AU7571774A - Disubstituted xanthone carboxylic acid derivatives - Google Patents
Disubstituted xanthone carboxylic acid derivativesInfo
- Publication number
- AU7571774A AU7571774A AU75717/74A AU7571774A AU7571774A AU 7571774 A AU7571774 A AU 7571774A AU 75717/74 A AU75717/74 A AU 75717/74A AU 7571774 A AU7571774 A AU 7571774A AU 7571774 A AU7571774 A AU 7571774A
- Authority
- AU
- Australia
- Prior art keywords
- carboxylic acid
- acid derivatives
- xanthone carboxylic
- disubstituted
- disubstituted xanthone
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- WNKRYYFWYMHTGV-UHFFFAOYSA-N 9-oxoxanthene-1-carboxylic acid Chemical class O1C2=CC=CC=C2C(=O)C2=C1C=CC=C2C(=O)O WNKRYYFWYMHTGV-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/80—Dibenzopyrans; Hydrogenated dibenzopyrans
- C07D311/82—Xanthenes
- C07D311/84—Xanthenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 9
- C07D311/86—Oxygen atoms, e.g. xanthones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05431794 US3894049A (en) | 1972-06-05 | 1974-01-08 | Disubstituted xanthone carboxylic acid compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AU7571774A true AU7571774A (en) | 1976-05-27 |
Family
ID=23713448
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU75717/74A Expired AU7571774A (en) | 1974-01-08 | 1974-11-25 | Disubstituted xanthone carboxylic acid derivatives |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS50126667A (enExample) |
| AT (1) | AT339297B (enExample) |
| AU (1) | AU7571774A (enExample) |
| BE (1) | BE823030R (enExample) |
| DE (1) | DE2461059A1 (enExample) |
| DK (1) | DK645674A (enExample) |
| ES (1) | ES433626A2 (enExample) |
| FI (1) | FI334874A7 (enExample) |
| FR (1) | FR2256755B2 (enExample) |
| GB (2) | GB1464562A (enExample) |
| NL (1) | NL7500218A (enExample) |
| NO (1) | NO744506L (enExample) |
| SE (1) | SE7415844L (enExample) |
| ZA (1) | ZA747671B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2136227A (en) * | 1983-03-07 | 1984-09-12 | Nat Res Dev | Direct Current Circuit Breakers |
-
1974
- 1974-11-20 FI FI3348/74A patent/FI334874A7/fi unknown
- 1974-11-25 AU AU75717/74A patent/AU7571774A/en not_active Expired
- 1974-12-02 ZA ZA00747671A patent/ZA747671B/xx unknown
- 1974-12-06 BE BE151224A patent/BE823030R/xx active
- 1974-12-11 DK DK645674A patent/DK645674A/da unknown
- 1974-12-13 NO NO744506A patent/NO744506L/no unknown
- 1974-12-17 SE SE7415844A patent/SE7415844L/xx unknown
- 1974-12-23 DE DE19742461059 patent/DE2461059A1/de active Pending
- 1974-12-24 GB GB4009076A patent/GB1464562A/en not_active Expired
- 1974-12-24 GB GB1296674A patent/GB1464561A/en not_active Expired
- 1974-12-24 JP JP50001055A patent/JPS50126667A/ja active Pending
-
1975
- 1975-01-07 ES ES433626A patent/ES433626A2/es not_active Expired
- 1975-01-07 FR FR7500380A patent/FR2256755B2/fr not_active Expired
- 1975-01-08 NL NL7500218A patent/NL7500218A/xx unknown
- 1975-01-08 AT AT9475A patent/AT339297B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2256755A2 (enExample) | 1975-08-01 |
| DK645674A (enExample) | 1975-09-01 |
| NL7500218A (nl) | 1975-07-10 |
| AT339297B (de) | 1977-10-10 |
| GB1464561A (en) | 1977-02-16 |
| ATA9475A (de) | 1977-02-15 |
| JPS50126667A (enExample) | 1975-10-04 |
| BE823030R (fr) | 1975-06-06 |
| NO744506L (enExample) | 1975-08-04 |
| FR2256755B2 (enExample) | 1978-06-30 |
| FI334874A7 (enExample) | 1975-07-09 |
| GB1464562A (en) | 1977-02-16 |
| ZA747671B (en) | 1976-07-28 |
| SE7415844L (enExample) | 1975-07-09 |
| ES433626A2 (es) | 1977-07-01 |
| DE2461059A1 (de) | 1975-07-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1536283A (en) | Alpha-protected oxyimino-beta-oxo-ypsilon-halogeno-butyric acid derivatives | |
| GB1516656A (en) | 3-sulphonyloxy-cephem-4-carboxylic acid derivatives | |
| GB1536282A (en) | Thiazolylacetic acid derivatives | |
| GB1484395A (en) | Substituted phenoxy-thiobenzoic acid esters | |
| ZA757290B (en) | Furanhydroxamic acid derivatives | |
| ZA724756B (en) | Novel disubstituted xanthone carboxylic acid compounds | |
| GB1518524A (en) | Thiazolidine carboxylic acid derivatives | |
| GB1539180A (en) | 1-cyclopentene-1-propanoic acid derivatives | |
| AU7903975A (en) | Indolylacetyl-amino acid derivatives | |
| IL56863A0 (en) | 7-cyclopentyl-heptanoic acid derivatives | |
| ZA724754B (en) | Novel substituted xanthone carboxylic acid compounds | |
| ZA724757B (en) | Novel disubstituted xanthone carboxylic acid compounds | |
| AU7571774A (en) | Disubstituted xanthone carboxylic acid derivatives | |
| MY7800453A (en) | 2-chloroethananephosphonic acid derivatives | |
| AU8692375A (en) | Prostenoic acid derivatives | |
| HK30876A (en) | Novel substituted xanthone carboxylic acid compounds | |
| CA1014167A (en) | Disubstituted xanthone carboxylic acid compounds | |
| AU478775B2 (en) | Novel substituted xanthone carboxylic acid compounds | |
| GB1535217A (en) | 20-alkoxy-16-alkyl-prostadienoic acid derivatives | |
| JPS51138693A (en) | Isoklabaranic acid derivative | |
| GB1523278A (en) | Penicillanic acid derivatives | |
| ZA724758B (en) | Novel disubstituted xanthone carboxylic acid compounds | |
| CA1017345A (en) | Disubstituted xanthone carboxylic acid compounds | |
| AU489177B2 (en) | Benzalicyolic carboxylic acid derivatives | |
| AU7201574A (en) | Benzalicyolic carboxylic acid derivatives |