AT26644B - Verfahren zur Darstellung von Azofarbstoffen der Chinolinreich. - Google Patents
Verfahren zur Darstellung von Azofarbstoffen der Chinolinreich.Info
- Publication number
- AT26644B AT26644B AT26644DA AT26644B AT 26644 B AT26644 B AT 26644B AT 26644D A AT26644D A AT 26644DA AT 26644 B AT26644 B AT 26644B
- Authority
- AT
- Austria
- Prior art keywords
- sep
- kingdom
- quinoline
- preparation
- azo dyes
- Prior art date
Links
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 title 2
- 239000000987 azo dye Substances 0.000 title 1
- 239000002253 acid Substances 0.000 description 7
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 4
- BRKFTWHPLMMNHF-UHFFFAOYSA-N 5-amino-2-methylbenzenesulfonic acid Chemical compound CC1=CC=C(N)C=C1S(O)(=O)=O BRKFTWHPLMMNHF-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 2
- 229950000244 sulfanilic acid Drugs 0.000 description 2
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- KUDPGZONDFORKU-UHFFFAOYSA-N n-chloroaniline Chemical compound ClNC1=CC=CC=C1 KUDPGZONDFORKU-UHFFFAOYSA-N 0.000 description 1
- NRZRRZAVMCAKEP-UHFFFAOYSA-N naphthionic acid Chemical compound C1=CC=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 NRZRRZAVMCAKEP-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Separation Using Semi-Permeable Membranes (AREA)
Description
<Desc/Clms Page number 1> EMI1.1 EMI1.2 <Desc/Clms Page number 2> EMI2.1 <tb> <tb> 1. <SEP> Anilin <SEP> grünlichgelb <tb> 2. <SEP> o-Toluidin <SEP> gelb <tb> 3. <SEP> p <SEP> <SEP> chloranilin <SEP> gelb <tb> 4. <SEP> p-Nitranilin <SEP> gelb <tb> 5. <SEP> Metanilsäure <SEP> grünlichgelb <tb> 6. <SEP> Sulfanilsäure <SEP> grünlichgelb <tb> 7. <SEP> p-Toluidin-o-sulfosäure <SEP> gelb <tb> 8. <SEP> Chlormetanilsäure <SEP> (Cl <SEP> : <SEP> (N <SEP> : <SEP> S <SEP> = <SEP> 1 <SEP> : <SEP> 4 <SEP> : <SEP> 2) <SEP> gelb <tb> 9. <SEP> p-Nitranilin-o-salfosänre <SEP> bräunlicbgelb <tb> 10. <SEP> o-Amidobenzoesäure <SEP> grünlicbgeib <tb> 11. <SEP> Amidoazobenzolidsulfosäure <SEP> orange <tb> 12. <SEP> a. <SEP> -Naphtylamin <SEP> rotbraun <tb> 13. <SEP> a-Naphtylamin-4-sulfosiiure <SEP> orangerot <tb> 14, <SEP> ss-Naphtylamin-1-sulfosäure <SEP> gelborange <tb> 15, <SEP> ss-Naphtylamin-8-sulfosäure <SEP> gelborange <tb> 16, <SEP> ss-Naphtylamin-6-8-disulfosäure <SEP> bräunlichgelb. <tb> EMI2.2 EMI2.3 <tb> <tb> 1. <SEP> Metanilsnure <SEP> grünlichgelb <tb> 2. <SEP> Sulfanilsäure <SEP> grünlichgelb <tb> 3. <SEP> p-Toluidin-o-sulfosäure <SEP> gelb <tb> 4. <SEP> Chlormetanilsäure <SEP> (Cl <SEP> : <SEP> N <SEP> : <SEP> S <SEP> = <SEP> 1 <SEP> : <SEP> 4 <SEP> : <SEP> 2) <SEP> gelb <tb> u. <SEP> o-Amidobcnzoësäurc <SEP> grünlichgelh <tb> 6. <SEP> Amidoazobenzoldisulfosäuro <SEP> orange <tb> 7, <SEP> α-Naphtylamin-4-sulfosäure <SEP> orangerot <tb> 8, <SEP> ss-Naphtylamin-6-8-disulfosäure <SEP> bräunlichgelb. <tb> EMI2.4
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1904165327D DE165327C (de) | 1904-12-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT26644B true AT26644B (de) | 1906-12-10 |
Family
ID=5685108
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT26644D AT26644B (de) | 1904-12-02 | 1905-11-13 | Verfahren zur Darstellung von Azofarbstoffen der Chinolinreich. |
Country Status (1)
| Country | Link |
|---|---|
| AT (1) | AT26644B (de) |
-
1905
- 1905-11-13 AT AT26644D patent/AT26644B/de active
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT26644B (de) | Verfahren zur Darstellung von Azofarbstoffen der Chinolinreich. | |
| US2368844A (en) | Dyestuffs of the stilbene series and a process of making same | |
| ES375021A1 (es) | Procedimiento para preparar colorantes reactivos de la se- rie triazinica o pirimidinica. | |
| US1861323A (en) | Stilbene dyestuffs and process of making same | |
| AT8080B (de) | Verfahren zur Darstellung von substantiven Azofarbstoffen aus Thiocarbonyldioxydinaphtylamindisulfosäure. | |
| AT33991B (de) | Verfahren zur Darstellung von stickstoffhaltigen Anthrachinonderivaten. | |
| US2183489A (en) | Monoazo dyestuffs | |
| AT29880B (de) | Verfahren zur Darstellung von Azofarbstoffen. | |
| US2449130A (en) | Acid chromable monoazo dyestuffs and a process of making same | |
| US2091463A (en) | Water-soluble basic triphenyl-methane dyestuffs | |
| US1509442A (en) | Azo dyes | |
| US1467711A (en) | Process for the manufacture of intermediate products and new dyestuffs derived from diarylsulphones | |
| US1766947A (en) | Manufacture of new azo dyestuffs | |
| US2073728A (en) | Process for the manufacture of chromatable azo dyestuffs of the pyrazolone series | |
| AT28707B (de) | Verfahren zur Darstellung von o-Oxyazofarbstoffen aus 1.5-Amidonaphtol. | |
| AT63834B (de) | Verfahren zur Darstellung von Chromderivaten von Hydroxyl- und Sulfogruppen enthaltenden Verbindungen. | |
| US2387848A (en) | Azo dyestuff derivatives of 5-amino-1,3-benzodioxole | |
| US2191823A (en) | Azo dyestuffs | |
| GB468686A (en) | Improvements in the manufacture and production of vat dyestuffs of the anthraquinone series | |
| AT45026B (de) | Verfahren zur Darstellung von sauren Wollfarbstoffen der Anthracenreihe. | |
| US2306681A (en) | Water-insoluble azo dyestuffs | |
| US2239005A (en) | Hexakisazo dyestuffs and their manufacture | |
| AT35430B (de) | Verfahren zur Darstellung von stickstoffhaltigen Anthracenderivaten. | |
| GB1216576A (en) | 2:1-metal complex monoazo dyestuffs and a process for their manufacture | |
| US2120560A (en) | Azo dyestuffs and their production |