ZA802088B - Veterinary medicament based on benzoquinolizine carboxylic acids and theirderivatives - Google Patents
Veterinary medicament based on benzoquinolizine carboxylic acids and theirderivativesInfo
- Publication number
- ZA802088B ZA802088B ZA00802088A ZA802088A ZA802088B ZA 802088 B ZA802088 B ZA 802088B ZA 00802088 A ZA00802088 A ZA 00802088A ZA 802088 A ZA802088 A ZA 802088A ZA 802088 B ZA802088 B ZA 802088B
- Authority
- ZA
- South Africa
- Prior art keywords
- theirderivatives
- carboxylic acids
- medicament based
- veterinary medicament
- benzoquinolizine carboxylic
- Prior art date
Links
- SWWBKIRNVOWLRS-UHFFFAOYSA-N 4h-benzo[a]quinolizine-1-carboxylic acid Chemical class C1=CC=C2C3=C(C(=O)O)C=CCN3C=CC2=C1 SWWBKIRNVOWLRS-UHFFFAOYSA-N 0.000 title 1
- 239000003814 drug Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D455/00—Heterocyclic compounds containing quinolizine ring systems, e.g. emetine alkaloids, protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine
- C07D455/03—Heterocyclic compounds containing quinolizine ring systems, e.g. emetine alkaloids, protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine containing quinolizine ring systems directly condensed with at least one six-membered carbocyclic ring, e.g. protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine
- C07D455/04—Heterocyclic compounds containing quinolizine ring systems, e.g. emetine alkaloids, protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine containing quinolizine ring systems directly condensed with at least one six-membered carbocyclic ring, e.g. protoberberine; Alkylenedioxy derivatives of dibenzo [a, g] quinolizines, e.g. berberine containing a quinolizine ring system condensed with only one six-membered carbocyclic ring, e.g. julolidine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT21723/79A IT1111918B (it) | 1979-04-10 | 1979-04-10 | Medicamento veterinario a base di acidi benzochinolizin carbossilici e loro derivati |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA802088B true ZA802088B (en) | 1981-08-26 |
Family
ID=11185937
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00802088A ZA802088B (en) | 1979-04-10 | 1980-04-09 | Veterinary medicament based on benzoquinolizine carboxylic acids and theirderivatives |
Country Status (7)
| Country | Link |
|---|---|
| AU (1) | AU5728280A (ref) |
| FR (1) | FR2453647A1 (ref) |
| GB (1) | GB2049420A (ref) |
| IE (1) | IE52296B1 (ref) |
| IT (1) | IT1111918B (ref) |
| NZ (1) | NZ193374A (ref) |
| ZA (1) | ZA802088B (ref) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4380543A (en) * | 1981-11-06 | 1983-04-19 | Riker Laboratories, Inc. | Antimicrobial 8-cyano-6,7-dihydro-5-methyl-1-oxo-1H,5H-benzo[ij]quinolizine-2-carboxylic acids |
| HU206975B (en) * | 1991-03-14 | 1993-03-01 | Reanal Finomvegyszergyar | Process for producing granulation and veterinary composition comprising water-soluble flumequine complex |
| HUP9601361A3 (en) * | 1996-05-21 | 1999-04-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing optically active compounds |
| HUP9601362A3 (en) * | 1996-05-21 | 1999-04-28 | Chinoin Gyogyszer Es Vegyeszet | Process for producing optically active compounds |
-
1979
- 1979-04-10 IT IT21723/79A patent/IT1111918B/it active
-
1980
- 1980-04-09 NZ NZ193374A patent/NZ193374A/xx unknown
- 1980-04-09 IE IE712/80A patent/IE52296B1/en not_active IP Right Cessation
- 1980-04-09 AU AU57282/80A patent/AU5728280A/en not_active Withdrawn
- 1980-04-09 ZA ZA00802088A patent/ZA802088B/xx unknown
- 1980-04-10 FR FR8008061A patent/FR2453647A1/fr active Granted
- 1980-04-10 GB GB8011882A patent/GB2049420A/en not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| FR2453647B1 (ref) | 1983-12-23 |
| AU5728280A (en) | 1980-10-16 |
| IT1111918B (it) | 1986-01-13 |
| IE800712L (en) | 1980-10-10 |
| NZ193374A (en) | 1982-12-07 |
| IE52296B1 (en) | 1987-09-02 |
| IT7921723A0 (it) | 1979-04-10 |
| FR2453647A1 (fr) | 1980-11-07 |
| GB2049420A (en) | 1980-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU528388B2 (en) | 4-amino-3-quinolinecarboxylic acids and esters | |
| CY1198A (en) | Androstadiene-17-carboxylic acids and their esters | |
| GB2066243B (en) | Iminothioacyldihydropyrazole carboxylic acid derivatives iminothioacylproline derivatives and related compounds | |
| ZA784094B (en) | Imidazole carboxylic acids and derivatives thereof | |
| DE3064453D1 (en) | Isoquinoline acetic acids and pharmaceutical compositions thereof | |
| NZ195415A (en) | Oxocarboxylic acids and medicaments | |
| JPS55122766A (en) | Mercaptoacyldihydropyrazole carboxylic acid derivative and its manufacture | |
| JPS57183772A (en) | Aminocyclopentanol acids and esters, manufacture and medicinal composition | |
| GB2040287B (en) | 6-alkyl-1,2-dihydro-2-oxonicotinic acids and esters | |
| ZA806026B (en) | 2-amino-4-substituted-5-thiazolecarboxylic acids and their derivatives | |
| ZA803668B (en) | Aryloxyalkylaminobenzoic acids, salts and esters thereof | |
| NZ194241A (en) | 7b-aminothiadiazolylacetamido-3-cephem-4 carboxylic acid derivatives and pharmaceutical compositions | |
| AU535316B2 (en) | Acids and esters | |
| AU2266077A (en) | 15, 16-dioxy prostenoic acids and esters | |
| GB2000505B (en) | 2-alkoxyalkoxy-5-nitrobenzenesulphonic acids and salts thereof | |
| JPS55127374A (en) | Mercaptoacylpyrazolidinone carboxylic acid derivative and its manufacture | |
| PT69411A (en) | 4-halo etianic acids and derivatives thereof | |
| ZA764557B (en) | 6,11-dihydro-11-oxodibenz7b,e)oxepinalkanoic acids and esters thereof | |
| AU3462178A (en) | Prostenoic acids and esters | |
| IE791375L (en) | Alpha-vinyl-amino acids and esters. | |
| IE850238L (en) | Acyldihydropyrazole carboxylic acid and acylproline¹derivatives. | |
| AU544054B2 (en) | Dithioacyldihydropyrazole carboxylic acid derivatives and dithioacylproline derivatives | |
| IL52123A (en) | 7-acylamino-3-pyrazinylthiomethyl-3-cephem-4-carboxylic acids and preparation thereof | |
| JPS55143991A (en) | Clavulanic acid derivative*its manufacture and its use | |
| IE782268L (en) | Ketogulonic and ketogluconic acids |