ZA76905B - 4,4-diphenylcyclohexylpiperidine compounds and analogs thereof - Google Patents
4,4-diphenylcyclohexylpiperidine compounds and analogs thereofInfo
- Publication number
- ZA76905B ZA76905B ZA905A ZA76905A ZA76905B ZA 76905 B ZA76905 B ZA 76905B ZA 905 A ZA905 A ZA 905A ZA 76905 A ZA76905 A ZA 76905A ZA 76905 B ZA76905 B ZA 76905B
- Authority
- ZA
- South Africa
- Prior art keywords
- diphenylcyclohexylpiperidine
- analogs
- compounds
- diphenylcyclohexylpiperidine compounds
- Prior art date
Links
- OHXWXHRQMUXFPG-UHFFFAOYSA-N 1-(4,4-diphenylcyclohexyl)piperidine Chemical class C1CCCCN1C1CCC(C=2C=CC=CC=2)(C=2C=CC=CC=2)CC1 OHXWXHRQMUXFPG-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/60—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D211/62—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4
- C07D211/66—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4 having a hetero atom as the second substituent in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/52—Oxygen atoms attached in position 4 having an aryl radical as the second substituent in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP50025170A JPS51100084A (cs) | 1975-02-28 | 1975-02-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA76905B true ZA76905B (en) | 1977-01-26 |
Family
ID=12158519
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA905A ZA76905B (en) | 1975-02-28 | 1976-02-16 | 4,4-diphenylcyclohexylpiperidine compounds and analogs thereof |
Country Status (3)
| Country | Link |
|---|---|
| JP (1) | JPS51100084A (cs) |
| BE (1) | BE838810A (cs) |
| ZA (1) | ZA76905B (cs) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE212635T1 (de) * | 1997-12-05 | 2002-02-15 | 1,3,8-triazaspiro(4,5)decan-4-on-derivate |
-
1975
- 1975-02-28 JP JP50025170A patent/JPS51100084A/ja active Pending
-
1976
- 1976-02-16 ZA ZA905A patent/ZA76905B/xx unknown
- 1976-02-20 BE BE164528A patent/BE838810A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS51100084A (cs) | 1976-09-03 |
| BE838810A (fr) | 1976-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PH20254A (en) | 1,2 dihydro-2-oxo-(pyridiny,) nicotinanide | |
| NZ181619A (en) | 1-aminoalkoxy-4-substituted-1 2, 3, 4-tetrahydroiso-quinolines | |
| NZ181789A (en) | 5(6)-substituted-1-hydrocarbylulphanyl-2-amino-bezimidazoles | |
| JPS51107904A (en) | Tokuni torakutaa no 3 tenbokikonotameno renketsuyokaki | |
| GB1520958A (en) | 11-deoxy-16-aryl - 17,18,19,20 - tetranorprostaglandins | |
| NZ183651A (en) | Tribalo-n-alkyl-2',4',6'-trinitrodiphenylamines | |
| GB1532697A (en) | 2,3-dihydroergolines | |
| JPS51102842A (en) | Jido 2 rinshanofureemu | |
| AU1214076A (en) | 2,3-dihalogen-alkanoyl-ureas | |
| PH14168A (en) | 2,4-pyrrolidinediones | |
| GB1557694A (en) | 2,9 dichlorquinacridone | |
| EG12183A (en) | 2-chloro-n-isoproyl-2',3'-imethylacetanilide | |
| GB1483330A (en) | 2,5-dimethoxy-4-chloroaniline | |
| GB1554021A (en) | 4,5-didehydroprostaglandins | |
| NZ182127A (en) | 6 ,17 -dihydroxy-1 -loweralkoxycarbonyl-3-oxo-17 -pregn-4-ene-21-carboxylic acid -lactones | |
| GB1554925A (en) | 2,3-methyl-eneprostaglandins | |
| ZA766301B (en) | Substituted 2,1,3-benzothiadiazine | |
| AU1724576A (en) | 2,4-diamino-5-benzylpyrimidines | |
| AU1483576A (en) | 16,16-dimethyl-prostaglandins | |
| JPS51105080A (en) | 55 furuororashirujudotainoseizohoho | |
| ZA76905B (en) | 4,4-diphenylcyclohexylpiperidine compounds and analogs thereof | |
| GB1486546A (en) | 4,4-diphenyl-cyclohexylpiperidine compounds and analogues thereof | |
| PH15282A (en) | 1,2-dihydro-6-phenyl-1h-imidazo-benzodiazepin-1-ones | |
| JPS51101911A (en) | Tansosu 334 no fuhowaarudehidono seizoho | |
| JPS5199224A (en) | 3 soburitsujigatainbaata no fukadenatsuhakeikairyokairo |