ZA762294B - 2-(3-(4-azatricyclo(4.3.1.13,8)undecan-4-yl)-1,1-diphenylpropyl)-5-methyl-1,3,4-oxadiazole and congeners - Google Patents
2-(3-(4-azatricyclo(4.3.1.13,8)undecan-4-yl)-1,1-diphenylpropyl)-5-methyl-1,3,4-oxadiazole and congenersInfo
- Publication number
- ZA762294B ZA762294B ZA762294A ZA762294A ZA762294B ZA 762294 B ZA762294 B ZA 762294B ZA 762294 A ZA762294 A ZA 762294A ZA 762294 A ZA762294 A ZA 762294A ZA 762294 B ZA762294 B ZA 762294B
- Authority
- ZA
- South Africa
- Prior art keywords
- azatricyclo
- diphenylpropyl
- undecan
- congeners
- oxadiazole
- Prior art date
Links
- YIDCNTPGTKCMED-UHFFFAOYSA-N 2-{3-[4-azatricyclo(4.3.1.13,8)undecan-4-yl]-1,1-diphenylpropyl}-5-methyl-1,3,4-oxadiazole Chemical compound O1C(C)=NN=C1C(C=1C=CC=CC=1)(C=1C=CC=CC=1)CCN1C(C2)CC(C3)CC2CC3C1 YIDCNTPGTKCMED-UHFFFAOYSA-N 0.000 title 1
- 239000000039 congener Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/14—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05568405 USB568405I5 (cg-RX-API-DMAC10.html) | 1975-04-16 | 1975-04-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA762294B true ZA762294B (en) | 1977-05-25 |
Family
ID=24271149
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA762294A ZA762294B (en) | 1975-04-16 | 1976-04-15 | 2-(3-(4-azatricyclo(4.3.1.13,8)undecan-4-yl)-1,1-diphenylpropyl)-5-methyl-1,3,4-oxadiazole and congeners |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | USB568405I5 (cg-RX-API-DMAC10.html) |
| BE (1) | BE840796A (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA762294B (cg-RX-API-DMAC10.html) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1498701A (cg-RX-API-DMAC10.html) * | 1965-10-04 | 1968-01-08 |
-
1975
- 1975-04-16 US US05568405 patent/USB568405I5/en active Pending
-
1976
- 1976-04-15 ZA ZA762294A patent/ZA762294B/xx unknown
- 1976-04-15 BE BE166201A patent/BE840796A/fr unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE840796A (fr) | 1976-10-15 |
| USB568405I5 (cg-RX-API-DMAC10.html) | 1976-03-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB2010259B (en) | 2-halomethyl-5-vinyl-1,3,4-oxadiazole | |
| NZ187921A (en) | 3-substituted-1,2,3,5-tetrahydroimidazo quinazolin-2-ones | |
| IL56339A (en) | Herbicidally active(3-amidophenyl)-1,2,4-oxadiazole derivatives,process for their manufacture and their use | |
| AU502962B2 (en) | 1, 3, 4-thiadiazoles | |
| ZA771428B (en) | 5-(1,1-diphenyl-3-(5-or 6-hydroxy-2-azabicyclo(2.2.2)oct-2-yl)propyl)-2-alkyl-1,3,4-oxadiazoles and related compounds | |
| NL176220B (nl) | Schroefsluiting voor thermoskannen. | |
| NZ182937A (en) | N-(5-substituted-1,3,4-thiadiazol-2-yl)-benzamides | |
| IL40321A (en) | 3-(3-alkoxyphenyl)-1,3,4-oxadiazol-2(3h)-one derivatives,processes for the preparation thereof and herbicidal compositions containing the same | |
| NL7803882A (nl) | 3-(1-piperazinyl)-1.2.4-benzotriazinen en n-oxiden. | |
| AU515506B2 (en) | 1, 2, 4-oxadiazole derivatives | |
| GB1540748A (en) | 2-halo-5-trichloromethyl-1,3,4-thiadiazoles and their fungicidal use | |
| ZA762294B (en) | 2-(3-(4-azatricyclo(4.3.1.13,8)undecan-4-yl)-1,1-diphenylpropyl)-5-methyl-1,3,4-oxadiazole and congeners | |
| AU1204576A (en) | 3, 4, 5-substituted benzenesulfonformamidines | |
| ZA742697B (en) | 3-substituted-4,5-dihydro-1,2,4-oxadiazoles | |
| AU500456B2 (en) | 2-(3-(4-azatricyclo (4,3,1,1,3,8) undecan-4-yl-7-1,1-diphenylpropyl)-5-methyl-1,3,4-oxadiazole & congenors | |
| AU2637177A (en) | Composition, for the treatment of paper | |
| IE43695L (en) | 2-substituted 5-trifluoromethyl-1,3,4-thiadiazoles | |
| NZ181819A (en) | 5-(2-imidazolin-2-ylamino)-2,1,3-benzothiadiazoles | |
| IL49957A (en) | 5-(substituted sulfamoyl)-1,3,4-thiadiazol-2-ylureas | |
| PH11896A (en) | 3-phenyl-1,2,4-oxadiazole derivatives as anti inflammatory-antitussive agents | |
| NZ185093A (en) | 5-(indol-3-ylmethylene)-1,3-dimethyl-2-methyl-liminoimidazolidin-4-ones | |
| PH13622A (en) | 5-(indol-3-ylmethylene)-1,3-dimethyl-2-methylimino-4-imidazolynone | |
| DK56776A (da) | Fungicidt middel indeholdende 2,5-substituerede 1,3,4-oxadiazoler | |
| AU1244376A (en) | 1,3,4 -thiadiazole, 1,3,4-oxadiazole and 1,2,4 triazole - 5 thiols | |
| IL46453A (en) | 1-(5-substituted-1,3,4-thiadiazol-2-yl)3-alkyl-4-imidazolin-2-ones |