BE816398A - 7-trifluoromethylsulfinylacetamido cephalosporines - Google Patents
7-trifluoromethylsulfinylacetamido cephalosporinesInfo
- Publication number
- BE816398A BE816398A BE145483A BE145483A BE816398A BE 816398 A BE816398 A BE 816398A BE 145483 A BE145483 A BE 145483A BE 145483 A BE145483 A BE 145483A BE 816398 A BE816398 A BE 816398A
- Authority
- BE
- Belgium
- Prior art keywords
- trifluoromethylsulfinylacetamido
- cephalosporins
- trifluoromethylsulfinylacetamido cephalosporins
- Prior art date
Links
- 229930186147 Cephalosporin Natural products 0.000 title 1
- 229940124587 cephalosporin Drugs 0.000 title 1
- HOKIDJSKDBPKTQ-GLXFQSAKSA-N cephalosporin C Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CCC[C@@H](N)C(O)=O)[C@@H]12 HOKIDJSKDBPKTQ-GLXFQSAKSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US371081A US3880848A (en) | 1973-06-18 | 1973-06-18 | 7-Trifluorome thylsulfinylacetamido cephalosporins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BE816398A true BE816398A (fr) | 1974-12-16 |
Family
ID=23462402
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BE145483A BE816398A (fr) | 1973-06-18 | 1974-06-14 | 7-trifluoromethylsulfinylacetamido cephalosporines |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3880848A (enExample) |
| JP (1) | JPS5035189A (enExample) |
| AU (1) | AU476265B2 (enExample) |
| BE (1) | BE816398A (enExample) |
| CA (1) | CA1027556A (enExample) |
| DE (1) | DE2429229A1 (enExample) |
| FR (1) | FR2233068B1 (enExample) |
| GB (1) | GB1434174A (enExample) |
| ZA (1) | ZA743837B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3963709A (en) * | 1973-08-17 | 1976-06-15 | Smithkline Corporation | Cyanomethyl sulfinyl- and sulfonyl-acetamido cephalosporins |
| US3963711A (en) * | 1973-08-17 | 1976-06-15 | Smithkline Corporation | Cyanomethyl sulfinyl- and sulfonyl-acetamido cephalosporins |
| US3998818A (en) * | 1973-12-26 | 1976-12-21 | Smithkline Corporation | Trifluoroethylmercapto, -sulfinyl or -sulfonyl acetamidocephalosporins |
| US3998819A (en) * | 1973-12-26 | 1976-12-21 | Smithkline Corporation | Trifluoroethyl-mercapto, -sulfinyl or -sulfonyl acetamidocephalosporins |
| US4286089A (en) * | 1974-12-27 | 1981-08-25 | Smithkline Corporation | 7-Acyl-3-(substituted tetrazolyl thiomethyl)cephalosporins |
| DK586175A (da) * | 1974-12-28 | 1976-06-29 | Asahi Chemical Ind | Cephalosporin-forbindelser |
| US4093723A (en) * | 1976-05-19 | 1978-06-06 | Smithkline Corporation | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl) cephalosporins |
| US4020057A (en) * | 1975-06-18 | 1977-04-26 | Smithkline Corporation | 7β-Acyloxy cephalosporins |
| US4075338A (en) * | 1975-12-29 | 1978-02-21 | Smithkline Corporation | Substituted acetamidocephalosporins |
| US4229573A (en) * | 1977-06-21 | 1980-10-21 | Asahi Kasei Kogyo Kabushiki Kaisha | 7α-Methoxycephalosporin derivatives |
| JPS5989870A (ja) * | 1982-11-16 | 1984-05-24 | Ube Ind Ltd | 流量調整弁 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3297692A (en) * | 1961-04-03 | 1967-01-10 | Lilly Co Eli | 7-alkylmercaptoacetamidocephalosporanic acid |
| US3445463A (en) * | 1965-06-17 | 1969-05-20 | Lilly Co Eli | 3-(cyclic acyl)oxymethyl cephalosporins |
| US3776906A (en) * | 1972-03-16 | 1973-12-04 | Bristol Myers Co | 7-(d-(alpha-amino-alpha-phenyl-,2-thienyl-and 3-thienyl-acetamido))-3-thienyl-acetamido))-3-(1,2,5-thiadiazol-3-yl)carbonylthiomethyl-3-cephem-4-carboxylic acids |
| US3865819A (en) * | 1972-05-03 | 1975-02-11 | Smithkline Corp | Substituted sulfonylacetamido cephalosporins |
| US3776907A (en) * | 1972-06-12 | 1973-12-04 | Bristol Myers Co | 7-(d-(alpha-amino-alpha-phenyl-,2-thienyl-and 3-thienyl-acetamido))-3-(1,2,3-thiadiazol-4-or 5-yl)-carbonylthiomethyl-3-cephem-4-carboxylic acids |
| US3828037A (en) * | 1972-07-20 | 1974-08-06 | Smithkline Corp | Trifluoromethylmercaptoacetamidocephalosporins |
-
1973
- 1973-06-18 US US371081A patent/US3880848A/en not_active Expired - Lifetime
-
1974
- 1974-06-12 AU AU70053/74A patent/AU476265B2/en not_active Expired
- 1974-06-12 JP JP49067596A patent/JPS5035189A/ja active Pending
- 1974-06-14 BE BE145483A patent/BE816398A/xx not_active IP Right Cessation
- 1974-06-14 FR FR7420810A patent/FR2233068B1/fr not_active Expired
- 1974-06-17 CA CA202,609A patent/CA1027556A/en not_active Expired
- 1974-06-17 ZA ZA00743837A patent/ZA743837B/xx unknown
- 1974-06-18 GB GB2686574A patent/GB1434174A/en not_active Expired
- 1974-06-18 DE DE2429229A patent/DE2429229A1/de not_active Ceased
Also Published As
| Publication number | Publication date |
|---|---|
| AU7005374A (en) | 1975-12-18 |
| FR2233068A1 (enExample) | 1975-01-10 |
| DE2429229A1 (de) | 1975-01-09 |
| GB1434174A (en) | 1976-05-05 |
| FR2233068B1 (enExample) | 1977-11-10 |
| CA1027556A (en) | 1978-03-07 |
| AU476265B2 (en) | 1976-09-16 |
| ZA743837B (en) | 1975-06-25 |
| JPS5035189A (enExample) | 1975-04-03 |
| US3880848A (en) | 1975-04-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT338352B (de) | Ohrstuck | |
| AT351454B (de) | Verbundstein | |
| AT325093B (de) | Trittbahn | |
| AT359180B (de) | Osteotom | |
| BE811060A (nl) | Kopieertoestel | |
| AT329420B (de) | Monoschi | |
| BE798927A (fr) | Sulfonylacetamido cephalosporines substituees | |
| AT325408B (de) | Stoffloser | |
| BE816398A (fr) | 7-trifluoromethylsulfinylacetamido cephalosporines | |
| BE816238A (fr) | Cephalosporines | |
| BE784181A (fr) | Cephalosporines | |
| BE823651A (fr) | Nouvelles cephalosporines | |
| AT334953B (de) | Schwemmaggregat | |
| BE787635A (fr) | Cephalosporines | |
| BE786271A (fr) | Cephalosporines | |
| AT342382B (de) | Flussmittel | |
| NO139145C (no) | Elektrofotografisk kopieringsanordning | |
| AT354042B (de) | Raffstore | |
| BE819635A (fr) | Perfectionnements relatifs aux cephalosporines | |
| ATA280876A (de) | Fugizid | |
| BE820030A (fr) | Cephalosporines | |
| BE809386A (fr) | Kunststofzak met harmonicavouwen | |
| BE832150A (fr) | Cephalosporines | |
| BE814559A (fr) | Penicillines | |
| BE835238A (fr) | Cephalosporines |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| RE | Patent lapsed |
Owner name: SMITHKLINE CORP. Effective date: 19870630 |