AT327188B - Verfahren zur herstellung neuer nitrofuranderivate - Google Patents
Verfahren zur herstellung neuer nitrofuranderivateInfo
- Publication number
- AT327188B AT327188B AT1045373*7A AT1045373A AT327188B AT 327188 B AT327188 B AT 327188B AT 1045373 A AT1045373 A AT 1045373A AT 327188 B AT327188 B AT 327188B
- Authority
- AT
- Austria
- Prior art keywords
- producing new
- nitrofuran derivatives
- new nitrofuran
- derivatives
- producing
- Prior art date
Links
- 229940027988 antiseptic and disinfectant nitrofuran derivative Drugs 0.000 title 1
- IAIWVQXQOWNYOU-FPYGCLRLSA-N nitrofural Chemical class NC(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 IAIWVQXQOWNYOU-FPYGCLRLSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722202745 DE2202745A1 (de) | 1972-01-21 | 1972-01-21 | Nitrofuryl-triazolo eckige klammer auf 4,3-b eckige klammer zu-pyridazin-carbonsaeurederivate |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA1045373A ATA1045373A (de) | 1975-04-15 |
| AT327188B true AT327188B (de) | 1976-01-26 |
Family
ID=5833565
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT1045373*7A AT327188B (de) | 1972-01-21 | 1973-01-19 | Verfahren zur herstellung neuer nitrofuranderivate |
| AT1045473*7A AT327189B (de) | 1972-01-21 | 1973-01-19 | Verfahren zur herstellung neuer nitrofuranderivate |
| AT1045273*7A AT327187B (de) | 1972-01-21 | 1973-01-19 | Verfahren zur herstellung neuer nitrofuranderivate |
| AT45273A AT319223B (de) | 1972-01-21 | 1973-01-19 | Verfahren zur Herstellung neuer Nitrofuranderivate |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT1045473*7A AT327189B (de) | 1972-01-21 | 1973-01-19 | Verfahren zur herstellung neuer nitrofuranderivate |
| AT1045273*7A AT327187B (de) | 1972-01-21 | 1973-01-19 | Verfahren zur herstellung neuer nitrofuranderivate |
| AT45273A AT319223B (de) | 1972-01-21 | 1973-01-19 | Verfahren zur Herstellung neuer Nitrofuranderivate |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3928342A (Direct) |
| JP (1) | JPS4880595A (Direct) |
| AT (4) | AT327188B (Direct) |
| AU (1) | AU466338B2 (Direct) |
| DE (1) | DE2202745A1 (Direct) |
| ES (1) | ES410662A1 (Direct) |
| FR (1) | FR2181672B1 (Direct) |
| GB (1) | GB1351922A (Direct) |
| HU (1) | HU165304B (Direct) |
| NL (1) | NL7300612A (Direct) |
| SE (1) | SE7300628L (Direct) |
| ZA (1) | ZA73418B (Direct) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US9187484B2 (en) | 2012-05-02 | 2015-11-17 | Southern Research Institute | Triazolopyridazine compounds, use as inhibitors of the kinase LRRK2, and methods for preparation thereof |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE630438A (Direct) * | 1962-04-02 | |||
| NL128591C (Direct) * | 1965-07-02 | |||
| NL128809C (Direct) * | 1966-06-18 | |||
| US3506656A (en) * | 1966-10-22 | 1970-04-14 | Boehringer Mannheim Gmbh | Triazolo-tetrazolo-pyridazine derivatives |
| US3767660A (en) * | 1971-09-13 | 1973-10-23 | Upjohn Co | 4h-s-triazolo(4,3-a)(1,4)benzodiazepines |
| US3767661A (en) * | 1971-09-13 | 1973-10-23 | Upjohn Co | 4h-s-triazolo(4,3-a)(1,4)benzodiazepines |
-
1972
- 1972-01-21 DE DE19722202745 patent/DE2202745A1/de active Pending
- 1972-12-18 US US316197A patent/US3928342A/en not_active Expired - Lifetime
-
1973
- 1973-01-15 HU HUBO1409A patent/HU165304B/hu unknown
- 1973-01-16 ES ES410662A patent/ES410662A1/es not_active Expired
- 1973-01-16 JP JP48007297A patent/JPS4880595A/ja active Pending
- 1973-01-16 FR FR7301382A patent/FR2181672B1/fr not_active Expired
- 1973-01-16 GB GB228573A patent/GB1351922A/en not_active Expired
- 1973-01-16 NL NL7300612A patent/NL7300612A/xx unknown
- 1973-01-17 SE SE7300628A patent/SE7300628L/sv unknown
- 1973-01-19 ZA ZA730418A patent/ZA73418B/xx unknown
- 1973-01-19 AT AT1045373*7A patent/AT327188B/de not_active IP Right Cessation
- 1973-01-19 AT AT1045473*7A patent/AT327189B/de not_active IP Right Cessation
- 1973-01-19 AT AT1045273*7A patent/AT327187B/de not_active IP Right Cessation
- 1973-01-19 AT AT45273A patent/AT319223B/de not_active IP Right Cessation
- 1973-01-22 AU AU51343/73A patent/AU466338B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ATA1045373A (de) | 1975-04-15 |
| AU466338B2 (en) | 1975-10-23 |
| AT319223B (de) | 1974-12-10 |
| JPS4880595A (Direct) | 1973-10-29 |
| AU5134373A (en) | 1974-07-25 |
| ES410662A1 (es) | 1976-01-01 |
| US3928342A (en) | 1975-12-23 |
| ATA1045473A (de) | 1975-04-15 |
| ATA1045273A (de) | 1975-04-15 |
| NL7300612A (Direct) | 1973-07-24 |
| AT327189B (de) | 1976-01-26 |
| GB1351922A (en) | 1974-05-15 |
| ZA73418B (en) | 1973-11-28 |
| FR2181672A1 (Direct) | 1973-12-07 |
| DE2202745A1 (de) | 1973-07-26 |
| SE7300628L (Direct) | 1973-07-23 |
| FR2181672B1 (Direct) | 1976-09-03 |
| HU165304B (Direct) | 1974-08-28 |
| AT327187B (de) | 1976-01-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT331970B (de) | Verfahren zur herstellung neuer alpha- aminobenzylpenicillinderivate | |
| AT333987B (de) | Verfahren zur herstellung neuer insulinderivate | |
| ATA588973A (de) | Verfahren zur herstellung neuer phenoxypropanolamine | |
| AT329570B (de) | Verfahren zur herstellung neuer chinazolinonderivate | |
| AT331255B (de) | Verfahren zur herstellung neuer hexahydrotriazinonderivate | |
| AT327414B (de) | Verfahren zur herstellung neuer bis-piperazino-androstan-derivate | |
| AT326653B (de) | Verfahren zur herstellung neuer 2-amino-4-h-pyrane | |
| AT327881B (de) | Verfahren zur herstellung neuer furanderivate | |
| ATA470873A (de) | Verfahren zur herstellung neuer anhydro- furanosederivate | |
| AT327185B (de) | Verfahren zur herstellung neuer nitrofuranderivate | |
| AT327188B (de) | Verfahren zur herstellung neuer nitrofuranderivate | |
| AT324323B (de) | Verfahren zur herstellung neuer benzimidazolderivate | |
| AT326120B (de) | Verfahren zur herstellung neuer isoxazolidinderivate | |
| AT335462B (de) | Verfahren zur herstellung neuer 1-nitrosoharnstoffderivate | |
| DD108067A5 (de) | Verfahren zur herstellung neuer bicycloalkan-derivate | |
| AT322542B (de) | Verfahren zur herstellung neuer nitrofuranverbindungen | |
| AT323730B (de) | Verfahren zur herstellung neuer indolderivate | |
| ATA1016673A (de) | Verfahren zur herstellung neuer sydnon-derivate | |
| ATA1030473A (de) | Verfahren zur herstellung neuer everninomicinderivate | |
| ATA2575A (de) | Verfahren zur herstellung neuer anhydro- furanosederivate | |
| ATA217775A (de) | Verfahren zur herstellung neuer phenoxypropanolamine | |
| ATA79175A (de) | Verfahren zur herstellung neuer sulfonamidodiphenylather | |
| ATA304275A (de) | Verfahren zur herstellung neuer benzoxazol-derivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |