AU514612B2 - 2,6-dinitroaniline herbicides - Google Patents
2,6-dinitroaniline herbicidesInfo
- Publication number
- AU514612B2 AU514612B2 AU20840/76A AU2084076A AU514612B2 AU 514612 B2 AU514612 B2 AU 514612B2 AU 20840/76 A AU20840/76 A AU 20840/76A AU 2084076 A AU2084076 A AU 2084076A AU 514612 B2 AU514612 B2 AU 514612B2
- Authority
- AU
- Australia
- Prior art keywords
- dinitroaniline herbicides
- dinitroaniline
- herbicides
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- QFUSCYRJMXLNRB-UHFFFAOYSA-N 2,6-dinitroaniline Chemical compound NC1=C([N+]([O-])=O)C=CC=C1[N+]([O-])=O QFUSCYRJMXLNRB-UHFFFAOYSA-N 0.000 title 1
- 239000004009 herbicide Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/13—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups
- C07C205/19—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by hydroxy groups having nitro groups bound to carbon atoms of six-membered aromatic rings and hydroxy groups bound to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/07—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms
- C07C205/11—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/07—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms
- C07C205/11—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings
- C07C205/12—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by halogen atoms having nitro groups bound to carbon atoms of six-membered aromatic rings the six-membered aromatic ring or a condensed ring system containing that ring being substituted by halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/45—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by at least one doubly—bound oxygen atom, not being part of a —CHO group
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US64322675A | 1975-12-22 | 1975-12-22 | |
| US643226 | 1975-12-22 | ||
| US69608576A | 1976-06-14 | 1976-06-14 | |
| US696085 | 1976-06-14 |
Related Child Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU65872/80A Division AU531431B2 (en) | 1975-12-22 | 1980-12-24 | 2,6-dinitroanilines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU2084076A AU2084076A (en) | 1978-06-29 |
| AU514612B2 true AU514612B2 (en) | 1981-02-19 |
Family
ID=27094213
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU20840/76A Ceased AU514612B2 (en) | 1975-12-22 | 1976-12-22 | 2,6-dinitroaniline herbicides |
| AU65872/80A Ceased AU531431B2 (en) | 1975-12-22 | 1980-12-24 | 2,6-dinitroanilines |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU65872/80A Ceased AU531431B2 (en) | 1975-12-22 | 1980-12-24 | 2,6-dinitroanilines |
Country Status (21)
| Country | Link |
|---|---|
| JP (1) | JPS5278841A (enExample) |
| AT (1) | AT362612B (enExample) |
| AU (2) | AU514612B2 (enExample) |
| BE (1) | BE849681R (enExample) |
| BG (2) | BG27524A3 (enExample) |
| CA (1) | CA1100998A (enExample) |
| CH (1) | CH618076A5 (enExample) |
| DD (3) | DD134516A5 (enExample) |
| DE (1) | DE2657327A1 (enExample) |
| DK (1) | DK574676A (enExample) |
| FI (1) | FI67209C (enExample) |
| GB (1) | GB1573014A (enExample) |
| IE (1) | IE44488B1 (enExample) |
| IL (1) | IL51079A (enExample) |
| IN (1) | IN145613B (enExample) |
| IT (1) | IT1066705B (enExample) |
| KE (1) | KE3135A (enExample) |
| MY (1) | MY8200076A (enExample) |
| OA (1) | OA05519A (enExample) |
| PT (1) | PT66000B (enExample) |
| SE (1) | SE442109B (enExample) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE787939A (fr) * | 1971-08-25 | 1973-02-26 | American Cyanamid Co | 2,6-dinitranilines possedant des proprietes herbicides |
-
1976
- 1976-12-08 IN IN2170/CAL/76A patent/IN145613B/en unknown
- 1976-12-10 IL IL51079A patent/IL51079A/xx unknown
- 1976-12-13 CA CA267,749A patent/CA1100998A/en not_active Expired
- 1976-12-15 GB GB52441/76A patent/GB1573014A/en not_active Expired
- 1976-12-17 DE DE19762657327 patent/DE2657327A1/de not_active Withdrawn
- 1976-12-21 BE BE173489A patent/BE849681R/xx active
- 1976-12-21 OA OA56021A patent/OA05519A/xx unknown
- 1976-12-21 IT IT52719/76A patent/IT1066705B/it active
- 1976-12-21 IE IE2801/76A patent/IE44488B1/en unknown
- 1976-12-21 PT PT66000A patent/PT66000B/pt unknown
- 1976-12-21 CH CH1610676A patent/CH618076A5/de not_active IP Right Cessation
- 1976-12-21 AT AT949076A patent/AT362612B/de not_active IP Right Cessation
- 1976-12-21 SE SE7614384A patent/SE442109B/xx unknown
- 1976-12-21 DK DK574676A patent/DK574676A/da not_active Application Discontinuation
- 1976-12-22 DD DD76203903A patent/DD134516A5/xx unknown
- 1976-12-22 BG BG034978A patent/BG27524A3/xx unknown
- 1976-12-22 FI FI763684A patent/FI67209C/fi not_active IP Right Cessation
- 1976-12-22 BG BG037521A patent/BG28256A4/xx unknown
- 1976-12-22 JP JP51154802A patent/JPS5278841A/ja active Granted
- 1976-12-22 DD DD7600196549A patent/DD130033A6/xx unknown
- 1976-12-22 DD DD76203902A patent/DD134836A5/xx unknown
- 1976-12-22 AU AU20840/76A patent/AU514612B2/en not_active Ceased
-
1980
- 1980-12-24 AU AU65872/80A patent/AU531431B2/en not_active Ceased
-
1981
- 1981-06-05 KE KE3135A patent/KE3135A/xx unknown
-
1982
- 1982-12-30 MY MY76/82A patent/MY8200076A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE849681R (fr) | 1977-06-21 |
| DD134516A5 (de) | 1979-03-07 |
| IL51079A0 (en) | 1977-02-28 |
| FI763684A7 (enExample) | 1977-06-23 |
| DD134836A5 (de) | 1979-03-28 |
| FI67209B (fi) | 1984-10-31 |
| DD130033A6 (de) | 1978-03-01 |
| IL51079A (en) | 1981-11-30 |
| BG28256A4 (bg) | 1980-03-25 |
| CA1100998A (en) | 1981-05-12 |
| ATA949076A (de) | 1980-10-15 |
| CH618076A5 (enExample) | 1980-07-15 |
| GB1573014A (en) | 1980-08-13 |
| DK574676A (da) | 1977-06-23 |
| JPS5278841A (en) | 1977-07-02 |
| DE2657327A1 (de) | 1977-07-07 |
| PT66000B (en) | 1978-06-16 |
| IT1066705B (it) | 1985-03-12 |
| SE442109B (sv) | 1985-12-02 |
| SE7614384L (sv) | 1977-06-23 |
| BG27524A3 (bg) | 1979-11-12 |
| PT66000A (en) | 1977-01-01 |
| FI67209C (fi) | 1985-02-11 |
| MY8200076A (en) | 1982-12-31 |
| IN145613B (enExample) | 1978-11-18 |
| JPS615469B2 (enExample) | 1986-02-18 |
| IE44488B1 (en) | 1981-12-16 |
| AU531431B2 (en) | 1983-08-25 |
| AU2084076A (en) | 1978-06-29 |
| OA05519A (fr) | 1981-04-30 |
| IE44488L (en) | 1977-06-22 |
| AT362612B (de) | 1981-06-10 |
| KE3135A (en) | 1981-07-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU2190677A (en) | Herbicides | |
| AU504595B2 (en) | 4,5-dihydro-2-lower-alkoxycarbonyl-amino-4 phenylimidazoles | |
| AU498333B2 (en) | 7-substituted-benzo-1, 2, 4-triazine-3-ethers | |
| AU507882B2 (en) | 1, 4-diphenyl-3-pyrazolin-5-ones | |
| AU498024B2 (en) | Herbicide | |
| AU499380B2 (en) | Herbicide | |
| AU518594B2 (en) | 15, 15-dihydroxyprostaglandins | |
| AU497412B2 (en) | N-(5-tetrazolyl)-1-oxo-1h-6-alkoxy pryimido(1,2-a)-quinoline-2-carboxamides | |
| AU499442B2 (en) | 1, 4 benzodioxanes | |
| AU507879B2 (en) | Selective herbicide | |
| AU498498B2 (en) | Herbicide | |
| AU514612B2 (en) | 2,6-dinitroaniline herbicides | |
| AU2352777A (en) | Oderised herbicides | |
| AU3146277A (en) | Meta-halostyrene herbicides | |
| AU504239B2 (en) | Nitro-phenyl-carboxylic herbicide | |
| AU500501B2 (en) | 6,11-dihydrodibenzo-thiepin-11-ones | |
| EG11582A (en) | 2,6-dinitroaniline herbicides | |
| ZA767317B (en) | 2,6-dinitroaniline herbicides | |
| AU506542B2 (en) | 1, 3-dialkyl-7-oxoalkylxanthines | |
| AU2816777A (en) | Herbicides | |
| AU516551B2 (en) | Cycloalanapyrazole herbicides | |
| AU6587280A (en) | 2,6-dinitroanilines | |
| PH15311A (en) | 2,6-dinitroaniline herbicides | |
| AU514608B2 (en) | 3,4-substituted-azetidin-z-ones | |
| AU506523B2 (en) | 1, 3-Dialkyl-7-oxoalkylaxanthines |