AT359657B - Verfahren zur herstellung von neuen prostan- derivaten - Google Patents
Verfahren zur herstellung von neuen prostan- derivatenInfo
- Publication number
- AT359657B AT359657B AT373376A AT373376A AT359657B AT 359657 B AT359657 B AT 359657B AT 373376 A AT373376 A AT 373376A AT 373376 A AT373376 A AT 373376A AT 359657 B AT359657 B AT 359657B
- Authority
- AT
- Austria
- Prior art keywords
- producing new
- prostane derivatives
- prostane
- derivatives
- producing
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title 1
- UKVVPDHLUHAJNZ-PMACEKPBSA-N prostane Chemical class CCCCCCCC[C@H]1CCC[C@@H]1CCCCCCC UKVVPDHLUHAJNZ-PMACEKPBSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
- C07C405/0008—Analogues having the carboxyl group in the side-chains replaced by other functional groups
- C07C405/0016—Analogues having the carboxyl group in the side-chains replaced by other functional groups containing only hydroxy, etherified or esterified hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
- C07C405/0008—Analogues having the carboxyl group in the side-chains replaced by other functional groups
- C07C405/0025—Analogues having the carboxyl group in the side-chains replaced by other functional groups containing keto groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752523676 DE2523676A1 (de) | 1975-05-26 | 1975-05-26 | Neue prostanderivate und verfahren zu ihrer herstellung |
| DE19762616304 DE2616304A1 (de) | 1976-04-12 | 1976-04-12 | Neue prostansaeurederivate und verfahren zu ihrer herstellung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA373376A ATA373376A (de) | 1980-04-15 |
| AT359657B true AT359657B (de) | 1980-11-25 |
Family
ID=25768952
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT373376A AT359657B (de) | 1975-05-26 | 1976-05-21 | Verfahren zur herstellung von neuen prostan- derivaten |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US4105792A (de) |
| JP (1) | JPS51143643A (de) |
| AT (1) | AT359657B (de) |
| AU (1) | AU510695B2 (de) |
| CA (1) | CA1091226A (de) |
| CH (1) | CH623036A5 (de) |
| DK (1) | DK229476A (de) |
| FR (1) | FR2312240A1 (de) |
| GB (1) | GB1553710A (de) |
| HU (1) | HU177906B (de) |
| IE (1) | IE44255B1 (de) |
| LU (1) | LU75011A1 (de) |
| NL (1) | NL7605381A (de) |
| SE (1) | SE7605925L (de) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4058564A (en) * | 1976-07-26 | 1977-11-15 | The Upjohn Company | Aliphatic 2-decarboxy-2-hydroxymethyl-13,14-didehydro-PG compounds |
| US4149006A (en) * | 1977-01-24 | 1979-04-10 | G. D. Searle & Co. | Prostaglandin derivatives having alkynyl, hydroxy and aryloxy junctions in the 2β side chain |
| US4171331A (en) * | 1978-06-05 | 1979-10-16 | Miles Laboratories, Inc. | 1 And 2-substituted analogues of certain prostaglandins |
| DE3405181A1 (de) * | 1984-02-10 | 1985-08-22 | Schering AG, 1000 Berlin und 4709 Bergkamen | Neue carbacycline, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| US5238961A (en) * | 1990-06-14 | 1993-08-24 | Allergan, Inc. | Pgf 1-alcohols and their use as ocular hypotensives |
| US5139491A (en) * | 1990-12-06 | 1992-08-18 | Allergan, Inc. | 2-decarboxyl-2-alkoxyalkyl prostaglandins as ocular hypotensives |
| US5767154A (en) * | 1991-02-07 | 1998-06-16 | Allergan | 5-trans-prostaglandins of the F series and their use as ocular hypotensives |
| WO1992013836A1 (en) * | 1991-02-07 | 1992-08-20 | Allergan, Inc. | 2-decarboxyl-2-hydroxyalkyl-5-trans prostaglandin f derivatives |
| US5312832A (en) * | 1991-05-17 | 1994-05-17 | Allergan, Inc. | Ocular hypotensive 2-decarboxyl-2-acylthioalkyl prostaglandin derivatives |
| US5688819A (en) * | 1992-09-21 | 1997-11-18 | Allergan | Cyclopentane heptanoic acid, 2-cycloalkyl or arylalkyl derivatives as therapeutic agents |
| US5352708A (en) * | 1992-09-21 | 1994-10-04 | Allergan, Inc. | Non-acidic cyclopentane heptanoic acid, 2-cycloalkyl or arylalkyl derivatives as therapeutic agents |
| US5972991A (en) | 1992-09-21 | 1999-10-26 | Allergan | Cyclopentane heptan(ene) oic acid, 2-heteroarylalkenyl derivatives as therapeutic agents |
| US5834498A (en) * | 1992-09-21 | 1998-11-10 | Allergan | Cyclopentane heptan(ene)oic acid, 2-heteroarylalkenyl derivatives as therapeutic agents |
| US5385945A (en) * | 1992-10-21 | 1995-01-31 | Allergan, Inc. | 7-(5-substituted cyclopentyl) and (5-substituted cyclopentenyl) heptyl alcohols, heptylamines and heptanoic acid amides, and method of lowering intraocular pressure in the eye of a mammal by administration of these novel compounds |
| US5510383A (en) * | 1993-08-03 | 1996-04-23 | Alcon Laboratories, Inc. | Use of cloprostenol, fluprostenol and their salts and esters to treat glaucoma and ocular hypertension |
| US6184250B1 (en) | 1993-08-03 | 2001-02-06 | Alcon Laboratories, Inc. | Use of cloprostenol and fluprostenol analogues to treat glaucoma and ocular hypertension |
| US5721273A (en) | 1993-12-15 | 1998-02-24 | Alcon Laboratories, Inc. | Use of certain 9-halo-13,14-dihydroprostaglandins to treat glaucoma and ocular hypertension |
| US5545665A (en) * | 1993-12-28 | 1996-08-13 | Allergan | Cyclopentane(ene) heptenoic or heptanoic acids and derivatives thereof useful as therapeutic agents |
| US7851504B2 (en) | 2005-03-16 | 2010-12-14 | Allergan, Inc. | Enhanced bimatoprost ophthalmic solution |
| WO2010102078A1 (en) | 2009-03-04 | 2010-09-10 | Allergan, Inc. | Enhanced bimatoprost ophthalmic solution |
| US9522153B2 (en) | 2009-12-22 | 2016-12-20 | Allergan, Inc. | Compositions and methods for lowering intraocular pressure |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3069322A (en) * | 1958-05-28 | 1962-12-18 | Bergstrom Sune | Pge and pgf |
| US3723528A (en) * | 1967-10-09 | 1973-03-27 | Upjohn Co | Prostaglandin oximes and oxime ethers |
| US3922293A (en) * | 1971-12-30 | 1975-11-25 | Upjohn Co | Prostaglandin F-type 9-monoacylates |
| GB1451798A (en) * | 1973-08-02 | 1976-10-06 | Ici Ltd | Prostanoic acid derivatives |
| GB1468830A (en) * | 1974-01-26 | 1977-03-30 | May & Baker Ltd | Cyclopentane derivatives |
| US3970685A (en) * | 1974-06-05 | 1976-07-20 | Syntex (U.S.A.) Inc. | (DL)-13-Substituted sulfinyl-prostaglandin-like compounds |
| US4117119A (en) * | 1975-03-11 | 1978-09-26 | Ono Pharmaceutical Company | 15-cyclobutyl-prostaglandins |
-
1976
- 1976-05-20 NL NL7605381A patent/NL7605381A/xx not_active Application Discontinuation
- 1976-05-21 CH CH640376A patent/CH623036A5/de not_active IP Right Cessation
- 1976-05-21 AT AT373376A patent/AT359657B/de not_active IP Right Cessation
- 1976-05-24 LU LU75011A patent/LU75011A1/xx unknown
- 1976-05-24 AU AU14225/76A patent/AU510695B2/en not_active Expired
- 1976-05-24 IE IE1084/76A patent/IE44255B1/en unknown
- 1976-05-25 US US05/689,849 patent/US4105792A/en not_active Expired - Lifetime
- 1976-05-25 GB GB21622/76A patent/GB1553710A/en not_active Expired
- 1976-05-25 HU HU76SCHE566A patent/HU177906B/hu unknown
- 1976-05-25 SE SE7605925A patent/SE7605925L/xx unknown
- 1976-05-25 DK DK229476A patent/DK229476A/da unknown
- 1976-05-26 CA CA253,389A patent/CA1091226A/en not_active Expired
- 1976-05-26 FR FR7615918A patent/FR2312240A1/fr active Granted
- 1976-05-26 JP JP51061035A patent/JPS51143643A/ja active Pending
-
1978
- 1978-03-02 US US05/882,687 patent/US4256745A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| GB1553710A (en) | 1979-09-26 |
| AU510695B2 (en) | 1980-07-10 |
| FR2312240B1 (de) | 1979-09-21 |
| SE7605925L (sv) | 1976-11-27 |
| NL7605381A (nl) | 1976-11-30 |
| US4105792A (en) | 1978-08-08 |
| US4256745A (en) | 1981-03-17 |
| LU75011A1 (de) | 1977-01-20 |
| DK229476A (da) | 1976-11-27 |
| HU177906B (en) | 1982-01-28 |
| AU1422576A (en) | 1977-12-01 |
| CA1091226A (en) | 1980-12-09 |
| JPS51143643A (en) | 1976-12-10 |
| FR2312240A1 (fr) | 1976-12-24 |
| ATA373376A (de) | 1980-04-15 |
| IE44255L (en) | 1976-11-26 |
| IE44255B1 (en) | 1981-09-23 |
| CH623036A5 (de) | 1981-05-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT348693B (de) | Verfahren zur herstellung von neuen decapeptidamidderivaten | |
| AT365579B (de) | Verfahren zur herstellung von neuen tetrahydroisochinoliniumverbindungen | |
| AT360005B (de) | Verfahren zur herstellung von neuen sulfonyl- benzimidazolderivaten | |
| AT359657B (de) | Verfahren zur herstellung von neuen prostan- derivaten | |
| AT344896B (de) | Verfahren zur herstellung von neuen piperazinyliminorifamycinen | |
| AT362085B (de) | Verfahren zur herstellung von neuen 16- -dehydroandrostan-derivaten | |
| AT349633B (de) | Verfahren zur herstellung von neuen dauno- saminylanthracylcinonen | |
| AT344163B (de) | Verfahren zur herstellung von neuen oxadiazolinon-derivaten | |
| AT360006B (de) | Verfahren zur herstellung von neuen thiazolinylbenzimidazolderivaten | |
| AT353956B (de) | Verfahren zur herstellung von neuen cephalosporinantibiotika | |
| ATA585876A (de) | Verfahren zur herstellung von neuen 2-benzimidazolylcarbamaten | |
| AT345815B (de) | Verfahren zur herstellung von neuen thiadiazolylimidazolidinonderivaten | |
| AT347453B (de) | Verfahren zur herstellung von neuen 5-phenyl- oxazolidinon-2-derivaten | |
| AT344150B (de) | Verfahren zur herstellung von neuen cyclohexylphenylen | |
| AT349142B (de) | Verfahren zur herstellung von neuen rifamyzin- verbindungen | |
| AT345278B (de) | Verfahren zur herstellung von neuen oxazolderivaten | |
| AT345801B (de) | Verfahren zur herstellung von neuen 1-phenoxy- 2-acyloxy-3-amino-propanderivaten | |
| AT347967B (de) | Verfahren zur herstellung von neuen biguaniden | |
| AT342617B (de) | Verfahren zur herstellung von neuen 1-methyl-3-alkyl-7-oxoalkylxanthinen | |
| AT355034B (de) | Verfahren zur herstellung von neuen 3- acylamino-2-azetidinonderivaten | |
| AT345818B (de) | Verfahren zur herstellung von neuen oxazolderivaten | |
| AT346355B (de) | Verfahren zur herstellung von neuen 2- morpholinonderivaten | |
| ATA127476A (de) | Verfahren zur herstellung von neuen cephemderivaten | |
| ATA572577A (de) | Verfahren zur herstellung von neuen cyclohexylphenylen | |
| ATA239476A (de) | Verfahren zur herstellung von neuen d-homo- steroiden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee | ||
| ELJ | Ceased due to non-payment of the annual fee |