AT360976B - Verfahren zur herstellung von fluessigem, lager- stabilem methylen-bis-(phenylisocyanat) - Google Patents
Verfahren zur herstellung von fluessigem, lager- stabilem methylen-bis-(phenylisocyanat)Info
- Publication number
- AT360976B AT360976B AT331479A AT331479A AT360976B AT 360976 B AT360976 B AT 360976B AT 331479 A AT331479 A AT 331479A AT 331479 A AT331479 A AT 331479A AT 360976 B AT360976 B AT 360976B
- Authority
- AT
- Austria
- Prior art keywords
- phenylisocyanate
- storage
- methylene bis
- producing liquid
- stable methylene
- Prior art date
Links
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 title 1
- 239000007788 liquid Substances 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G18/00—Polymeric products of isocyanates or isothiocyanates
- C08G18/06—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen
- C08G18/70—Polymeric products of isocyanates or isothiocyanates with compounds having active hydrogen characterised by the isocyanates or isothiocyanates used
- C08G18/72—Polyisocyanates or polyisothiocyanates
- C08G18/77—Polyisocyanates or polyisothiocyanates having heteroatoms in addition to the isocyanate or isothiocyanate nitrogen and oxygen or sulfur
- C08G18/78—Nitrogen
- C08G18/79—Nitrogen characterised by the polyisocyanates used, these having groups formed by oligomerisation of isocyanates or isothiocyanates
- C08G18/797—Nitrogen characterised by the polyisocyanates used, these having groups formed by oligomerisation of isocyanates or isothiocyanates containing carbodiimide and/or uretone-imine groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C267/00—Carbodiimides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Polyurethanes Or Polyureas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/903,308 US4154752A (en) | 1978-05-05 | 1978-05-05 | Preparation of partially carbodiimidized methylenebis (phenyl isocyanate) |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA331479A ATA331479A (de) | 1980-07-15 |
| AT360976B true AT360976B (de) | 1981-02-10 |
Family
ID=25417284
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT331479A AT360976B (de) | 1978-05-05 | 1979-05-03 | Verfahren zur herstellung von fluessigem, lager- stabilem methylen-bis-(phenylisocyanat) |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4154752A (enExample) |
| EP (1) | EP0005233B1 (enExample) |
| JP (1) | JPS54148759A (enExample) |
| AT (1) | AT360976B (enExample) |
| AU (1) | AU524227B2 (enExample) |
| CA (1) | CA1112659A (enExample) |
| DE (1) | DE2967099D1 (enExample) |
| ES (1) | ES480249A1 (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4228095A (en) * | 1979-08-20 | 1980-10-14 | Basf Wyandotte Corporation | Process for the preparation of liquid carbodiimide-modified organic polyisocyanates employing organotin catalysts |
| US4306052A (en) * | 1980-09-25 | 1981-12-15 | The Upjohn Company | Thermoplastic polyester polyurethanes |
| EP0057862A1 (de) * | 1981-02-05 | 1982-08-18 | Mobay Chemical Corporation | Bei niedriger Temperatur lagerbeständiges, teilweise carbodiimidisiertes Methylenbis (phenylisocyanat), ein Verfahren zu seiner Herstellung und seine Verwendung als Ausgangsstoff für die Diisocyanat-Polyadditionsreaktion |
| US4490301A (en) * | 1983-09-30 | 1984-12-25 | Mobay Chemical Corporation | Liquid diphenylmethane diisocyanate compositions |
| US4490300A (en) * | 1983-09-30 | 1984-12-25 | Mobay Chemical Corporation | Liquid diphenylmethane diisocyanate compositions |
| US4490302A (en) * | 1983-11-25 | 1984-12-25 | Mobay Chemical Corporation | Liquid diphenylmethane diisocyanate compositions |
| JPS61111318A (ja) * | 1984-11-06 | 1986-05-29 | Toyobo Co Ltd | 熱可塑性エラストマーの製造法 |
| US4910333A (en) * | 1987-06-03 | 1990-03-20 | Mobay Corporation | Liquid diphenylmethane diisocyanate compositions |
| US4883909A (en) * | 1988-05-11 | 1989-11-28 | Mobay Corporation | Liquid diphenylmetane diisocyanate compositions |
| US4986929A (en) * | 1989-08-23 | 1991-01-22 | Mobay Corporation | Novel isocyanate blends |
| US5043472A (en) * | 1989-12-21 | 1991-08-27 | Mobay Corporation | Storage stable solid isocyanate compositions, preparation, and method of use thereof |
| US5109034A (en) * | 1989-12-21 | 1992-04-28 | Miles Inc. | Storage stable solid isocyanate compositions, preparation, and method of use thereof |
| US5089534A (en) * | 1990-03-23 | 1992-02-18 | The Dow Chemical Company | Process for preparing flexible polyurethane foam |
| ES2081060T5 (es) * | 1991-11-21 | 1999-01-16 | Bp Chem Int Ltd | Proceso para deshidrogenar hidrocarburos e hidrocarburos oxigenados. |
| US5288899A (en) * | 1993-06-30 | 1994-02-22 | Miles Inc. | Liquification of diphenylmethane diisocyanate by partially reacting the isocyanate groups with blocking agents |
| US5350778A (en) * | 1993-10-28 | 1994-09-27 | Miles Inc. | Polyisocyanate based upon 4,4'- and 2,4'-diphenylmethane diisocyanates and use thereof in a rim process |
| CA2117741A1 (en) * | 1993-10-28 | 1995-04-29 | Michael F. Hurley | Rim process utilizing isocyanates based upon 2,4'-and 4,4'- diphenylmethane diisocyanate |
| CA2117740A1 (en) * | 1993-10-28 | 1995-04-29 | Michael F. Hurley | Polyisocyanate based upon 4,4'-and 2,4'-diphenylmethane diisocyanates and use thereof in a rim process |
| DE4403233A1 (de) * | 1994-02-03 | 1995-08-10 | Bayer Ag | Oberhalb 5 DEG C flüssige Polyisocyanatmischungen |
| JPH0867662A (ja) * | 1994-08-30 | 1996-03-12 | Sumitomo Bayer Urethane Kk | 液状のジフェニルメタンジイソシアネートの製造法 |
| US6482913B1 (en) | 2000-02-07 | 2002-11-19 | Bayer Aktiengesellschaft | Liquid MDI adducts wtih improved freeze stability |
| US6376567B1 (en) | 2000-12-07 | 2002-04-23 | Bayer Corporation | Polyisocyanate compositions and a process for the production of low-density flexible foams with low humid aged compression sets from these polyisocyanate compositions |
| DE102004024205A1 (de) * | 2004-05-13 | 2005-12-08 | Basf Ag | Polyurethane enthaltend Carbodiimide |
| DE102004051026A1 (de) * | 2004-10-20 | 2006-04-27 | Bayer Materialscience Ag | Kristallisationsstabile MDI-Allophanate nach einem zweistufigen Verfahren |
| US20090156777A1 (en) * | 2007-12-17 | 2009-06-18 | Nodelman Neil H | Freeze-stable aromatic diisocyanates and processes for the preparation of these freeze-stable products |
| HUP1400402A2 (hu) * | 2014-08-29 | 2016-03-29 | Borsodchem Zrt | Eljárás világos színû, stabilan tárolható uretonimin modifikált poliizocianát elõállítására |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3152162A (en) * | 1959-07-29 | 1964-10-06 | Bayer Ag | Polyisocyanate-carbodiimide adducts and process for the production thereof |
| BE787395A (fr) * | 1971-08-13 | 1973-02-12 | Basf Wyandotte Corp | Procede de preparation de polyisocyanates |
| JPS5037172A (enExample) * | 1973-08-09 | 1975-04-07 | ||
| DE2504400A1 (de) * | 1975-02-01 | 1976-08-05 | Bayer Ag | Lagerstabile, carbodiimidgruppen enthaltende polyisocyanate |
| GB1476088A (en) * | 1975-04-03 | 1977-06-10 | Ici Ltd | Carbodiimides |
| DE2537685C2 (de) * | 1975-08-23 | 1989-04-06 | Bayer Ag, 5090 Leverkusen | Verfahren zur teilweisen Carbodiimidisierung der Isocyanatgruppen von organischen Polyisocyanaten |
| DE2606419A1 (de) * | 1976-02-18 | 1977-08-25 | Basf Ag | Lagerbestaendige, fluessige carbodiimidgruppen aufweisende polyisocyanate und verfahren zu ihrer herstellung |
| GB1584153A (en) * | 1976-09-22 | 1981-02-04 | Ici Ltd | Carbodimides |
-
1978
- 1978-05-05 US US05/903,308 patent/US4154752A/en not_active Expired - Lifetime
-
1979
- 1979-04-25 DE DE7979101243T patent/DE2967099D1/de not_active Expired
- 1979-04-25 EP EP79101243A patent/EP0005233B1/de not_active Expired
- 1979-05-01 CA CA326,746A patent/CA1112659A/en not_active Expired
- 1979-05-03 AT AT331479A patent/AT360976B/de not_active IP Right Cessation
- 1979-05-04 JP JP5424779A patent/JPS54148759A/ja active Granted
- 1979-05-04 AU AU46680/79A patent/AU524227B2/en not_active Ceased
- 1979-05-04 ES ES480249A patent/ES480249A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA1112659A (en) | 1981-11-17 |
| AU4668079A (en) | 1979-11-08 |
| JPS54148759A (en) | 1979-11-21 |
| ATA331479A (de) | 1980-07-15 |
| ES480249A1 (es) | 1980-01-16 |
| JPH02341B2 (enExample) | 1990-01-08 |
| US4154752A (en) | 1979-05-15 |
| EP0005233B1 (de) | 1984-07-11 |
| EP0005233A1 (de) | 1979-11-14 |
| DE2967099D1 (en) | 1984-08-16 |
| AU524227B2 (en) | 1982-09-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT360976B (de) | Verfahren zur herstellung von fluessigem, lager- stabilem methylen-bis-(phenylisocyanat) | |
| AT381714B (de) | Verfahren zur herstellung von polyurethanen | |
| AT362477B (de) | Verfahren zur herstellung von (u,pu)02-misch- kristallen | |
| AT371097B (de) | Verfahren zur herstellung von o-methallyloxyphenol | |
| AT373885B (de) | Verfahren zur herstellung von 1,2,3-thiadiazol -5-yl-harnstoffen | |
| ATA311179A (de) | Verfahren zur herstellung von 6alpha-halogen -pregnadien-derivates | |
| DD135197A5 (de) | Verfahren zur herstellung von biuretgruppen aufweisenden polyisocyanaten | |
| AT374486B (de) | Verfahren zur herstellung von 17beta-hydroxy-17 | |
| DD130484A5 (de) | Verfahren zur herstellung von biuretgruppen aufweisenden polyisocyanaten | |
| AT367773B (de) | Verfahren zur herstellung von 25,26-dihydroxycholesterin | |
| AT380701B (de) | Verfahren zur herstellung von monofilen | |
| ATA663779A (de) | Verfahren zur herstellung von 3-exomethyl- encephamsulfoxidestern | |
| AT367017B (de) | Verfahren zur herstellung von p-amino-diphenylamin | |
| AT369728B (de) | Verfahren zur herstellung von trichloraethylen | |
| AT360978B (de) | Verfahren zur herstellung von isocyanaten | |
| AT364345B (de) | Verfahren zur herstellung von n-aethylaethylendiamin | |
| ATA817779A (de) | Verfahren zur herstellung von 7-chlor-2-methyl-3,3a-dihydro-2h,9h-isoxazol (3,2-b) (1,3)-benzoxazin-9-on | |
| AT368508B (de) | Verfahren zur herstellung von 3-carbamoyloxymethylcephalosporinverbindungen | |
| AT374399B (de) | Verfahren zur herstellung von ziehsteinbohrungen | |
| AT375653B (de) | Verfahren zur herstellung von 2-oxodihydrobenzo(d)(1,3)-oxazinen | |
| AT373244B (de) | Verfahren zur herstellung von n-tritylimidazolverbindungen | |
| AT376439B (de) | Verfahren zur herstellung von ergotalkaloiden | |
| AT370422B (de) | Verfahren zur herstellung von vindesinmonosulfat | |
| ATA254579A (de) | Verfahren zur herstellung von 2-mercaptobenzthiazol | |
| DD138074A1 (de) | Verfahren zur herstellung von sehr hochviskosem polybutylenterephthalat |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |