ATE73676T1 - Cyclosporin-zusammensetzungen. - Google Patents
Cyclosporin-zusammensetzungen.Info
- Publication number
- ATE73676T1 ATE73676T1 AT89300856T AT89300856T ATE73676T1 AT E73676 T1 ATE73676 T1 AT E73676T1 AT 89300856 T AT89300856 T AT 89300856T AT 89300856 T AT89300856 T AT 89300856T AT E73676 T1 ATE73676 T1 AT E73676T1
- Authority
- AT
- Austria
- Prior art keywords
- cyclosporin compositions
- cyclosporin
- compositions
- Prior art date
Links
- PMATZTZNYRCHOR-CGLBZJNRSA-N Cyclosporin A Chemical compound CC[C@@H]1NC(=O)[C@H]([C@H](O)[C@H](C)C\C=C\C)N(C)C(=O)[C@H](C(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)N(C)C(=O)CN(C)C1=O PMATZTZNYRCHOR-CGLBZJNRSA-N 0.000 title 1
- 229930105110 Cyclosporin A Natural products 0.000 title 1
- 108010036949 Cyclosporine Proteins 0.000 title 1
- 229960001265 ciclosporin Drugs 0.000 title 1
- 229930182912 cyclosporin Natural products 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1912588 | 1988-01-29 | ||
| JP11163988 | 1988-05-10 | ||
| JP63183127A JP2632010B2 (ja) | 1988-01-29 | 1988-07-22 | シクロスポリン製剤 |
| EP89300856A EP0327280B1 (de) | 1988-01-29 | 1989-01-27 | Cyclosporin-Zusammensetzungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ATE73676T1 true ATE73676T1 (de) | 1992-04-15 |
Family
ID=27441782
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT89300856T ATE73676T1 (de) | 1988-01-29 | 1989-01-27 | Cyclosporin-zusammensetzungen. |
Country Status (1)
| Country | Link |
|---|---|
| AT (1) | ATE73676T1 (de) |
-
1989
- 1989-01-27 AT AT89300856T patent/ATE73676T1/de not_active IP Right Cessation
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE68900991D1 (de) | Cyclosporin-zusammensetzungen. | |
| DE68917371D1 (de) | Allzweckreinigerzusammensetzungen. | |
| DE68907659D1 (de) | Warmhaertende organosiloxanzusammensetzung. | |
| DE68919910D1 (de) | Perorale Zusammensetzungen. | |
| DK455989A (da) | Cyclosporinpraeparater | |
| FI891395L (fi) | Eldbestaendig olefinhartskomposition. | |
| DE68921455D1 (de) | Organopolysiloxanzusammensetzungen. | |
| DE68921266D1 (de) | Waschmittelzusammensetzungen. | |
| FI895064A0 (fi) | Kompositioner innehaollande cyklosporin foer behandling av oegoninflammationer. | |
| DE68917195D1 (de) | Waschmittelzusammensetzungen. | |
| NO901838L (no) | Emulgerbare pasticidiske faststoff-sammensetninger. | |
| NO903926L (no) | Aktive limsammensetninger. | |
| DE68908297D1 (de) | Formgepresste zusammensetzungen. | |
| DE68919392D1 (de) | Waschmittelzusammensetzungen. | |
| FI875703A0 (fi) | Laekemedelplaoster-kompositioner. | |
| DE68916395D1 (de) | Zusammensetzung. | |
| DE68918201D1 (de) | Grundierungszusammensetzungen. | |
| DE68903468D1 (de) | Schmiermittelzusammensetzungen. | |
| FI893643L (fi) | Farmaceutiska kompositioner. | |
| DE68905762D1 (de) | Perorale zusammensetzungen. | |
| DE68911160D1 (de) | Arthropodizide Zusammensetzungen. | |
| FI893193A0 (fi) | Kompositioner. | |
| DE68919601D1 (de) | Waschmittelzusammensetzungen. | |
| FI892744L (fi) | Flocklimkomposition. | |
| DE68920622D1 (de) | Polyketonzusammensetzungen. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EELA | Cancelled due to lapse of time |