AU453368B2 - Prostanoic acid derivatives - Google Patents
Prostanoic acid derivativesInfo
- Publication number
- AU453368B2 AU453368B2 AU32384/71A AU3238471A AU453368B2 AU 453368 B2 AU453368 B2 AU 453368B2 AU 32384/71 A AU32384/71 A AU 32384/71A AU 3238471 A AU3238471 A AU 3238471A AU 453368 B2 AU453368 B2 AU 453368B2
- Authority
- AU
- Australia
- Prior art keywords
- acid derivatives
- prostanoic acid
- prostanoic
- derivatives
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- WGJJROVFWIXTPA-OALUTQOASA-N prostanoic acid Chemical class CCCCCCCC[C@H]1CCC[C@@H]1CCCCCCC(O)=O WGJJROVFWIXTPA-OALUTQOASA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US7251170A | 1970-09-15 | 1970-09-15 | |
| USUS72511 | 1970-09-15 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU3238471A AU3238471A (en) | 1973-02-22 |
| AU453368B2 true AU453368B2 (en) | 1974-10-03 |
Family
ID=22108068
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU32384/71A Expired AU453368B2 (en) | 1970-09-15 | 1971-08-16 | Prostanoic acid derivatives |
Country Status (9)
| Country | Link |
|---|---|
| JP (1) | JPS5549072B1 (enExample) |
| AU (1) | AU453368B2 (enExample) |
| BE (1) | BE772623A (enExample) |
| DE (1) | DE2144048A1 (enExample) |
| FR (1) | FR2106534B1 (enExample) |
| GB (1) | GB1302349A (enExample) |
| NL (1) | NL7112663A (enExample) |
| PH (4) | PH9363A (enExample) |
| ZA (1) | ZA715163B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1991014428A1 (en) * | 1990-03-19 | 1991-10-03 | Allergan, Inc. | USE OF 5-TRANS PROSTAGLANDIN F2α AS AN OCULAR HYPOTENSIVE AGENT |
-
1971
- 1971-08-03 ZA ZA715163A patent/ZA715163B/xx unknown
- 1971-08-12 GB GB3793471A patent/GB1302349A/en not_active Expired
- 1971-08-16 AU AU32384/71A patent/AU453368B2/en not_active Expired
- 1971-08-18 PH PH12762*UA patent/PH9363A/en unknown
- 1971-09-02 DE DE19712144048 patent/DE2144048A1/de active Pending
- 1971-09-10 JP JP6979271A patent/JPS5549072B1/ja active Pending
- 1971-09-14 FR FR7133112A patent/FR2106534B1/fr not_active Expired
- 1971-09-15 BE BE772623A patent/BE772623A/xx not_active IP Right Cessation
- 1971-09-15 NL NL7112663A patent/NL7112663A/xx not_active Application Discontinuation
-
1974
- 1974-10-15 PH PH16422A patent/PH10941A/en unknown
- 1974-10-15 PH PH16420A patent/PH11686A/en unknown
- 1974-10-17 PH PH16430A patent/PH11850A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PH9363A (en) | 1975-10-22 |
| GB1302349A (enExample) | 1973-01-10 |
| PH11850A (en) | 1978-07-28 |
| ZA715163B (en) | 1972-04-26 |
| DE2144048A1 (enExample) | 1972-03-16 |
| FR2106534A1 (enExample) | 1972-05-05 |
| JPS5549072B1 (enExample) | 1980-12-10 |
| PH10941A (en) | 1977-10-05 |
| FR2106534B1 (enExample) | 1979-08-17 |
| AU3238471A (en) | 1973-02-22 |
| BE772623A (fr) | 1972-02-15 |
| NL7112663A (enExample) | 1972-03-17 |
| PH11686A (en) | 1978-05-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| MY7700132A (en) | Prostanoic acid derivatives | |
| IL39376A0 (en) | Prostanoic acid derivatives | |
| ZM15873A1 (en) | Prostanoic acid derivatives | |
| CA969965A (en) | Cycloakylaminoarylcarboxylic acid derivatives | |
| CA957371A (en) | Carbamoyl-triiodophenoxy-ethoxy-propionic acid derivatives | |
| CA957693A (en) | 1-thiachromone-2-carboxylic acid derivatives | |
| AU463362B2 (en) | Penicillanic acid derivatives | |
| CA942748A (en) | 1-aziridinylcarbonyl substituted-3-quinolinecarboxylic acid compounds | |
| CA939364A (en) | Substituted furancarboxylic acid cycloalkylamide | |
| CA967161A (en) | Piperidine-acetic acid derivatives | |
| AU453368B2 (en) | Prostanoic acid derivatives | |
| ZA715518B (en) | Prostanoic acid derivatives | |
| CA850674A (en) | Prostanoic acid derivatives | |
| CA853706A (en) | N-dihydropyranylmethyl-5-sulfamoyl-anthranilic acid derivatives | |
| CA842267A (en) | Thiophenephosphonic acid derivatives | |
| CA841018A (en) | 7-phenylacetamidocephalosporanic acid derivatives | |
| CA834767A (en) | Paracycloalkylphenylacetic acid derivatives | |
| CA831984A (en) | 5-sulfamoylanthranilic acid derivatives | |
| AU432290B2 (en) | Prostanoic acid derivatives | |
| AU481170B2 (en) | Prostanoic acid derivatives | |
| AU482145B2 (en) | Prostanoic acid derivatives | |
| CA903767A (en) | Prostanoic acid derivatives | |
| AU467238B2 (en) | Thiophenecarboxylic acid derivatives | |
| CA833050A (en) | Levulinic acid derivatives | |
| AU443823B2 (en) | Thiocarbamic acid derivatives |