BR6915336D0 - Reptidios contendo tirosina-o-sulfato - Google Patents
Reptidios contendo tirosina-o-sulfatoInfo
- Publication number
- BR6915336D0 BR6915336D0 BR21533669A BR21533669A BR6915336D0 BR 6915336 D0 BR6915336 D0 BR 6915336D0 BR 21533669 A BR21533669 A BR 21533669A BR 21533669 A BR21533669 A BR 21533669A BR 6915336 D0 BR6915336 D0 BR 6915336D0
- Authority
- BR
- Brazil
- Prior art keywords
- reptides
- sulfate
- containing tyrosine
- tyrosine
- reptides containing
- Prior art date
Links
- CIQHWLTYGMYQQR-QMMMGPOBSA-N O(4')-sulfo-L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(OS(O)(=O)=O)C=C1 CIQHWLTYGMYQQR-QMMMGPOBSA-N 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US82836869A | 1969-05-27 | 1969-05-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BR6915336D0 true BR6915336D0 (pt) | 1973-03-13 |
Family
ID=25251606
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BR21533669A BR6915336D0 (pt) | 1969-05-27 | 1969-12-19 | Reptidios contendo tirosina-o-sulfato |
Country Status (6)
| Country | Link |
|---|---|
| BR (1) | BR6915336D0 (enExample) |
| CA (1) | CA919658A (enExample) |
| CH (1) | CH515893A (enExample) |
| DE (1) | DE2022623A1 (enExample) |
| FR (1) | FR2051561B1 (enExample) |
| GB (1) | GB1304074A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD128973B1 (de) | 1976-11-29 | 1979-11-28 | Hartmut Niedrich | Verfahren zur herstellung von peptiden,die tyrosinsulfat enthalten |
| DE3066728D1 (en) * | 1979-04-30 | 1984-03-29 | Max Planck Gesellschaft | Tyrosine derivatives, process for their production and their use in the synthesis of peptides |
| DK489683A (da) * | 1982-10-27 | 1984-04-28 | Amano Pharma Co Ltd | Fremgangsmaade til fremstilling af peptider |
| DE69017704T2 (de) * | 1989-11-27 | 1995-07-20 | Fisons Corp | Hexapeptide mit sulphat-ester-gruppen. |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3472832A (en) * | 1966-08-09 | 1969-10-14 | Farmaceutici Italia | Peptides related to caerulein |
-
1969
- 1969-12-19 BR BR21533669A patent/BR6915336D0/pt unknown
-
1970
- 1970-04-30 CA CA081527A patent/CA919658A/en not_active Expired
- 1970-05-04 GB GB2129570A patent/GB1304074A/en not_active Expired
- 1970-05-08 DE DE19702022623 patent/DE2022623A1/de active Pending
- 1970-05-26 FR FR7019205A patent/FR2051561B1/fr not_active Expired
- 1970-05-27 CH CH789870A patent/CH515893A/fr not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CA919658A (en) | 1973-01-23 |
| FR2051561A1 (enExample) | 1971-04-09 |
| CH515893A (fr) | 1971-11-30 |
| FR2051561B1 (enExample) | 1974-08-30 |
| DE2022623A1 (de) | 1970-12-03 |
| GB1304074A (enExample) | 1973-01-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| BE751784R (fr) | Draaiknop | |
| BE745669A (fr) | Pulserend verbrandingssysteem | |
| BE752294A (fr) | Supraconducteurs | |
| BE744024A (fr) | Manipulateur-synthetiseur | |
| BE752089A (fr) | Benzimidazoolcarbamaten | |
| BE749371A (fr) | Spectrofotometer | |
| BE751497A (fr) | Rejeteaux | |
| AT306980B (de) | Aeroionisator | |
| BE748247A (fr) | Electrocardiometre | |
| BE750639A (fr) | Tetrahydropyranols | |
| BE748852A (fr) | Audio-moniteur | |
| BE750203A (fr) | Roterend perforeerapparaat | |
| BE752029A (fr) | Bleekmiddel | |
| BE747871A (fr) | Weefmachine | |
| BE750202A (de) | Zelfklevend sluitetiket | |
| BE752426A (fr) | Fotochrome polycondensaten | |
| BE747783R (fr) | Elektrofotografisch | |
| BE747731A (fr) | Afhankelijk stroom-tijdrelais | |
| BE747903A (fr) | Spectraal gesensibiliseerd lichtgevoelig materiaal | |
| BE750756A (fr) | Photocomposeuse | |
| BE752151A (fr) | Filmcassette | |
| BE752854A (fr) | Beta-mercapto-gesubstitueerde alifatische nitrillen | |
| BE747782A (fr) | Fotografisch veellagenkleurenmateriaal | |
| BE749943A (fr) | Zuurkast | |
| BE749878A (fr) | Volumemeters |