AT184919B - Verfahren zur Herstellung von neuen Estern der Bixine - Google Patents
Verfahren zur Herstellung von neuen Estern der BixineInfo
- Publication number
- AT184919B AT184919B AT184919DA AT184919B AT 184919 B AT184919 B AT 184919B AT 184919D A AT184919D A AT 184919DA AT 184919 B AT184919 B AT 184919B
- Authority
- AT
- Austria
- Prior art keywords
- bixine
- production
- new esters
- esters
- new
- Prior art date
Links
- RAFGELQLHMBRHD-UHFFFAOYSA-N 20-methoxy-4,8,13,17-tetramethyl-20-oxoicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid Chemical compound COC(=O)C=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC(O)=O RAFGELQLHMBRHD-UHFFFAOYSA-N 0.000 title 1
- 150000002148 esters Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/52—Esters of acyclic unsaturated carboxylic acids having the esterified carboxyl group bound to an acyclic carbon atom
- C07C69/602—Dicarboxylic acid esters having at least two carbon-to-carbon double bonds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH314001T | 1952-12-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT184919B true AT184919B (de) | 1956-03-10 |
Family
ID=4495426
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT184919D AT184919B (de) | 1952-12-18 | 1953-12-07 | Verfahren zur Herstellung von neuen Estern der Bixine |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US2768198A (de) |
| AT (1) | AT184919B (de) |
| CH (1) | CH314001A (de) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2830908A (en) * | 1955-05-09 | 1958-04-15 | Pfizer & Co C | Food color and method of preparing the same |
| US2891087A (en) * | 1955-07-25 | 1959-06-16 | Pfizer & Co C | Bixin and nor-bixin esters |
| BR0207405B1 (pt) | 2001-02-23 | 2012-09-18 | novos ésteres carotenóides. | |
| US20050026874A1 (en) * | 2002-07-29 | 2005-02-03 | Lockwood Samuel Fournier | Carotenoid ether analogs or derivatives for the inhibition and amelioration of liver disease |
| US20050059659A1 (en) * | 2002-07-29 | 2005-03-17 | Lockwood Samuel Fournier | Carotenoid analogs or derivatives for controlling C-reactive protein levels |
| US7320997B2 (en) * | 2002-07-29 | 2008-01-22 | Cardax Pharmaceuticals, Inc. | Pharmaceutical compositions including carotenoid ester analogs or derivatives for the inhibition and amelioration of disease |
| US20050004235A1 (en) * | 2002-07-29 | 2005-01-06 | Lockwood Samuel Fournier | Carotenoid analogs or derivatives for the inhibition and amelioration of liver disease |
| US7521584B2 (en) * | 2002-07-29 | 2009-04-21 | Cardax Pharmaceuticals, Inc. | Carotenoid analogs or derivatives for the inhibition and amelioration of disease |
| US7375133B2 (en) | 2002-07-29 | 2008-05-20 | Cardax Pharmaceuticals, Inc. | Pharmaceutical compositions including carotenoid ether analogs or derivatives for the inhibition and amelioration of disease |
| US20050148517A1 (en) * | 2002-07-29 | 2005-07-07 | Lockwood Samuel F. | Carotenoid ether analogs or derivatives for controlling connexin 43 expression |
| US20050049248A1 (en) * | 2002-07-29 | 2005-03-03 | Lockwood Samuel Fournier | Carotenoid ether analogs or derivatives for controlling C-reactive protein levels |
| CN101845009B (zh) * | 2002-07-29 | 2012-10-03 | 卡达克斯药物公司 | 用于抑制和改善疾病的类胡萝卜素结构类似物 |
| US7345091B2 (en) * | 2002-07-29 | 2008-03-18 | Cardax Pharmaceuticals, Inc. | Carotenoid ether analogs or derivatives for the inhibition and amelioration of disease |
| US7763649B2 (en) * | 2002-07-29 | 2010-07-27 | Cardax Pharmaceuticals, Inc. | Carotenoid analogs or derivatives for controlling connexin 43 expression |
| US20050059635A1 (en) * | 2002-07-29 | 2005-03-17 | Lockwood Samuel Fournier | Carotenoid ester analogs or derivatives for controlling C-reactive protein levels |
| US7723327B2 (en) * | 2002-07-29 | 2010-05-25 | Cardax Pharmaceuticals, Inc. | Carotenoid ester analogs or derivatives for the inhibition and amelioration of liver disease |
| US20050009788A1 (en) * | 2002-07-29 | 2005-01-13 | Lockwood Samuel Fournier | Carotenoid ester analogs or derivatives for controlling connexin 43 expression |
| US7189218B2 (en) * | 2003-08-07 | 2007-03-13 | Edward Lichtenberg | Needle apparatus with quick/safe release mechanism |
| US20090099061A1 (en) * | 2006-01-27 | 2009-04-16 | Foss Bente J | Synthesis of carotenoid analogs or derivatives with improved antioxidant characteristics |
| WO2008118862A1 (en) * | 2007-03-23 | 2008-10-02 | Cardax Pharmaceuticals, Inc. | Carotenoid analogs and derivatives for the prevention of platelet aggregation |
| KR101194337B1 (ko) * | 2010-07-14 | 2012-10-24 | 웅진코웨이주식회사 | 레티노이드 유도체 및 그를 포함하는 화장료 조성물 |
-
1952
- 1952-12-18 CH CH314001D patent/CH314001A/de unknown
-
1953
- 1953-12-07 AT AT184919D patent/AT184919B/de active
- 1953-12-17 US US398884A patent/US2768198A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CH314001A (de) | 1956-05-31 |
| US2768198A (en) | 1956-10-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT192742B (de) | Verfahren zur Herstellung von Nahrungsmitteln | |
| AT184919B (de) | Verfahren zur Herstellung von neuen Estern der Bixine | |
| CH322260A (de) | Verfahren zur Herstellung von N-Methylol-polypyrrolidonen | |
| CH322870A (de) | Verfahren zur Herstellung von Terephthalsäure | |
| AT185367B (de) | Verfahren zur Herstellung von neuen Phenthiazinderivaten | |
| AT180566B (de) | Verfahren zur Herstellung von neuen Estern der Karbaminsäure mit Acetylenalkoholen | |
| AT187520B (de) | Verfahren zur Herstellung von neuen Cumarinderivaten | |
| AT184910B (de) | Verfahren zur Herstellung von neuen Salicylaniliden | |
| AT184297B (de) | Verfahren zur Herstellung von neuen Penicillinestern | |
| AT184296B (de) | Verfahren zur Herstellung von neuen Penicillinestern | |
| AT183175B (de) | Verfahren zur Herstellung von neuen Penicillinestern | |
| AT178907B (de) | Verfahren zur Herstellung von neuen Urethanen | |
| AT195905B (de) | Verfahren zur Herstellung des neuen Lactons der δ-Hydroxy-dodekansäure | |
| AT196398B (de) | Verfahren zur Herstellung von neuen Estern | |
| AT196397B (de) | Verfahren zur Herstellung von neuen Estern | |
| AT176308B (de) | Verfahren zur Herstellung von neuen Estern | |
| CH315546A (de) | Verfahren zur Herstellung von Kunstfaden | |
| AT177786B (de) | Verfahren zur Herstellung von Plakaten | |
| AT183753B (de) | Verfahren zur Herstellung von Acetessigestern | |
| AT187246B (de) | Verfahren zur Herstellung von neuen Estern von Hormonen der Cyclopentanopolyhydrophenanthrenreihe | |
| AT178904B (de) | Verfahren zur Herstellung von neuen Urethanen | |
| AT178905B (de) | Verfahren zur Herstellung von neuen Urethanen | |
| AT180932B (de) | Verfahren zur Herstellung von Estern | |
| AT180062B (de) | Verfahren zur Herstellung von Chlorurethanen | |
| AT178355B (de) | Verfahren zur Herstellung von Sulfanilguanidin |