AT298489B - Verfahren zur Herstellung neuer 7-Nitro-8-hydroxy-chinolinester - Google Patents
Verfahren zur Herstellung neuer 7-Nitro-8-hydroxy-chinolinesterInfo
- Publication number
- AT298489B AT298489B AT116270A AT116270A AT298489B AT 298489 B AT298489 B AT 298489B AT 116270 A AT116270 A AT 116270A AT 116270 A AT116270 A AT 116270A AT 298489 B AT298489 B AT 298489B
- Authority
- AT
- Austria
- Prior art keywords
- nitro
- hydroxy
- preparation
- new
- quinoline esters
- Prior art date
Links
- RPJWQGVDVSVGPQ-UHFFFAOYSA-N 7-nitroquinolin-8-ol Chemical class C1=CN=C2C(O)=C([N+]([O-])=O)C=CC2=C1 RPJWQGVDVSVGPQ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
- C07D215/32—Esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
- C07D215/28—Alcohols; Ethers thereof with halogen atoms or nitro radicals in positions 5, 6 or 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT1267669 | 1969-02-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT298489B true AT298489B (de) | 1972-05-10 |
Family
ID=11142657
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT116270A AT298489B (de) | 1969-02-10 | 1970-02-09 | Verfahren zur Herstellung neuer 7-Nitro-8-hydroxy-chinolinester |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3793314A (enFirst) |
| AT (1) | AT298489B (enFirst) |
| BE (1) | BE745258A (enFirst) |
| CH (1) | CH511229A (enFirst) |
| DE (1) | DE2005959C3 (enFirst) |
| ES (1) | ES376391A1 (enFirst) |
| FI (1) | FI49032C (enFirst) |
| FR (1) | FR2034532B1 (enFirst) |
| GB (1) | GB1299753A (enFirst) |
| IL (1) | IL33560A (enFirst) |
| NL (1) | NL7000974A (enFirst) |
| NO (1) | NO130727C (enFirst) |
| SE (1) | SE349803B (enFirst) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH528214A (de) * | 1970-02-13 | 1972-09-30 | Ciba Geigy Ag | Schädlingsbekämpfungsmittel |
| US3984417A (en) * | 1971-12-27 | 1976-10-05 | Ajinomoto Co., Inc. | Method of producing active amino acid esters |
| US4168311A (en) * | 1973-12-10 | 1979-09-18 | Hoechst Aktiengesellschaft | Hydroxyquinoline carbamates and n-oxide hydroxyquinoline carbamates and their use as insecticides |
| CH577265B5 (enFirst) * | 1974-05-29 | 1976-07-15 | Ciba Geigy Ag | |
| US3997542A (en) * | 1975-06-23 | 1976-12-14 | Sterling Drug Inc. | 1-(Halogenated-acetyl)-1,2,3,4-tetrahydro-6-quinolinols and esters thereof |
| DE3621540A1 (de) * | 1986-06-27 | 1988-01-07 | Basf Ag | Chinolinderivate, verfahren zu ihrer herstellung, diese enthaltende mikrobizide und ihre verwendung zur bekaempfung von bakterien und pilzen |
| AU2022286464A1 (en) * | 2021-05-31 | 2024-01-18 | Asieris Pharmaceuticals (Shanghai) Co., Ltd. | 7-nitro-8-hydroxyquinoline derivative, preparation method therefor and medical use thereof |
| CN118546129B (zh) * | 2024-05-15 | 2025-05-16 | 中国热带农业科学院环境与植物保护研究所 | 含硫醚喹啉的香豆素类衍生物及其合成方法、应用 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1148405A (en) * | 1966-08-18 | 1969-04-10 | Produits Chemiques Soc Et | Esters derived from nitroquinoline |
-
1969
- 1969-12-18 IL IL6933560A patent/IL33560A/xx unknown
-
1970
- 1970-01-19 US US00004065A patent/US3793314A/en not_active Expired - Lifetime
- 1970-01-23 NL NL7000974A patent/NL7000974A/xx unknown
- 1970-01-28 GB GB4092/70A patent/GB1299753A/en not_active Expired
- 1970-01-30 BE BE745258D patent/BE745258A/xx unknown
- 1970-02-03 FI FI700296A patent/FI49032C/fi active
- 1970-02-06 FR FR707004270A patent/FR2034532B1/fr not_active Expired
- 1970-02-09 SE SE01589/70A patent/SE349803B/xx unknown
- 1970-02-09 ES ES376391A patent/ES376391A1/es not_active Expired
- 1970-02-09 AT AT116270A patent/AT298489B/de not_active IP Right Cessation
- 1970-02-10 NO NO462/70A patent/NO130727C/no unknown
- 1970-02-10 DE DE2005959A patent/DE2005959C3/de not_active Expired
- 1970-02-10 CH CH190970A patent/CH511229A/fr not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IL33560A (en) | 1973-04-30 |
| DE2005959A1 (de) | 1970-08-06 |
| US3793314A (en) | 1974-02-19 |
| NL7000974A (enFirst) | 1970-08-12 |
| FR2034532B1 (enFirst) | 1973-08-10 |
| GB1299753A (en) | 1972-12-13 |
| ES376391A1 (es) | 1972-04-01 |
| FR2034532A1 (enFirst) | 1970-12-11 |
| IL33560A0 (en) | 1970-02-19 |
| SE349803B (enFirst) | 1972-10-09 |
| BE745258A (fr) | 1970-07-01 |
| FI49032C (fi) | 1975-03-10 |
| NO130727C (enFirst) | 1975-01-29 |
| DE2005959B2 (de) | 1973-03-15 |
| FI49032B (enFirst) | 1974-12-02 |
| DE2005959C3 (de) | 1973-10-11 |
| NO130727B (enFirst) | 1974-10-21 |
| CH511229A (fr) | 1971-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH539012A (de) | Verfahren zur Herstellung neuer Phenoxyalkancarbonsäuren | |
| CH531000A (de) | Verfahren zur Herstellung neuer Benzocycloheptathiophene | |
| CH541565A (de) | Verfahren zur Herstellung neuer substituierter N-Allyl-2-arylamino-imidazoline-(2) | |
| AT309696B (de) | Verfahren zur Herstellung neuer D-Arabinofuranosylpurinderivate | |
| CH537410A (de) | Verfahren zur Herstellung neuer Thiazolylessigsäureester | |
| CH536803A (de) | Verfahren zur Herstellung neuer Naphthylpropionsäuren | |
| AT299917B (de) | Verfahren zur Herstellung neuer Acylaminobenzoesäurephenylester | |
| AT301752B (de) | Verfahren zur Herstellung neuer Pleuromutilin-Derivate | |
| CH537895A (de) | Verfahren zur Herstellung neuer Hydroxycrotonsäuren | |
| CH532556A (de) | Verfahren zur Herstellung neuer Hydrazon-N-dithiocarbonsäureester | |
| AT298489B (de) | Verfahren zur Herstellung neuer 7-Nitro-8-hydroxy-chinolinester | |
| AT301753B (de) | Verfahren zur Herstellung neuer Pleuromutilin-Derivate | |
| AT299916B (de) | Verfahren zur Herstellung neuer bis-Aminobenzoate | |
| AT289776B (de) | Verfahren zur Herstellung neuer 1-Carbamoyl-3-aroylpyrrolidine | |
| AT320612B (de) | Verfahren zur Herstellung neuer Alkylbenzyl-dialkylammoniumsulfonate | |
| CH530988A (de) | Verfahren zur Herstellung neuer Diallylaminoalkanoylamide | |
| CH516591A (de) | Verfahren zur Herstellung neuer Thiazolopyrrolopyrimidine | |
| AT289840B (de) | Verfahren zur Herstellung neuer O-Alkyl-O-aryl-thiolphosphorsäureester | |
| AT301036B (de) | Verfahren zur Herstellung neuer Neriifolin-Derivate | |
| CH509303A (de) | Verfahren zur Herstellung neuer Cyclopropancarbonsäureester | |
| AT305253B (de) | Verfahren zur Herstellung neuer Diphenoxyacetamide | |
| AT319914B (de) | Verfahren zur Herstellung neuer Triazapentadiene | |
| AT310147B (de) | Verfahren zur Herstellung neuer m-Benzoylphenylalkansäureester | |
| AT311568B (de) | Verfahren zur Herstellung neuer Dotriacontapeptidamide | |
| AT294842B (de) | Verfahren zur Herstellung des Chinoxalin-di-N-oxyd-aldehyds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |