ZA743305B - Calcium nitrate explosive composition - Google Patents
Calcium nitrate explosive compositionInfo
- Publication number
- ZA743305B ZA743305B ZA00743305A ZA743305A ZA743305B ZA 743305 B ZA743305 B ZA 743305B ZA 00743305 A ZA00743305 A ZA 00743305A ZA 743305 A ZA743305 A ZA 743305A ZA 743305 B ZA743305 B ZA 743305B
- Authority
- ZA
- South Africa
- Prior art keywords
- calcium nitrate
- explosive composition
- nitrate explosive
- composition
- calcium
- Prior art date
Links
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 title 2
- 239000002360 explosive Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B47/00—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase
- C06B47/14—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase comprising a solid component and an aqueous phase
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Solid Fuels And Fuel-Associated Substances (AREA)
- Liquid Carbonaceous Fuels (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US456083A US3899374A (en) | 1974-03-29 | 1974-03-29 | Calcium nitrate explosive composition |
| SE7406873A SE7406873L (sv) | 1974-03-29 | 1974-05-22 | Kalciumnitrathaltigt sprengemne. |
| BR4189/74A BR7404189A (pt) | 1974-03-29 | 1974-05-22 | Composicao explosiva e processo para sua preparacao |
| ZA00743305A ZA743305B (en) | 1974-03-29 | 1974-05-22 | Calcium nitrate explosive composition |
| DE19742424886 DE2424886A1 (de) | 1974-03-29 | 1974-05-22 | Explosive calciumnitrat-komposition |
| JP49056783A JPS50148514A (cg-RX-API-DMAC10.html) | 1974-03-29 | 1974-05-22 | |
| FR7417958A FR2272052A1 (cg-RX-API-DMAC10.html) | 1974-03-29 | 1974-05-22 | |
| NL7406912A NL7406912A (nl) | 1974-03-29 | 1974-05-22 | Explosief mengsel op basis van anorganische oxyderende zouten, alsmede werkwijze voor het bereiden daarvan. |
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US456083A US3899374A (en) | 1974-03-29 | 1974-03-29 | Calcium nitrate explosive composition |
| SE7406873A SE7406873L (sv) | 1974-03-29 | 1974-05-22 | Kalciumnitrathaltigt sprengemne. |
| BR4189/74A BR7404189A (pt) | 1974-03-29 | 1974-05-22 | Composicao explosiva e processo para sua preparacao |
| ZA00743305A ZA743305B (en) | 1974-03-29 | 1974-05-22 | Calcium nitrate explosive composition |
| DE19742424886 DE2424886A1 (de) | 1974-03-29 | 1974-05-22 | Explosive calciumnitrat-komposition |
| JP49056783A JPS50148514A (cg-RX-API-DMAC10.html) | 1974-03-29 | 1974-05-22 | |
| FR7417958A FR2272052A1 (cg-RX-API-DMAC10.html) | 1974-03-29 | 1974-05-22 | |
| NL7406912A NL7406912A (nl) | 1974-03-29 | 1974-05-22 | Explosief mengsel op basis van anorganische oxyderende zouten, alsmede werkwijze voor het bereiden daarvan. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ZA743305B true ZA743305B (en) | 1975-06-25 |
Family
ID=27570190
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ZA00743305A ZA743305B (en) | 1974-03-29 | 1974-05-22 | Calcium nitrate explosive composition |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3899374A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS50148514A (cg-RX-API-DMAC10.html) |
| BR (1) | BR7404189A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2424886A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2272052A1 (cg-RX-API-DMAC10.html) |
| NL (1) | NL7406912A (cg-RX-API-DMAC10.html) |
| SE (1) | SE7406873L (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA743305B (cg-RX-API-DMAC10.html) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4091213A (en) * | 1975-12-12 | 1978-05-23 | Bristol-Myers Company | 7-Cyclizedamino-3-heterothiomethyl cephalosporin derivatives |
| US4364782A (en) * | 1980-09-12 | 1982-12-21 | Ireco Chemicals | Permissible slurry explosive |
| US4356044A (en) * | 1981-03-23 | 1982-10-26 | Ireco Chemicals | Emulsion explosives containing high concentrations of calcium nitrate |
| US4453989A (en) * | 1982-04-05 | 1984-06-12 | Atlas Powder Company | Solid sensitizers for water-in-oil emulsion explosives |
| US4439254A (en) * | 1982-04-05 | 1984-03-27 | Atlas Powder Company | Solid sensitizers in water gel explosives and method |
| US4416711A (en) * | 1982-12-17 | 1983-11-22 | Ireco Chemicals | Perchlorate slurry explosive |
| JPS6021891A (ja) * | 1983-07-15 | 1985-02-04 | 日本油脂株式会社 | 爆薬組成物 |
| US4693765A (en) * | 1986-05-22 | 1987-09-15 | Stromquist Donald M | Gel type slurry explosive and matrix and method for making same |
| US4701227A (en) * | 1987-02-05 | 1987-10-20 | Loverro Jr Nicholas P | Ammonium nitrate explosive compositions |
| US5007973A (en) * | 1989-10-12 | 1991-04-16 | Atlas Powder Company | Multicomponent explosives |
| US4978400A (en) * | 1989-11-17 | 1990-12-18 | General Sciences, Inc. | Synergistic composite pyrotechnic material |
| US5051142A (en) * | 1990-01-17 | 1991-09-24 | Atlas Powder Company | Emulsion explosive containing nitrostarch |
| US5089652A (en) * | 1990-01-17 | 1992-02-18 | Atlas Powder Company | Nitrate ester preparation |
| US4980000A (en) * | 1990-01-17 | 1990-12-25 | Atlas Powder Company | Nitrostarch emulsion explosives production process |
| US6334917B1 (en) * | 1998-10-23 | 2002-01-01 | Autoliv Asp, Inc. | Propellant compositions for gas generating apparatus |
| US6238500B1 (en) * | 1999-07-26 | 2001-05-29 | Trw Inc. | Smokeless gas generating material |
| US20080245450A1 (en) * | 2007-01-23 | 2008-10-09 | Bioenergy Systems, Llc | Explosive Compositions Containing Glycerin |
| US8101032B1 (en) * | 2007-05-18 | 2012-01-24 | University Of Central Florida Research Foundation, Inc. | Ethanol based gel fuel for a hybrid rocket engine |
| CN114594226B (zh) * | 2022-03-08 | 2022-12-06 | 武汉理工大学 | 内爆毁伤威力评估装置及方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3660181A (en) * | 1969-05-01 | 1972-05-02 | Intermountain Res & Eng | Blasting slurry compositions containing calcium nitrate and method of preparation |
| US3816191A (en) * | 1970-05-04 | 1974-06-11 | Dow Chemical Co | Method of making calcium nitrate explosive composition |
| US3713917A (en) * | 1970-11-16 | 1973-01-30 | Ireco Chemicals | Blasting slurry compositions contain-ing calcium nitrate and method of preparation |
| US3787254A (en) * | 1971-06-01 | 1974-01-22 | Ireco Chemicals | Explosive compositions containing calcium nitrate |
-
1974
- 1974-03-29 US US456083A patent/US3899374A/en not_active Expired - Lifetime
- 1974-05-22 DE DE19742424886 patent/DE2424886A1/de active Pending
- 1974-05-22 NL NL7406912A patent/NL7406912A/xx unknown
- 1974-05-22 SE SE7406873A patent/SE7406873L/ not_active Application Discontinuation
- 1974-05-22 BR BR4189/74A patent/BR7404189A/pt unknown
- 1974-05-22 FR FR7417958A patent/FR2272052A1/fr not_active Withdrawn
- 1974-05-22 JP JP49056783A patent/JPS50148514A/ja active Pending
- 1974-05-22 ZA ZA00743305A patent/ZA743305B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2424886A1 (de) | 1975-12-04 |
| JPS50148514A (cg-RX-API-DMAC10.html) | 1975-11-28 |
| SE7406873L (sv) | 1975-11-24 |
| FR2272052A1 (cg-RX-API-DMAC10.html) | 1975-12-19 |
| BR7404189A (pt) | 1976-02-03 |
| NL7406912A (nl) | 1975-11-25 |
| US3899374A (en) | 1975-08-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PH11334A (en) | Nitroparaffin explosive composition | |
| ZA751473B (en) | Antiperspirant compositions | |
| HU170012B (en) | Polvinilchlorid composition | |
| ZA743305B (en) | Calcium nitrate explosive composition | |
| JPS51125407A (en) | New composition | |
| IL46585A0 (en) | Explosive compositions | |
| JPS511905A (en) | M sokoryuki | |
| ZA745280B (en) | Construction composition | |
| ZA7670B (en) | Blasting composition containing calcium nitrate and sulfur | |
| ZA756345B (en) | Nitroparaffin explosive composition | |
| PH14474A (en) | Substituted ureido compounds | |
| ATA383674A (de) | Mauerwerk aus formsteinen | |
| MW3175A1 (en) | Detonating fusecord | |
| ZA722094B (en) | Explosive compositions containing calcium nitrate | |
| AU8706475A (en) | Antiperspirant compositions | |
| AU8082975A (en) | Brine free pcikling composition | |
| AU7922975A (en) | Composition | |
| ZA75198B (en) | Powder forming | |
| ZA757134B (en) | Safety explosive composition | |
| JPS51138944A (en) | Refrigerant mixture | |
| JPS5135897A (en) | N konokyoshinseruojusuru senkeikasokuki | |
| PH12186A (en) | Stabilized nitrato-alkanol explosives composition | |
| CA1011561A (en) | Calcium nitrate explosive composition | |
| AU7371074A (en) | Explosive composition | |
| YU39935B (en) | Hand grenade fuse |