 1018525A CA 196694 A CA196694 A CA 196694A CA 1018525 A CA1018525 A CA 1018525A
- Authority
- CA
- Canada
- Prior art keywords
- benzothiazine
- carboxamides
- hydroxy
- route
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- MDGONKGLMIHIIR-UHFFFAOYSA-N 4-hydroxy-2h-1,2-benzothiazine-3-carboxamide Chemical class C1=CC=C2SNC(C(=O)N)=C(O)C2=C1 MDGONKGLMIHIIR-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/22—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/14—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/46—Acylated amino or imino radicals by carboxylic acids, or sulfur or nitrogen analogues thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00353607A US3853862A (en) | 1973-04-23 | 1973-04-23 | Production of 4-hydroxy-1,2-benzothiazine-3-carboxamides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1018525A true CA1018525A (en) | 1977-10-04 |
Family
ID=23389837
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA196,694A Expired CA1018525A (en) | 1973-04-23 | 1974-04-03 | Route to 4-hydroxy-1,2-benzothiazine-3-carboxamides |
Country Status (21)
| Country | Link |
|---|---|
| US (3) | US3853862A (mo) |
| JP (1) | JPS5760347B2 (mo) |
| AR (1) | AR205249A1 (mo) |
| AT (1) | AT333777B (mo) |
| CA (1) | CA1018525A (mo) |
| CH (1) | CH590257A5 (mo) |
| CS (1) | CS165311B2 (mo) |
| DD (1) | DD111079A5 (mo) |
| DK (1) | DK140014B (mo) |
| ES (1) | ES425398A1 (mo) |
| FI (1) | FI52087C (mo) |
| GB (1) | GB1414887A (mo) |
| HU (1) | HU170489B (mo) |
| IE (1) | IE39119B1 (mo) |
| LU (1) | LU69905A1 (mo) |
| NL (1) | NL7405413A (mo) |
| PL (1) | PL90468B1 (mo) |
| RO (1) | RO63727A (mo) |
| SE (1) | SE406467B (mo) |
| SU (1) | SU552030A3 (mo) |
| YU (1) | YU39152B (mo) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3954786A (en) * | 1974-04-19 | 1976-05-04 | Pfizer Inc. | Isoxazole intermediate compounds |
| US3900470A (en) * | 1974-09-23 | 1975-08-19 | Mcneilab Inc | Esters of benzothiazine-1,1-dioxides derivatives |
| US3923801A (en) * | 1974-09-23 | 1975-12-02 | Mcneilab Inc | Oxazinobenzothiazine 6,6-dioxides |
| US3925371A (en) * | 1974-09-23 | 1975-12-09 | Mcneilab Inc | Benzothiazine-1,1-dioxides |
| US3891637A (en) * | 1974-10-01 | 1975-06-24 | Pfizer | Process for the production of carboxamides of oxo-1,2-benzothiazine-1,1-dioxides |
| US3892740A (en) * | 1974-10-15 | 1975-07-01 | Pfizer | Process for the production of carboxamides of oxo-1,2-benzothiazine-1,1-dioxides |
| US4100347A (en) * | 1976-06-10 | 1978-07-11 | Pfizer Inc. | 3,4-Dihydro-2-methyl-4-oxo-2H-1,2-benzothiazine-3-carboxylic acid-1,1-dioxide |
| DE2756113A1 (de) * | 1977-12-16 | 1979-06-21 | Thomae Gmbh Dr K | Neue 4-hydroxy-2h-1,2-benzothiazin- 3-carboxamid-1,1-dioxide, verfahren zu ihrer herstellung und diese enthaltende arzneimittel |
| US4217355A (en) * | 1978-04-24 | 1980-08-12 | Pfizer Inc. | Amide therapeutic agents |
| JPS5714589A (en) * | 1980-06-27 | 1982-01-25 | Mitsui Toatsu Chem Inc | Benzothiazine derivative, its preparation and drug composition |
| JPS57140785A (en) * | 1981-02-24 | 1982-08-31 | Mitsui Toatsu Chem Inc | Benzothiazine derivative, its preparation, and pharmaceutical composition containing the same |
| US4289879A (en) * | 1980-09-29 | 1981-09-15 | Pfizer Inc. | Synthetic method and intermediate for piroxicam |
| IN158333B (mo) * | 1981-08-03 | 1986-10-18 | Pfizer | |
| GT198276334A (es) * | 1981-08-03 | 1984-01-10 | Procedimiento e inter-medios para la produccion de carboxamidas de benzotiazina. | |
| IN159273B (mo) * | 1981-10-05 | 1987-04-25 | Pfizer | |
| SU1306476A3 (ru) * | 1982-06-17 | 1987-04-23 | Пфайзер,Инк (Фирма) | Способ получени 2-метил-3- @ -(2-пиридил)-карбамоил-3,4-дигидро-2 @ -1,2-бензтиазин-1,1-диоксида |
| US4483982A (en) * | 1982-09-02 | 1984-11-20 | Pfizer Inc. | Processes for preparing piroxicam and intermediates leading thereto |
| IT1196307B (it) * | 1984-10-22 | 1988-11-16 | Chiesi Farma Spa | Formulazioni farmaceutiche acquose di piroxicam monoidrato |
| JPS6243434U (mo) * | 1985-09-03 | 1987-03-16 | ||
| JPH0629271B2 (ja) * | 1988-03-09 | 1994-04-20 | 株式会社日本ハイポックス | ベンゾチアジン―1,1―ジオキシド誘導体及びそれを含有する医薬組成物 |
| US5741798A (en) * | 1996-06-03 | 1998-04-21 | Boehringer Ingelheim Pharmaceuticals, Inc. | 2-benzyl-4-sulfonyl-4H-isoquinolin-1,3-diones and their use as antiinflammatory agents |
| ATE464292T1 (de) | 2000-10-17 | 2010-04-15 | Merck Serono Sa | Pharmazeutisch aktive sulfonamid-derivate |
| US6865910B2 (en) * | 2001-12-05 | 2005-03-15 | Emhart Glass S.A. | Glass container forming machine |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2676188A (en) * | 1950-12-16 | 1954-04-20 | American Home Prod | Acylated glycinamides |
| US3591584A (en) * | 1968-08-27 | 1971-07-06 | Pfizer | Benzothiazine dioxides |
| US4062861A (en) * | 1973-07-27 | 1977-12-13 | Shionogi & Co., Ltd. | 3-Isoxazolylurea derivatives |
| GB1498884A (en) * | 1975-04-15 | 1978-01-25 | Wyeth John & Brother Ltd | Aminoacetamide-pyridyl-tetrahydropyridyl and-piperidyl derivatives |
-
1973
- 1973-04-23 US US00353607A patent/US3853862A/en not_active Expired - Lifetime
- 1973-10-01 GB GB4586373A patent/GB1414887A/en not_active Expired
-
1974
- 1974-01-01 AR AR253392A patent/AR205249A1/es active
- 1974-04-03 CA CA196,694A patent/CA1018525A/en not_active Expired
- 1974-04-05 IE IE00742/74A patent/IE39119B1/xx unknown
- 1974-04-17 ES ES425398A patent/ES425398A1/es not_active Expired
- 1974-04-19 AT AT327374A patent/AT333777B/de not_active IP Right Cessation
- 1974-04-19 YU YU01121/74A patent/YU39152B/xx unknown
- 1974-04-22 SE SE747405399A patent/SE406467B/xx not_active IP Right Cessation
- 1974-04-22 LU LU69905A patent/LU69905A1/xx unknown
- 1974-04-22 SU SU2022042A patent/SU552030A3/ru active
- 1974-04-22 NL NL7405413A patent/NL7405413A/xx active Search and Examination
- 1974-04-22 CS CS2856A patent/CS165311B2/cs unknown
- 1974-04-22 PL PL1974170535A patent/PL90468B1/pl unknown
- 1974-04-22 HU HUPI416A patent/HU170489B/hu unknown
- 1974-04-22 FI FI741205A patent/FI52087C/fi active
- 1974-04-22 DK DK219274AA patent/DK140014B/da not_active IP Right Cessation
- 1974-04-23 CH CH557074A patent/CH590257A5/xx not_active IP Right Cessation
- 1974-04-23 DD DD178074A patent/DD111079A5/xx unknown
- 1974-04-23 JP JP49045179A patent/JPS5760347B2/ja not_active Expired
- 1974-04-23 RO RO7400078533A patent/RO63727A/ro unknown
-
1976
- 1976-11-30 US US05/746,186 patent/USRE29669E/en not_active Expired - Lifetime
-
1977
- 1977-03-23 US US05/780,312 patent/USRE29668E/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| YU39152B (en) | 1984-06-30 |
| JPS5012094A (mo) | 1975-02-07 |
| HU170489B (mo) | 1977-06-28 |
| GB1414887A (en) | 1975-11-19 |
| RO63727A (fr) | 1978-12-15 |
| JPS5760347B2 (mo) | 1982-12-18 |
| USRE29668E (en) | 1978-06-13 |
| AT333777B (de) | 1976-12-10 |
| DK140014C (mo) | 1979-11-05 |
| NL7405413A (mo) | 1974-10-25 |
| FI52087B (mo) | 1977-02-28 |
| USRE29669E (en) | 1978-06-13 |
| DD111079A5 (mo) | 1975-01-20 |
| DK140014B (da) | 1979-06-05 |
| LU69905A1 (mo) | 1974-11-21 |
| ATA327374A (de) | 1976-04-15 |
| US3853862A (en) | 1974-12-10 |
| SU552030A3 (ru) | 1977-03-25 |
| PL90468B1 (mo) | 1977-01-31 |
| IE39119L (en) | 1974-10-23 |
| FI52087C (fi) | 1977-06-10 |
| SE406467B (sv) | 1979-02-12 |
| CH590257A5 (mo) | 1977-07-29 |
| ES425398A1 (es) | 1976-05-16 |
| IE39119B1 (en) | 1978-08-02 |
| CS165311B2 (mo) | 1975-12-22 |
| YU112174A (en) | 1982-06-30 |
| AR205249A1 (es) | 1976-04-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1018525A (en) | Route to 4-hydroxy-1,2-benzothiazine-3-carboxamides | |
| CA1015126A (en) | Construction system | |
| PH11009A (en) | Triazolyl-o,n-acetals | |
| AU468964B2 (en) | Melik | |
| ZA744095B (en) | Aminodibenzo <b,d> pyrans | |
| CA1002558A (en) | Tricycle | |
| AU476599B2 (en) | Improved pack-bed | |
| CA1026686A (en) | Separators | |
| CA1010414A (en) | Swing-brake for grabs | |
| AU474588B2 (en) | Substituted pyrrolidinemethanols | |
| CA1002084A (en) | Coupler | |
| CA1023655A (en) | Well construction | |
| CA1001902A (en) | Icebreaker | |
| ZA74932B (en) | 7-alkyl-delta3,5-steroids | |
| ZA743304B (en) | 17beta-hydroxy-16,16-dimethylestr-4-en-3-one | |
| AU474711B2 (en) | Chopper-control system | |
| CA1034943A (en) | Substituted phenylglycylcephalosporins | |
| CA1026331A (en) | Substituted indolobenzazepines | |
| CA1022943A (en) | Substituted ureido-s-triazines | |
| CA1010882A (en) | 5-bromo-5-nitro-2-alkylsubstituted-1,3-dioxane | |
| GB1407940A (en) | 6-aza-1h-1,4-bnezodiazepines | |
| AU479172B2 (en) | l, 3-DIOXANS | |
| AU478213B2 (en) | 17b- hydroxy-16, 16-dimethylester-4-en-3-one | |
| AU483739B2 (en) | Substituted trizzolo-1, 5-benzodiazephines | |
| CA972328A (en) | Carton construction |