ZA807578B - Crystalline 4,1',6'-trichloro-4,1',6'-trideoxy-galactosucrose - Google Patents
Crystalline 4,1',6'-trichloro-4,1',6'-trideoxy-galactosucroseInfo
- Publication number
- ZA807578B ZA807578B ZA00807578A ZA807578A ZA807578B ZA 807578 B ZA807578 B ZA 807578B ZA 00807578 A ZA00807578 A ZA 00807578A ZA 807578 A ZA807578 A ZA 807578A ZA 807578 B ZA807578 B ZA 807578B
- Authority
- ZA
- South Africa
- Prior art keywords
- galactosucrose
- trideoxy
- trichloro
- crystalline
- Prior art date
Links
- BAQAVOSOZGMPRM-UHFFFAOYSA-N sucralose Chemical compound OC1C(O)C(Cl)C(CO)OC1OC1(CCl)C(O)C(O)C(CCl)O1 BAQAVOSOZGMPRM-UHFFFAOYSA-N 0.000 title 1
- 235000019408 sucralose Nutrition 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7943491A GB2034323B (en) | 1978-12-18 | 1979-12-18 | Production of dna comprising the b hepatitis viral genome |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA807578B true ZA807578B (en) | 1981-11-25 |
Family
ID=10509914
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00807578A ZA807578B (en) | 1979-12-18 | 1980-12-04 | Crystalline 4,1',6'-trichloro-4,1',6'-trideoxy-galactosucrose |
Country Status (2)
| Country | Link |
|---|---|
| JP (1) | JPS5697297A (ref) |
| ZA (1) | ZA807578B (ref) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU6167598A (en) * | 1997-02-13 | 1998-09-08 | Mcneil-Ppc, Inc. | Chromatographic purification of chlorinated sucrose |
| US6646121B2 (en) * | 2000-11-17 | 2003-11-11 | Mcneil-Ppc, Inc. | Sucralose composition and process for its preparation |
| US6998480B2 (en) * | 2002-03-08 | 2006-02-14 | Tate & Lyle Public Limited Company | Process for improving sucralose purity and yield |
| US7049435B2 (en) * | 2002-03-08 | 2006-05-23 | Tate & Lyle Public Limited Company | Extractive methods for purifying sucralose |
| KR20070048702A (ko) * | 2004-07-29 | 2007-05-09 | 엔스이코 세이토 가부시키가이샤 | 결정 락토수크로오스 또는 이를 함유하는 당밀 및 그 용도 |
-
1980
- 1980-12-04 ZA ZA00807578A patent/ZA807578B/xx unknown
- 1980-12-18 JP JP17967580A patent/JPS5697297A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6254434B2 (ref) | 1987-11-14 |
| JPS5697297A (en) | 1981-08-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3065399D1 (en) | Crystalline 4,1',6'-trichloro-4,1',6'-trideoxy-galactosucrose | |
| DE3062467D1 (en) | Process for the preparation of 4,1',6'-trichloro-4,1',6'-trideoxy-galactosucrose | |
| GB2064520B (en) | A-aryl-1h-1,2,4-triazole-1-ethanols | |
| GB2041361B (en) | 1,2-dihydro-2-oxo-4-phenyl-3-quinolinecarbonitrile derivatives | |
| IL59829A0 (en) | Substituted 9,10-anthracene-bishydrazones | |
| GB2058767B (en) | 4'-substituted-4,5',8-trialklpsoralens | |
| GB2058766B (en) | 5'-aminoalkyl-4,4'-dialkylpsoralens | |
| GB2065646B (en) | Crystalline 4,1',6'-trichloro-4,1',6'-trideoxygalactosucrose | |
| GB2065648B (en) | Preparation of 4,1',6'-trichloro-4,1',6'-trideoxgalactosucrose | |
| ZA807494B (en) | 2,3-indoledione derivatives | |
| NZ193666A (en) | 3-aryl-2-(2,3-dihydrothiazol-2-ylidene)-3-oxopropionitriles | |
| PH18722A (en) | Crystalline 1,1-dioxopeniciliianoyloxymethyl-6-(o- -phenylacetamido)penicillante | |
| ZA807578B (en) | Crystalline 4,1',6'-trichloro-4,1',6'-trideoxy-galactosucrose | |
| GB2061713B (en) | Pouches | |
| ZA804183B (en) | 1,2,4-thiadiazolyloxyphenylureas | |
| JPS55143992A (en) | Crystallization | |
| JPS6485961A (en) | 3,5-cyclovitamine derivative | |
| PH16262A (en) | Herbicidal 1,2,4-benzotriazines | |
| IL59681A0 (en) | 2,o-dihydro-1,j-bezodioxane derivatives | |
| CS515881A2 (en) | Zpusob pripravy oktahydropyrazolo(3,4 g) chinolinu | |
| ZA833346B (en) | Crystalline 9-deoxo-9-methylene-16,16-dimethyl-pge2 | |
| GB2118169B (en) | 1,1,1-trichlorotriacontane | |
| GB2042519B (en) | 1,1,2-triphenylethane and -ehylene derivatives | |
| GB2066814B (en) | Herbicidal 2,5-dialkylphenylurea derivatives | |
| JPS5672625A (en) | Rake |