AU471957B2 - Carbazole derivatives - Google Patents
Carbazole derivativesInfo
- Publication number
- AU471957B2 AU471957B2 AU61882/73A AU6188273A AU471957B2 AU 471957 B2 AU471957 B2 AU 471957B2 AU 61882/73 A AU61882/73 A AU 61882/73A AU 6188273 A AU6188273 A AU 6188273A AU 471957 B2 AU471957 B2 AU 471957B2
- Authority
- AU
- Australia
- Prior art keywords
- carbazole derivatives
- carbazole
- derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000000609 carbazolyl group Chemical class C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/80—[b, c]- or [b, d]-condensed
- C07D209/82—Carbazoles; Hydrogenated carbazoles
- C07D209/86—Carbazoles; Hydrogenated carbazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the ring system
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00317149A US3833596A (en) | 1972-12-21 | 1972-12-21 | Carbazole derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU6188273A AU6188273A (en) | 1975-05-01 |
| AU471957B2 true AU471957B2 (en) | 1976-05-06 |
Family
ID=23232326
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU61882/73A Expired AU471957B2 (en) | 1972-12-21 | 1973-10-26 | Carbazole derivatives |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3833596A (enExample) |
| JP (1) | JPS4988869A (enExample) |
| AU (1) | AU471957B2 (enExample) |
| CA (1) | CA1042441A (enExample) |
| DE (1) | DE2362599A1 (enExample) |
| FR (1) | FR2211240B1 (enExample) |
| GB (1) | GB1419666A (enExample) |
| IL (1) | IL43672A (enExample) |
| ZA (1) | ZA738209B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6057588B2 (ja) * | 1977-10-20 | 1985-12-16 | 株式会社リコー | 電子写真用感光体 |
| US5116995A (en) * | 1990-05-25 | 1992-05-26 | Taisho Pharmaceutical Co., Ltd. | Carbazole compounds |
-
1972
- 1972-12-21 US US00317149A patent/US3833596A/en not_active Expired - Lifetime
-
1973
- 1973-10-23 ZA ZA738209A patent/ZA738209B/xx unknown
- 1973-10-26 AU AU61882/73A patent/AU471957B2/en not_active Expired
- 1973-10-29 CA CA184,539A patent/CA1042441A/en not_active Expired
- 1973-11-21 IL IL43672A patent/IL43672A/en unknown
- 1973-12-17 GB GB5826473A patent/GB1419666A/en not_active Expired
- 1973-12-17 DE DE2362599A patent/DE2362599A1/de not_active Withdrawn
- 1973-12-19 FR FR7345516A patent/FR2211240B1/fr not_active Expired
- 1973-12-20 JP JP48141921A patent/JPS4988869A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| CA1042441A (en) | 1978-11-14 |
| FR2211240A1 (enExample) | 1974-07-19 |
| US3833596A (en) | 1974-09-03 |
| GB1419666A (en) | 1975-12-31 |
| IL43672A (en) | 1977-03-31 |
| AU6188273A (en) | 1975-05-01 |
| IL43672A0 (en) | 1974-03-14 |
| JPS4988869A (enExample) | 1974-08-24 |
| FR2211240B1 (enExample) | 1977-01-28 |
| DE2362599A1 (de) | 1974-06-27 |
| ZA738209B (en) | 1974-09-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU467361B2 (en) | Q-aryl-4-substituted piperidinoalkanol derivatives | |
| AU5172573A (en) | Indole derivatives | |
| CA1019738A (en) | Isothiocyanopyridine derivatives | |
| AU470719B2 (en) | Oxazinoindole-and thiazinoinindole derivatives | |
| AU467405B2 (en) | Diphenylalkyllactamimide derivatives | |
| CA1020946A (en) | 1-phenoxy-3-phenoxyethylamino-2-propanol derivatives | |
| AU466790B2 (en) | New phenylhydrazone derivatives | |
| AU467019B2 (en) | Phenylhydrazone derivatives | |
| CA1018161A (en) | Indan-1-carboxamide derivatives | |
| AU470763B2 (en) | Pyrano-and thiopyranoindole derivatives | |
| CA1006514A (en) | Beta-aminoketone derivatives | |
| AU471957B2 (en) | Carbazole derivatives | |
| CA978526A (en) | Pyrano- and thiopyranoindole derivatives | |
| CA981684A (en) | Cyclopenteno-quinolone derivatives | |
| CA909771A (en) | Indole derivatives | |
| CA895306A (en) | Indole derivatives | |
| CA904287A (en) | Indole derivatives | |
| CA905956A (en) | Indole derivatives | |
| CA910311A (en) | En-amine derivatives | |
| AU477427B2 (en) | 2-fluoro-substituted thiazanthene derivatives | |
| CA910910A (en) | Pyrimidinylpyrazole derivatives | |
| CA899886A (en) | Oxotremarine derivatives | |
| CA898253A (en) | Styryl-naphthalene derivatives | |
| CA896560A (en) | 6-phenyl-dihydropyridazine-3-one derivatives | |
| CA912581A (en) | Zearalane derivatives |