AU608858B2 - Process for preparing monohalogenated cyclobutarenes - Google Patents
Process for preparing monohalogenated cyclobutarenes Download PDFInfo
- Publication number
- AU608858B2 AU608858B2 AU18206/88A AU1820688A AU608858B2 AU 608858 B2 AU608858 B2 AU 608858B2 AU 18206/88 A AU18206/88 A AU 18206/88A AU 1820688 A AU1820688 A AU 1820688A AU 608858 B2 AU608858 B2 AU 608858B2
- Authority
- AU
- Australia
- Prior art keywords
- cyclobutarene
- agent
- group
- less
- organic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 238000004519 manufacturing process Methods 0.000 title description 6
- 239000008139 complexing agent Substances 0.000 claims abstract description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 23
- 239000002516 radical scavenger Substances 0.000 claims abstract description 15
- 239000002253 acid Substances 0.000 claims abstract description 8
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 36
- 239000003795 chemical substances by application Substances 0.000 claims description 34
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 30
- 238000000034 method Methods 0.000 claims description 29
- 230000002140 halogenating effect Effects 0.000 claims description 24
- 239000003085 diluting agent Substances 0.000 claims description 19
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 16
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 15
- -1 saturated aliphatic alcohols Chemical class 0.000 claims description 14
- 238000005658 halogenation reaction Methods 0.000 claims description 13
- 239000000203 mixture Substances 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 230000026030 halogenation Effects 0.000 claims description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 150000001340 alkali metals Chemical class 0.000 claims description 6
- 229910052784 alkaline earth metal Chemical class 0.000 claims description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 claims description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 5
- 229920006395 saturated elastomer Polymers 0.000 claims description 5
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical group BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 claims description 4
- JPOXNPPZZKNXOV-UHFFFAOYSA-N bromochloromethane Chemical compound ClCBr JPOXNPPZZKNXOV-UHFFFAOYSA-N 0.000 claims description 4
- 150000002009 diols Chemical class 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 4
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 claims description 3
- CODNYICXDISAEA-UHFFFAOYSA-N bromine monochloride Chemical compound BrCl CODNYICXDISAEA-UHFFFAOYSA-N 0.000 claims description 3
- 239000012320 chlorinating reagent Substances 0.000 claims description 3
- 150000002391 heterocyclic compounds Chemical class 0.000 claims description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 150000003512 tertiary amines Chemical class 0.000 claims description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 239000002585 base Substances 0.000 claims description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 2
- 150000004292 cyclic ethers Chemical class 0.000 claims description 2
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 150000007524 organic acids Chemical group 0.000 claims description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims 2
- 125000004429 atom Chemical group 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 150000002118 epoxides Chemical class 0.000 claims 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 claims 1
- 125000001453 quaternary ammonium group Chemical group 0.000 claims 1
- 150000003335 secondary amines Chemical class 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 33
- 239000003054 catalyst Substances 0.000 abstract description 12
- 229910052736 halogen Inorganic materials 0.000 abstract description 9
- 150000002367 halogens Chemical class 0.000 abstract description 8
- 229910001385 heavy metal Inorganic materials 0.000 abstract description 3
- UMIVXZPTRXBADB-UHFFFAOYSA-N benzocyclobutene Chemical class C1=CC=C2CCC2=C1 UMIVXZPTRXBADB-UHFFFAOYSA-N 0.000 description 24
- 239000012433 hydrogen halide Substances 0.000 description 21
- 229910000039 hydrogen halide Inorganic materials 0.000 description 21
- 239000011541 reaction mixture Substances 0.000 description 18
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 11
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 10
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 10
- 229910052794 bromium Inorganic materials 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 9
- 239000007789 gas Substances 0.000 description 8
- 125000003118 aryl group Chemical group 0.000 description 7
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 6
- 150000002894 organic compounds Chemical class 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 6
- 229940001584 sodium metabisulfite Drugs 0.000 description 6
- 235000010262 sodium metabisulphite Nutrition 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 239000006227 byproduct Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 4
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 4
- RUGOFYNHMCFJFD-UHFFFAOYSA-N 1-bromo-2-(2-bromoethyl)benzene Chemical compound BrCCC1=CC=CC=C1Br RUGOFYNHMCFJFD-UHFFFAOYSA-N 0.000 description 3
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 150000002924 oxiranes Chemical class 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- FUFVKLQESJNNAN-ZZJGABIISA-M [(1r,5s)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octan-3-yl] 2-hydroxy-2-phenylacetate;bromide Chemical group [Br-].C([C@H]1CC[C@@H](C2)[N+]1(C)C)C2OC(=O)C(O)C1=CC=CC=C1 FUFVKLQESJNNAN-ZZJGABIISA-M 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 238000005893 bromination reaction Methods 0.000 description 2
- 230000000536 complexating effect Effects 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical compound C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- DTLTUUJDCNTTSN-UHFFFAOYSA-N 1,4-dioxane;molecular bromine Chemical compound BrBr.C1COCCO1 DTLTUUJDCNTTSN-UHFFFAOYSA-N 0.000 description 1
- VQRBXYBBGHOGFT-UHFFFAOYSA-N 1-(chloromethyl)-2-methylbenzene Chemical compound CC1=CC=CC=C1CCl VQRBXYBBGHOGFT-UHFFFAOYSA-N 0.000 description 1
- XQQZRZQVBFHBHL-UHFFFAOYSA-N 12-crown-4 Chemical compound C1COCCOCCOCCO1 XQQZRZQVBFHBHL-UHFFFAOYSA-N 0.000 description 1
- WAEVWDZKMBQDEJ-UHFFFAOYSA-N 2-[2-(2-methoxypropoxy)propoxy]propan-1-ol Chemical compound COC(C)COC(C)COC(C)CO WAEVWDZKMBQDEJ-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical group CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- CBQYNPHHHJTCJS-UHFFFAOYSA-N Alline Chemical group C1=CC=C2C3(O)CCN(C)C3NC2=C1 CBQYNPHHHJTCJS-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- NBLMCHLTMPJVPC-UHFFFAOYSA-N ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.Cl Chemical compound ClCCl.ClCCl.ClCCl.ClCCl.ClCCl.Cl NBLMCHLTMPJVPC-UHFFFAOYSA-N 0.000 description 1
- RLVSPLXEYHNHNE-UHFFFAOYSA-N ClN1C(CCC1=O)=O.[Cl] Chemical compound ClN1C(CCC1=O)=O.[Cl] RLVSPLXEYHNHNE-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- QZRGKCOWNLSUDK-UHFFFAOYSA-N Iodochlorine Chemical compound ICl QZRGKCOWNLSUDK-UHFFFAOYSA-N 0.000 description 1
- WYGOIVMQIZOBKT-UHFFFAOYSA-N OC.CCCCCC=CC(C)=O Chemical compound OC.CCCCCC=CC(C)=O WYGOIVMQIZOBKT-UHFFFAOYSA-N 0.000 description 1
- 241000577218 Phenes Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- ZDZHCHYQNPQSGG-UHFFFAOYSA-N binaphthyl group Chemical group C1(=CC=CC2=CC=CC=C12)C1=CC=CC2=CC=CC=C12 ZDZHCHYQNPQSGG-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- WBZKQQHYRPRKNJ-UHFFFAOYSA-L disulfite Chemical compound [O-]S(=O)S([O-])(=O)=O WBZKQQHYRPRKNJ-UHFFFAOYSA-L 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000004434 industrial solvent Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000012336 iodinating agent Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229940035429 isobutyl alcohol Drugs 0.000 description 1
- BRMYZIKAHFEUFJ-UHFFFAOYSA-L mercury diacetate Chemical compound CC(=O)O[Hg]OC(C)=O BRMYZIKAHFEUFJ-UHFFFAOYSA-L 0.000 description 1
- MFWJWOJHEWMCAB-UHFFFAOYSA-N methanol Chemical compound OC.OC.OC.OC.OC.OC.OC MFWJWOJHEWMCAB-UHFFFAOYSA-N 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000003134 recirculating effect Effects 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 150000005621 tetraalkylammonium salts Chemical class 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C25/00—Compounds containing at least one halogen atom bound to a six-membered aromatic ring
- C07C25/18—Polycyclic aromatic halogenated hydrocarbons
- C07C25/22—Polycyclic aromatic halogenated hydrocarbons with condensed rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
- C07C17/10—Preparation of halogenated hydrocarbons by replacement by halogens of hydrogen atoms
- C07C17/12—Preparation of halogenated hydrocarbons by replacement by halogens of hydrogen atoms in the ring of aromatic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/064,714 US4822930A (en) | 1987-06-22 | 1987-06-22 | Process for preparing monobrominated cyclobutarenes |
| US064714 | 1987-06-22 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU1820688A AU1820688A (en) | 1988-12-22 |
| AU608858B2 true AU608858B2 (en) | 1991-04-18 |
Family
ID=22057807
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU18206/88A Ceased AU608858B2 (en) | 1987-06-22 | 1988-06-22 | Process for preparing monohalogenated cyclobutarenes |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4822930A (enExample) |
| EP (1) | EP0296517B1 (enExample) |
| JP (1) | JPS6463535A (enExample) |
| KR (1) | KR910005226B1 (enExample) |
| AT (1) | ATE92021T1 (enExample) |
| AU (1) | AU608858B2 (enExample) |
| CA (1) | CA1305495C (enExample) |
| DE (1) | DE3882606T2 (enExample) |
| DK (1) | DK339488A (enExample) |
| IL (1) | IL86815A (enExample) |
| MY (1) | MY103585A (enExample) |
| NO (1) | NO167654C (enExample) |
| NZ (1) | NZ225069A (enExample) |
| ZA (1) | ZA884452B (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4898999A (en) * | 1988-06-03 | 1990-02-06 | Shell Oil Company | Process for halogenating cyclobutenoarenes |
| US4994548A (en) * | 1989-05-09 | 1991-02-19 | Shell Oil Company | Modified bisphenol resins having at least one arylcyclo-butanenealkyl moiety |
| US4960956A (en) * | 1989-05-09 | 1990-10-02 | Shell Oil Company | Modified bisphenols having at least one arylcyclobutenealkyl moiety and cured products therefrom |
| US4940807A (en) * | 1989-06-12 | 1990-07-10 | Ethyl Corporation | Selective bromination of aromatic compounds using potassium tribromide |
| US5232970A (en) * | 1990-08-31 | 1993-08-03 | The Dow Chemical Company | Ceramic-filled thermally-conductive-composites containing fusible semi-crystalline polyamide and/or polybenzocyclobutenes for use in microelectronic applications |
| US5138081A (en) * | 1991-04-30 | 1992-08-11 | The Dow Chemical Company | Process for purifying vinylically-unsaturated organosilicon compounds |
| US5264646A (en) * | 1991-03-28 | 1993-11-23 | The Dow Chemical Company | Process for preparing vinylically-unsaturated compounds |
| US5136069A (en) * | 1991-03-28 | 1992-08-04 | The Dow Chemical Company | Process for preparing vinylically-unsaturated compounds (II) |
| US5227536A (en) * | 1991-09-20 | 1993-07-13 | The Dow Chemical Company | Process for preparing hydroxybenzocyclobutenes |
| US5274135A (en) * | 1991-09-20 | 1993-12-28 | The Dow Chemical Company | Process for preparing aminobenzocyclobutenes |
| US5391650A (en) * | 1992-12-30 | 1995-02-21 | The Dow Chemical Company | Bisbenzocyclobutene thermosetting compounds and process for preparing the same |
| US5416233A (en) * | 1994-01-25 | 1995-05-16 | The Dow Chemical Company | Preparation of vinylsilane-benzocyclobutenes |
| US5491250A (en) * | 1995-03-23 | 1996-02-13 | The Dow Chemical Company | Process for purifying vinylically unsaturated compounds prepared using a palladium-complex catalyst |
| US5567835A (en) * | 1995-10-27 | 1996-10-22 | The Dow Chemical Company | Preparation of a vinylsiloxane-benzocylobutene from a hydrolyzable vinylsilane-benzocylobutene |
| US7019093B2 (en) * | 2002-10-18 | 2006-03-28 | Dow Global Technologies Inc. | Aqueous developable, photosensitive benzocyclobutene-based oligomers and polymers with high moisture resistance |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4540763A (en) * | 1984-09-14 | 1985-09-10 | The Dow Chemical Company | Polymers derived from poly(arylcyclobutenes) |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3420035A (en) * | 1966-06-08 | 1969-01-07 | Kleer Vu Ind Inc | Packaging machine |
| US3755444A (en) * | 1969-04-24 | 1973-08-28 | Dow Chemical Co | Bromination of organic compounds with a bromine chloride dioxane complex |
| US3607883A (en) * | 1969-04-24 | 1971-09-21 | Dow Chemical Co | Bromine chloride-dioxane complex |
| US3763248A (en) * | 1971-03-02 | 1973-10-02 | Ethyl Corp | Process for production of poly brominated aromatics |
| US3890326A (en) * | 1973-12-13 | 1975-06-17 | Olin Corp | Bromination with trifluoromethylbromide |
| US4661193A (en) * | 1984-08-27 | 1987-04-28 | The Dow Chemical Company | Adhesive compositions for arylcyclobutene monomeric compositions |
-
1987
- 1987-06-22 US US07/064,714 patent/US4822930A/en not_active Expired - Lifetime
-
1988
- 1988-06-16 CA CA000569622A patent/CA1305495C/en not_active Expired - Fee Related
- 1988-06-17 NZ NZ225069A patent/NZ225069A/en unknown
- 1988-06-18 DE DE88109765T patent/DE3882606T2/de not_active Expired - Lifetime
- 1988-06-18 EP EP88109765A patent/EP0296517B1/en not_active Expired - Lifetime
- 1988-06-18 AT AT88109765T patent/ATE92021T1/de not_active IP Right Cessation
- 1988-06-21 NO NO882733A patent/NO167654C/no unknown
- 1988-06-21 KR KR1019880007447A patent/KR910005226B1/ko not_active Expired
- 1988-06-21 IL IL8681588A patent/IL86815A/en not_active IP Right Cessation
- 1988-06-21 MY MYPI88000683A patent/MY103585A/en unknown
- 1988-06-21 JP JP63151330A patent/JPS6463535A/ja active Granted
- 1988-06-21 DK DK339488A patent/DK339488A/da not_active Application Discontinuation
- 1988-06-22 ZA ZA884452A patent/ZA884452B/xx unknown
- 1988-06-22 AU AU18206/88A patent/AU608858B2/en not_active Ceased
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4540763A (en) * | 1984-09-14 | 1985-09-10 | The Dow Chemical Company | Polymers derived from poly(arylcyclobutenes) |
Also Published As
| Publication number | Publication date |
|---|---|
| ATE92021T1 (de) | 1993-08-15 |
| JPH0354929B2 (enExample) | 1991-08-21 |
| IL86815A0 (en) | 1988-11-30 |
| IL86815A (en) | 1994-10-21 |
| KR910005226B1 (ko) | 1991-07-24 |
| NZ225069A (en) | 1991-04-26 |
| NO882733L (no) | 1988-12-23 |
| EP0296517A2 (en) | 1988-12-28 |
| DE3882606D1 (de) | 1993-09-02 |
| KR890000387A (ko) | 1989-03-14 |
| EP0296517B1 (en) | 1993-07-28 |
| JPS6463535A (en) | 1989-03-09 |
| NO882733D0 (no) | 1988-06-21 |
| ZA884452B (en) | 1990-02-28 |
| AU1820688A (en) | 1988-12-22 |
| NO167654B (no) | 1991-08-19 |
| NO167654C (no) | 1991-11-27 |
| DK339488A (da) | 1988-12-23 |
| DK339488D0 (da) | 1988-06-21 |
| MY103585A (en) | 1993-08-28 |
| US4822930A (en) | 1989-04-18 |
| CA1305495C (en) | 1992-07-21 |
| EP0296517A3 (en) | 1989-10-18 |
| DE3882606T2 (de) | 1993-12-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU608858B2 (en) | Process for preparing monohalogenated cyclobutarenes | |
| JP2587621B2 (ja) | ハロゲン化(2,2)−パラシクロフアンの製造方法とその結果得られるハロゲン化(2,2)−パラシクロフアンの混合物 | |
| US3795710A (en) | Process for preparing fluoro-halogenated propane derivatives and use thereof | |
| KR20010033884A (ko) | 1,4-비스-(클로로디플루오로메틸)벤젠의 제조 방법 | |
| US4891455A (en) | Process for preparing monohalogenated cyclobutarenes | |
| US5041687A (en) | Bromination process | |
| Coe et al. | Polyfluoro-1, 2-epoxy-alkanes and-cycloalkanes. Part III. Some 1, 2-epoxides derived from oligomers of tetrafluoroethylene | |
| US3637875A (en) | Process for obtaining tetrachloroethanes | |
| US3365505A (en) | Novel halogenated compounds and methods for the preparation thereof | |
| US2774783A (en) | 1, 1-dicyano ethylenes and ethanes containing halogen substituents | |
| US2648702A (en) | 2,2,3,3-tetrahalo-1,4-butanedioldibenzoates | |
| US2276203A (en) | Condensation of allyl halides and substituted allyl halides | |
| US3444196A (en) | Methods of manufacturing 2,6-dichlorobenzamide | |
| CA1133939A (en) | Process for the manufacture of p-tert. butylbenzaldehyde and its derivatives halogen-substituted at the nucleus | |
| US5107044A (en) | Process for bromination of biphenyl with brcl | |
| EP0063384B1 (en) | Process for the nuclear chlorination of toluene | |
| CA1093585A (en) | Thermal process for preparing 3-phenoxybenzyl bromide | |
| US3801645A (en) | Chlorination of lower aliphatic aldehydes | |
| US4377713A (en) | Chemical process for preparing 3-phenoxybenzyl chloride | |
| US3021375A (en) | Process for the preparation of 2, 4-bis-(chloromethyl)-toluene | |
| US3248433A (en) | Process for mono-halogenating and mono-nitrating the diels-alder diadduct of hexachlorocyclopentadiene and naphthalene | |
| Prins | Syntheses of polychloro‐compounds with aluminium chloride V. The condensation of hexachloropropene with trichloroethene | |
| US3704307A (en) | Process for the preparation of 3-chloro-4-methoxy-phenylisocyanate | |
| US4368340A (en) | Process for producing 1,3,5-trichlorobenzene | |
| JPH0249293B2 (enExample) |