AT325785B - Verfahren zur herstellung von papaverinanalogen - Google Patents
Verfahren zur herstellung von papaverinanalogenInfo
- Publication number
- AT325785B AT325785B AT817672A AT817672A AT325785B AT 325785 B AT325785 B AT 325785B AT 817672 A AT817672 A AT 817672A AT 817672 A AT817672 A AT 817672A AT 325785 B AT325785 B AT 325785B
- Authority
- AT
- Austria
- Prior art keywords
- papaverine
- analogs
- manufacturing
- papaverine analogs
- manufacturing papaverine
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000000034 method Methods 0.000 title 1
- XQYZDYMELSJDRZ-UHFFFAOYSA-N papaverine Chemical class C1=C(OC)C(OC)=CC=C1CC1=NC=CC2=CC(OC)=C(OC)C=C12 XQYZDYMELSJDRZ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/12—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring
- C07D217/14—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring other than aralkyl radicals
- C07D217/16—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring other than aralkyl radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/12—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring
- C07D217/18—Aralkyl radicals
- C07D217/20—Aralkyl radicals with oxygen atoms directly attached to the aromatic ring of said aralkyl radical, e.g. papaverine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/22—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the nitrogen-containing ring
- C07D217/26—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Steroid Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4424071A GB1400425A (en) | 1971-09-22 | 1971-09-22 | Substituted 3-hydroxymethyl-isoquinolines and derivatives |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA817672A ATA817672A (de) | 1975-01-15 |
| AT325785B true AT325785B (de) | 1975-11-10 |
Family
ID=10432407
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT817672A AT325785B (de) | 1971-09-22 | 1972-09-22 | Verfahren zur herstellung von papaverinanalogen |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US3891654A (enExample) |
| JP (1) | JPS5029476B2 (enExample) |
| AT (1) | AT325785B (enExample) |
| AU (1) | AU469543B2 (enExample) |
| BE (1) | BE788984A (enExample) |
| CA (1) | CA990297A (enExample) |
| CH (1) | CH550173A (enExample) |
| CS (1) | CS165974B2 (enExample) |
| DE (1) | DE2246307C2 (enExample) |
| DK (1) | DK131778C (enExample) |
| ES (1) | ES406912A1 (enExample) |
| FI (1) | FI49827C (enExample) |
| FR (1) | FR2154500B1 (enExample) |
| GB (1) | GB1400425A (enExample) |
| IL (1) | IL40412A (enExample) |
| LU (1) | LU66120A1 (enExample) |
| NL (1) | NL154502B (enExample) |
| NO (1) | NO136926C (enExample) |
| OA (1) | OA04182A (enExample) |
| RO (1) | RO60560A (enExample) |
| SE (1) | SE400764B (enExample) |
| ZA (1) | ZA726478B (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2811361A1 (de) * | 1978-03-16 | 1979-09-27 | Hoechst Ag | Neue isochinolinaldehyde und verfahren zu ihrer herstellung |
| IN154316B (enExample) * | 1979-07-19 | 1984-10-13 | Andre Buzas | |
| JPS5640334A (en) * | 1979-09-11 | 1981-04-16 | Komatsu Ltd | Indoor information transmission system |
| SE8107537L (sv) * | 1980-12-22 | 1982-06-23 | Delalande Sa | Nya derivat av heterocykliska aminoalcoyler, deras framstellningssett och deras terapeutiska anvendning |
| DE3244594A1 (de) * | 1982-12-02 | 1984-06-07 | Hoechst Ag, 6230 Frankfurt | 1-phenylisochinolinderivate und verfahren zu ihrer herstellung, diese verbindung enthaltende pharmazeutische praeparate und deren anwendung |
| HU196758B (en) * | 1986-05-21 | 1989-01-30 | Gyogyszerkutato Intezet | Process for production of 3-hidroxi-methil-quinolines and medical compositions containing them |
| JPH0714310Y2 (ja) * | 1990-11-26 | 1995-04-05 | 株式会社スギヤス | 階段昇降機 |
| GB9027055D0 (en) * | 1990-12-13 | 1991-02-06 | Sandoz Ltd | Organic compounds |
| GB9322828D0 (en) * | 1993-11-05 | 1993-12-22 | Sandoz Ltd | Organic compounds |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB374627A (en) * | 1931-06-08 | 1932-06-16 | George Beloe Ellis | Process for the production of synthetic bodies similar to papaverine |
| US2683713A (en) * | 1951-02-16 | 1954-07-13 | Lilly Co Eli | Substituted benzylisoquinolines |
| GB1032269A (en) * | 1963-09-30 | 1966-06-08 | Orgamol Sa | Process for the preparation of water-soluble alkane sulphonic acid salts of isoquinoline bases of the papaverine series |
| US3334106A (en) * | 1964-10-20 | 1967-08-01 | Aldrich Chem Co Inc | N(aryl)n(hydrocarbyl)-omega-(4-phenyl-4-piperidinocarbonylheteroamine) alkanoamide |
| US3389140A (en) * | 1966-05-16 | 1968-06-18 | Bristol Myers Co | 1-beta-arylaminoethyl-2-methyl-6, 7-dimethoxy-1, 2, 3, 4-tetrahydroisoquinolines |
| SE347970B (enExample) * | 1969-01-25 | 1972-08-21 | Tanabe Seiyaku Co |
-
1971
- 1971-09-22 GB GB4424071A patent/GB1400425A/en not_active Expired
-
1972
- 1972-09-12 FR FR7232294A patent/FR2154500B1/fr not_active Expired
- 1972-09-19 BE BE788984A patent/BE788984A/xx not_active IP Right Cessation
- 1972-09-20 CH CH1374872A patent/CH550173A/fr not_active IP Right Cessation
- 1972-09-20 LU LU66120A patent/LU66120A1/xx unknown
- 1972-09-20 CA CA152,191A patent/CA990297A/en not_active Expired
- 1972-09-21 RO RO72297A patent/RO60560A/ro unknown
- 1972-09-21 US US290813A patent/US3891654A/en not_active Expired - Lifetime
- 1972-09-21 ES ES406912A patent/ES406912A1/es not_active Expired
- 1972-09-21 NO NO723383A patent/NO136926C/no unknown
- 1972-09-21 DK DK465672A patent/DK131778C/da active
- 1972-09-21 DE DE2246307A patent/DE2246307C2/de not_active Expired
- 1972-09-21 FI FI722607A patent/FI49827C/fi active
- 1972-09-21 SE SE7212195A patent/SE400764B/xx unknown
- 1972-09-22 NL NL727212904A patent/NL154502B/xx not_active IP Right Cessation
- 1972-09-22 CS CS6482A patent/CS165974B2/cs unknown
- 1972-09-22 JP JP7295655A patent/JPS5029476B2/ja not_active Expired
- 1972-09-22 ZA ZA726478A patent/ZA726478B/xx unknown
- 1972-09-22 OA OA54696A patent/OA04182A/xx unknown
- 1972-09-22 AU AU46982/72A patent/AU469543B2/en not_active Expired
- 1972-09-22 AT AT817672A patent/AT325785B/de active
- 1972-09-22 IL IL40412A patent/IL40412A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE788984A (fr) | 1973-01-15 |
| ES406912A1 (es) | 1976-01-16 |
| FR2154500B1 (enExample) | 1975-10-31 |
| IL40412A0 (en) | 1972-11-28 |
| DE2246307A1 (de) | 1973-03-29 |
| LU66120A1 (enExample) | 1973-01-17 |
| ATA817672A (de) | 1975-01-15 |
| OA04182A (fr) | 1979-12-31 |
| JPS5029476B2 (enExample) | 1975-09-23 |
| FR2154500A1 (enExample) | 1973-05-11 |
| NO136926C (no) | 1977-11-30 |
| DE2246307C2 (de) | 1982-11-04 |
| RO60560A (enExample) | 1976-09-15 |
| ZA726478B (en) | 1973-06-27 |
| SE400764B (sv) | 1978-04-10 |
| DK131778C (da) | 1976-02-02 |
| FI49827B (enExample) | 1975-06-30 |
| US3891654A (en) | 1975-06-24 |
| FI49827C (fi) | 1975-10-10 |
| NL154502B (nl) | 1977-09-15 |
| AU469543B2 (en) | 1976-02-19 |
| CA990297A (en) | 1976-06-01 |
| DK131778B (da) | 1975-09-01 |
| IL40412A (en) | 1976-04-30 |
| AU4698272A (en) | 1974-03-28 |
| CH550173A (fr) | 1974-06-14 |
| NO136926B (no) | 1977-08-22 |
| GB1400425A (en) | 1975-07-16 |
| NL7212904A (enExample) | 1973-03-26 |
| CS165974B2 (enExample) | 1975-12-22 |
| JPS4839483A (enExample) | 1973-06-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT326270B (de) | Verfahren zur herstellung von arzneiformen | |
| AT345152B (de) | Verfahren zur herstellung von formkoerpern | |
| AT330740B (de) | Verfahren zur herstellung von neuensulfonamidodiphenylathern | |
| AT333713B (de) | Verfahren zur herstellung von neuen polyglykolathern | |
| ATA326172A (de) | Verfahren zur herstellung von polyimiden | |
| AT323868B (de) | Verfahren zur herstellung von waschmitteln | |
| CH558792A (de) | Verfahren zur herstellung von tetrahydrodibenzopyranen. | |
| AT325785B (de) | Verfahren zur herstellung von papaverinanalogen | |
| CH556368A (de) | Verfahren zur herstellung von anthrachinonverbindungen. | |
| AT335456B (de) | Verfahren zur herstellung von cyanpyridinen | |
| AT322549B (de) | Verfahren zur herstellung von neuen anilinobenzoxazolen | |
| AT340068B (de) | Verfahren zur herstellung von pregnan-derivaten | |
| AT325017B (de) | Verfahren zur herstellung von allylacetat | |
| AT335078B (de) | Verfahren zur herstellung von 3beta-hydroxy-5alfa-cardenoliden und -bufadienoliden | |
| CH552034A (de) | Verfahren zur herstellung von neuen azopigmenten. | |
| AT358520B (de) | Verfahren zur herstellung von briketts | |
| AT335176B (de) | Verfahren zur herstellung von resolen | |
| AT340884B (de) | Verfahren zur herstellung von substituierten alkinolen | |
| AT332380B (de) | Verfahren zur herstellung von chlorameisensaurearylestern | |
| AT324318B (de) | Verfahren zur herstellung von furanderivaten | |
| AT326817B (de) | Verfahren zur herstellung von virusstämmen | |
| AT316743B (de) | Verfahren zur Herstellung von tierartspezifischen antithymocytären Seren | |
| AT317239B (de) | Verfahren zur herstellung von neuen substituierten biguaniden | |
| CH552030A (de) | Verfahren zur herstellung von pyranthronen. | |
| AT329752B (de) | Verfahren zur herstellung von hetacephalexin |