BE816238A - Cephalosporines - Google Patents
CephalosporinesInfo
- Publication number
- BE816238A BE816238A BE145344A BE145344A BE816238A BE 816238 A BE816238 A BE 816238A BE 145344 A BE145344 A BE 145344A BE 145344 A BE145344 A BE 145344A BE 816238 A BE816238 A BE 816238A
- Authority
- BE
- Belgium
- Prior art keywords
- cephalosporins
- Prior art date
Links
- 229930186147 Cephalosporin Natural products 0.000 title 1
- 229940124587 cephalosporin Drugs 0.000 title 1
- HOKIDJSKDBPKTQ-GLXFQSAKSA-N cephalosporin C Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CCC[C@@H](N)C(O)=O)[C@@H]12 HOKIDJSKDBPKTQ-GLXFQSAKSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB27970/73A GB1479711A (en) | 1973-06-12 | 1973-06-12 | Acylureido cephalosporins |
| GB4896873 | 1973-10-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| BE816238A true BE816238A (fr) | 1974-12-12 |
Family
ID=26259100
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| BE145344A BE816238A (fr) | 1973-06-12 | 1974-06-12 | Cephalosporines |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4312982A (show.php) |
| JP (1) | JPS5047990A (show.php) |
| AR (1) | AR219722A1 (show.php) |
| AU (1) | AU475246B2 (show.php) |
| BE (1) | BE816238A (show.php) |
| CH (1) | CH609350A5 (show.php) |
| DD (1) | DD111581A5 (show.php) |
| DE (1) | DE2428139A1 (show.php) |
| DK (1) | DK311874A (show.php) |
| GB (1) | GB1479711A (show.php) |
| IE (1) | IE39294B1 (show.php) |
| IL (2) | IL44959A (show.php) |
| MW (1) | MW2474A1 (show.php) |
| NL (1) | NL7407815A (show.php) |
| SE (2) | SE7407713L (show.php) |
| ZM (1) | ZM8574A1 (show.php) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4224442A (en) * | 1975-03-03 | 1980-09-23 | Eli Lilly And Company | 7-Ureido acetamido substituted cephalosporin antibiotics |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4071683A (en) * | 1973-10-30 | 1978-01-31 | Bayer Aktiengesellschaft | Oxoimidazolidinylthiocarbonyl derivatives of ceph-3-em-4-carboxylic acids |
| US4107304A (en) | 1974-02-18 | 1978-08-15 | Bayer Aktiengesellschaft | Oxo-imidazolidine substituted cephalosporins and antibacterial compositions and methods of combatting bacteria employing them |
| US4086340A (en) | 1974-02-18 | 1978-04-25 | Bayer Aktiengesellschaft | Cephalosporins and their production |
| US4061630A (en) * | 1976-02-20 | 1977-12-06 | Eli Lilly And Company | 7-Substituted-ureido-3-carbamoyloxymethyl cephalosporin antibiotics |
| US4061861A (en) * | 1976-06-21 | 1977-12-06 | Eli Lilly And Company | 7-[α-(2,3-DIHYDRO-2-OXO-1H-benzimidazol-1-ylcarbonyl-amino)arylacetamido]cephalosporins |
| FR2362146A1 (fr) * | 1976-08-17 | 1978-03-17 | Fujisawa Pharmaceutical Co | Procede de preparation de composes d'acide 7-(n-substitue-2-phenylglycinamido)-3-substitue-3-cephem-4-carboxylique et nouveaux produits ainsi obtenus, a activite antibacterienne |
| JPS5346996A (en) * | 1976-10-13 | 1978-04-27 | Sangyo Kagaku Kenkyu Kyokai | Antifungal compound |
| DK225179A (da) | 1978-06-22 | 1979-12-23 | Chugai Pharmaceutical Co Ltd | Fremgangsmaade til fremstilling af cephalosporinderivater |
| US4217348A (en) | 1978-09-28 | 1980-08-12 | E. R. Squibb & Sons, Inc. | Cephalosporins having an oxazolidonyloxamido substituted acyl sidechain |
| US4436903A (en) * | 1980-12-22 | 1984-03-13 | Ciba-Geigy Corporation | Process for the production of 7 β-substituted-3-unsubstituted-3-cephem-4-carboxylic acid compounds |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3687949A (en) * | 1969-01-21 | 1972-08-29 | Bristol Myers Co | Synthetic cephalosporins |
| US3673183A (en) * | 1969-11-17 | 1972-06-27 | Squibb & Sons Inc | {60 -ureidocephalosporanic acid compounds |
| US3741962A (en) * | 1971-05-21 | 1973-06-26 | Squibb & Sons Inc | Alpha-thioureidocephalosporanic acid compounds |
| CH570407A5 (show.php) * | 1972-03-29 | 1975-12-15 | Ciba Geigy Ag | |
| US4107304A (en) * | 1974-02-18 | 1978-08-15 | Bayer Aktiengesellschaft | Oxo-imidazolidine substituted cephalosporins and antibacterial compositions and methods of combatting bacteria employing them |
| US4086340A (en) * | 1974-02-18 | 1978-04-25 | Bayer Aktiengesellschaft | Cephalosporins and their production |
| US3925368A (en) * | 1974-04-01 | 1975-12-09 | Lilly Co Eli | Acylureido substituted cephalosporins |
| US3956292A (en) * | 1974-04-01 | 1976-05-11 | Eli Lilly And Company | 7-(α-FUROYLUREIDOARYL AND CYCLOHEXADIENYLACETAMIDO) CEPHALOSPORIN ANTIBIOTICS |
| US4224442A (en) * | 1975-03-03 | 1980-09-23 | Eli Lilly And Company | 7-Ureido acetamido substituted cephalosporin antibiotics |
| US4061630A (en) * | 1976-02-20 | 1977-12-06 | Eli Lilly And Company | 7-Substituted-ureido-3-carbamoyloxymethyl cephalosporin antibiotics |
-
1973
- 1973-06-12 GB GB27970/73A patent/GB1479711A/en not_active Expired
-
1974
- 1974-05-29 IE IE1132/74A patent/IE39294B1/xx unknown
- 1974-06-03 IL IL44959A patent/IL44959A/xx unknown
- 1974-06-05 ZM ZM85/74A patent/ZM8574A1/xx unknown
- 1974-06-06 AU AU69843/74A patent/AU475246B2/en not_active Expired
- 1974-06-10 MW MW24/74*UA patent/MW2474A1/xx unknown
- 1974-06-11 DK DK311874A patent/DK311874A/da unknown
- 1974-06-11 DD DD179086A patent/DD111581A5/xx unknown
- 1974-06-11 SE SE7407713A patent/SE7407713L/xx unknown
- 1974-06-11 JP JP49066446A patent/JPS5047990A/ja active Pending
- 1974-06-11 DE DE19742428139 patent/DE2428139A1/de active Pending
- 1974-06-12 NL NL7407815A patent/NL7407815A/xx not_active Application Discontinuation
- 1974-06-12 CH CH806474A patent/CH609350A5/xx not_active IP Right Cessation
- 1974-06-12 BE BE145344A patent/BE816238A/xx unknown
-
1976
- 1976-05-06 US US05/683,792 patent/US4312982A/en not_active Expired - Lifetime
-
1977
- 1977-05-24 SE SE7706081A patent/SE7706081L/ not_active Application Discontinuation
- 1977-08-11 IL IL52704A patent/IL52704A0/xx unknown
- 1977-11-07 AR AR269874A patent/AR219722A1/es active
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4224442A (en) * | 1975-03-03 | 1980-09-23 | Eli Lilly And Company | 7-Ureido acetamido substituted cephalosporin antibiotics |
Also Published As
| Publication number | Publication date |
|---|---|
| IE39294L (en) | 1974-12-12 |
| IL52704A0 (en) | 1977-10-31 |
| CH609350A5 (show.php) | 1979-02-28 |
| JPS5047990A (show.php) | 1975-04-28 |
| AR219722A1 (es) | 1980-09-15 |
| SE7706081L (sv) | 1977-05-24 |
| IL44959A (en) | 1978-07-31 |
| US4312982A (en) | 1982-01-26 |
| DD111581A5 (show.php) | 1975-02-20 |
| GB1479711A (en) | 1977-07-13 |
| NL7407815A (show.php) | 1974-12-16 |
| IL44959A0 (en) | 1974-09-10 |
| MW2474A1 (en) | 1975-08-13 |
| DK311874A (show.php) | 1975-02-17 |
| SE7407713L (show.php) | 1974-12-13 |
| AU475246B2 (en) | 1976-08-19 |
| AU6984374A (en) | 1975-12-11 |
| IE39294B1 (en) | 1978-09-13 |
| ZM8574A1 (en) | 1976-08-23 |
| DE2428139A1 (de) | 1975-01-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT338352B (de) | Ohrstuck | |
| AT351454B (de) | Verbundstein | |
| AT325093B (de) | Trittbahn | |
| AT359180B (de) | Osteotom | |
| BE822623A (fr) | Hogedruk-tinhalogenide-ontladingslamp | |
| BE811060A (nl) | Kopieertoestel | |
| ATA446774A (de) | Monoschi | |
| BE798927A (fr) | Sulfonylacetamido cephalosporines substituees | |
| AT325408B (de) | Stoffloser | |
| BE816184R (fr) | Azapurinones | |
| BE816398A (fr) | 7-trifluoromethylsulfinylacetamido cephalosporines | |
| BE816238A (fr) | Cephalosporines | |
| BE784181A (fr) | Cephalosporines | |
| BE823651A (fr) | Nouvelles cephalosporines | |
| AT334953B (de) | Schwemmaggregat | |
| HU173865B (hu) | Datchik raznicy davlenija | |
| BE787635A (fr) | Cephalosporines | |
| BE786271A (fr) | Cephalosporines | |
| AT342382B (de) | Flussmittel | |
| SE389204B (sv) | Elektrofotografisk kopieringsanordning | |
| AT354042B (de) | Raffstore | |
| BE819635A (fr) | Perfectionnements relatifs aux cephalosporines | |
| ATA280876A (de) | Fugizid | |
| SE399929B (sv) | Vattenlas | |
| BE820030A (fr) | Cephalosporines |