AT260228B - Verfahren zur Herstellung neuer Nitrofuran- und Nitrothiophenderivate - Google Patents
Verfahren zur Herstellung neuer Nitrofuran- und NitrothiophenderivateInfo
- Publication number
- AT260228B AT260228B AT630866A AT630866A AT260228B AT 260228 B AT260228 B AT 260228B AT 630866 A AT630866 A AT 630866A AT 630866 A AT630866 A AT 630866A AT 260228 B AT260228 B AT 260228B
- Authority
- AT
- Austria
- Prior art keywords
- production
- nitrofuran
- nitrothiophene
- derivatives
- new
- Prior art date
Links
- JIZRGGUCOQKGQD-UHFFFAOYSA-N 2-nitrothiophene Chemical class [O-][N+](=O)C1=CC=CS1 JIZRGGUCOQKGQD-UHFFFAOYSA-N 0.000 title 1
- IAIWVQXQOWNYOU-FPYGCLRLSA-N nitrofural Chemical compound NC(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 IAIWVQXQOWNYOU-FPYGCLRLSA-N 0.000 title 1
- 229960001907 nitrofurazone Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB0082651 | 1965-07-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT260228B true AT260228B (de) | 1968-02-12 |
Family
ID=6981583
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT630866A AT260228B (de) | 1965-07-02 | 1966-07-01 | Verfahren zur Herstellung neuer Nitrofuran- und Nitrothiophenderivate |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3483193A (enFirst) |
| AT (1) | AT260228B (enFirst) |
| CH (1) | CH472426A (enFirst) |
| DE (1) | DE1545598A1 (enFirst) |
| GB (1) | GB1079196A (enFirst) |
| NL (2) | NL6609264A (enFirst) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH535225A (de) * | 1969-03-29 | 1973-03-31 | Schering Ag | Verfahren zur Herstellung von heterocyclischen Nitroverbindungen |
| DE2202745A1 (de) * | 1972-01-21 | 1973-07-26 | Boehringer Mannheim Gmbh | Nitrofuryl-triazolo eckige klammer auf 4,3-b eckige klammer zu-pyridazin-carbonsaeurederivate |
| DE2202744A1 (de) * | 1972-01-21 | 1973-07-26 | Boehringer Mannheim Gmbh | Nitrofuryl-triazolo eckige klammer auf 4,3-b eckige klammer zu-pyridazin-amide |
| PL91799B1 (enFirst) * | 1972-04-01 | 1977-03-31 | ||
| US3989832A (en) * | 1972-04-01 | 1976-11-02 | Boehringer Mannheim G.M.B.H. | Combating bacteria with nitroimidazolyl-triazolo-pyridiazine compounds |
| US4136182A (en) * | 1976-05-26 | 1979-01-23 | The Dow Chemical Company | Triazolopyridazines used to alleviate bronchial spasms |
| US4112095A (en) * | 1976-10-07 | 1978-09-05 | American Cyanamid Company | 6-Phenyl-1,2,4-triazolo[4,3-b]pyridazine hypotensive agents |
| US4526890A (en) * | 1979-10-29 | 1985-07-02 | The Dow Chemical Company | 3,6,7,8-Substituted-s-triazolo[4,3-b]pyridazines as bronchodilators |
| US4487930A (en) * | 1982-09-07 | 1984-12-11 | The Dow Chemical Company | 6-[(Cyclic amino)alkylamino]-tetrahydrotriazolo[3,4-a]phthalazines |
| HRP20170103T1 (hr) | 2005-12-21 | 2017-03-24 | Janssen Pharmaceutica N.V. | Triazolopiridazini kao modulatori tirozin kinaze |
| PT2464645T (pt) * | 2009-07-27 | 2017-10-11 | Gilead Sciences Inc | Compostos heterocíclicos fusionados como moduladores do canal de iões |
| PT2707361T (pt) | 2011-05-10 | 2017-11-28 | Gilead Sciences Inc | Compostos heterocíclicos fusionados como moduladores do canal de sódio |
| NO3175985T3 (enFirst) | 2011-07-01 | 2018-04-28 | ||
| TWI622583B (zh) | 2011-07-01 | 2018-05-01 | 基利科學股份有限公司 | 作為離子通道調節劑之稠合雜環化合物 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE630163A (enFirst) * | 1962-03-28 | |||
| US3330724A (en) * | 1965-12-17 | 1967-07-11 | Salsbury Lab | Nitrofuran derivatives for treating coccidiosis |
| US3407195A (en) * | 1967-04-03 | 1968-10-22 | Norwich Pharma Co | 4-methyl-1-(5-nitrofurfurylideneamino)-2-imidazolidinone |
-
0
- NL NL128591D patent/NL128591C/xx active
-
1965
- 1965-07-02 DE DE19651545598 patent/DE1545598A1/de active Pending
-
1966
- 1966-06-27 GB GB28632/66A patent/GB1079196A/en not_active Expired
- 1966-06-29 CH CH942066A patent/CH472426A/de not_active IP Right Cessation
- 1966-06-29 US US561359A patent/US3483193A/en not_active Expired - Lifetime
- 1966-07-01 NL NL6609264A patent/NL6609264A/xx unknown
- 1966-07-01 AT AT630866A patent/AT260228B/de active
Also Published As
| Publication number | Publication date |
|---|---|
| GB1079196A (en) | 1967-08-16 |
| DE1545598A1 (de) | 1969-11-27 |
| US3483193A (en) | 1969-12-09 |
| CH472426A (de) | 1969-05-15 |
| NL6609264A (enFirst) | 1967-01-03 |
| NL128591C (enFirst) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT272530B (de) | Verfahren zur Herstellung von neuen Thebain- und Oripavinderivaten | |
| AT260228B (de) | Verfahren zur Herstellung neuer Nitrofuran- und Nitrothiophenderivate | |
| CH547816A (de) | Verfahren zur herstellung von aminothiophen-derivaten. | |
| AT294331B (de) | Verfahren zur Herstellung neuer Isoxazolderivate | |
| CH474486A (de) | Verfahren zur Herstellung neuer Diphenylharnstoffe | |
| CH505805A (de) | Verfahren zur Herstellung neuer Bisnorcholanderivate | |
| AT279636B (de) | Verfahren zur Herstellung neuer Benzomorphanderivate | |
| CH519488A (de) | Verfahren zur Herstellung neuer 19-Nor-androstatriene | |
| CH446340A (de) | Verfahren zur Herstellung neuer Phenthiazinderivate | |
| CH467786A (de) | Verfahren zur Herstellung neuer Chinazolin-Derivate | |
| CH467789A (de) | Verfahren zur Herstellung neuer Diazepin-Derivate | |
| AT256848B (de) | Verfahren zur Herstellung neuer Oxepinderivate | |
| CH507286A (de) | Verfahren zur Herstellung von Nitrofuranderivaten | |
| CH467800A (de) | Verfahren zur Herstellung neuer Diazepin-Derivate | |
| AT256097B (de) | Verfahren zur Herstellung neuer Indolderivate | |
| AT266106B (de) | Verfahren zur Herstellung neuer Nitrofuranderivate | |
| AT307633B (de) | Verfahren zur Herstellung von neuer 18-Methyl-5α-H-androstan-derivate | |
| CH464935A (de) | Verfahren zur Herstellung neuer Chinazolinonderivate | |
| AT275513B (de) | Verfahren zur Herstellung von neuen Thiazolderivaten | |
| AT261819B (de) | Verfahren zur Herstellung neuer Gonanderivate | |
| CH467793A (de) | Verfahren zur Herstellung neuer Ergolen-Derivate | |
| CH467776A (de) | Verfahren zur Herstellung neuer Indol-Derivate | |
| AT261598B (de) | Verfahren zur Herstellung von Nitrofuranderivaten | |
| AT265254B (de) | Verfahren zur Herstellung von neuen Rhodaninderivaten | |
| CH477432A (de) | Verfahren zur Herstellung von Benzofuranderivaten |