AU5616173A - 3-formylrifamycin azines - Google Patents
3-formylrifamycin azinesInfo
- Publication number
- AU5616173A AU5616173A AU56161/73A AU5616173A AU5616173A AU 5616173 A AU5616173 A AU 5616173A AU 56161/73 A AU56161/73 A AU 56161/73A AU 5616173 A AU5616173 A AU 5616173A AU 5616173 A AU5616173 A AU 5616173A
- Authority
- AU
- Australia
- Prior art keywords
- formylrifamycin
- azines
- formylrifamycin azines
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- BBNQHOMJRFAQBN-UPZFVJMDSA-N 3-formylrifamycin sv Chemical compound OC1=C(C(O)=C2C)C3=C(O)C(C=O)=C1NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)\C=C\O[C@@]1(C)OC2=C3C1=O BBNQHOMJRFAQBN-UPZFVJMDSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/22—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains four or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D498/08—Bridged systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D498/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D498/12—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and oxygen atoms as the only ring hetero atoms in which the condensed system contains three hetero rings
- C07D498/18—Bridged systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT2507572 | 1972-05-31 | ||
| ITIT25075/72 | 1972-05-31 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU5616173A true AU5616173A (en) | 1974-11-28 |
| AU478264B2 AU478264B2 (en) | 1974-11-28 |
Family
ID=
Also Published As
| Publication number | Publication date |
|---|---|
| HU167317B (en) | 1975-09-27 |
| CA992961A (en) | 1976-07-13 |
| CH573433A5 (en) | 1976-03-15 |
| IE37481B1 (en) | 1977-08-03 |
| LU67695A1 (en) | 1973-08-02 |
| IL41926A (en) | 1976-04-30 |
| SU514572A3 (en) | 1976-05-15 |
| SE386444B (en) | 1976-08-09 |
| JPS516679B2 (en) | 1976-03-01 |
| JPS4942698A (en) | 1974-04-22 |
| ES414894A1 (en) | 1976-02-01 |
| IE37481L (en) | 1973-11-30 |
| ZA732293B (en) | 1974-02-27 |
| PL87112B1 (en) | 1976-06-30 |
| AR198715A1 (en) | 1974-07-15 |
| IL41926A0 (en) | 1973-06-29 |
| FR2186231B1 (en) | 1976-03-05 |
| NL154510B (en) | 1977-09-15 |
| DD107285A5 (en) | 1974-07-20 |
| DE2326698A1 (en) | 1973-12-13 |
| BE800276A (en) | 1973-09-17 |
| FR2186231A1 (en) | 1974-01-11 |
| GB1392272A (en) | 1975-04-30 |
| NL7307319A (en) | 1973-12-04 |
| AT323885B (en) | 1975-08-11 |
| AR198663A1 (en) | 1974-07-15 |
| RO65182A (en) | 1981-05-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU462348B2 (en) | Saf-t-jet | |
| AU467469B2 (en) | Trifluoromethylmercaptoacetamindocephalosphorins | |
| AU454372B2 (en) | Childsafe actuator-overcap | |
| AU469305B2 (en) | Deipenylyl-alkanoylaminopyridine | |
| AU475339B2 (en) | S-substituted-2-thiodenosines | |
| AU475748B2 (en) | Napnthopyrans | |
| AU470359B2 (en) | Sulphamoylphenyl-imidazolidinones | |
| AU468159B2 (en) | 5-aroyl-furans | |
| AU466344B2 (en) | Cycloalkyllactamimides | |
| AU471369B2 (en) | Diphenylmethoxyethylamines | |
| CA992961A (en) | 3-formylrifamycin azines | |
| AU468599B2 (en) | 15-oxasteroids | |
| AU467526B2 (en) | Pyronorifamycins | |
| AU468236B2 (en) | 2-acyl-5-nitrothiazoles | |
| AU473297B2 (en) | Indolylimidoylheterocyclics | |
| AU478264B2 (en) | 3-formylrifamycin azines | |
| AU472554B2 (en) | Isothocyanobenzoxazoles | |
| AU469608B2 (en) | Oxainoquinazolinones | |
| AU479515B2 (en) | Imino-isoindolinones | |
| AU469398B2 (en) | N-benzyl-tetrahydropyridines | |
| AU468979B2 (en) | - amino - q - hydroxyphenylacetamidocephal-osporins | |
| AU473061B2 (en) | 3-aminohydroxypropoxy-2-substituted-4-pyranones | |
| AU451103B2 (en) | 1-alkylidene-3-indenyl echanols | |
| AU474168B2 (en) | Anilinobenzothiazoles | |
| AU465942B2 (en) | Buhner |