AT293628B - Verfahren zur Herstellung des neuen D-6-Methyl-8-ergolin(I)ylessigsäurechlorid-Hydrochlorids - Google Patents
Verfahren zur Herstellung des neuen D-6-Methyl-8-ergolin(I)ylessigsäurechlorid-HydrochloridsInfo
- Publication number
- AT293628B AT293628B AT1053069A AT1053069A AT293628B AT 293628 B AT293628 B AT 293628B AT 1053069 A AT1053069 A AT 1053069A AT 1053069 A AT1053069 A AT 1053069A AT 293628 B AT293628 B AT 293628B
- Authority
- AT
- Austria
- Prior art keywords
- ergolin
- methyl
- new
- production
- acid chloride
- Prior art date
Links
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS192067 | 1967-03-16 | ||
| CS192267 | 1967-03-16 | ||
| CS192167 | 1967-03-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT293628B true AT293628B (de) | 1971-10-25 |
Family
ID=27179353
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT1053169A AT288608B (de) | 1967-03-16 | 1968-03-15 | Verfahren zur Herstellung der neuen D-1,6-Dimethyl-8-ergolin-(I)ylessigsäure |
| AT1053069A AT293628B (de) | 1967-03-16 | 1968-03-15 | Verfahren zur Herstellung des neuen D-6-Methyl-8-ergolin(I)ylessigsäurechlorid-Hydrochlorids |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT1053169A AT288608B (de) | 1967-03-16 | 1968-03-15 | Verfahren zur Herstellung der neuen D-1,6-Dimethyl-8-ergolin-(I)ylessigsäure |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3732231A (de) |
| AT (2) | AT288608B (de) |
| BE (1) | BE712054A (de) |
| CH (1) | CH507248A (de) |
| DE (1) | DE1695839A1 (de) |
| DK (1) | DK124080B (de) |
| FI (1) | FI48080C (de) |
| FR (1) | FR1556791A (de) |
| GB (1) | GB1199233A (de) |
| NL (1) | NL155831B (de) |
| SE (1) | SE341853B (de) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3920664A (en) * | 1972-07-21 | 1975-11-18 | Lilly Co Eli | D-2-halo-6-alkyl-8-substituted ergolines and related compounds |
| NL7400790A (de) * | 1973-02-02 | 1974-08-06 | ||
| US3901894A (en) * | 1974-06-06 | 1975-08-26 | Lilly Co Eli | 8-thiomethylergolines |
| US4348392A (en) * | 1974-07-19 | 1982-09-07 | Sandoz Ltd. | 8α-Substituted ergoline-I derivatives |
| GB1517971A (en) * | 1974-07-19 | 1978-07-19 | Sandoz Ltd | 8alpha-substituted ergoline i derivatives |
| US4001242A (en) * | 1974-08-02 | 1977-01-04 | Eli Lilly And Company | D-6-methyl-8-formyl-10α-alkoxy-8-ergolene |
| US3904757A (en) * | 1974-08-08 | 1975-09-09 | Lilly Co Eli | Treatment of parkinsonism |
| US3985752A (en) * | 1974-12-06 | 1976-10-12 | Eli Lilly And Company | 6-Methyl-8-(substituted) methylergolines |
| US3959288A (en) * | 1974-12-13 | 1976-05-25 | Eli Lilly And Company | 8-Oxymethylergolines and process therefor |
| US3992385A (en) * | 1975-01-20 | 1976-11-16 | Eli Lilly And Company | 2,3-Dihydroergolines |
| US4054660A (en) * | 1975-04-14 | 1977-10-18 | Eli Lilly And Company | Method of inhibiting prolactin |
| CS188414B1 (en) * | 1975-12-12 | 1979-03-30 | Antonin Cerny | New d-6-alkyl-8-cyanmethyl ergolines,their salts and method of producing |
| DE2656344A1 (de) * | 1975-12-23 | 1977-07-07 | Sandoz Ag | Ergolinderivate, ihre verwendung und herstellung |
| US4098790A (en) * | 1976-09-15 | 1978-07-04 | Eli Lilly And Company | Ergoline chlorination process |
| IT1158162B (it) * | 1977-12-22 | 1987-02-18 | Sandoz Ag | Composizioni farmaceutiche a base di derivati dell'ergolena e dell'ergolina |
| DE3001752A1 (de) * | 1980-01-16 | 1981-07-30 | Schering Ag Berlin Und Bergkamen, 1000 Berlin | Verfahren zur herstellung von 8(alpha)-substituierten 6-methylergolinen |
| GB2112382B (en) * | 1981-11-06 | 1985-03-06 | Erba Farmitalia | Ergoline derivatives |
| GB2120242A (en) * | 1982-04-30 | 1983-11-30 | Erba Farmitalia | Ergoline derivatives |
| US4801712A (en) * | 1985-06-24 | 1989-01-31 | Eli Lilly And Company | 2-Alkyl(or phenyl)thio-6-n-alkylergolines are dopamine D-1 antagonists without D-2 agonist activity |
| US5728457A (en) * | 1994-09-30 | 1998-03-17 | Cornell Research Foundation, Inc. | Porous polymeric material with gradients |
| KR102539788B1 (ko) | 2014-09-25 | 2023-06-07 | 베링거잉겔하임베트메디카게엠베하 | 말과 동물의 대사 장애를 예방하기 위한 sglt2 억제제와 도파민 작용제의 병용 치료 |
| US9534492B2 (en) * | 2014-11-11 | 2017-01-03 | Baker Hughes Incorporated | Pressure compensated capacitive micromachined ultrasound transducer for downhole applications |
-
1968
- 1968-03-12 CH CH360468A patent/CH507248A/de not_active IP Right Cessation
- 1968-03-12 BE BE712054D patent/BE712054A/xx unknown
- 1968-03-15 AT AT1053169A patent/AT288608B/de not_active IP Right Cessation
- 1968-03-15 DK DK111668AA patent/DK124080B/da unknown
- 1968-03-15 DE DE19681695839 patent/DE1695839A1/de active Pending
- 1968-03-15 AT AT1053069A patent/AT293628B/de not_active IP Right Cessation
- 1968-03-15 FI FI680722A patent/FI48080C/fi active
- 1968-03-15 SE SE3454/68A patent/SE341853B/xx unknown
- 1968-03-15 NL NL6803759.A patent/NL155831B/xx unknown
- 1968-03-15 GB GB12580/68A patent/GB1199233A/en not_active Expired
- 1968-03-18 FR FR1556791D patent/FR1556791A/fr not_active Expired
-
1971
- 1971-06-18 US US00154672A patent/US3732231A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FI48080C (fi) | 1974-06-10 |
| AT288608B (de) | 1971-03-10 |
| CH507248A (de) | 1971-05-15 |
| SE341853B (de) | 1972-01-17 |
| NL6803759A (de) | 1968-09-17 |
| DK124080B (da) | 1972-09-11 |
| FR1556791A (de) | 1969-02-07 |
| BE712054A (de) | 1968-07-15 |
| FI48080B (de) | 1974-02-28 |
| GB1199233A (en) | 1970-07-15 |
| NL155831B (nl) | 1978-02-15 |
| DE1695839A1 (de) | 1971-05-13 |
| US3732231A (en) | 1973-05-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT297320B (de) | Verfahren zur Herstellung von neuen Polyurethanen | |
| AT293628B (de) | Verfahren zur Herstellung des neuen D-6-Methyl-8-ergolin(I)ylessigsäurechlorid-Hydrochlorids | |
| AT288355B (de) | Verfahren zur Herstellung von neuen Phenyläthanolaminderivaten | |
| CH499489A (de) | Verfahren zur Herstellung von neuen Amino-monohalogen-phenyläthanolaminen | |
| AT257658B (de) | Verfahren zur Herstellung von neuen Dithiolphosphorsäuretriestern | |
| AT277964B (de) | Verfahren zur Herstellung von neuen Ketonitrilen | |
| AT281286B (de) | Verfahren zur Herstellung von therapeutischen Wirkstoffen | |
| AT256854B (de) | Verfahren zur Herstellung von neuen Anthranilsäurederivaten | |
| AT282577B (de) | Verfahren zur Herstellung von neuen Fluorcyanoacrylaten | |
| AT243786B (de) | Verfahren zur Herstellung von neuen Salicylsäure-Derivaten | |
| CH533113A (de) | Verfahren zur Herstellung von neuen Zimtsäureamiden | |
| AT290741B (de) | Verfahren zur Herstellung von neuen Pregnan-Derivaten | |
| AT291291B (de) | Verfahren zur Herstellung von neuen Dithiophosphaten | |
| AT278035B (de) | Verfahren zur Herstellung von neuen Benzodioxan-N-methylcarbamaten | |
| AT283610B (de) | Verfahren zur Herstellung von neuen 4-Oxasteroiden | |
| CH487145A (de) | Verfahren zur Herstellung von neuen Butoxy-dimethylbenzamiden | |
| AT279168B (de) | Verfahren zur Herstellung von neuen Polyamiden | |
| AT316541B (de) | Verfahren zur Herstellung von neuen Isoindolderivaten | |
| AT291290B (de) | Verfahren zur Herstellung von neuen, stickstoffhältigen Phosphonsäureestern | |
| AT292731B (de) | Verfahren zur Herstellung von neuen cis-Propenylphosphonsäureverbindungen | |
| CH500986A (de) | Verfahren zur Herstellung von neuen tertiären Stickstoffverbindungen | |
| AT298669B (de) | Verfahren zur Herstellung von neuen Cyclopeptiden | |
| CH507226A (de) | Verfahren zur Herstellung von neuen 3-Oxo-steroid-oximen | |
| AT283349B (de) | Verfahren zur herstellung von neuen 1-acyl-3-indolylcarbonsaeurederivaten | |
| AT279597B (de) | Verfahren zur Herstellung von neuen Isocyanaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A1J | Withdrawal paragraph 166 lit. 6 | ||
| ELJ | Ceased due to non-payment of the annual fee |