AU449620B2 - 1-n benzyl b methoxy 3 trifluoromethyl phenethylamine - Google Patents
1-n benzyl b methoxy 3 trifluoromethyl phenethylamineInfo
- Publication number
- AU449620B2 AU449620B2 AU31125/71A AU3112571A AU449620B2 AU 449620 B2 AU449620 B2 AU 449620B2 AU 31125/71 A AU31125/71 A AU 31125/71A AU 3112571 A AU3112571 A AU 3112571A AU 449620 B2 AU449620 B2 AU 449620B2
- Authority
- AU
- Australia
- Prior art keywords
- methoxy
- benzyl
- phenethylamine
- trifluoromethyl
- trifluoromethyl phenethylamine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- VPMZPWZIUBDDJW-UHFFFAOYSA-N N-methoxy-2-[3-(trifluoromethyl)phenyl]ethanamine Chemical compound CONCCC1=CC(=CC=C1)C(F)(F)F VPMZPWZIUBDDJW-UHFFFAOYSA-N 0.000 title 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 title 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US5904170A | 1970-07-28 | 1970-07-28 | |
| USUS59,041 | 1970-07-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU3112571A AU3112571A (en) | 1973-01-18 |
| AU449620B2 true AU449620B2 (en) | 1974-06-20 |
Family
ID=22020434
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU31125/71A Expired AU449620B2 (en) | 1970-07-28 | 1971-07-12 | 1-n benzyl b methoxy 3 trifluoromethyl phenethylamine |
Country Status (7)
| Country | Link |
|---|---|
| AU (1) | AU449620B2 (enExample) |
| BE (1) | BE769983A (enExample) |
| CA (1) | CA993454A (enExample) |
| DE (1) | DE2137807A1 (enExample) |
| FR (1) | FR2100957B1 (enExample) |
| GB (1) | GB1308264A (enExample) |
| ZA (1) | ZA714501B (enExample) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL143905B (nl) * | 1965-06-28 | 1974-11-15 | Melville Sahyun Handelende Ond | Werkwijze voor het bereiden van alkoxytrifluormethylfenylalkylaminen en van geneesmiddelen die deze verbindingen bevatten en de aldus verkregen gevormde geneesmiddelen. |
-
1971
- 1971-07-06 CA CA117,482A patent/CA993454A/en not_active Expired
- 1971-07-07 ZA ZA714501A patent/ZA714501B/xx unknown
- 1971-07-12 AU AU31125/71A patent/AU449620B2/en not_active Expired
- 1971-07-14 BE BE769983A patent/BE769983A/xx unknown
- 1971-07-19 FR FR7126369A patent/FR2100957B1/fr not_active Expired
- 1971-07-27 GB GB3515671A patent/GB1308264A/en not_active Expired
- 1971-07-28 DE DE19712137807 patent/DE2137807A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DE2137807A1 (de) | 1972-02-10 |
| CA993454A (en) | 1976-07-20 |
| AU3112571A (en) | 1973-01-18 |
| GB1308264A (en) | 1973-02-21 |
| FR2100957B1 (enExample) | 1974-11-15 |
| ZA714501B (en) | 1972-03-29 |
| BE769983A (fr) | 1972-01-14 |
| FR2100957A1 (enExample) | 1972-03-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA978544A (en) | Benzyl cyanide compounds | |
| CA959818A (en) | Stabilized palladium-carbon catalysts | |
| CA921215A (en) | Toothbrush | |
| CA942753A (en) | 5-azaspiro (2,4) heptane-4,6-diones | |
| CA960193A (en) | Distributeur multiple d'un liquide | |
| CA1009238A (en) | 2,5-dihydroxy benzene sulfonic acid mono-and diesters | |
| CA965104A (en) | 3,4,5-trialkylcyclohexanols | |
| CA986128A (en) | Tetraphenol | |
| AU449620B2 (en) | 1-n benzyl b methoxy 3 trifluoromethyl phenethylamine | |
| CA977350A (en) | Halogeno-6-hydroxy-pyridone-(2) compounds, their manufacture and use | |
| AU2733371A (en) | 5, 7-DISUBSTITUTED-l, 9-ALKYLENE-l, 4-BENZODIAZEPIN-2 ONES | |
| AU465145B2 (en) | 2, 4-diamino-5-benzylpyrimidines | |
| CA957190A (en) | Cattle guard | |
| CA837636A (en) | 1,3-diazacyclo-2,4-butanediones | |
| CA981254A (en) | Bromosalicylanilide biocidal agents | |
| CA855733A (en) | Ammonoxydation d'olefines | |
| CA1003858A (en) | Aminoalcohols | |
| AU3151271A (en) | Substituted 1, 3-indandiols | |
| CA835423A (en) | L-alpha-methyl-beta-(3,4-dihydroxyphenyl) alanine | |
| CA916713A (en) | Anorexigenic compound | |
| AU465195B2 (en) | L-r, 2-(3,4-dialkoxy-b-or2-b-phenethyl) imino-pyrrolidines | |
| AU440569B2 (en) | 1,2,6b,7b-DIMETHYLENE-STEROIDS | |
| CA836581A (en) | 2'3'-di-deoxyriboside-2',3'-olefins | |
| CA854718A (en) | 1,2-dihydro-1-hydroxypyrimidines | |
| CA858562A (en) | 2-halo-3,11,20-triketo-17-hydroxy-21-acyloxy-pregnanes |